mirror of
https://gitlab.com/asus-linux/asusctl.git
synced 2026-01-22 17:33:19 +01:00
Compare commits
226 Commits
| Author | SHA1 | Date | |
|---|---|---|---|
|
|
ccf8d8df91 | ||
|
|
b970d364f7 | ||
|
|
1da68ea69d | ||
|
|
e62e7e8eca | ||
|
|
1b1d10c461 | ||
|
|
14ea0f6d83 | ||
|
|
5107a6c39c | ||
|
|
2c77ec9e24 | ||
|
|
817a66bdf1 | ||
|
|
664a3d5533 | ||
|
|
37bc5e45b9 | ||
|
|
a18692ef1e | ||
|
|
1b023d0f5f | ||
|
|
74f74e73c4 | ||
|
|
9c7df9ad39 | ||
|
|
94adf5d24d | ||
|
|
8dbdb68175 | ||
|
|
89002eb5ec | ||
|
|
dc9ef8cf54 | ||
|
|
667697d042 | ||
|
|
bc92fa11f9 | ||
|
|
f5d5681b49 | ||
|
|
1c8e50843b | ||
|
|
487d140bd5 | ||
|
|
661ea8d3bf | ||
|
|
28d1ed6ab3 | ||
|
|
903b978e86 | ||
|
|
519f6bd46b | ||
|
|
a94a8ca28d | ||
|
|
f9dca2da5d | ||
|
|
df88ff1acb | ||
|
|
cb5aa0f170 | ||
|
|
4ea79f966e | ||
|
|
b8bc1a01b3 | ||
|
|
0e5d1815bd | ||
|
|
64e8cb65d0 | ||
|
|
3142353f98 | ||
|
|
484ca692ad | ||
|
|
1ebdfada96 | ||
|
|
3bc9dfcda1 | ||
|
|
895e5d2ca3 | ||
|
|
564992719e | ||
|
|
a737d240be | ||
|
|
d89c1ebf26 | ||
|
|
be7686bb46 | ||
|
|
4f70055f85 | ||
|
|
91ca049298 | ||
|
|
635d0378ac | ||
|
|
1c729316f7 | ||
|
|
4701c019a8 | ||
|
|
ca0d8bda4b | ||
|
|
a271ffbb10 | ||
|
|
00babaf949 | ||
|
|
2f844ac151 | ||
|
|
5178bf1d1a | ||
|
|
116afb9b6c | ||
|
|
4468a58487 | ||
|
|
2f73577e91 | ||
|
|
c1cffc8f59 | ||
|
|
6d8f85c154 | ||
|
|
0674e7f61c | ||
|
|
fde2f3ba15 | ||
|
|
70493d1a93 | ||
|
|
c20d0a76a0 | ||
|
|
e6952e241a | ||
|
|
b40812928a | ||
|
|
8cdc9773c9 | ||
|
|
8d30282edf | ||
|
|
4ba44560a9 | ||
|
|
cdc9ca7b58 | ||
|
|
7eae7c5664 | ||
|
|
739a0ffa63 | ||
|
|
637360095c | ||
|
|
4b34ab83fb | ||
|
|
ac605cbc00 | ||
|
|
4b38e5daa6 | ||
|
|
1c007b4216 | ||
|
|
193f9dfa1e | ||
|
|
1366422d96 | ||
|
|
4e778a3d28 | ||
|
|
be05508110 | ||
|
|
9119229d41 | ||
|
|
5c43c31331 | ||
|
|
014604724f | ||
|
|
7d076368e9 | ||
|
|
5d6ed5c365 | ||
|
|
a2b8f0f93c | ||
|
|
5fe8416c65 | ||
|
|
1b4d7a95af | ||
|
|
e8627fde4c | ||
|
|
6b0edc6da1 | ||
|
|
f6ad631a0f | ||
|
|
f6393a3926 | ||
|
|
d51384c3a1 | ||
|
|
78f18959fb | ||
|
|
7a661a585e | ||
|
|
f4f7a1e648 | ||
|
|
b6e3e5e823 | ||
|
|
41b1bd23d6 | ||
|
|
69458a0595 | ||
|
|
5fd107df27 | ||
|
|
2558057e9f | ||
|
|
8111daaf1d | ||
|
|
672acb234f | ||
|
|
9725062fb9 | ||
|
|
c7b1624313 | ||
|
|
67b97f1d43 | ||
|
|
6498fd1349 | ||
|
|
e371229b6c | ||
|
|
0fac33a8ff | ||
|
|
b0da062577 | ||
|
|
ca41bd59de | ||
|
|
efcad3f6f9 | ||
|
|
fa2255cbaf | ||
|
|
02b9bac899 | ||
|
|
a1fcf5023c | ||
|
|
2f8ea80e6d | ||
|
|
b798cf6a4e | ||
|
|
3da848d131 | ||
|
|
a88c33c201 | ||
|
|
7b0f037cba | ||
|
|
91b1456d06 | ||
|
|
c3b02a2bb0 | ||
|
|
8e4b7d53f4 | ||
|
|
a44145f487 | ||
|
|
bb7b3a81fb | ||
|
|
19607d71c3 | ||
|
|
96f281d789 | ||
|
|
7613eded95 | ||
|
|
50eccd2b1d | ||
|
|
ba54007102 | ||
|
|
a028f5375f | ||
|
|
9ec02cd727 | ||
|
|
4b46ece09a | ||
|
|
086bbd0908 | ||
|
|
c94eaa473e | ||
|
|
b1b809834b | ||
|
|
84183288ec | ||
|
|
86cbef83b6 | ||
|
|
006fb632c4 | ||
|
|
e3636ed8ce | ||
|
|
cfd207f251 | ||
|
|
d4c68546e7 | ||
|
|
6f4a7e16dc | ||
|
|
f64253d633 | ||
|
|
124c17aadc | ||
|
|
ab40f9fcbf | ||
|
|
5cdfa5a8d4 | ||
|
|
ce870cd5ed | ||
|
|
4541d2e1ba | ||
|
|
b525411fd3 | ||
|
|
a867496f13 | ||
|
|
f421b8ee3b | ||
|
|
82780feb4b | ||
|
|
1e5443e206 | ||
|
|
027a591d26 | ||
|
|
e90375828d | ||
|
|
75b4d67072 | ||
|
|
9aa332de3b | ||
|
|
5efd7fc6a7 | ||
|
|
0aafe24a02 | ||
|
|
dda6d343d9 | ||
|
|
6f39307080 | ||
|
|
ef63789faa | ||
|
|
c422e77ba6 | ||
|
|
3c234dd3c4 | ||
|
|
c420dd820a | ||
|
|
a3e6fec163 | ||
|
|
9b4e76be87 | ||
|
|
7b2125cbdf | ||
|
|
694a644cc6 | ||
|
|
922aa0c352 | ||
|
|
c06f78990f | ||
|
|
5c8bb6e6ea | ||
|
|
993131d0a9 | ||
|
|
0a69c23288 | ||
|
|
f6e4cc0626 | ||
|
|
1f696508e7 | ||
|
|
fa043adc99 | ||
|
|
b9c2d929b3 | ||
|
|
eda1e920df | ||
|
|
0de2c9e424 | ||
|
|
e88e7be8ae | ||
|
|
e470d3acc0 | ||
|
|
f5b3f0bc38 | ||
|
|
19497c94e0 | ||
|
|
670eee23e8 | ||
|
|
26309776e9 | ||
|
|
a7d5057976 | ||
|
|
8eb9b1d4eb | ||
|
|
71ee9e43ba | ||
|
|
f1b0e1288a | ||
|
|
35c7fd10b3 | ||
|
|
4c50dc259c | ||
|
|
0fd0aeff88 | ||
|
|
fd37f41ef1 | ||
|
|
1307997122 | ||
|
|
85187d2d8d | ||
|
|
e29a568195 | ||
|
|
6c375a9951 | ||
|
|
4641e19c43 | ||
|
|
91f0c2ea14 | ||
|
|
b4a8cb9de2 | ||
|
|
67bbcdb964 | ||
|
|
8acfe0a9e8 | ||
|
|
5f6e6ec382 | ||
|
|
cf92526d87 | ||
|
|
f290594562 | ||
|
|
423bd54f79 | ||
|
|
ea0eaef8a6 | ||
|
|
ef62a26148 | ||
|
|
2f916fa4e5 | ||
|
|
e42fd10404 | ||
|
|
93edd1b632 | ||
|
|
6957a08d83 | ||
|
|
98569b98e7 | ||
|
|
573568d6e2 | ||
|
|
3ec37a4dac | ||
|
|
11483b28a6 | ||
|
|
2cce83d164 | ||
|
|
42b92f3b87 | ||
|
|
b652fd15a2 | ||
|
|
9154aaa97c | ||
|
|
9e65921c0a | ||
|
|
8d8b5e5f51 | ||
|
|
9418b63454 |
@@ -2,11 +2,17 @@
|
||||
|
||||
set -e
|
||||
|
||||
echo 'find -name \*.slint | xargs slint-tr-extractor -o rog-control-center/translations/en/rog-control-center.po'
|
||||
find -name \*.slint | xargs slint-tr-extractor -o rog-control-center/translations/en/rog-control-center.po
|
||||
|
||||
echo '+cargo +nightly fmt --all -- --check'
|
||||
cargo +nightly fmt --all -- --check
|
||||
|
||||
echo '+cargo clippy --all -- -D warnings'
|
||||
cargo clippy --all -- -D warnings
|
||||
|
||||
echo '+cargo test --all'
|
||||
cargo test --all
|
||||
|
||||
echo '+cargo cranky'
|
||||
cargo cranky
|
||||
9
.gitignore
vendored
9
.gitignore
vendored
@@ -14,7 +14,8 @@ vendor_*
|
||||
node-modules
|
||||
bindings/ts/*.d.ts
|
||||
bindings/ts/*.js.map
|
||||
desktop-extensions/gnome/dist
|
||||
desktop-extensions/gnome/node_modules
|
||||
desktop-extensions/gnome/schemas/gschemas.compiled
|
||||
desktop-extensions/gnome/*.zip
|
||||
desktop-extensions/gnome*/dist
|
||||
desktop-extensions/gnome*/@types/gir-generated
|
||||
desktop-extensions/gnome*/node_modules
|
||||
desktop-extensions/gnome*/schemas/gschemas.compiled
|
||||
desktop-extensions/gnome*/*.zip
|
||||
|
||||
@@ -17,7 +17,7 @@ image: rust:latest
|
||||
- target/release/.cargo-lock
|
||||
|
||||
before_script:
|
||||
- apt-get update -qq && apt-get install -y -qq libudev-dev libgtk-3-dev grep llvm clang libclang-dev libsdl2-dev libsdl2-gfx-dev
|
||||
- apt-get update -qq && apt-get install -y -qq libinput-dev libseat-dev libudev-dev libgtk-3-dev grep llvm clang libclang-dev libsdl2-dev libsdl2-gfx-dev
|
||||
|
||||
stages:
|
||||
- format
|
||||
@@ -59,11 +59,12 @@ release:
|
||||
- tags
|
||||
<<: *rust_cache
|
||||
script:
|
||||
- cargo install cargo-vendor-filterer
|
||||
- make && make vendor
|
||||
artifacts:
|
||||
paths:
|
||||
- vendor_asusctl*.tar.xz
|
||||
- cargo-config
|
||||
- vendor_asusctl*.tar.xz
|
||||
- cargo-config
|
||||
|
||||
pages:
|
||||
stage: deploy
|
||||
|
||||
32
.gitlab/issue_templates/default.md
Normal file
32
.gitlab/issue_templates/default.md
Normal file
@@ -0,0 +1,32 @@
|
||||
## Issue description
|
||||
|
||||
(** I can not support distros which are outdated by default. This includes Ubuntu at least 50% of the time, and definitely includes Mint. **)
|
||||
(Summarize the bug encountered)
|
||||
|
||||
## Steps to reproduce
|
||||
|
||||
(How can the issue be reproduced)
|
||||
|
||||
## What is the current bug behavior?
|
||||
|
||||
(What actually happens)
|
||||
|
||||
## What is the expected correct behavior?
|
||||
|
||||
(What you should see instead)
|
||||
|
||||
## Relevant logs and/or screenshots
|
||||
|
||||
(run `journalctl -b -u asusd > ~/asusd.log` and attach `~/asusd.log`)
|
||||
|
||||
(Paste any relevant logs - use code blocks (```) to format console output, logs, and code, as
|
||||
it's very hard to read otherwise.)
|
||||
|
||||
## System details
|
||||
|
||||
- Distro:
|
||||
- Kernel: (`uname -r`)
|
||||
- Desktop:
|
||||
- Xorg or wayland: ??
|
||||
|
||||
/label ~bug ~reproducable ~needs-investigation
|
||||
512
CHANGELOG.md
512
CHANGELOG.md
File diff suppressed because it is too large
Load Diff
4231
Cargo.lock
generated
4231
Cargo.lock
generated
File diff suppressed because it is too large
Load Diff
73
Cargo.toml
73
Cargo.toml
@@ -1,24 +1,57 @@
|
||||
[workspace]
|
||||
members = ["asusctl", "asusd", "asusd-user", "config-traits", "rog-platform", "rog-dbus", "rog-anime", "rog-aura", "rog-profiles", "rog-control-center", "simulators"]
|
||||
default-members = ["asusctl", "asusd", "asusd-user", "rog-control-center"]
|
||||
|
||||
[workspace.package]
|
||||
version = "4.7.0-RC3"
|
||||
version = "6.0.5"
|
||||
rust-version = "1.77"
|
||||
license = "MPL-2.0"
|
||||
readme = "README.md"
|
||||
authors = ["Luke <luke@ljones.dev>"]
|
||||
repository = "https://gitlab.com/asus-linux/asusctl"
|
||||
homepage = "https://gitlab.com/asus-linux/asusctl"
|
||||
description = "Laptop feature control for ASUS ROG laptops and others"
|
||||
edition = "2021"
|
||||
|
||||
[workspace]
|
||||
members = [
|
||||
"asusctl",
|
||||
"asusd",
|
||||
"asusd-user",
|
||||
"config-traits",
|
||||
"cpuctl",
|
||||
"dmi-id",
|
||||
"rog-platform",
|
||||
"rog-dbus",
|
||||
"rog-anime",
|
||||
"rog-aura",
|
||||
"rog-profiles",
|
||||
"rog-control-center",
|
||||
"rog-slash",
|
||||
"simulators",
|
||||
]
|
||||
default-members = [
|
||||
"asusctl",
|
||||
"asusd",
|
||||
"asusd-user",
|
||||
"cpuctl",
|
||||
"rog-control-center",
|
||||
]
|
||||
resolver = "2"
|
||||
|
||||
[workspace.dependencies]
|
||||
async-trait = "^0.1"
|
||||
tokio = { version = "^1.23.0", features = ["macros", "rt-multi-thread", "time", "sync"]}
|
||||
tokio = { version = "^1.36.0", default-features = false, features = [
|
||||
"macros",
|
||||
"sync",
|
||||
"time",
|
||||
"rt-multi-thread",
|
||||
] }
|
||||
concat-idents = "^1.1"
|
||||
dirs = "^4.0"
|
||||
smol = "^1.3"
|
||||
mio = "0.8.11"
|
||||
|
||||
zbus = "~3.13.1"
|
||||
logind-zbus = { version = "^3.1.0" } #, default-features = false, features = ["non_blocking"] }
|
||||
zbus = "4.1"
|
||||
logind-zbus = { version = "4.0.2" } #, default-features = false, features = ["non_blocking"] }
|
||||
|
||||
serde = "^1.0"
|
||||
serde_derive = "^1.0"
|
||||
serde_json = "^1.0"
|
||||
toml = "^0.5.10"
|
||||
ron = "*"
|
||||
typeshare = "1.0.0"
|
||||
|
||||
@@ -27,9 +60,8 @@ env_logger = "^0.10.0"
|
||||
|
||||
glam = { version = "^0.22", features = ["serde"] }
|
||||
gumdrop = "^0.8"
|
||||
udev = "^0.7"
|
||||
udev = { version = "^0.8", features = ["mio"] }
|
||||
rusb = "^0.9"
|
||||
sysfs-class = "^0.1.3"
|
||||
inotify = "^0.10.0"
|
||||
|
||||
png_pong = "^0.8"
|
||||
@@ -37,9 +69,11 @@ pix = "^0.13"
|
||||
tinybmp = "^0.4.0"
|
||||
gif = "^0.12.0"
|
||||
|
||||
versions = "4.1"
|
||||
versions = "6.2"
|
||||
|
||||
notify-rust = { git = "https://github.com/flukejones/notify-rust.git", default-features = false, features = ["z"] }
|
||||
notify-rust = { git = "https://github.com/flukejones/notify-rust.git", rev = "54176413b81189a3e4edbdc20a0b4f7e2e35c063", default-features = false, features = [
|
||||
"z",
|
||||
] }
|
||||
|
||||
[profile.release]
|
||||
# thin = 57s, asusd = 9.0M
|
||||
@@ -48,10 +82,15 @@ lto = "fat"
|
||||
debug = false
|
||||
opt-level = 3
|
||||
panic = "abort"
|
||||
codegen-units = 1
|
||||
|
||||
[profile.dev]
|
||||
debug = true
|
||||
opt-level = 1
|
||||
codegen-units = 16
|
||||
|
||||
[profile.dev.package."*"]
|
||||
opt-level = 1
|
||||
codegen-units = 16
|
||||
|
||||
[profile.bench]
|
||||
debug = false
|
||||
@@ -60,4 +99,4 @@ opt-level = 3
|
||||
[workspace.dependencies.cargo-husky]
|
||||
version = "1"
|
||||
default-features = false
|
||||
features = ["user-hooks"]
|
||||
features = ["user-hooks"]
|
||||
|
||||
37
MANUAL.md
37
MANUAL.md
@@ -1,5 +1,7 @@
|
||||
# asusctrl manual
|
||||
|
||||
**NOTE:** this manual is in need of an update in some places. If you find issues please file issue reports.
|
||||
|
||||
`asusd` is a utility for Linux to control many aspects of various ASUS laptops
|
||||
but can also be used with non-asus laptops with reduced features.
|
||||
|
||||
@@ -8,11 +10,10 @@ but can also be used with non-asus laptops with reduced features.
|
||||
- `asusd`: The main system daemon. It is autostarted by a udev rule and systemd unit.
|
||||
- `asusd-user`: The user level daemon. Currently will run an anime sequence, with RGB keyboard sequences soon.
|
||||
- `asusctl`: The CLI for interacting with the system daemon
|
||||
- `asus-notify`: A notification daemon with a user systemd unit that can be enabled.
|
||||
|
||||
## `asusd`
|
||||
|
||||
`asusd` is the main system-level daemon which will control/load/save various settings in a safe way for the user, along with exposing a *safe* dbus interface for these interactions. This section covers only the daemon plus the various configuration file options.
|
||||
`asusd` is the main system-level daemon which will control/load/save various settings in a safe way for the user, along with exposing a _safe_ dbus interface for these interactions. This section covers only the daemon plus the various configuration file options.
|
||||
|
||||
The functionality that `asusd` exposes is:
|
||||
|
||||
@@ -56,6 +57,7 @@ Almost all modern ASUS laptops have charging limit control now. This can be cont
|
||||
```json
|
||||
"bat_charge_limit": 80,
|
||||
```
|
||||
|
||||
where the number is a percentage.
|
||||
|
||||
### Bios control
|
||||
@@ -63,7 +65,7 @@ where the number is a percentage.
|
||||
Some options that you find in Armory Crate are available under this controller, so far there is:
|
||||
|
||||
- POST sound: this is the sound you hear on bios boot post
|
||||
- GPU MUX: this controls if the dGPU is the *only* GPU, making it the main GPU and disabling the iGPU
|
||||
- GPU MUX: this controls if the dGPU is the _only_ GPU, making it the main GPU and disabling the iGPU
|
||||
|
||||
These options are not written to the config file as they are stored in efivars. The only way to change these is to use the exposed safe dbus methods, or use the `asusctl` CLI tool.
|
||||
|
||||
@@ -72,6 +74,7 @@ These options are not written to the config file as they are stored in efivars.
|
||||
asusctl can support setting a power profile via platform_profile drivers. This requires [power-profiles-daemon](https://gitlab.freedesktop.org/hadess/power-profiles-daemon) v0.10.0 minimum. It also requires the kernel patch for platform_profile support to be applied form [here](https://lkml.org/lkml/2021/8/18/1022) - this patch is merged to 5.15 kernel upstream.
|
||||
|
||||
A common use of asusctl is to bind the `fn+f5` (fan) key to `asusctl profile -n` to cycle through the 3 profiles:
|
||||
|
||||
1. Balanced
|
||||
2. Performance
|
||||
3. Quiet
|
||||
@@ -97,7 +100,7 @@ There is one more controller; the support controller. The sole pupose of this co
|
||||
|
||||
## asusd-user
|
||||
|
||||
`asusd-user` is a usermode daemon. The intended purpose is to provide a method for users to run there own custom per-key keyboard effects and modes, AniMe sequences, and possibly their own profiles - all without overwriting the *base* system config. As such some parts of the system daemon will migrate to the user daemon over time with the expectation that the Linux system runs both.
|
||||
`asusd-user` is a usermode daemon. The intended purpose is to provide a method for users to run there own custom per-key keyboard effects and modes, AniMe sequences, and possibly their own profiles - all without overwriting the _base_ system config. As such some parts of the system daemon will migrate to the user daemon over time with the expectation that the Linux system runs both.
|
||||
|
||||
As of now only AniMe is active in this with configuration in `~/.config/rog/`. On first run defaults are created that are intended to work as examples.
|
||||
|
||||
@@ -177,6 +180,7 @@ An Aura config itself is a file with contents:
|
||||
```
|
||||
|
||||
If your laptop supports multizone, `"led"` can also be `"Zone": <one of the following>`
|
||||
|
||||
- `SingleZone` // Keyboards with only one zone
|
||||
- `ZonedKbLeft` // keyboard left
|
||||
- `ZonedKbLeftMid` // keyboard left-middle
|
||||
@@ -238,6 +242,7 @@ Each object in the array can be one of:
|
||||
##### AsusAnimation
|
||||
|
||||
`AsusAnimation` is specifically for running the gif files that Armory Crate comes with. `asusctl` includes all of these in `/usr/share/asusd/anime/asus/`
|
||||
|
||||
```json
|
||||
"AsusAnimation": {
|
||||
"file": "<FILE_PATH>",
|
||||
@@ -260,7 +265,7 @@ Virtually the same as `AsusAnimation` but for png files, typically created in th
|
||||
|
||||
##### ImageAnimation
|
||||
|
||||
`ImageAnimation` can play *any* gif of any size.
|
||||
`ImageAnimation` can play _any_ gif of any size.
|
||||
|
||||
```json
|
||||
"ImageAnimation": {
|
||||
@@ -319,6 +324,7 @@ Must be full path: `"/usr/share/asusd/anime/asus/gaming/Controller.gif"` or `/ho
|
||||
**<FLOAT>**
|
||||
|
||||
A number from 0.0-1.0.
|
||||
|
||||
- `brightness`: If it is brightness it is combined with the system daemon global brightness
|
||||
- `scale`: 1.0 is the original size with lower number shrinking, larger growing
|
||||
- `angle`: Rotation angle in radians
|
||||
@@ -327,6 +333,7 @@ A number from 0.0-1.0.
|
||||
**<TIME>**
|
||||
|
||||
Time is the length of time to run the gif for:
|
||||
|
||||
```json
|
||||
"time": {
|
||||
"Time": {
|
||||
@@ -335,17 +342,23 @@ Time is the length of time to run the gif for:
|
||||
}
|
||||
},
|
||||
```
|
||||
|
||||
A cycle is how many gif loops to run:
|
||||
|
||||
```json
|
||||
"time": {
|
||||
"Cycles": 2
|
||||
},
|
||||
```
|
||||
|
||||
`Infinite` means that this gif will never end:
|
||||
|
||||
```json
|
||||
"time": "Infinite",
|
||||
```
|
||||
|
||||
`Fade` allows an image or gif to fade in and out, and remain at max brightness to n time:
|
||||
|
||||
```json
|
||||
"time": {
|
||||
"Fade": {
|
||||
@@ -364,6 +377,7 @@ A cycle is how many gif loops to run:
|
||||
}
|
||||
},
|
||||
```
|
||||
|
||||
`show_for` can be `null`, if it is `null` then the `show_for` becomes `gif_time_length - fade_in - fade_out`.
|
||||
This is period for which the gif or image will be max brightness (as set).
|
||||
|
||||
@@ -404,26 +418,19 @@ asusctl <command> <subcommand> --help
|
||||
|
||||
To switch to next/previous Aura modes you will need to bind both the aura keys (if available) to one of:
|
||||
**Next**
|
||||
|
||||
```
|
||||
asusctl led-mode -n
|
||||
```
|
||||
|
||||
**Previous**
|
||||
|
||||
```
|
||||
asusctl led-mode -p
|
||||
```
|
||||
|
||||
To switch Fan/Thermal profiles you need to bind the Fn+F5 key to `asusctl profile -n`.
|
||||
|
||||
## User NOTIFICATIONS via dbus
|
||||
|
||||
If you have a notifications handler set up, or are using KDE or Gnome then you
|
||||
can enable the user service to get basic notifications when something changes.
|
||||
|
||||
```
|
||||
systemctl --user enable asus-notify.service
|
||||
systemctl --user start asus-notify.service
|
||||
```
|
||||
|
||||
# License & Trademarks
|
||||
|
||||
Mozilla Public License 2 (MPL-2.0)
|
||||
|
||||
15
Makefile
15
Makefile
@@ -112,6 +112,8 @@ vendor:
|
||||
echo 'directory = "vendor"' >> .cargo/config
|
||||
mv .cargo/config ./cargo-config
|
||||
rm -rf .cargo
|
||||
rm -rf vendor
|
||||
cargo vendor-filterer --platform x86_64-unknown-linux-gnu vendor
|
||||
tar pcfJ vendor_asusctl_$(VERSION).tar.xz vendor
|
||||
rm -rf vendor
|
||||
|
||||
@@ -121,19 +123,12 @@ bindings:
|
||||
typeshare ./rog-profiles/src/ --lang=typescript --output-file=bindings/ts/profiles.ts
|
||||
typeshare ./rog-platform/src/ --lang=typescript --output-file=bindings/ts/platform.ts
|
||||
|
||||
introspect:
|
||||
gdbus introspect --system -d org.asuslinux.Daemon -o /org/asuslinux/Aura -x > bindings/dbus-xml/org-asuslinux-aura-4.xml
|
||||
gdbus introspect --system -d org.asuslinux.Daemon -o /org/asuslinux/Anime -x > bindings/dbus-xml/org-asuslinux-anime-4.xml
|
||||
gdbus introspect --system -d org.asuslinux.Daemon -o /org/asuslinux/Platform -x > bindings/dbus-xml/org-asuslinux-platform-4.xml
|
||||
gdbus introspect --system -d org.asuslinux.Daemon -o /org/asuslinux/Power -x > bindings/dbus-xml/org-asuslinux-power-4.xml
|
||||
gdbus introspect --system -d org.asuslinux.Daemon -o /org/asuslinux/Profile -x > bindings/dbus-xml/org-asuslinux-profile-4.xml
|
||||
gdbus introspect --system -d org.asuslinux.Daemon -o /org/asuslinux/Supported -x > bindings/dbus-xml/org-asuslinux-supported-4.xml
|
||||
xmlstarlet ed -L -O -d '//interface[@name="org.freedesktop.DBus.Introspectable"]' bindings/dbus-xml/org-asuslinux-*
|
||||
xmlstarlet ed -L -O -d '//interface[@name="org.freedesktop.DBus.Properties"]' bindings/dbus-xml/org-asuslinux-*
|
||||
xmlstarlet ed -L -O -d '//interface[@name="org.freedesktop.DBus.Peer"]' bindings/dbus-xml/org-asuslinux-*
|
||||
translate:
|
||||
find -name \*.slint | xargs slint-tr-extractor -o rog-control-center/translations/en/rog-control-center.po
|
||||
|
||||
build:
|
||||
ifeq ($(VENDORED),1)
|
||||
cargo vendor
|
||||
@echo "version = $(VERSION)"
|
||||
tar pxf vendor_asusctl_$(VERSION).tar.xz
|
||||
endif
|
||||
|
||||
97
README.md
97
README.md
@@ -1,8 +1,8 @@
|
||||
# `asusctl` for ASUS ROG
|
||||
|
||||
[](https://www.paypal.com/donate/?hosted_button_id=4V2DEPS7K6APC) - [Asus Linux Website](https://asus-linux.org/)
|
||||
[Become a Patron!](https://www.patreon.com/bePatron?u=7602281) - [Asus Linux Website](https://asus-linux.org/)
|
||||
|
||||
**WARNING:** Many features are developed in tandem with kernel patches. If you see a feature is missing you either need a patched kernel, or v6.1 which has all my work merged upstream.
|
||||
**WARNING:** Many features are developed in tandem with kernel patches. If you see a feature is missing you either need a patched kernel or latest release.
|
||||
|
||||
`asusd` is a utility for Linux to control many aspects of various ASUS laptops
|
||||
but can also be used with non-asus laptops with reduced features.
|
||||
@@ -11,27 +11,29 @@ Now includes a GUI, `rog-control-center`.
|
||||
|
||||
## Kernel support
|
||||
|
||||
**The minimum supported kernel version is 5.17**
|
||||
**The minimum supported kernel version is 6.10**, which will contain the patches from [here](https://lore.kernel.org/platform-driver-x86/20240404001652.86207-1-luke@ljones.dev/). This is especially required for 2023+ devices and possibly some lat 2022 devices.
|
||||
|
||||
**For TUF laptops, the minimum supported kernel version is 6.1**
|
||||
Z13 devices will need [these](https://lore.kernel.org/linux-input/20240416090402.31057-1-luke@ljones.dev/T/#t)
|
||||
|
||||
## Goals
|
||||
|
||||
1. To provide an interface for rootless control of some system functions most users wish to control such as fan speeds, keyboard LEDs, graphics modes.
|
||||
2. Enable third-party apps to use the above with dbus methods
|
||||
3. To make the above as easy as possible for new users
|
||||
4. Respect the users resources: be small, light, and fast
|
||||
The main goal of this work is to provide a safe and easy to use abstraction over various laptop features via DBUS, and to provide some helpful defaults and other behaviour such as toggling throttle/profile on AC/battery change.
|
||||
|
||||
Point 3 means that the list of supported distros is very narrow - fedora is explicitly
|
||||
supported. All other distros are *not* supported (while asusd might still run fine on them).
|
||||
For best support use fedora 36+ Workstation.
|
||||
1. Provide safe dbus interface
|
||||
2. Respect the users resources: be small, light, and fast
|
||||
|
||||
Point 4? asusd currently uses a tiny fraction of cpu time, and less than 1Mb of ram, the way
|
||||
a system-level daemon should.
|
||||
a system-level daemon should. Languages such as JS and python should never be used for system level daemons (please stop).
|
||||
|
||||
## Keyboard LEDs
|
||||
|
||||
The level of support for laptops is dependent on folks submitting data to include in [`./rog-aura/data/layouts/aura_support.ron`](./rog-aura/data/layouts/aura_support.ron), typically installed in `/usr/share/asusd/aura_support.ron`. This is because the controller used for keyboards and LEDs is used across many years and many laptop models, all with different firmware configurations - the only way to track this is with the file mentioned above. Why not just enable all by default? Because it confuses people.
|
||||
|
||||
See the [rog-aura readme](./rog-aura/README.md) for more details.
|
||||
|
||||
## Discord
|
||||
|
||||
[Discord server link](https://discord.gg/WTHnqabm)
|
||||
[](https://discord.gg/z8y99XqPb7)
|
||||
|
||||
## SUPPORTED LAPTOPS
|
||||
|
||||
@@ -42,54 +44,43 @@ to this:
|
||||
Bus 001 Device 002: ID 0b05:1866 ASUSTek Computer, Inc. N-KEY Device
|
||||
```
|
||||
|
||||
or
|
||||
|
||||
```
|
||||
Bus 003 Device 002: ID 0b05:19b6 ASUSTek Computer, Inc. [unknown]
|
||||
```
|
||||
|
||||
then it may work without tweaks. Technically all other functions except the LED
|
||||
and AniMe parts should work regardless of your latop make.
|
||||
|
||||
## Implemented
|
||||
|
||||
- [X] System daemon
|
||||
- [X] GUI app (includes tray and notifications)
|
||||
- [X] Setting/modifying built-in LED modes
|
||||
- [X] Per-key LED setting
|
||||
- [X] Fancy LED modes (See examples) (currently being reworked)
|
||||
- [X] AniMatrix display on G14 and M16 models that include it
|
||||
- [X] Set battery charge limit (with kernel supporting this)
|
||||
- [X] Fan curve control on supported laptops (G14/G15, some TUF like FA507)
|
||||
- [X] Toggle bios setting for boot/POST sound
|
||||
- [X] Toggle GPU MUX (g-sync, or called MUX on 2022+ laptops)
|
||||
The list is a bit outdated as many features have been enabled in the Linux kernel with upstream patches and then supported in asusctl suite.
|
||||
|
||||
- [x] System daemon
|
||||
- [x] GUI app (includes tray and notifications)
|
||||
- [x] Setting/modifying built-in LED modes
|
||||
- [x] Per-key LED setting
|
||||
- [x] Fancy LED modes (See examples) (currently being reworked)
|
||||
- [x] AniMatrix display on G14 and M16 models that include it
|
||||
- [x] Set battery charge limit (with kernel supporting this)
|
||||
- [x] Fan curve control on supported laptops (G14/G15, some TUF like FA507)
|
||||
- [x] Toggle bios setting for boot/POST sound
|
||||
- [x] Toggle GPU MUX (g-sync, or called MUX on 2022+ laptops)
|
||||
|
||||
# GUI
|
||||
|
||||
A gui is now in the repo - ROG Control Center. At this time it is still a WIP, but it has almost all features in place already.
|
||||
|
||||

|
||||

|
||||

|
||||
**NOTE**: Xorg is not supported.
|
||||
|
||||
# BUILDING
|
||||
|
||||
Requirements are rust >= 1.57 installed from rustup.io if the distro provided version is too old, and `make`.
|
||||
|
||||
**Ubuntu (unsuported):**
|
||||
|
||||
apt install libgtk-3-dev libpango1.0-dev libgdk-pixbuf-2.0-dev libglib2.0-dev cmake libclang-dev libudev-dev libayatana-appindicator3-1
|
||||
curl --proto '=https' --tlsv1.2 -sSf https://sh.rustup.rs | sh
|
||||
source "$HOME/.cargo/env"
|
||||
make
|
||||
sudo make install
|
||||
|
||||
**popos (unsuported):**
|
||||
|
||||
sudo apt install cmake libclang-dev libudev-dev libgtk-3-dev libclang-dev libglib2.0-dev libatkmm-1.6-dev libpangomm-1.4-dev librust-gdk-pixbuf-dev
|
||||
curl --proto '=https' --tlsv1.2 -sSf https://sh.rustup.rs | sh
|
||||
source "$HOME/.cargo/env"
|
||||
make
|
||||
sudo make install
|
||||
|
||||
Rust and cargo are required, they can be installed from [rustup.rs](https://rustup.rs/) or from the distro repos if newer than 1.75.
|
||||
|
||||
**fedora:**
|
||||
|
||||
dnf install cmake clang-devel systemd-devel glib2-devel cairo-devel atkmm-devel pangomm-devel gdk-pixbuf2-devel gtk3-devel libappindicator-gtk3
|
||||
dnf install cmake clang-devel libinput-devel libseat-devel libgbm-devel libxkbcommon-devel systemd-devel libdrm-devel expat-devel pcre2-devel libzstd-devel gtk3-devel
|
||||
make
|
||||
sudo make install
|
||||
|
||||
@@ -98,28 +89,34 @@ Requirements are rust >= 1.57 installed from rustup.io if the distro provided ve
|
||||
Works with KDE Plasma (without GTK packages)
|
||||
|
||||
zypper in -t pattern devel_basis
|
||||
zypper in rustup make cmake systemd-devel clang-devel llvm-devel gdk-pixbuf-devel cairo-devel pango-devel freetype-devel gtk3-devel libexpat-devel libayatana-indicator3-7
|
||||
zypper in rustup make cmake clang-devel libinput-devel libseat-devel libgbm-devel libxkbcommon-devel systemd-devel libdrm-devel expat-devel pcre2-devel libzstd-devel gtk3-devel
|
||||
make
|
||||
sudo make install
|
||||
|
||||
**Ubuntu, Popos (unsuported):**
|
||||
|
||||
instructions removed as outdated
|
||||
|
||||
## Installing
|
||||
|
||||
- Fedora copr = https://copr.fedorainfracloud.org/coprs/lukenukem/asus-linux/
|
||||
- openSUSE = https://download.opensuse.org/repositories/home:/luke_nukem:/asus/
|
||||
- Ubuntu = not supported due to packaging woes, but you can build and install on your own.
|
||||
|
||||
=======
|
||||
|
||||
The default init method is to use the udev rule, this ensures that the service is
|
||||
started when the device is initialised and ready.
|
||||
|
||||
You may also need to activate the service for debian install. If running Pop!\_OS, I suggest disabling `system76-power` gnome-shell extension and systemd service.
|
||||
|
||||
## Upgrading
|
||||
|
||||
If you are upgrading from a previous installed version, you will need to restart the service or reboot.
|
||||
|
||||
```
|
||||
$ systemctl daemon-reload && systemctl restart asusd
|
||||
```
|
||||
|
||||
You may also need to activate the service for debian install. If running Pop!_OS, I suggest disabling `system76-power` gnome-shell extension and systemd service.
|
||||
|
||||
## Uninstalling
|
||||
|
||||
Run `sudo make uninstall` in the source repo, and remove `/etc/asusd/`.
|
||||
@@ -136,7 +133,7 @@ Dbus introsepction XML requires with `make introspection` requires `anime_sim` t
|
||||
|
||||
## AniMe Matrix simulator
|
||||
|
||||
A simulator using SDL2 can be built using `cargo build --package rog_simulators` and run with `./target/debug/anime_sim`. Once started `asusd` will need restarting to pick it up. If running this sim on a laptop *with* the display, the simulated display will be used instead of the physical display.
|
||||
A simulator using SDL2 can be built using `cargo build --package rog_simulators` and run with `./target/debug/anime_sim`. Once started `asusd` will need restarting to pick it up. If running this sim on a laptop _with_ the display, the simulated display will be used instead of the physical display.
|
||||
|
||||
## Supporting more laptops
|
||||
|
||||
|
||||
@@ -1,26 +1,28 @@
|
||||
[package]
|
||||
name = "asusctl"
|
||||
license = "MPL-2.0"
|
||||
authors = ["Luke D Jones <luke@ljones.dev>"]
|
||||
edition = "2021"
|
||||
license.workspace = true
|
||||
version.workspace = true
|
||||
readme.workspace = true
|
||||
authors.workspace = true
|
||||
repository.workspace = true
|
||||
homepage.workspace = true
|
||||
edition.workspace = true
|
||||
|
||||
[dependencies]
|
||||
rog_anime = { path = "../rog-anime" }
|
||||
rog_slash = { path = "../rog-slash" }
|
||||
rog_aura = { path = "../rog-aura" }
|
||||
rog_dbus = { path = "../rog-dbus" }
|
||||
rog_profiles = { path = "../rog-profiles" }
|
||||
rog_platform = { path = "../rog-platform" }
|
||||
asusd = { path = "../asusd" }
|
||||
dmi_id = { path = "../dmi-id" }
|
||||
|
||||
ron.workspace = true
|
||||
gumdrop.workspace = true
|
||||
toml.workspace = true
|
||||
sysfs-class.workspace = true
|
||||
zbus.workspace = true
|
||||
|
||||
[dev-dependencies]
|
||||
gif.workspace = true
|
||||
tinybmp.workspace = true
|
||||
glam.workspace = true
|
||||
rog_dbus = { path = "../rog-dbus" }
|
||||
|
||||
cargo-husky.workspace = true
|
||||
cargo-husky.workspace = true
|
||||
|
||||
@@ -5,12 +5,14 @@ use std::process::exit;
|
||||
|
||||
use rog_anime::usb::get_anime_type;
|
||||
use rog_anime::{AnimeDiagonal, AnimeType};
|
||||
use rog_dbus::RogDbusClientBlocking;
|
||||
use rog_dbus::zbus_anime::AnimeProxyBlocking;
|
||||
use zbus::blocking::Connection;
|
||||
|
||||
fn main() -> Result<(), Box<dyn Error>> {
|
||||
let (client, _) = RogDbusClientBlocking::new().unwrap();
|
||||
let conn = Connection::system().unwrap();
|
||||
let proxy = AnimeProxyBlocking::new(&conn).unwrap();
|
||||
|
||||
let args: Vec<String> = env::args().into_iter().collect();
|
||||
let args: Vec<String> = env::args().collect();
|
||||
if args.len() != 3 {
|
||||
println!("Usage: <filepath> <brightness>");
|
||||
println!("e.g, asusctl/examples/doom_large.png 0.8");
|
||||
@@ -26,11 +28,7 @@ fn main() -> Result<(), Box<dyn Error>> {
|
||||
|
||||
let anime_type = get_anime_type()?;
|
||||
|
||||
client
|
||||
.proxies()
|
||||
.anime()
|
||||
.write(matrix.into_data_buffer(anime_type)?)
|
||||
.unwrap();
|
||||
proxy.write(matrix.into_data_buffer(anime_type)?).unwrap();
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
@@ -3,7 +3,8 @@ use std::time::Duration;
|
||||
|
||||
use rog_anime::usb::get_anime_type;
|
||||
use rog_anime::{AnimeDiagonal, AnimeType};
|
||||
use rog_dbus::RogDbusClientBlocking;
|
||||
use rog_dbus::zbus_anime::AnimeProxyBlocking;
|
||||
use zbus::blocking::Connection;
|
||||
|
||||
// In usable data:
|
||||
// Top row start at 1, ends at 32
|
||||
@@ -11,26 +12,25 @@ use rog_dbus::RogDbusClientBlocking;
|
||||
// 74w x 36h diagonal used by the windows app
|
||||
|
||||
fn main() {
|
||||
let (client, _) = RogDbusClientBlocking::new().unwrap();
|
||||
let conn = Connection::system().unwrap();
|
||||
let proxy = AnimeProxyBlocking::new(&conn).unwrap();
|
||||
|
||||
for step in (2..50).rev() {
|
||||
let mut matrix = AnimeDiagonal::new(AnimeType::GA401, None);
|
||||
for c in (0..60).into_iter().step_by(step) {
|
||||
for c in (0..60).step_by(step) {
|
||||
for i in matrix.get_mut().iter_mut() {
|
||||
i[c] = 50;
|
||||
}
|
||||
}
|
||||
|
||||
for c in (0..35).into_iter().step_by(step) {
|
||||
for c in (0..35).step_by(step) {
|
||||
for i in &mut matrix.get_mut()[c] {
|
||||
*i = 50;
|
||||
}
|
||||
}
|
||||
|
||||
let anime_type = get_anime_type().unwrap();
|
||||
client
|
||||
.proxies()
|
||||
.anime()
|
||||
proxy
|
||||
.write(matrix.into_data_buffer(anime_type).unwrap())
|
||||
.unwrap();
|
||||
sleep(Duration::from_millis(300));
|
||||
|
||||
@@ -4,12 +4,14 @@ use std::thread::sleep;
|
||||
|
||||
use rog_anime::usb::get_anime_type;
|
||||
use rog_anime::{ActionData, ActionLoader, Sequences};
|
||||
use rog_dbus::RogDbusClientBlocking;
|
||||
use rog_dbus::zbus_anime::AnimeProxyBlocking;
|
||||
use zbus::blocking::Connection;
|
||||
|
||||
fn main() {
|
||||
let (client, _) = RogDbusClientBlocking::new().unwrap();
|
||||
let conn = Connection::system().unwrap();
|
||||
let proxy = AnimeProxyBlocking::new(&conn).unwrap();
|
||||
|
||||
let args: Vec<String> = env::args().into_iter().collect();
|
||||
let args: Vec<String> = env::args().collect();
|
||||
if args.len() != 3 {
|
||||
println!("Please supply filepath and brightness");
|
||||
return;
|
||||
@@ -33,11 +35,7 @@ fn main() {
|
||||
for action in seq.iter() {
|
||||
if let ActionData::Animation(frames) = action {
|
||||
for frame in frames.frames() {
|
||||
client
|
||||
.proxies()
|
||||
.anime()
|
||||
.write(frame.frame().clone())
|
||||
.unwrap();
|
||||
proxy.write(frame.frame().clone()).unwrap();
|
||||
sleep(frame.delay());
|
||||
}
|
||||
}
|
||||
|
||||
@@ -2,7 +2,8 @@ use std::convert::TryFrom;
|
||||
|
||||
use rog_anime::usb::get_anime_type;
|
||||
use rog_anime::{AnimeDataBuffer, AnimeGrid};
|
||||
use rog_dbus::RogDbusClientBlocking;
|
||||
use rog_dbus::zbus_anime::AnimeProxyBlocking;
|
||||
use zbus::blocking::Connection;
|
||||
|
||||
// In usable data:
|
||||
// Top row start at 1, ends at 32
|
||||
@@ -10,7 +11,9 @@ use rog_dbus::RogDbusClientBlocking;
|
||||
// 74w x 36h diagonal used by the windows app
|
||||
|
||||
fn main() {
|
||||
let (client, _) = RogDbusClientBlocking::new().unwrap();
|
||||
let conn = Connection::system().unwrap();
|
||||
let proxy = AnimeProxyBlocking::new(&conn).unwrap();
|
||||
|
||||
let anime_type = get_anime_type().unwrap();
|
||||
let mut matrix = AnimeGrid::new(anime_type);
|
||||
let tmp = matrix.get_mut();
|
||||
@@ -43,5 +46,5 @@ fn main() {
|
||||
|
||||
let matrix = <AnimeDataBuffer>::try_from(matrix).unwrap();
|
||||
|
||||
client.proxies().anime().write(matrix).unwrap();
|
||||
proxy.write(matrix).unwrap();
|
||||
}
|
||||
|
||||
@@ -1,12 +1,14 @@
|
||||
use rog_anime::usb::get_anime_type;
|
||||
use rog_anime::AnimeDataBuffer;
|
||||
use rog_dbus::RogDbusClientBlocking;
|
||||
use rog_dbus::zbus_anime::AnimeProxyBlocking;
|
||||
use zbus::blocking::Connection;
|
||||
|
||||
// In usable data:
|
||||
// Top row start at 1, ends at 32
|
||||
|
||||
fn main() {
|
||||
let (client, _) = RogDbusClientBlocking::new().unwrap();
|
||||
let conn = Connection::system().unwrap();
|
||||
let proxy = AnimeProxyBlocking::new(&conn).unwrap();
|
||||
let anime_type = get_anime_type().unwrap();
|
||||
let mut matrix = AnimeDataBuffer::new(anime_type);
|
||||
matrix.data_mut()[1] = 100; // start = 1
|
||||
@@ -127,5 +129,5 @@ fn main() {
|
||||
matrix.data_mut()[1244] = 100; // end
|
||||
println!("{:?}", &matrix);
|
||||
|
||||
client.proxies().anime().write(matrix).unwrap();
|
||||
proxy.write(matrix).unwrap();
|
||||
}
|
||||
|
||||
@@ -6,12 +6,14 @@ use std::process::exit;
|
||||
|
||||
use rog_anime::usb::get_anime_type;
|
||||
use rog_anime::{AnimeDataBuffer, AnimeImage, Vec2};
|
||||
use rog_dbus::RogDbusClientBlocking;
|
||||
use rog_dbus::zbus_anime::AnimeProxyBlocking;
|
||||
use zbus::blocking::Connection;
|
||||
|
||||
fn main() -> Result<(), Box<dyn Error>> {
|
||||
let (client, _) = RogDbusClientBlocking::new().unwrap();
|
||||
let conn = Connection::system().unwrap();
|
||||
let proxy = AnimeProxyBlocking::new(&conn).unwrap();
|
||||
|
||||
let args: Vec<String> = env::args().into_iter().collect();
|
||||
let args: Vec<String> = env::args().collect();
|
||||
if args.len() != 7 {
|
||||
println!("Usage: <filepath> <scale> <angle> <x pos> <y pos> <brightness>");
|
||||
println!("e.g, asusctl/examples/doom_large.png 0.9 0.4 0.0 0.0 0.8");
|
||||
@@ -31,11 +33,7 @@ fn main() -> Result<(), Box<dyn Error>> {
|
||||
anime_type,
|
||||
)?;
|
||||
|
||||
client
|
||||
.proxies()
|
||||
.anime()
|
||||
.write(<AnimeDataBuffer>::try_from(&matrix)?)
|
||||
.unwrap();
|
||||
proxy.write(<AnimeDataBuffer>::try_from(&matrix)?).unwrap();
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
@@ -9,12 +9,14 @@ use std::time::Duration;
|
||||
|
||||
use rog_anime::usb::get_anime_type;
|
||||
use rog_anime::{AnimeDataBuffer, AnimeImage, Vec2};
|
||||
use rog_dbus::RogDbusClientBlocking;
|
||||
use rog_dbus::zbus_anime::AnimeProxyBlocking;
|
||||
use zbus::blocking::Connection;
|
||||
|
||||
fn main() -> Result<(), Box<dyn Error>> {
|
||||
let (client, _) = RogDbusClientBlocking::new().unwrap();
|
||||
let conn = Connection::system().unwrap();
|
||||
let proxy = AnimeProxyBlocking::new(&conn).unwrap();
|
||||
|
||||
let args: Vec<String> = env::args().into_iter().collect();
|
||||
let args: Vec<String> = env::args().collect();
|
||||
if args.len() != 7 {
|
||||
println!("Usage: <filepath> <scale> <angle> <x pos> <y pos> <brightness>");
|
||||
println!("e.g, asusctl/examples/doom_large.png 0.9 0.4 0.0 0.0 0.8");
|
||||
@@ -41,11 +43,7 @@ fn main() -> Result<(), Box<dyn Error>> {
|
||||
}
|
||||
matrix.update();
|
||||
|
||||
client
|
||||
.proxies()
|
||||
.anime()
|
||||
.write(<AnimeDataBuffer>::try_from(&matrix)?)
|
||||
.unwrap();
|
||||
proxy.write(<AnimeDataBuffer>::try_from(&matrix)?).unwrap();
|
||||
sleep(Duration::from_micros(500));
|
||||
}
|
||||
}
|
||||
|
||||
@@ -1,16 +1,17 @@
|
||||
//! Using a combination of key-colour array plus a key layout to generate
|
||||
//! outputs.
|
||||
|
||||
use rog_aura::advanced::LedCode;
|
||||
use rog_aura::effects::{AdvancedEffects, Effect};
|
||||
use rog_aura::layouts::KeyLayout;
|
||||
use rog_aura::keyboard::{KeyLayout, LedCode};
|
||||
use rog_aura::Colour;
|
||||
use rog_dbus::RogDbusClientBlocking;
|
||||
use rog_dbus::zbus_aura::AuraProxyBlocking;
|
||||
use zbus::blocking::Connection;
|
||||
|
||||
fn main() -> Result<(), Box<dyn std::error::Error>> {
|
||||
let layout = KeyLayout::default_layout();
|
||||
|
||||
let (client, _) = RogDbusClientBlocking::new().unwrap();
|
||||
let conn = Connection::system().unwrap();
|
||||
let proxy = AuraProxyBlocking::new(&conn).unwrap();
|
||||
|
||||
let mut seq = AdvancedEffects::new(true);
|
||||
|
||||
@@ -62,7 +63,7 @@ fn main() -> Result<(), Box<dyn std::error::Error>> {
|
||||
seq.next_state(&layout);
|
||||
let packets = seq.create_packets();
|
||||
|
||||
client.proxies().led().direct_addressing_raw(packets)?;
|
||||
proxy.direct_addressing_raw(packets)?;
|
||||
std::thread::sleep(std::time::Duration::from_millis(33));
|
||||
}
|
||||
}
|
||||
|
||||
@@ -17,10 +17,28 @@ pub struct AnimeCommand {
|
||||
help = "set global base brightness value <Off, Low, Med, High>"
|
||||
)]
|
||||
pub brightness: Option<Brightness>,
|
||||
#[options(meta = "", help = "set global (image) brightness value")]
|
||||
pub image_brightness: Option<f32>,
|
||||
#[options(help = "clear the display")]
|
||||
pub clear: bool,
|
||||
#[options(
|
||||
no_short,
|
||||
meta = "",
|
||||
help = "turn the anime off when external power is unplugged"
|
||||
)]
|
||||
pub off_when_unplugged: Option<bool>,
|
||||
#[options(
|
||||
no_short,
|
||||
meta = "",
|
||||
help = "turn the anime off when the laptop suspends"
|
||||
)]
|
||||
pub off_when_suspended: Option<bool>,
|
||||
#[options(
|
||||
no_short,
|
||||
meta = "",
|
||||
help = "turn the anime off when the lid is closed"
|
||||
)]
|
||||
pub off_when_lid_closed: Option<bool>,
|
||||
#[options(no_short, meta = "", help = "Off with his head!!!")]
|
||||
pub off_with_his_head: Option<bool>,
|
||||
#[options(command)]
|
||||
pub command: Option<AnimeActions>,
|
||||
}
|
||||
@@ -43,15 +61,27 @@ pub enum AnimeActions {
|
||||
pub struct Builtins {
|
||||
#[options(help = "print help message")]
|
||||
pub help: bool,
|
||||
#[options(meta = "", help = " <GlitchConstruction, StaticEmergence>")]
|
||||
#[options(
|
||||
meta = "",
|
||||
help = "Default is used if unspecified, <default:GlitchConstruction, StaticEmergence>"
|
||||
)]
|
||||
pub boot: AnimBooting,
|
||||
#[options(meta = "", help = "<BinaryBannerScroll, RogLogoGlitch>")]
|
||||
#[options(
|
||||
meta = "",
|
||||
help = "Default is used if unspecified, <default:BinaryBannerScroll, RogLogoGlitch>"
|
||||
)]
|
||||
pub awake: AnimAwake,
|
||||
#[options(meta = "", help = "<BannerSwipe, Starfield>")]
|
||||
#[options(
|
||||
meta = "",
|
||||
help = "Default is used if unspecified, <default:BannerSwipe, Starfield>"
|
||||
)]
|
||||
pub sleep: AnimSleeping,
|
||||
#[options(meta = "", help = "<GlitchOut, SeeYa>")]
|
||||
#[options(
|
||||
meta = "",
|
||||
help = "Default is used if unspecified, <default:GlitchOut, SeeYa>"
|
||||
)]
|
||||
pub shutdown: AnimShutdown,
|
||||
#[options(meta = "", help = "set/apply the animations")]
|
||||
#[options(meta = "", help = "set/apply the animations <true/false>")]
|
||||
pub set: Option<bool>,
|
||||
}
|
||||
|
||||
|
||||
@@ -10,10 +10,10 @@ pub struct LedPowerCommand1 {
|
||||
pub help: bool,
|
||||
#[options(meta = "", help = "Control if LEDs enabled while awake <true/false>")]
|
||||
pub awake: Option<bool>,
|
||||
#[options(meta = "", help = "Use with awake option <true/false>")]
|
||||
pub keyboard: Option<bool>,
|
||||
#[options(meta = "", help = "Use with awake option <true/false>")]
|
||||
pub lightbar: Option<bool>,
|
||||
#[options(help = "Use with awake option, if excluded defaults to false")]
|
||||
pub keyboard: bool,
|
||||
#[options(help = "Use with awake option, if excluded defaults to false")]
|
||||
pub lightbar: bool,
|
||||
#[options(meta = "", help = "Control boot animations <true/false>")]
|
||||
pub boot: Option<bool>,
|
||||
#[options(meta = "", help = "Control suspend animations <true/false>")]
|
||||
@@ -59,14 +59,14 @@ pub struct AuraPowerStates {
|
||||
|
||||
#[derive(Options)]
|
||||
pub struct LedBrightness {
|
||||
level: Option<u32>,
|
||||
level: Option<u8>,
|
||||
}
|
||||
impl LedBrightness {
|
||||
pub fn new(level: Option<u32>) -> Self {
|
||||
pub fn new(level: Option<u8>) -> Self {
|
||||
LedBrightness { level }
|
||||
}
|
||||
|
||||
pub fn level(&self) -> Option<u32> {
|
||||
pub fn level(&self) -> Option<u8> {
|
||||
self.level
|
||||
}
|
||||
}
|
||||
@@ -87,6 +87,7 @@ impl FromStr for LedBrightness {
|
||||
}
|
||||
}
|
||||
}
|
||||
#[allow(clippy::to_string_trait_impl)]
|
||||
impl ToString for LedBrightness {
|
||||
fn to_string(&self) -> String {
|
||||
let s = match self.level {
|
||||
@@ -214,29 +215,29 @@ pub struct MultiColourSpeed {
|
||||
#[derive(Options)]
|
||||
pub enum SetAuraBuiltin {
|
||||
#[options(help = "set a single static colour")]
|
||||
Static(SingleColour),
|
||||
Static(SingleColour), // 0
|
||||
#[options(help = "pulse between one or two colours")]
|
||||
Breathe(TwoColourSpeed),
|
||||
Breathe(TwoColourSpeed), // 1
|
||||
#[options(help = "strobe through all colours")]
|
||||
Strobe(SingleSpeed),
|
||||
Strobe(SingleSpeed), // 2
|
||||
#[options(help = "rainbow cycling in one of four directions")]
|
||||
Rainbow(SingleSpeedDirection),
|
||||
Rainbow(SingleSpeedDirection), // 3
|
||||
#[options(help = "rain pattern mimicking raindrops")]
|
||||
Stars(TwoColourSpeed),
|
||||
Stars(TwoColourSpeed), // 4
|
||||
#[options(help = "rain pattern of three preset colours")]
|
||||
Rain(SingleSpeed),
|
||||
Rain(SingleSpeed), // 5
|
||||
#[options(help = "pressed keys are highlighted to fade")]
|
||||
Highlight(SingleColourSpeed),
|
||||
Highlight(SingleColourSpeed), // 6
|
||||
#[options(help = "pressed keys generate horizontal laser")]
|
||||
Laser(SingleColourSpeed),
|
||||
Laser(SingleColourSpeed), // 7
|
||||
#[options(help = "pressed keys ripple outwards like a splash")]
|
||||
Ripple(SingleColourSpeed),
|
||||
Ripple(SingleColourSpeed), // 8
|
||||
#[options(help = "set a rapid pulse")]
|
||||
Pulse(SingleColour),
|
||||
Pulse(SingleColour), // 10
|
||||
#[options(help = "set a vertical line zooming from left")]
|
||||
Comet(SingleColour),
|
||||
Comet(SingleColour), // 11
|
||||
#[options(help = "set a wide vertical line zooming from left")]
|
||||
Flash(SingleColour),
|
||||
Flash(SingleColour), // 12
|
||||
}
|
||||
|
||||
impl Default for SetAuraBuiltin {
|
||||
|
||||
@@ -1,8 +1,10 @@
|
||||
use gumdrop::Options;
|
||||
use rog_platform::platform::ThrottlePolicy;
|
||||
|
||||
use crate::anime_cli::AnimeCommand;
|
||||
use crate::aura_cli::{LedBrightness, LedPowerCommand1, LedPowerCommand2, SetAuraBuiltin};
|
||||
use crate::profiles_cli::{FanCurveCommand, ProfileCommand};
|
||||
use crate::fan_curve_cli::FanCurveCommand;
|
||||
use crate::slash_cli::SlashCommand;
|
||||
|
||||
#[derive(Default, Options)]
|
||||
pub struct CliStart {
|
||||
@@ -40,10 +42,30 @@ pub enum CliCommand {
|
||||
Graphics(GraphicsCommand),
|
||||
#[options(name = "anime", help = "Manage AniMe Matrix")]
|
||||
Anime(AnimeCommand),
|
||||
#[options(name = "slash", help = "Manage Slash Ledbar")]
|
||||
Slash(SlashCommand),
|
||||
#[options(help = "Change bios settings")]
|
||||
Bios(BiosCommand),
|
||||
}
|
||||
|
||||
#[derive(Debug, Clone, Options)]
|
||||
pub struct ProfileCommand {
|
||||
#[options(help = "print help message")]
|
||||
pub help: bool,
|
||||
|
||||
#[options(help = "toggle to next profile in list")]
|
||||
pub next: bool,
|
||||
|
||||
#[options(help = "list available profiles")]
|
||||
pub list: bool,
|
||||
|
||||
#[options(help = "get profile")]
|
||||
pub profile_get: bool,
|
||||
|
||||
#[options(meta = "", help = "set the active profile")]
|
||||
pub profile_set: Option<ThrottlePolicy>,
|
||||
}
|
||||
|
||||
#[derive(Options)]
|
||||
pub struct LedModeCommand {
|
||||
#[options(help = "print help message")]
|
||||
|
||||
49
asusctl/src/fan_curve_cli.rs
Normal file
49
asusctl/src/fan_curve_cli.rs
Normal file
@@ -0,0 +1,49 @@
|
||||
use gumdrop::Options;
|
||||
use rog_platform::platform::ThrottlePolicy;
|
||||
use rog_profiles::fan_curve_set::CurveData;
|
||||
use rog_profiles::FanCurvePU;
|
||||
|
||||
#[derive(Debug, Clone, Options)]
|
||||
pub struct FanCurveCommand {
|
||||
#[options(help = "print help message")]
|
||||
pub help: bool,
|
||||
|
||||
#[options(help = "get enabled fan profiles")]
|
||||
pub get_enabled: bool,
|
||||
|
||||
#[options(help = "set the active profile's fan curve to default")]
|
||||
pub default: bool,
|
||||
|
||||
#[options(
|
||||
meta = "",
|
||||
help = "profile to modify fan-curve for. Shows data if no options provided"
|
||||
)]
|
||||
pub mod_profile: Option<ThrottlePolicy>,
|
||||
|
||||
#[options(
|
||||
meta = "",
|
||||
help = "enable or disable <true/false> fan all curves for a profile. `--mod_profile` \
|
||||
required"
|
||||
)]
|
||||
pub enable_fan_curves: Option<bool>,
|
||||
|
||||
#[options(
|
||||
meta = "",
|
||||
help = "enable or disable <true/false> a single fan curve for a profile. `--mod_profile` \
|
||||
and `--fan` required"
|
||||
)]
|
||||
pub enable_fan_curve: Option<bool>,
|
||||
|
||||
#[options(
|
||||
meta = "",
|
||||
help = "select fan <cpu/gpu/mid> to modify. `--mod_profile` required"
|
||||
)]
|
||||
pub fan: Option<FanCurvePU>,
|
||||
|
||||
#[options(
|
||||
meta = "",
|
||||
help = "data format = 30c:1%,49c:2%,59c:3%,69c:4%,79c:31%,89c:49%,99c:56%,109c:58%. \
|
||||
`--mod-profile` required. If '%' is omitted the fan range is 0-255"
|
||||
)]
|
||||
pub data: Option<CurveData>,
|
||||
}
|
||||
@@ -5,26 +5,35 @@ use std::process::Command;
|
||||
use std::thread::sleep;
|
||||
|
||||
use anime_cli::{AnimeActions, AnimeCommand};
|
||||
use asusd::ctrl_fancurves::FAN_CURVE_ZBUS_NAME;
|
||||
use aura_cli::{LedPowerCommand1, LedPowerCommand2};
|
||||
use dmi_id::DMIID;
|
||||
use fan_curve_cli::FanCurveCommand;
|
||||
use gumdrop::{Opt, Options};
|
||||
use profiles_cli::{FanCurveCommand, ProfileCommand};
|
||||
use rog_anime::usb::get_anime_type;
|
||||
use rog_anime::{AnimTime, AnimeDataBuffer, AnimeDiagonal, AnimeGif, AnimeImage, AnimeType, Vec2};
|
||||
use rog_aura::power::KbAuraPowerState;
|
||||
use rog_aura::usb::{AuraDevRog1, AuraDevTuf, AuraDevice, AuraPowerDev};
|
||||
use rog_aura::{self, AuraEffect};
|
||||
use rog_dbus::RogDbusClientBlocking;
|
||||
use rog_platform::platform::GpuMode;
|
||||
use rog_platform::supported::*;
|
||||
use rog_aura::keyboard::{AuraPowerState, LaptopAuraPower};
|
||||
use rog_aura::{self, AuraDeviceType, AuraEffect, PowerZones};
|
||||
use rog_dbus::zbus_anime::AnimeProxyBlocking;
|
||||
use rog_dbus::zbus_aura::AuraProxyBlocking;
|
||||
use rog_dbus::zbus_fan_curves::FanCurvesProxyBlocking;
|
||||
use rog_dbus::zbus_platform::PlatformProxyBlocking;
|
||||
use rog_dbus::zbus_slash::SlashProxyBlocking;
|
||||
use rog_platform::platform::{GpuMode, Properties, ThrottlePolicy};
|
||||
use rog_profiles::error::ProfileError;
|
||||
use rog_slash::SlashMode;
|
||||
use ron::ser::PrettyConfig;
|
||||
use zbus::blocking::Connection;
|
||||
|
||||
use crate::aura_cli::{AuraPowerStates, LedBrightness};
|
||||
use crate::cli_opts::*;
|
||||
use crate::slash_cli::SlashCommand;
|
||||
|
||||
mod anime_cli;
|
||||
mod aura_cli;
|
||||
mod cli_opts;
|
||||
mod profiles_cli;
|
||||
mod fan_curve_cli;
|
||||
mod slash_cli;
|
||||
|
||||
fn main() {
|
||||
let args: Vec<String> = args().skip(1).collect();
|
||||
@@ -42,44 +51,51 @@ fn main() {
|
||||
}
|
||||
};
|
||||
|
||||
if let Ok((dbus, _)) = RogDbusClientBlocking::new().map_err(|e| {
|
||||
print_error_help(&e, None);
|
||||
let conn = Connection::system().unwrap();
|
||||
if let Ok(platform_proxy) = PlatformProxyBlocking::new(&conn).map_err(|e| {
|
||||
check_service("asusd");
|
||||
println!("\nError: {e}\n");
|
||||
print_info();
|
||||
}) {
|
||||
if let Ok(supported) = dbus
|
||||
.proxies()
|
||||
.supported()
|
||||
.supported_functions()
|
||||
.map_err(|e| {
|
||||
print_error_help(&e, None);
|
||||
})
|
||||
{
|
||||
if parsed.version {
|
||||
println!("asusctl v{}", env!("CARGO_PKG_VERSION"));
|
||||
println!();
|
||||
print_info();
|
||||
}
|
||||
let self_version = env!("CARGO_PKG_VERSION");
|
||||
let asusd_version = platform_proxy.version().unwrap();
|
||||
if asusd_version != self_version {
|
||||
println!("Version mismatch: asusctl = {self_version}, asusd = {asusd_version}");
|
||||
return;
|
||||
}
|
||||
|
||||
if let Err(err) = do_parsed(&parsed, &supported, &dbus) {
|
||||
print_error_help(&*err, Some(&supported));
|
||||
}
|
||||
let supported_properties = platform_proxy.supported_properties().unwrap();
|
||||
let supported_interfaces = platform_proxy.supported_interfaces().unwrap();
|
||||
|
||||
if parsed.version {
|
||||
println!("asusctl v{}", env!("CARGO_PKG_VERSION"));
|
||||
println!();
|
||||
print_info();
|
||||
}
|
||||
|
||||
if let Err(err) = do_parsed(&parsed, &supported_interfaces, &supported_properties, conn) {
|
||||
print_error_help(&*err, &supported_interfaces, &supported_properties);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
fn print_error_help(err: &dyn std::error::Error, supported: Option<&SupportedFunctions>) {
|
||||
fn print_error_help(
|
||||
err: &dyn std::error::Error,
|
||||
supported_interfaces: &[String],
|
||||
supported_properties: &[Properties],
|
||||
) {
|
||||
check_service("asusd");
|
||||
println!("\nError: {}\n", err);
|
||||
print_info();
|
||||
if let Some(supported) = supported {
|
||||
println!();
|
||||
println!("Supported laptop functions:\n\n{}", supported);
|
||||
}
|
||||
println!();
|
||||
println!("Supported interfaces:\n\n{:#?}\n", supported_interfaces);
|
||||
println!("Supported properties:\n\n{:#?}\n", supported_properties);
|
||||
}
|
||||
|
||||
fn print_info() {
|
||||
let dmi = sysfs_class::DmiId::default();
|
||||
let board_name = dmi.board_name().expect("Could not get board_name");
|
||||
let prod_family = dmi.product_family().expect("Could not get product_family");
|
||||
let dmi = DMIID::new().unwrap_or_default();
|
||||
let board_name = dmi.board_name;
|
||||
let prod_family = dmi.product_family;
|
||||
println!("asusctl version: {}", env!("CARGO_PKG_VERSION"));
|
||||
println!(" Product family: {}", prod_family.trim());
|
||||
println!(" Board name: {}", board_name.trim());
|
||||
@@ -102,22 +118,68 @@ fn check_service(name: &str) -> bool {
|
||||
false
|
||||
}
|
||||
|
||||
fn find_aura_iface() -> Result<Vec<AuraProxyBlocking<'static>>, Box<dyn std::error::Error>> {
|
||||
let conn = zbus::blocking::Connection::system().unwrap();
|
||||
let f = zbus::blocking::fdo::ObjectManagerProxy::new(
|
||||
&conn,
|
||||
"org.asuslinux.Daemon",
|
||||
"/org/asuslinux",
|
||||
)
|
||||
.unwrap();
|
||||
let interfaces = f.get_managed_objects().unwrap();
|
||||
let mut aura_paths = Vec::new();
|
||||
for v in interfaces.iter() {
|
||||
// let o: Vec<zbus::names::OwnedInterfaceName> = v.1.keys().map(|e|
|
||||
// e.to_owned()).collect(); println!("{}, {:?}", v.0, o);
|
||||
for k in v.1.keys() {
|
||||
if k.as_str() == "org.asuslinux.Aura" {
|
||||
println!("Found aura device at {}, {}", v.0, k);
|
||||
aura_paths.push(v.0.clone());
|
||||
}
|
||||
}
|
||||
}
|
||||
if aura_paths.len() > 1 {
|
||||
println!("Multiple aura devices found: {aura_paths:?}");
|
||||
println!("TODO: enable selection");
|
||||
}
|
||||
if !aura_paths.is_empty() {
|
||||
let mut ctrl = Vec::new();
|
||||
for path in aura_paths {
|
||||
ctrl.push(
|
||||
AuraProxyBlocking::builder(&conn)
|
||||
.path(path.clone())?
|
||||
.destination("org.asuslinux.Daemon")?
|
||||
.build()?,
|
||||
);
|
||||
}
|
||||
return Ok(ctrl);
|
||||
}
|
||||
|
||||
Err("No Aura interface".into())
|
||||
}
|
||||
|
||||
fn do_parsed(
|
||||
parsed: &CliStart,
|
||||
supported: &SupportedFunctions,
|
||||
dbus: &RogDbusClientBlocking<'_>,
|
||||
supported_interfaces: &[String],
|
||||
supported_properties: &[Properties],
|
||||
conn: Connection,
|
||||
) -> Result<(), Box<dyn std::error::Error>> {
|
||||
match &parsed.command {
|
||||
Some(CliCommand::LedMode(mode)) => handle_led_mode(dbus, &supported.keyboard_led, mode)?,
|
||||
Some(CliCommand::LedPow1(pow)) => handle_led_power1(dbus, &supported.keyboard_led, pow)?,
|
||||
Some(CliCommand::LedPow2(pow)) => handle_led_power2(dbus, &supported.keyboard_led, pow)?,
|
||||
Some(CliCommand::Profile(cmd)) => handle_profile(dbus, &supported.platform_profile, cmd)?,
|
||||
Some(CliCommand::LedMode(mode)) => handle_led_mode(&find_aura_iface()?, mode)?,
|
||||
Some(CliCommand::LedPow1(pow)) => handle_led_power1(&find_aura_iface()?, pow)?,
|
||||
Some(CliCommand::LedPow2(pow)) => handle_led_power2(&find_aura_iface()?, pow)?,
|
||||
Some(CliCommand::Profile(cmd)) => {
|
||||
handle_throttle_profile(&conn, supported_properties, cmd)?
|
||||
}
|
||||
Some(CliCommand::FanCurve(cmd)) => {
|
||||
handle_fan_curve(dbus, &supported.platform_profile, cmd)?;
|
||||
handle_fan_curve(&conn, supported_interfaces, cmd)?;
|
||||
}
|
||||
Some(CliCommand::Graphics(_)) => do_gfx(),
|
||||
Some(CliCommand::Anime(cmd)) => handle_anime(dbus, &supported.anime_ctrl, cmd)?,
|
||||
Some(CliCommand::Bios(cmd)) => handle_bios_option(dbus, &supported.rog_bios_ctrl, cmd)?,
|
||||
Some(CliCommand::Anime(cmd)) => handle_anime(&conn, cmd)?,
|
||||
Some(CliCommand::Slash(cmd)) => handle_slash(&conn, cmd)?,
|
||||
Some(CliCommand::Bios(cmd)) => {
|
||||
handle_platform_properties(&conn, supported_properties, cmd)?
|
||||
}
|
||||
None => {
|
||||
if (!parsed.show_supported
|
||||
&& parsed.kbd_bright.is_none()
|
||||
@@ -129,21 +191,25 @@ fn do_parsed(
|
||||
println!("{}", CliStart::usage());
|
||||
println!();
|
||||
if let Some(cmdlist) = CliStart::command_list() {
|
||||
let dev_type = if let Ok(proxy) = find_aura_iface() {
|
||||
// TODO: commands on all?
|
||||
proxy
|
||||
.first()
|
||||
.unwrap()
|
||||
.device_type()
|
||||
.unwrap_or(AuraDeviceType::Unknown)
|
||||
} else {
|
||||
AuraDeviceType::Unknown
|
||||
};
|
||||
let commands: Vec<String> = cmdlist.lines().map(|s| s.to_owned()).collect();
|
||||
for command in commands.iter().filter(|command| {
|
||||
if !matches!(
|
||||
supported.keyboard_led.dev_id,
|
||||
AuraDevice::X1854
|
||||
| AuraDevice::X1869
|
||||
| AuraDevice::X1866
|
||||
| AuraDevice::Tuf
|
||||
) && command.trim().starts_with("led-pow-1")
|
||||
if !dev_type.is_old_laptop()
|
||||
&& !dev_type.is_tuf_laptop()
|
||||
&& command.trim().starts_with("led-pow-1")
|
||||
{
|
||||
return false;
|
||||
}
|
||||
if supported.keyboard_led.dev_id != AuraDevice::X19b6
|
||||
&& command.trim().starts_with("led-pow-2")
|
||||
{
|
||||
if !dev_type.is_new_laptop() && command.trim().starts_with("led-pow-2") {
|
||||
return false;
|
||||
}
|
||||
true
|
||||
@@ -160,34 +226,67 @@ fn do_parsed(
|
||||
}
|
||||
|
||||
if let Some(brightness) = &parsed.kbd_bright {
|
||||
match brightness.level() {
|
||||
None => {
|
||||
let level = dbus.proxies().led().led_brightness()?;
|
||||
println!("Current keyboard led brightness: {}", level);
|
||||
if let Ok(aura) = find_aura_iface() {
|
||||
for aura in aura.iter() {
|
||||
match brightness.level() {
|
||||
None => {
|
||||
let level = aura.brightness()?;
|
||||
println!("Current keyboard led brightness: {level:?}");
|
||||
}
|
||||
Some(level) => aura.set_brightness(rog_aura::LedBrightness::from(level))?,
|
||||
}
|
||||
}
|
||||
Some(level) => dbus
|
||||
.proxies()
|
||||
.led()
|
||||
.set_brightness(<rog_aura::LedBrightness>::from(level))?,
|
||||
} else {
|
||||
println!("No aura interface found");
|
||||
}
|
||||
}
|
||||
|
||||
if parsed.next_kbd_bright {
|
||||
dbus.proxies().led().next_led_brightness()?;
|
||||
if let Ok(aura) = find_aura_iface() {
|
||||
for aura in aura.iter() {
|
||||
let brightness = aura.brightness()?;
|
||||
aura.set_brightness(brightness.next())?;
|
||||
}
|
||||
} else {
|
||||
println!("No aura interface found");
|
||||
}
|
||||
}
|
||||
|
||||
if parsed.prev_kbd_bright {
|
||||
dbus.proxies().led().prev_led_brightness()?;
|
||||
if let Ok(aura) = find_aura_iface() {
|
||||
for aura in aura.iter() {
|
||||
let brightness = aura.brightness()?;
|
||||
aura.set_brightness(brightness.prev())?;
|
||||
}
|
||||
} else {
|
||||
println!("No aura interface found");
|
||||
}
|
||||
}
|
||||
|
||||
if parsed.show_supported {
|
||||
println!("Supported laptop functions:\n\n{}", supported);
|
||||
println!("Supported Core Functions:\n{:#?}", supported_interfaces);
|
||||
println!(
|
||||
"Supported Platform Properties:\n{:#?}",
|
||||
supported_properties
|
||||
);
|
||||
if let Ok(aura) = find_aura_iface() {
|
||||
// TODO: multiple RGB check
|
||||
let bright = aura.first().unwrap().supported_brightness()?;
|
||||
let modes = aura.first().unwrap().supported_basic_modes()?;
|
||||
let zones = aura.first().unwrap().supported_basic_zones()?;
|
||||
let power = aura.first().unwrap().supported_power_zones()?;
|
||||
println!("Supported Keyboard Brightness:\n{:#?}", bright);
|
||||
println!("Supported Aura Modes:\n{:#?}", modes);
|
||||
println!("Supported Aura Zones:\n{:#?}", zones);
|
||||
println!("Supported Aura Power Zones:\n{:#?}", power);
|
||||
} else {
|
||||
println!("No aura interface found");
|
||||
}
|
||||
}
|
||||
|
||||
if let Some(chg_limit) = parsed.chg_limit {
|
||||
dbus.proxies()
|
||||
.charge()
|
||||
.set_charge_control_end_threshold(chg_limit)?;
|
||||
let proxy = PlatformProxyBlocking::new(&conn)?;
|
||||
proxy.set_charge_control_end_threshold(chg_limit)?;
|
||||
}
|
||||
|
||||
Ok(())
|
||||
@@ -201,16 +300,15 @@ fn do_gfx() {
|
||||
println!("This command will be removed in future");
|
||||
}
|
||||
|
||||
fn handle_anime(
|
||||
dbus: &RogDbusClientBlocking<'_>,
|
||||
_supported: &AnimeSupportedFunctions,
|
||||
cmd: &AnimeCommand,
|
||||
) -> Result<(), Box<dyn std::error::Error>> {
|
||||
fn handle_anime(conn: &Connection, cmd: &AnimeCommand) -> Result<(), Box<dyn std::error::Error>> {
|
||||
if (cmd.command.is_none()
|
||||
&& cmd.enable_display.is_none()
|
||||
&& cmd.enable_powersave_anim.is_none()
|
||||
&& cmd.brightness.is_none()
|
||||
&& cmd.image_brightness.is_none()
|
||||
&& cmd.off_when_lid_closed.is_none()
|
||||
&& cmd.off_when_suspended.is_none()
|
||||
&& cmd.off_when_unplugged.is_none()
|
||||
&& cmd.off_with_his_head.is_none()
|
||||
&& !cmd.clear)
|
||||
|| cmd.help
|
||||
{
|
||||
@@ -219,18 +317,27 @@ fn handle_anime(
|
||||
println!("\n{}", lst);
|
||||
}
|
||||
}
|
||||
let proxy = AnimeProxyBlocking::new(conn)?;
|
||||
if let Some(enable) = cmd.enable_display {
|
||||
dbus.proxies().anime().set_enable_display(enable)?;
|
||||
proxy.set_enable_display(enable)?;
|
||||
}
|
||||
if let Some(enable) = cmd.enable_powersave_anim {
|
||||
dbus.proxies().anime().set_builtins_enabled(enable)?;
|
||||
proxy.set_builtins_enabled(enable)?;
|
||||
}
|
||||
if let Some(bright) = cmd.brightness {
|
||||
dbus.proxies().anime().set_brightness(bright)?;
|
||||
proxy.set_brightness(bright)?;
|
||||
}
|
||||
if let Some(bright) = cmd.image_brightness {
|
||||
verify_brightness(bright);
|
||||
dbus.proxies().anime().set_image_brightness(bright)?;
|
||||
if let Some(enable) = cmd.off_when_lid_closed {
|
||||
proxy.set_off_when_lid_closed(enable)?;
|
||||
}
|
||||
if let Some(enable) = cmd.off_when_suspended {
|
||||
proxy.set_off_when_suspended(enable)?;
|
||||
}
|
||||
if let Some(enable) = cmd.off_when_unplugged {
|
||||
proxy.set_off_when_unplugged(enable)?;
|
||||
}
|
||||
if cmd.off_with_his_head.is_some() {
|
||||
println!("Did Alice _really_ make it back from Wonderland?");
|
||||
}
|
||||
|
||||
let mut anime_type = get_anime_type()?;
|
||||
@@ -243,7 +350,7 @@ fn handle_anime(
|
||||
if cmd.clear {
|
||||
let data = vec![255u8; anime_type.data_length()];
|
||||
let tmp = AnimeDataBuffer::from_vec(anime_type, data)?;
|
||||
dbus.proxies().anime().write(tmp)?;
|
||||
proxy.write(tmp)?;
|
||||
}
|
||||
|
||||
if let Some(action) = cmd.command.as_ref() {
|
||||
@@ -267,9 +374,7 @@ fn handle_anime(
|
||||
anime_type,
|
||||
)?;
|
||||
|
||||
dbus.proxies()
|
||||
.anime()
|
||||
.write(<AnimeDataBuffer>::try_from(&matrix)?)?;
|
||||
proxy.write(<AnimeDataBuffer>::try_from(&matrix)?)?;
|
||||
}
|
||||
AnimeActions::PixelImage(image) => {
|
||||
if image.help_requested() || image.path.is_empty() {
|
||||
@@ -288,9 +393,7 @@ fn handle_anime(
|
||||
anime_type,
|
||||
)?;
|
||||
|
||||
dbus.proxies()
|
||||
.anime()
|
||||
.write(matrix.into_data_buffer(anime_type)?)?;
|
||||
proxy.write(matrix.into_data_buffer(anime_type)?)?;
|
||||
}
|
||||
AnimeActions::Gif(gif) => {
|
||||
if gif.help_requested() || gif.path.is_empty() {
|
||||
@@ -315,7 +418,7 @@ fn handle_anime(
|
||||
let mut loops = gif.loops as i32;
|
||||
loop {
|
||||
for frame in matrix.frames() {
|
||||
dbus.proxies().anime().write(frame.frame().clone())?;
|
||||
proxy.write(frame.frame().clone())?;
|
||||
sleep(frame.delay());
|
||||
}
|
||||
if loops >= 0 {
|
||||
@@ -346,7 +449,7 @@ fn handle_anime(
|
||||
let mut loops = gif.loops as i32;
|
||||
loop {
|
||||
for frame in matrix.frames() {
|
||||
dbus.proxies().anime().write(frame.frame().clone())?;
|
||||
proxy.write(frame.frame().clone())?;
|
||||
sleep(frame.delay());
|
||||
}
|
||||
if loops >= 0 {
|
||||
@@ -367,12 +470,12 @@ fn handle_anime(
|
||||
return Ok(());
|
||||
}
|
||||
|
||||
dbus.proxies().anime().set_builtin_animations(
|
||||
builtins.boot,
|
||||
builtins.awake,
|
||||
builtins.sleep,
|
||||
builtins.shutdown,
|
||||
)?;
|
||||
proxy.set_builtin_animations(rog_anime::Animations {
|
||||
boot: builtins.boot,
|
||||
awake: builtins.awake,
|
||||
sleep: builtins.sleep,
|
||||
shutdown: builtins.shutdown,
|
||||
})?;
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -388,9 +491,48 @@ fn verify_brightness(brightness: f32) {
|
||||
}
|
||||
}
|
||||
|
||||
fn handle_slash(conn: &Connection, cmd: &SlashCommand) -> Result<(), Box<dyn std::error::Error>> {
|
||||
if (cmd.brightness.is_none()
|
||||
&& cmd.interval.is_none()
|
||||
&& cmd.slash_mode.is_none()
|
||||
&& !cmd.list
|
||||
&& !cmd.enable
|
||||
&& !cmd.disable)
|
||||
|| cmd.help
|
||||
{
|
||||
println!("Missing arg or command\n\n{}", cmd.self_usage());
|
||||
if let Some(lst) = cmd.self_command_list() {
|
||||
println!("\n{}", lst);
|
||||
}
|
||||
}
|
||||
let proxy = SlashProxyBlocking::new(conn)?;
|
||||
if cmd.enable {
|
||||
proxy.set_enabled(true)?;
|
||||
}
|
||||
if cmd.disable {
|
||||
proxy.set_enabled(false)?;
|
||||
}
|
||||
if let Some(brightness) = cmd.brightness {
|
||||
proxy.set_brightness(brightness)?;
|
||||
}
|
||||
if let Some(interval) = cmd.interval {
|
||||
proxy.set_interval(interval)?;
|
||||
}
|
||||
if let Some(slash_mode) = cmd.slash_mode {
|
||||
proxy.set_slash_mode(slash_mode)?;
|
||||
}
|
||||
if cmd.list {
|
||||
let res = SlashMode::list();
|
||||
for p in &res {
|
||||
println!("{:?}", p);
|
||||
}
|
||||
}
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
fn handle_led_mode(
|
||||
dbus: &RogDbusClientBlocking<'_>,
|
||||
supported: &LedSupportedFunctions,
|
||||
aura: &[AuraProxyBlocking],
|
||||
mode: &LedModeCommand,
|
||||
) -> Result<(), Box<dyn std::error::Error>> {
|
||||
if mode.command.is_none() && !mode.prev_mode && !mode.next_mode {
|
||||
@@ -402,8 +544,10 @@ fn handle_led_mode(
|
||||
|
||||
if let Some(cmdlist) = LedModeCommand::command_list() {
|
||||
let commands: Vec<String> = cmdlist.lines().map(|s| s.to_owned()).collect();
|
||||
// TODO: multiple rgb check
|
||||
let modes = aura.first().unwrap().supported_basic_modes()?;
|
||||
for command in commands.iter().filter(|command| {
|
||||
for mode in &supported.basic_modes {
|
||||
for mode in &modes {
|
||||
if command
|
||||
.trim()
|
||||
.starts_with(&<&str>::from(mode).to_lowercase())
|
||||
@@ -411,9 +555,10 @@ fn handle_led_mode(
|
||||
return true;
|
||||
}
|
||||
}
|
||||
if !supported.basic_zones.is_empty() && command.trim().starts_with("multi") {
|
||||
return true;
|
||||
}
|
||||
// TODO
|
||||
// if !supported.basic_zones.is_empty() && command.trim().starts_with("multi") {
|
||||
// return true;
|
||||
// }
|
||||
false
|
||||
}) {
|
||||
println!("{}", command);
|
||||
@@ -429,51 +574,67 @@ fn handle_led_mode(
|
||||
return Ok(());
|
||||
}
|
||||
if mode.next_mode {
|
||||
dbus.proxies().led().next_led_mode()?;
|
||||
for aura in aura {
|
||||
let mode = aura.led_mode()?;
|
||||
let modes = aura.supported_basic_modes()?;
|
||||
let mut pos = modes.iter().position(|m| *m == mode).unwrap() + 1;
|
||||
if pos >= modes.len() {
|
||||
pos = 0;
|
||||
}
|
||||
aura.set_led_mode(modes[pos])?;
|
||||
}
|
||||
} else if mode.prev_mode {
|
||||
dbus.proxies().led().prev_led_mode()?;
|
||||
for aura in aura {
|
||||
let mode = aura.led_mode()?;
|
||||
let modes = aura.supported_basic_modes()?;
|
||||
let mut pos = modes.iter().position(|m| *m == mode).unwrap();
|
||||
if pos == 0 {
|
||||
pos = modes.len() - 1;
|
||||
} else {
|
||||
pos -= 1;
|
||||
}
|
||||
aura.set_led_mode(modes[pos])?;
|
||||
}
|
||||
} else if let Some(mode) = mode.command.as_ref() {
|
||||
if mode.help_requested() {
|
||||
println!("{}", mode.self_usage());
|
||||
return Ok(());
|
||||
}
|
||||
dbus.proxies()
|
||||
.led()
|
||||
.set_led_mode(&<AuraEffect>::from(mode))?;
|
||||
for aura in aura {
|
||||
aura.set_led_mode_data(<AuraEffect>::from(mode))?;
|
||||
}
|
||||
}
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
fn handle_led_power1(
|
||||
dbus: &RogDbusClientBlocking<'_>,
|
||||
supported: &LedSupportedFunctions,
|
||||
aura: &[AuraProxyBlocking],
|
||||
power: &LedPowerCommand1,
|
||||
) -> Result<(), Box<dyn std::error::Error>> {
|
||||
if power.awake.is_none()
|
||||
&& power.sleep.is_none()
|
||||
&& power.boot.is_none()
|
||||
&& power.keyboard.is_none()
|
||||
&& power.lightbar.is_none()
|
||||
{
|
||||
if !power.help {
|
||||
println!("Missing arg or command\n");
|
||||
for aura in aura {
|
||||
let dev_type = aura.device_type()?;
|
||||
if !dev_type.is_old_laptop() && !dev_type.is_tuf_laptop() {
|
||||
println!("This option applies only to keyboards 2021+");
|
||||
}
|
||||
println!("{}\n", power.self_usage());
|
||||
return Ok(());
|
||||
}
|
||||
|
||||
if matches!(
|
||||
supported.dev_id,
|
||||
AuraDevice::X1854 | AuraDevice::X1869 | AuraDevice::X1866
|
||||
) {
|
||||
handle_led_power_1_do_1866(dbus, power)?;
|
||||
return Ok(());
|
||||
}
|
||||
if power.awake.is_none()
|
||||
&& power.sleep.is_none()
|
||||
&& power.boot.is_none()
|
||||
&& !power.keyboard
|
||||
&& !power.lightbar
|
||||
{
|
||||
if !power.help {
|
||||
println!("Missing arg or command\n");
|
||||
}
|
||||
println!("{}\n", power.self_usage());
|
||||
return Ok(());
|
||||
}
|
||||
|
||||
if matches!(supported.dev_id, AuraDevice::Tuf) {
|
||||
handle_led_power_1_do_tuf(dbus, power)?;
|
||||
return Ok(());
|
||||
if dev_type.is_old_laptop() || dev_type.is_tuf_laptop() {
|
||||
handle_led_power_1_do_1866(aura, power)?;
|
||||
return Ok(());
|
||||
}
|
||||
}
|
||||
|
||||
println!("These options are for keyboards of product ID 0x1866 or TUF only");
|
||||
@@ -481,143 +642,105 @@ fn handle_led_power1(
|
||||
}
|
||||
|
||||
fn handle_led_power_1_do_1866(
|
||||
dbus: &RogDbusClientBlocking<'_>,
|
||||
aura: &AuraProxyBlocking,
|
||||
power: &LedPowerCommand1,
|
||||
) -> Result<(), Box<dyn std::error::Error>> {
|
||||
let mut enabled: Vec<AuraDevRog1> = Vec::new();
|
||||
let mut disabled: Vec<AuraDevRog1> = Vec::new();
|
||||
|
||||
let mut check = |e: Option<bool>, a: AuraDevRog1| {
|
||||
if let Some(arg) = e {
|
||||
if arg {
|
||||
enabled.push(a);
|
||||
} else {
|
||||
disabled.push(a);
|
||||
}
|
||||
}
|
||||
};
|
||||
|
||||
check(power.awake, AuraDevRog1::Awake);
|
||||
check(power.boot, AuraDevRog1::Boot);
|
||||
check(power.sleep, AuraDevRog1::Sleep);
|
||||
check(power.keyboard, AuraDevRog1::Keyboard);
|
||||
check(power.lightbar, AuraDevRog1::Lightbar);
|
||||
|
||||
let data = AuraPowerDev {
|
||||
old_rog: enabled,
|
||||
..Default::default()
|
||||
};
|
||||
dbus.proxies().led().set_led_power(data, true)?;
|
||||
|
||||
let data = AuraPowerDev {
|
||||
old_rog: disabled,
|
||||
..Default::default()
|
||||
};
|
||||
dbus.proxies().led().set_led_power(data, false)?;
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
fn handle_led_power_1_do_tuf(
|
||||
dbus: &RogDbusClientBlocking<'_>,
|
||||
power: &LedPowerCommand1,
|
||||
) -> Result<(), Box<dyn std::error::Error>> {
|
||||
let mut enabled: Vec<AuraDevTuf> = Vec::new();
|
||||
let mut disabled: Vec<AuraDevTuf> = Vec::new();
|
||||
|
||||
let mut check = |e: Option<bool>, a: AuraDevTuf| {
|
||||
if let Some(arg) = e {
|
||||
if arg {
|
||||
enabled.push(a);
|
||||
} else {
|
||||
disabled.push(a);
|
||||
}
|
||||
}
|
||||
};
|
||||
|
||||
check(power.awake, AuraDevTuf::Awake);
|
||||
check(power.boot, AuraDevTuf::Boot);
|
||||
check(power.sleep, AuraDevTuf::Sleep);
|
||||
check(power.keyboard, AuraDevTuf::Keyboard);
|
||||
|
||||
let data = AuraPowerDev {
|
||||
tuf: enabled,
|
||||
..Default::default()
|
||||
};
|
||||
dbus.proxies().led().set_led_power(data, true)?;
|
||||
|
||||
let data = AuraPowerDev {
|
||||
tuf: disabled,
|
||||
..Default::default()
|
||||
};
|
||||
dbus.proxies().led().set_led_power(data, false)?;
|
||||
let mut states = Vec::new();
|
||||
if power.keyboard {
|
||||
states.push(AuraPowerState {
|
||||
zone: PowerZones::Keyboard,
|
||||
boot: power.boot.unwrap_or_default(),
|
||||
awake: power.awake.unwrap_or_default(),
|
||||
sleep: power.sleep.unwrap_or_default(),
|
||||
shutdown: false,
|
||||
});
|
||||
}
|
||||
if power.lightbar {
|
||||
states.push(AuraPowerState {
|
||||
zone: PowerZones::Lightbar,
|
||||
boot: power.boot.unwrap_or_default(),
|
||||
awake: power.awake.unwrap_or_default(),
|
||||
sleep: power.sleep.unwrap_or_default(),
|
||||
shutdown: false,
|
||||
});
|
||||
}
|
||||
|
||||
let states = LaptopAuraPower { states };
|
||||
aura.set_led_power(states)?;
|
||||
Ok(())
|
||||
}
|
||||
|
||||
fn handle_led_power2(
|
||||
dbus: &RogDbusClientBlocking<'_>,
|
||||
supported: &LedSupportedFunctions,
|
||||
aura: &[AuraProxyBlocking],
|
||||
power: &LedPowerCommand2,
|
||||
) -> Result<(), Box<dyn std::error::Error>> {
|
||||
if power.command().is_none() {
|
||||
if !power.help {
|
||||
println!("Missing arg or command\n");
|
||||
for aura in aura {
|
||||
let dev_type = aura.device_type()?;
|
||||
if !dev_type.is_new_laptop() {
|
||||
println!("This option applies only to keyboards 2021+");
|
||||
continue;
|
||||
}
|
||||
println!("{}\n", power.self_usage());
|
||||
println!("Commands available");
|
||||
|
||||
if let Some(cmdlist) = LedPowerCommand2::command_list() {
|
||||
let commands: Vec<String> = cmdlist.lines().map(|s| s.to_owned()).collect();
|
||||
for command in &commands {
|
||||
println!("{}", command);
|
||||
if power.command().is_none() {
|
||||
if !power.help {
|
||||
println!("Missing arg or command\n");
|
||||
}
|
||||
}
|
||||
println!("{}\n", power.self_usage());
|
||||
println!("Commands available");
|
||||
|
||||
println!("\nHelp can also be requested on commands, e.g: boot --help");
|
||||
return Ok(());
|
||||
}
|
||||
if let Some(cmdlist) = LedPowerCommand2::command_list() {
|
||||
let commands: Vec<String> = cmdlist.lines().map(|s| s.to_owned()).collect();
|
||||
for command in &commands {
|
||||
println!("{}", command);
|
||||
}
|
||||
}
|
||||
|
||||
if let Some(pow) = power.command.as_ref() {
|
||||
if pow.help_requested() {
|
||||
println!("{}", pow.self_usage());
|
||||
println!("\nHelp can also be requested on commands, e.g: boot --help");
|
||||
return Ok(());
|
||||
}
|
||||
|
||||
if supported.dev_id != AuraDevice::X19b6 {
|
||||
println!("This option applies only to keyboards with product ID 0x19b6");
|
||||
}
|
||||
|
||||
let set = |power: &mut KbAuraPowerState, set_to: &AuraPowerStates| {
|
||||
power.boot = set_to.boot;
|
||||
power.awake = set_to.awake;
|
||||
power.sleep = set_to.sleep;
|
||||
power.shutdown = set_to.shutdown;
|
||||
};
|
||||
|
||||
let mut enabled = dbus.proxies().led().led_power()?;
|
||||
if let Some(cmd) = &power.command {
|
||||
match cmd {
|
||||
aura_cli::SetAuraZoneEnabled::Keyboard(k) => set(&mut enabled.rog.keyboard, k),
|
||||
aura_cli::SetAuraZoneEnabled::Logo(l) => set(&mut enabled.rog.logo, l),
|
||||
aura_cli::SetAuraZoneEnabled::Lightbar(l) => set(&mut enabled.rog.lightbar, l),
|
||||
aura_cli::SetAuraZoneEnabled::Lid(l) => set(&mut enabled.rog.lid, l),
|
||||
aura_cli::SetAuraZoneEnabled::RearGlow(r) => set(&mut enabled.rog.rear_glow, r),
|
||||
if let Some(pow) = power.command.as_ref() {
|
||||
if pow.help_requested() {
|
||||
println!("{}", pow.self_usage());
|
||||
return Ok(());
|
||||
}
|
||||
}
|
||||
|
||||
dbus.proxies().led().set_led_power(enabled, true)?;
|
||||
let mut states = aura.led_power()?;
|
||||
let mut set = |zone: PowerZones, set_to: &AuraPowerStates| {
|
||||
for state in states.states.iter_mut() {
|
||||
if state.zone == zone {
|
||||
state.boot = set_to.boot;
|
||||
state.awake = set_to.awake;
|
||||
state.sleep = set_to.sleep;
|
||||
state.shutdown = set_to.shutdown;
|
||||
break;
|
||||
}
|
||||
}
|
||||
};
|
||||
|
||||
if let Some(cmd) = &power.command {
|
||||
match cmd {
|
||||
aura_cli::SetAuraZoneEnabled::Keyboard(k) => set(PowerZones::Keyboard, k),
|
||||
aura_cli::SetAuraZoneEnabled::Logo(l) => set(PowerZones::Logo, l),
|
||||
aura_cli::SetAuraZoneEnabled::Lightbar(l) => set(PowerZones::Lightbar, l),
|
||||
aura_cli::SetAuraZoneEnabled::Lid(l) => set(PowerZones::Lid, l),
|
||||
aura_cli::SetAuraZoneEnabled::RearGlow(r) => set(PowerZones::RearGlow, r),
|
||||
}
|
||||
}
|
||||
|
||||
aura.set_led_power(states)?;
|
||||
}
|
||||
}
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
fn handle_profile(
|
||||
dbus: &RogDbusClientBlocking<'_>,
|
||||
supported: &PlatformProfileFunctions,
|
||||
fn handle_throttle_profile(
|
||||
conn: &Connection,
|
||||
supported: &[Properties],
|
||||
cmd: &ProfileCommand,
|
||||
) -> Result<(), Box<dyn std::error::Error>> {
|
||||
if !supported.platform_profile {
|
||||
if !supported.contains(&Properties::ThrottlePolicy) {
|
||||
println!("Profiles not supported by either this kernel or by the laptop.");
|
||||
return Err(ProfileError::NotSupported.into());
|
||||
}
|
||||
@@ -634,35 +757,36 @@ fn handle_profile(
|
||||
return Ok(());
|
||||
}
|
||||
|
||||
let proxy = PlatformProxyBlocking::new(conn)?;
|
||||
let current = proxy.throttle_thermal_policy()?;
|
||||
|
||||
if cmd.next {
|
||||
dbus.proxies().profile().next_profile()?;
|
||||
proxy.set_throttle_thermal_policy(current.next())?;
|
||||
} else if let Some(profile) = cmd.profile_set {
|
||||
dbus.proxies().profile().set_active_profile(profile)?;
|
||||
proxy.set_throttle_thermal_policy(profile)?;
|
||||
}
|
||||
|
||||
if cmd.list {
|
||||
let res = dbus.proxies().profile().profiles()?;
|
||||
let res = ThrottlePolicy::list();
|
||||
for p in &res {
|
||||
println!("{:?}", p);
|
||||
}
|
||||
}
|
||||
|
||||
if cmd.profile_get {
|
||||
let res = dbus.proxies().profile().active_profile()?;
|
||||
println!("Active profile is {:?}", res);
|
||||
println!("Active profile is {current:?}");
|
||||
}
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
fn handle_fan_curve(
|
||||
dbus: &RogDbusClientBlocking<'_>,
|
||||
supported: &PlatformProfileFunctions,
|
||||
conn: &Connection,
|
||||
supported: &[String],
|
||||
cmd: &FanCurveCommand,
|
||||
) -> Result<(), Box<dyn std::error::Error>> {
|
||||
if supported.fans.is_empty() {
|
||||
if !supported.contains(&FAN_CURVE_ZBUS_NAME.to_string()) {
|
||||
println!("Fan-curves not supported by either this kernel or by the laptop.");
|
||||
println!("This requires kernel 5.17 or the fan curve patch listed in the readme.");
|
||||
return Err(ProfileError::NotSupported.into());
|
||||
}
|
||||
|
||||
@@ -678,49 +802,66 @@ fn handle_fan_curve(
|
||||
return Ok(());
|
||||
}
|
||||
|
||||
if (cmd.enabled.is_some() || cmd.fan.is_some() || cmd.data.is_some())
|
||||
if (cmd.enable_fan_curves.is_some() || cmd.fan.is_some() || cmd.data.is_some())
|
||||
&& cmd.mod_profile.is_none()
|
||||
{
|
||||
println!("--enabled, --fan, and --data options require --mod-profile");
|
||||
println!(
|
||||
"--enable-fan-curves, --enable-fan-curve, --fan, and --data options require \
|
||||
--mod-profile"
|
||||
);
|
||||
return Ok(());
|
||||
}
|
||||
|
||||
let plat_proxy = PlatformProxyBlocking::new(conn)?;
|
||||
let fan_proxy = FanCurvesProxyBlocking::new(conn)?;
|
||||
if cmd.get_enabled {
|
||||
// TODO:
|
||||
// let res = dbus.proxies().profile().enabled_fan_profiles()?;
|
||||
// println!("{:?}", res);
|
||||
let profile = plat_proxy.throttle_thermal_policy()?;
|
||||
let curves = fan_proxy.fan_curve_data(profile)?;
|
||||
for curve in curves.iter() {
|
||||
println!("{}", String::from(curve));
|
||||
}
|
||||
}
|
||||
|
||||
if cmd.default {
|
||||
dbus.proxies().profile().set_active_curve_to_defaults()?;
|
||||
let active = plat_proxy.throttle_thermal_policy()?;
|
||||
fan_proxy.set_curves_to_defaults(active)?;
|
||||
}
|
||||
|
||||
if let Some(profile) = cmd.mod_profile {
|
||||
if cmd.enabled.is_none() && cmd.data.is_none() {
|
||||
let data = dbus.proxies().profile().fan_curve_data(profile)?;
|
||||
let data = toml::to_string(&data)?;
|
||||
println!("\nFan curves for {:?}\n\n{}", profile, data);
|
||||
if cmd.enable_fan_curves.is_none() && cmd.data.is_none() {
|
||||
let data = fan_proxy.fan_curve_data(profile)?;
|
||||
let ron = ron::ser::to_string_pretty(&data, PrettyConfig::new().depth_limit(4))?;
|
||||
println!("\nFan curves for {:?}\n\n{}", profile, ron);
|
||||
}
|
||||
|
||||
if let Some(enabled) = cmd.enabled {
|
||||
dbus.proxies()
|
||||
.profile()
|
||||
.set_fan_curves_enabled(profile, enabled)?;
|
||||
if let Some(enabled) = cmd.enable_fan_curves {
|
||||
fan_proxy.set_fan_curves_enabled(profile, enabled)?;
|
||||
}
|
||||
|
||||
if let Some(enabled) = cmd.enable_fan_curve {
|
||||
if let Some(fan) = cmd.fan {
|
||||
fan_proxy.set_profile_fan_curve_enabled(profile, fan, enabled)?;
|
||||
} else {
|
||||
println!(
|
||||
"--enable-fan-curves, --enable-fan-curve, --fan, and --data options require \
|
||||
--mod-profile"
|
||||
);
|
||||
}
|
||||
}
|
||||
|
||||
if let Some(mut curve) = cmd.data.clone() {
|
||||
let fan = cmd.fan.unwrap_or_default();
|
||||
curve.set_fan(fan);
|
||||
dbus.proxies().profile().set_fan_curve(profile, curve)?;
|
||||
fan_proxy.set_fan_curve(profile, curve)?;
|
||||
}
|
||||
}
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
fn handle_bios_option(
|
||||
dbus: &RogDbusClientBlocking<'_>,
|
||||
supported: &RogBiosSupportedFunctions,
|
||||
fn handle_platform_properties(
|
||||
conn: &Connection,
|
||||
supported: &[Properties],
|
||||
cmd: &BiosCommand,
|
||||
) -> Result<(), Box<dyn std::error::Error>> {
|
||||
{
|
||||
@@ -737,42 +878,42 @@ fn handle_bios_option(
|
||||
let usage: Vec<String> = BiosCommand::usage().lines().map(|s| s.to_owned()).collect();
|
||||
|
||||
for line in usage.iter().filter(|line| {
|
||||
line.contains("sound") && supported.post_sound
|
||||
|| line.contains("GPU") && supported.gpu_mux
|
||||
|| line.contains("panel") && supported.panel_overdrive
|
||||
line.contains("sound") && supported.contains(&Properties::PostAnimationSound)
|
||||
|| line.contains("GPU") && supported.contains(&Properties::GpuMuxMode)
|
||||
|| line.contains("panel") && supported.contains(&Properties::PanelOd)
|
||||
}) {
|
||||
println!("{}", line);
|
||||
}
|
||||
}
|
||||
|
||||
let proxy = PlatformProxyBlocking::new(conn)?;
|
||||
|
||||
if let Some(opt) = cmd.post_sound_set {
|
||||
dbus.proxies().rog_bios().set_post_boot_sound(opt)?;
|
||||
proxy.set_boot_sound(opt)?;
|
||||
}
|
||||
if cmd.post_sound_get {
|
||||
let res = dbus.proxies().rog_bios().post_boot_sound()? == 1;
|
||||
let res = proxy.boot_sound()?;
|
||||
println!("Bios POST sound on: {}", res);
|
||||
}
|
||||
|
||||
if let Some(opt) = cmd.gpu_mux_mode_set {
|
||||
println!("Rebuilding initrd to include drivers");
|
||||
dbus.proxies()
|
||||
.rog_bios()
|
||||
.set_gpu_mux_mode(GpuMode::from_mux(opt))?;
|
||||
proxy.set_gpu_mux_mode(GpuMode::from_mux(opt))?;
|
||||
println!(
|
||||
"The mode change is not active until you reboot, on boot the bios will make the \
|
||||
required change"
|
||||
);
|
||||
}
|
||||
if cmd.gpu_mux_mode_get {
|
||||
let res = dbus.proxies().rog_bios().gpu_mux_mode()?;
|
||||
let res = proxy.gpu_mux_mode()?;
|
||||
println!("Bios GPU MUX: {:?}", res);
|
||||
}
|
||||
|
||||
if let Some(opt) = cmd.panel_overdrive_set {
|
||||
dbus.proxies().rog_bios().set_panel_od(opt)?;
|
||||
proxy.set_panel_od(opt)?;
|
||||
}
|
||||
if cmd.panel_overdrive_get {
|
||||
let res = dbus.proxies().rog_bios().panel_od()?;
|
||||
let res = proxy.panel_od()?;
|
||||
println!("Panel overdrive on: {}", res);
|
||||
}
|
||||
}
|
||||
|
||||
@@ -1,52 +0,0 @@
|
||||
use gumdrop::Options;
|
||||
use rog_profiles::fan_curve_set::CurveData;
|
||||
use rog_profiles::{FanCurvePU, Profile};
|
||||
|
||||
#[derive(Debug, Clone, Options)]
|
||||
pub struct ProfileCommand {
|
||||
#[options(help = "print help message")]
|
||||
pub help: bool,
|
||||
#[options(help = "toggle to next profile in list")]
|
||||
pub next: bool,
|
||||
#[options(help = "list available profiles")]
|
||||
pub list: bool,
|
||||
|
||||
#[options(help = "get profile")]
|
||||
pub profile_get: bool,
|
||||
#[options(meta = "", help = "set the active profile")]
|
||||
pub profile_set: Option<Profile>,
|
||||
}
|
||||
|
||||
#[derive(Debug, Clone, Options)]
|
||||
pub struct FanCurveCommand {
|
||||
#[options(help = "print help message")]
|
||||
pub help: bool,
|
||||
|
||||
#[options(help = "get enabled fan profiles")]
|
||||
pub get_enabled: bool,
|
||||
#[options(help = "set the active profile's fan curve to default")]
|
||||
pub default: bool,
|
||||
|
||||
#[options(
|
||||
meta = "",
|
||||
help = "profile to modify fan-curve for. Shows data if no options provided"
|
||||
)]
|
||||
pub mod_profile: Option<Profile>,
|
||||
#[options(
|
||||
meta = "",
|
||||
help = "enable or disable <true/false> fan curve. `mod_profile` required"
|
||||
)]
|
||||
pub enabled: Option<bool>,
|
||||
#[options(
|
||||
meta = "",
|
||||
help = "select fan <cpu/gpu/mid> to modify. `mod_profile` required"
|
||||
)]
|
||||
pub fan: Option<FanCurvePU>,
|
||||
|
||||
#[options(
|
||||
meta = "",
|
||||
help = "data format = 30c:1%,49c:2%,59c:3%,69c:4%,79c:31%,89c:49%,99c:56%,109c:58%.
|
||||
`--mod-profile` required. If '%' is omitted the fan range is 0-255"
|
||||
)]
|
||||
pub data: Option<CurveData>,
|
||||
}
|
||||
20
asusctl/src/slash_cli.rs
Normal file
20
asusctl/src/slash_cli.rs
Normal file
@@ -0,0 +1,20 @@
|
||||
use gumdrop::Options;
|
||||
use rog_slash::SlashMode;
|
||||
|
||||
#[derive(Options)]
|
||||
pub struct SlashCommand {
|
||||
#[options(help = "print help message")]
|
||||
pub help: bool,
|
||||
#[options(help = "Enable the Slash Ledbar")]
|
||||
pub enable: bool,
|
||||
#[options(help = "Ddisable the Slash Ledbar")]
|
||||
pub disable: bool,
|
||||
#[options(meta = "", help = "Set brightness value <0-255>")]
|
||||
pub brightness: Option<u8>,
|
||||
#[options(meta = "", help = "Set interval value <0-255>")]
|
||||
pub interval: Option<u8>,
|
||||
#[options(help = "Set SlashMode (so 'list' for all options)")]
|
||||
pub slash_mode: Option<SlashMode>,
|
||||
#[options(help = "list available animations")]
|
||||
pub list: bool,
|
||||
}
|
||||
@@ -1,10 +1,12 @@
|
||||
[package]
|
||||
name = "asusd-user"
|
||||
license = "MPL-2.0"
|
||||
license.workspace = true
|
||||
version.workspace = true
|
||||
authors = ["Luke D Jones <luke@ljones.dev>"]
|
||||
edition = "2021"
|
||||
description = "Usermode daemon for user settings, anime, per-key lighting"
|
||||
readme.workspace = true
|
||||
authors.workspace = true
|
||||
repository.workspace = true
|
||||
homepage.workspace = true
|
||||
edition.workspace = true
|
||||
|
||||
[[bin]]
|
||||
name = "asusd-user"
|
||||
@@ -16,8 +18,8 @@ smol.workspace = true
|
||||
|
||||
# serialisation
|
||||
serde.workspace = true
|
||||
serde_json.workspace = true
|
||||
serde_derive.workspace = true
|
||||
ron.workspace = true
|
||||
|
||||
rog_anime = { path = "../rog-anime" }
|
||||
rog_aura = { path = "../rog-aura" }
|
||||
@@ -26,10 +28,10 @@ rog_platform = { path = "../rog-platform" }
|
||||
config-traits = { path = "../config-traits" }
|
||||
|
||||
zbus.workspace = true
|
||||
|
||||
# cli and logging
|
||||
log.workspace = true
|
||||
env_logger.workspace = true
|
||||
|
||||
[dev-dependencies]
|
||||
cargo-husky.workspace = true
|
||||
cargo-husky.workspace = true
|
||||
|
||||
[package.metadata.cargo-machete]
|
||||
ignored = ["serde"]
|
||||
|
||||
@@ -3,8 +3,8 @@ use std::time::Duration;
|
||||
|
||||
use config_traits::{StdConfig, StdConfigLoad};
|
||||
use rog_anime::{ActionLoader, AnimTime, AnimeType, Fade, Sequences as AnimeSequences, Vec2};
|
||||
use rog_aura::advanced::LedCode;
|
||||
use rog_aura::effects::{AdvancedEffects as AuraSequences, Breathe, DoomFlicker, Effect, Static};
|
||||
use rog_aura::keyboard::LedCode;
|
||||
use rog_aura::{Colour, Speed};
|
||||
use serde_derive::{Deserialize, Serialize};
|
||||
|
||||
|
||||
@@ -7,9 +7,10 @@ use std::time::{Duration, Instant};
|
||||
use config_traits::StdConfig;
|
||||
use rog_anime::error::AnimeError;
|
||||
use rog_anime::{ActionData, ActionLoader, AnimTime, Fade, Sequences, Vec2};
|
||||
use rog_dbus::RogDbusClientBlocking;
|
||||
use rog_dbus::zbus_anime::AnimeProxyBlocking;
|
||||
use ron::ser::PrettyConfig;
|
||||
use serde_derive::{Deserialize, Serialize};
|
||||
use zbus::dbus_interface;
|
||||
use zbus::interface;
|
||||
use zbus::zvariant::{ObjectPath, Type};
|
||||
|
||||
use crate::config::ConfigAnime;
|
||||
@@ -61,14 +62,14 @@ pub enum TimeType {
|
||||
/// thread and a zbus server behind `Arc<Mutex<T>>`
|
||||
pub struct CtrlAnimeInner<'a> {
|
||||
sequences: Sequences,
|
||||
client: RogDbusClientBlocking<'a>,
|
||||
client: AnimeProxyBlocking<'a>,
|
||||
do_early_return: Arc<AtomicBool>,
|
||||
}
|
||||
|
||||
impl<'a> CtrlAnimeInner<'static> {
|
||||
pub fn new(
|
||||
sequences: Sequences,
|
||||
client: RogDbusClientBlocking<'static>,
|
||||
client: AnimeProxyBlocking<'static>,
|
||||
do_early_return: Arc<AtomicBool>,
|
||||
) -> Result<Self, Error> {
|
||||
Ok(Self {
|
||||
@@ -93,19 +94,13 @@ impl<'a> CtrlAnimeInner<'static> {
|
||||
return Ok(true); // Do safe exit
|
||||
}
|
||||
self.client
|
||||
.proxies()
|
||||
.anime()
|
||||
.write(output)
|
||||
.map_err(|e| AnimeError::Dbus(format!("{}", e)))
|
||||
.map(|_| false)
|
||||
});
|
||||
}
|
||||
ActionData::Image(image) => {
|
||||
self.client
|
||||
.proxies()
|
||||
.anime()
|
||||
.write(image.as_ref().clone())
|
||||
.ok();
|
||||
self.client.write(image.as_ref().clone()).ok();
|
||||
}
|
||||
ActionData::Pause(duration) => {
|
||||
let start = Instant::now();
|
||||
@@ -132,7 +127,7 @@ impl<'a> CtrlAnimeInner<'static> {
|
||||
|
||||
pub struct CtrlAnime<'a> {
|
||||
config: Arc<Mutex<ConfigAnime>>,
|
||||
client: RogDbusClientBlocking<'a>,
|
||||
client: AnimeProxyBlocking<'a>,
|
||||
inner: Arc<Mutex<CtrlAnimeInner<'a>>>,
|
||||
/// Must be the same Atomic as in CtrlAnimeInner
|
||||
inner_early_return: Arc<AtomicBool>,
|
||||
@@ -142,7 +137,7 @@ impl CtrlAnime<'static> {
|
||||
pub fn new(
|
||||
config: Arc<Mutex<ConfigAnime>>,
|
||||
inner: Arc<Mutex<CtrlAnimeInner<'static>>>,
|
||||
client: RogDbusClientBlocking<'static>,
|
||||
client: AnimeProxyBlocking<'static>,
|
||||
inner_early_return: Arc<AtomicBool>,
|
||||
) -> Result<Self, Error> {
|
||||
Ok(CtrlAnime {
|
||||
@@ -175,7 +170,7 @@ impl CtrlAnime<'static> {
|
||||
// - Do actions
|
||||
// - Write config if required
|
||||
// - Unset inner_early_return
|
||||
#[dbus_interface(name = "org.asuslinux.Daemon")]
|
||||
#[interface(name = "org.asuslinux.Daemon")]
|
||||
impl CtrlAnime<'static> {
|
||||
pub fn insert_asus_gif(
|
||||
&mut self,
|
||||
@@ -205,11 +200,12 @@ impl CtrlAnime<'static> {
|
||||
config.anime.push(action);
|
||||
config.write();
|
||||
|
||||
let json = serde_json::to_string_pretty(&*config).expect("Parse config to JSON failed");
|
||||
let ron = ron::ser::to_string_pretty(&*config, PrettyConfig::new().depth_limit(4))
|
||||
.expect("Parse config to RON failed");
|
||||
|
||||
// Release the inner run loop again
|
||||
self.inner_early_return.store(false, Ordering::SeqCst);
|
||||
return Ok(json);
|
||||
return Ok(ron);
|
||||
}
|
||||
Err(zbus::fdo::Error::Failed("UserConfig lock fail".into()))
|
||||
}
|
||||
@@ -250,12 +246,11 @@ impl CtrlAnime<'static> {
|
||||
config.anime.push(action);
|
||||
config.write();
|
||||
|
||||
let json =
|
||||
serde_json::to_string_pretty(&*config.anime).expect("Parse config to JSON failed");
|
||||
|
||||
let ron = ron::ser::to_string_pretty(&*config, PrettyConfig::new().depth_limit(4))
|
||||
.expect("Parse config to RON failed");
|
||||
// Release the inner run loop again
|
||||
self.inner_early_return.store(false, Ordering::SeqCst);
|
||||
return Ok(json);
|
||||
return Ok(ron);
|
||||
}
|
||||
Err(zbus::fdo::Error::Failed("UserConfig lock fail".into()))
|
||||
}
|
||||
@@ -295,12 +290,11 @@ impl CtrlAnime<'static> {
|
||||
config.anime.push(action);
|
||||
config.write();
|
||||
|
||||
let json =
|
||||
serde_json::to_string_pretty(&*config.anime).expect("Parse config to JSON failed");
|
||||
|
||||
let ron = ron::ser::to_string_pretty(&*config, PrettyConfig::new().depth_limit(4))
|
||||
.expect("Parse config to RON failed");
|
||||
// Release the inner run loop again
|
||||
self.inner_early_return.store(false, Ordering::SeqCst);
|
||||
return Ok(json);
|
||||
return Ok(ron);
|
||||
}
|
||||
Err(zbus::fdo::Error::Failed("UserConfig lock fail".into()))
|
||||
}
|
||||
@@ -320,12 +314,11 @@ impl CtrlAnime<'static> {
|
||||
config.anime.push(action);
|
||||
config.write();
|
||||
|
||||
let json =
|
||||
serde_json::to_string_pretty(&*config.anime).expect("Parse config to JSON failed");
|
||||
|
||||
let ron = ron::ser::to_string_pretty(&*config, PrettyConfig::new().depth_limit(4))
|
||||
.expect("Parse config to RON failed");
|
||||
// Release the inner run loop again
|
||||
self.inner_early_return.store(false, Ordering::SeqCst);
|
||||
return Ok(json);
|
||||
return Ok(ron);
|
||||
}
|
||||
Err(zbus::fdo::Error::Failed("UserConfig lock fail".into()))
|
||||
}
|
||||
@@ -343,12 +336,11 @@ impl CtrlAnime<'static> {
|
||||
}
|
||||
config.write();
|
||||
|
||||
let json =
|
||||
serde_json::to_string_pretty(&*config.anime).expect("Parse config to JSON failed");
|
||||
|
||||
let ron = ron::ser::to_string_pretty(&*config, PrettyConfig::new().depth_limit(4))
|
||||
.expect("Parse config to RON failed");
|
||||
// Release the inner run loop again
|
||||
self.inner_early_return.store(false, Ordering::SeqCst);
|
||||
return Ok(json);
|
||||
return Ok(ron);
|
||||
}
|
||||
Err(zbus::fdo::Error::Failed("UserConfig lock fail".into()))
|
||||
}
|
||||
@@ -356,13 +348,13 @@ impl CtrlAnime<'static> {
|
||||
pub fn set_state(&mut self, on: bool) -> zbus::fdo::Result<()> {
|
||||
// Operations here need to be in specific order
|
||||
if on {
|
||||
self.client.proxies().anime().set_enable_display(on).ok();
|
||||
self.client.set_enable_display(on).ok();
|
||||
// Let the inner loop run
|
||||
self.inner_early_return.store(false, Ordering::SeqCst);
|
||||
} else {
|
||||
// Must make the inner run loop return early
|
||||
self.inner_early_return.store(true, Ordering::SeqCst);
|
||||
self.client.proxies().anime().set_enable_display(on).ok();
|
||||
self.client.set_enable_display(on).ok();
|
||||
}
|
||||
Ok(())
|
||||
}
|
||||
|
||||
@@ -5,12 +5,14 @@ use std::sync::{Arc, Mutex};
|
||||
|
||||
use asusd_user::config::*;
|
||||
use asusd_user::ctrl_anime::{CtrlAnime, CtrlAnimeInner};
|
||||
use asusd_user::DBUS_NAME;
|
||||
use config_traits::{StdConfig, StdConfigLoad};
|
||||
use rog_anime::usb::get_anime_type;
|
||||
use rog_aura::aura_detection::LaptopLedData;
|
||||
use rog_aura::layouts::KeyLayout;
|
||||
use rog_dbus::RogDbusClientBlocking;
|
||||
use rog_aura::aura_detection::LedSupportData;
|
||||
use rog_aura::keyboard::KeyLayout;
|
||||
use rog_dbus::zbus_anime::AnimeProxyBlocking;
|
||||
use rog_dbus::zbus_aura::AuraProxyBlocking;
|
||||
use rog_dbus::zbus_platform::PlatformProxyBlocking;
|
||||
use rog_dbus::DBUS_NAME;
|
||||
use smol::Executor;
|
||||
use zbus::Connection;
|
||||
|
||||
@@ -33,22 +35,26 @@ fn main() -> Result<(), Box<dyn std::error::Error>> {
|
||||
println!(" rog-dbus v{}", rog_dbus::VERSION);
|
||||
println!("rog-platform v{}", rog_platform::VERSION);
|
||||
|
||||
let (client, _) = RogDbusClientBlocking::new()?;
|
||||
let supported = client.proxies().supported().supported_functions()?;
|
||||
let conn = zbus::blocking::Connection::system().unwrap();
|
||||
let platform_proxy = PlatformProxyBlocking::new(&conn).unwrap();
|
||||
|
||||
let supported = platform_proxy
|
||||
.supported_interfaces()
|
||||
.unwrap_or_default()
|
||||
.contains(&"Anime".to_string());
|
||||
let config = ConfigBase::new().load();
|
||||
|
||||
let executor = Executor::new();
|
||||
|
||||
let early_return = Arc::new(AtomicBool::new(false));
|
||||
// Set up the anime data and run loop/thread
|
||||
if supported.anime_ctrl.0 {
|
||||
if supported {
|
||||
if let Some(cfg) = config.active_anime {
|
||||
let anime_type = get_anime_type()?;
|
||||
let anime_config = ConfigAnime::new().set_name(cfg).load();
|
||||
let anime = anime_config.create(anime_type)?;
|
||||
let anime_config = Arc::new(Mutex::new(anime_config));
|
||||
|
||||
let anime_proxy_blocking = AnimeProxyBlocking::new(&conn).unwrap();
|
||||
executor
|
||||
.spawn(async move {
|
||||
// Create server
|
||||
@@ -57,12 +63,21 @@ fn main() -> Result<(), Box<dyn std::error::Error>> {
|
||||
|
||||
// Inner behind mutex required for thread safety
|
||||
let inner = Arc::new(Mutex::new(
|
||||
CtrlAnimeInner::new(anime, client, early_return.clone()).unwrap(),
|
||||
CtrlAnimeInner::new(
|
||||
anime,
|
||||
anime_proxy_blocking.clone(),
|
||||
early_return.clone(),
|
||||
)
|
||||
.unwrap(),
|
||||
));
|
||||
// Need new client object for dbus control part
|
||||
let (client, _) = RogDbusClientBlocking::new().unwrap();
|
||||
let anime_control =
|
||||
CtrlAnime::new(anime_config, inner.clone(), client, early_return).unwrap();
|
||||
let anime_control = CtrlAnime::new(
|
||||
anime_config,
|
||||
inner.clone(),
|
||||
anime_proxy_blocking,
|
||||
early_return,
|
||||
)
|
||||
.unwrap();
|
||||
anime_control.add_to_server(&mut connection).await;
|
||||
loop {
|
||||
if let Ok(inner) = inner.clone().try_lock() {
|
||||
@@ -79,7 +94,7 @@ fn main() -> Result<(), Box<dyn std::error::Error>> {
|
||||
let mut aura_config = ConfigAura::new().set_name(cfg).load();
|
||||
// let baord_name = std::fs::read_to_string(BOARD_NAME)?;
|
||||
|
||||
let led_support = LaptopLedData::get_data();
|
||||
let led_support = LedSupportData::get_data("");
|
||||
|
||||
let layout = KeyLayout::find_layout(led_support, PathBuf::from(DATA_DIR))
|
||||
.map_err(|e| {
|
||||
@@ -87,22 +102,14 @@ fn main() -> Result<(), Box<dyn std::error::Error>> {
|
||||
})
|
||||
.unwrap_or_else(|_| KeyLayout::default_layout());
|
||||
|
||||
let aura_proxy_blocking = AuraProxyBlocking::new(&conn).unwrap();
|
||||
executor
|
||||
.spawn(async move {
|
||||
// Create server
|
||||
let (client, _) = RogDbusClientBlocking::new().unwrap();
|
||||
// let connection = Connection::session().await.unwrap();
|
||||
// connection.request_name(DBUS_NAME).await.unwrap();
|
||||
|
||||
loop {
|
||||
aura_config.aura.next_state(&layout);
|
||||
let packets = aura_config.aura.create_packets();
|
||||
|
||||
client
|
||||
.proxies()
|
||||
.led()
|
||||
.direct_addressing_raw(packets)
|
||||
.unwrap();
|
||||
aura_proxy_blocking.direct_addressing_raw(packets).unwrap();
|
||||
std::thread::sleep(std::time::Duration::from_millis(33));
|
||||
}
|
||||
})
|
||||
|
||||
@@ -6,6 +6,4 @@ pub mod ctrl_anime;
|
||||
|
||||
pub mod zbus_anime;
|
||||
|
||||
pub static DBUS_NAME: &str = "org.asuslinux.Daemon";
|
||||
|
||||
pub static VERSION: &str = env!("CARGO_PKG_VERSION");
|
||||
|
||||
@@ -21,9 +21,9 @@
|
||||
//! …consequently `zbus-xmlgen` did not generate code for the above interfaces.
|
||||
#![allow(clippy::too_many_arguments)]
|
||||
|
||||
use zbus::dbus_proxy;
|
||||
use zbus::proxy;
|
||||
|
||||
#[dbus_proxy(
|
||||
#[proxy(
|
||||
interface = "org.asuslinux.Daemon",
|
||||
default_path = "/org/asuslinux/Anime"
|
||||
)]
|
||||
|
||||
@@ -1,13 +1,13 @@
|
||||
[package]
|
||||
name = "asusd"
|
||||
license = "MPL-2.0"
|
||||
license.workspace = true
|
||||
version.workspace = true
|
||||
readme = "README.md"
|
||||
authors = ["Luke <luke@ljones.dev>"]
|
||||
repository = "https://gitlab.com/asus-linux/asus-nb-ctrl"
|
||||
homepage = "https://gitlab.com/asus-linux/asus-nb-ctrl"
|
||||
description = "A daemon app for ASUS GX502 and similar laptops to control missing features"
|
||||
edition = "2021"
|
||||
readme.workspace = true
|
||||
authors.workspace = true
|
||||
repository.workspace = true
|
||||
homepage.workspace = true
|
||||
description.workspace = true
|
||||
edition.workspace = true
|
||||
|
||||
[[bin]]
|
||||
name = "asusd"
|
||||
@@ -16,13 +16,18 @@ path = "src/daemon.rs"
|
||||
[dependencies]
|
||||
config-traits = { path = "../config-traits" }
|
||||
rog_anime = { path = "../rog-anime", features = ["dbus"] }
|
||||
rog_slash = { path = "../rog-slash", features = ["dbus"] }
|
||||
rog_aura = { path = "../rog-aura", features = ["dbus"] }
|
||||
rog_platform = { path = "../rog-platform" }
|
||||
rog_profiles = { path = "../rog-profiles" }
|
||||
rog_dbus = { path = "../rog-dbus" }
|
||||
dmi_id = { path = "../dmi-id" }
|
||||
futures-lite = "*"
|
||||
udev.workspace = true
|
||||
inotify.workspace = true
|
||||
|
||||
async-trait.workspace = true
|
||||
mio.workspace = true
|
||||
tokio.workspace = true
|
||||
# console-subscriber = "0.2.0"
|
||||
|
||||
# cli and logging
|
||||
log.workspace = true
|
||||
@@ -35,12 +40,10 @@ logind-zbus.workspace = true
|
||||
serde.workspace = true
|
||||
serde_derive.workspace = true
|
||||
|
||||
# Device control
|
||||
sysfs-class.workspace = true # used for backlight control and baord ID
|
||||
|
||||
concat-idents.workspace = true
|
||||
|
||||
systemd-zbus = "*"
|
||||
|
||||
[dev-dependencies]
|
||||
cargo-husky.workspace = true
|
||||
cargo-husky.workspace = true
|
||||
|
||||
[package.metadata.cargo-machete]
|
||||
ignored = ["serde"]
|
||||
|
||||
@@ -1,83 +1,159 @@
|
||||
use config_traits::{StdConfig, StdConfigLoad2};
|
||||
use config_traits::{StdConfig, StdConfigLoad1};
|
||||
use rog_platform::cpu::CPUEPP;
|
||||
use rog_platform::platform::ThrottlePolicy;
|
||||
use serde_derive::{Deserialize, Serialize};
|
||||
|
||||
const CONFIG_FILE: &str = "asusd.ron";
|
||||
|
||||
#[derive(Deserialize, Serialize, Default, Debug)]
|
||||
#[derive(Deserialize, Serialize, Debug, PartialEq, PartialOrd)]
|
||||
pub struct Config {
|
||||
/// Save charge limit for restoring on boot
|
||||
pub bat_charge_limit: u8,
|
||||
/// Save charge limit for restoring on boot/resume
|
||||
pub charge_control_end_threshold: u8,
|
||||
pub panel_od: bool,
|
||||
pub boot_sound: bool,
|
||||
pub mini_led_mode: bool,
|
||||
pub disable_nvidia_powerd_on_battery: bool,
|
||||
/// An optional command/script to run when power is changed to AC
|
||||
pub ac_command: String,
|
||||
/// An optional command/script to run when power is changed to battery
|
||||
pub bat_command: String,
|
||||
/// Set true if energy_performance_preference should be set if the
|
||||
/// throttle/platform profile is changed
|
||||
pub throttle_policy_linked_epp: bool,
|
||||
/// Which throttle/profile to use on battery power
|
||||
pub throttle_policy_on_battery: ThrottlePolicy,
|
||||
/// Which throttle/profile to use on AC power
|
||||
pub throttle_policy_on_ac: ThrottlePolicy,
|
||||
/// The energy_performance_preference for this throttle/platform profile
|
||||
pub throttle_quiet_epp: CPUEPP,
|
||||
/// The energy_performance_preference for this throttle/platform profile
|
||||
pub throttle_balanced_epp: CPUEPP,
|
||||
/// The energy_performance_preference for this throttle/platform profile
|
||||
pub throttle_performance_epp: CPUEPP,
|
||||
/// Defaults to `None` if not supported
|
||||
#[serde(skip_serializing_if = "Option::is_none", default)]
|
||||
pub ppt_pl1_spl: Option<u8>,
|
||||
/// Defaults to `None` if not supported
|
||||
#[serde(skip_serializing_if = "Option::is_none", default)]
|
||||
pub ppt_pl2_sppt: Option<u8>,
|
||||
/// Defaults to `None` if not supported
|
||||
#[serde(skip_serializing_if = "Option::is_none", default)]
|
||||
pub ppt_fppt: Option<u8>,
|
||||
/// Defaults to `None` if not supported
|
||||
#[serde(skip_serializing_if = "Option::is_none", default)]
|
||||
pub ppt_apu_sppt: Option<u8>,
|
||||
/// Defaults to `None` if not supported
|
||||
#[serde(skip_serializing_if = "Option::is_none", default)]
|
||||
pub ppt_platform_sppt: Option<u8>,
|
||||
/// Defaults to `None` if not supported
|
||||
#[serde(skip_serializing_if = "Option::is_none", default)]
|
||||
pub nv_dynamic_boost: Option<u8>,
|
||||
/// Defaults to `None` if not supported
|
||||
#[serde(skip_serializing_if = "Option::is_none", default)]
|
||||
pub nv_temp_target: Option<u8>,
|
||||
/// Temporary state for AC/Batt
|
||||
#[serde(skip)]
|
||||
pub last_power_plugged: u8,
|
||||
}
|
||||
|
||||
impl Default for Config {
|
||||
fn default() -> Self {
|
||||
Self {
|
||||
charge_control_end_threshold: 100,
|
||||
panel_od: false,
|
||||
boot_sound: false,
|
||||
mini_led_mode: false,
|
||||
disable_nvidia_powerd_on_battery: true,
|
||||
ac_command: Default::default(),
|
||||
bat_command: Default::default(),
|
||||
throttle_policy_linked_epp: true,
|
||||
throttle_policy_on_battery: ThrottlePolicy::Quiet,
|
||||
throttle_policy_on_ac: ThrottlePolicy::Performance,
|
||||
throttle_quiet_epp: CPUEPP::Power,
|
||||
throttle_balanced_epp: CPUEPP::BalancePower,
|
||||
throttle_performance_epp: CPUEPP::Performance,
|
||||
ppt_pl1_spl: Default::default(),
|
||||
ppt_pl2_sppt: Default::default(),
|
||||
ppt_fppt: Default::default(),
|
||||
ppt_apu_sppt: Default::default(),
|
||||
ppt_platform_sppt: Default::default(),
|
||||
nv_dynamic_boost: Default::default(),
|
||||
nv_temp_target: Default::default(),
|
||||
last_power_plugged: Default::default(),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl StdConfig for Config {
|
||||
fn new() -> Self {
|
||||
Config {
|
||||
bat_charge_limit: 100,
|
||||
panel_od: false,
|
||||
mini_led_mode: false,
|
||||
charge_control_end_threshold: 100,
|
||||
disable_nvidia_powerd_on_battery: true,
|
||||
throttle_policy_on_battery: ThrottlePolicy::Quiet,
|
||||
throttle_policy_on_ac: ThrottlePolicy::Performance,
|
||||
ac_command: String::new(),
|
||||
bat_command: String::new(),
|
||||
..Default::default()
|
||||
}
|
||||
}
|
||||
|
||||
fn config_dir() -> std::path::PathBuf {
|
||||
std::path::PathBuf::from(crate::CONFIG_PATH_BASE)
|
||||
}
|
||||
|
||||
fn file_name(&self) -> String {
|
||||
CONFIG_FILE.to_owned()
|
||||
}
|
||||
|
||||
fn config_dir() -> std::path::PathBuf {
|
||||
std::path::PathBuf::from(crate::CONFIG_PATH_BASE)
|
||||
}
|
||||
}
|
||||
|
||||
impl StdConfigLoad2<Config458, Config462> for Config {}
|
||||
impl StdConfigLoad1<Config507> for Config {}
|
||||
|
||||
#[derive(Deserialize, Serialize)]
|
||||
pub struct Config462 {
|
||||
pub struct Config507 {
|
||||
/// Save charge limit for restoring on boot
|
||||
pub bat_charge_limit: u8,
|
||||
pub charge_control_end_threshold: u8,
|
||||
pub panel_od: bool,
|
||||
pub mini_led_mode: bool,
|
||||
pub disable_nvidia_powerd_on_battery: bool,
|
||||
pub ac_command: String,
|
||||
pub bat_command: String,
|
||||
pub platform_policy_linked_epp: bool,
|
||||
pub platform_policy_on_battery: ThrottlePolicy,
|
||||
pub platform_policy_on_ac: ThrottlePolicy,
|
||||
//
|
||||
pub ppt_pl1_spl: Option<u8>,
|
||||
pub ppt_pl2_sppt: Option<u8>,
|
||||
pub ppt_fppt: Option<u8>,
|
||||
pub ppt_apu_sppt: Option<u8>,
|
||||
pub ppt_platform_sppt: Option<u8>,
|
||||
pub nv_dynamic_boost: Option<u8>,
|
||||
pub nv_temp_target: Option<u8>,
|
||||
}
|
||||
|
||||
impl From<Config462> for Config {
|
||||
fn from(c: Config462) -> Self {
|
||||
impl From<Config507> for Config {
|
||||
fn from(c: Config507) -> Self {
|
||||
Self {
|
||||
bat_charge_limit: c.bat_charge_limit,
|
||||
charge_control_end_threshold: c.charge_control_end_threshold,
|
||||
panel_od: c.panel_od,
|
||||
mini_led_mode: false,
|
||||
disable_nvidia_powerd_on_battery: true,
|
||||
ac_command: String::new(),
|
||||
bat_command: String::new(),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[derive(Deserialize, Serialize)]
|
||||
pub struct Config458 {
|
||||
/// Save charge limit for restoring on boot
|
||||
pub bat_charge_limit: u8,
|
||||
pub panel_od: bool,
|
||||
pub ac_command: String,
|
||||
pub bat_command: String,
|
||||
}
|
||||
|
||||
impl From<Config458> for Config {
|
||||
fn from(c: Config458) -> Self {
|
||||
Self {
|
||||
bat_charge_limit: c.bat_charge_limit,
|
||||
panel_od: c.panel_od,
|
||||
mini_led_mode: false,
|
||||
disable_nvidia_powerd_on_battery: true,
|
||||
boot_sound: false,
|
||||
disable_nvidia_powerd_on_battery: c.disable_nvidia_powerd_on_battery,
|
||||
ac_command: c.ac_command,
|
||||
bat_command: c.bat_command,
|
||||
mini_led_mode: c.mini_led_mode,
|
||||
throttle_policy_linked_epp: true,
|
||||
throttle_policy_on_battery: c.platform_policy_on_battery,
|
||||
throttle_policy_on_ac: c.platform_policy_on_ac,
|
||||
throttle_quiet_epp: CPUEPP::Power,
|
||||
throttle_balanced_epp: CPUEPP::BalancePower,
|
||||
throttle_performance_epp: CPUEPP::Performance,
|
||||
ppt_pl1_spl: c.ppt_pl1_spl,
|
||||
ppt_pl2_sppt: c.ppt_pl2_sppt,
|
||||
ppt_fppt: c.ppt_fppt,
|
||||
ppt_apu_sppt: c.ppt_apu_sppt,
|
||||
ppt_platform_sppt: c.ppt_platform_sppt,
|
||||
nv_dynamic_boost: c.nv_dynamic_boost,
|
||||
nv_temp_target: c.nv_temp_target,
|
||||
last_power_plugged: 0,
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
@@ -3,7 +3,9 @@ use std::time::Duration;
|
||||
use config_traits::{StdConfig, StdConfigLoad2};
|
||||
use rog_anime::error::AnimeError;
|
||||
use rog_anime::usb::Brightness;
|
||||
use rog_anime::{ActionData, ActionLoader, AnimTime, Animations, AnimeType, Fade, Vec2};
|
||||
use rog_anime::{
|
||||
ActionData, ActionLoader, AnimTime, Animations, AnimeType, DeviceState, Fade, Vec2,
|
||||
};
|
||||
use serde_derive::{Deserialize, Serialize};
|
||||
|
||||
const CONFIG_FILE: &str = "anime.ron";
|
||||
@@ -24,7 +26,6 @@ impl From<AnimeConfigV460> for AnimeConfig {
|
||||
system: c.system,
|
||||
boot: c.boot,
|
||||
wake: c.wake,
|
||||
sleep: c.sleep,
|
||||
shutdown: c.shutdown,
|
||||
..Default::default()
|
||||
}
|
||||
@@ -32,25 +33,32 @@ impl From<AnimeConfigV460> for AnimeConfig {
|
||||
}
|
||||
|
||||
#[derive(Deserialize, Serialize, Debug)]
|
||||
pub struct AnimeConfigV5 {
|
||||
pub struct AnimeConfigV472 {
|
||||
pub model_override: Option<AnimeType>,
|
||||
pub system: Vec<ActionLoader>,
|
||||
pub boot: Vec<ActionLoader>,
|
||||
pub wake: Vec<ActionLoader>,
|
||||
pub sleep: Vec<ActionLoader>,
|
||||
pub shutdown: Vec<ActionLoader>,
|
||||
pub brightness: f32,
|
||||
pub awake_enabled: bool,
|
||||
pub boot_anim_enabled: bool,
|
||||
pub display_enabled: bool,
|
||||
pub display_brightness: Brightness,
|
||||
pub builtin_anims_enabled: bool,
|
||||
pub builtin_anims: Animations,
|
||||
}
|
||||
|
||||
impl From<AnimeConfigV5> for AnimeConfig {
|
||||
fn from(c: AnimeConfigV5) -> AnimeConfig {
|
||||
impl From<AnimeConfigV472> for AnimeConfig {
|
||||
fn from(c: AnimeConfigV472) -> AnimeConfig {
|
||||
AnimeConfig {
|
||||
system: c.system,
|
||||
boot: c.boot,
|
||||
wake: c.wake,
|
||||
sleep: c.sleep,
|
||||
shutdown: c.shutdown,
|
||||
model_override: c.model_override,
|
||||
display_enabled: c.display_enabled,
|
||||
display_brightness: c.display_brightness,
|
||||
builtin_anims_enabled: c.builtin_anims_enabled,
|
||||
builtin_anims: c.builtin_anims,
|
||||
..Default::default()
|
||||
}
|
||||
}
|
||||
@@ -61,7 +69,6 @@ pub struct AnimeConfigCached {
|
||||
pub system: Vec<ActionData>,
|
||||
pub boot: Vec<ActionData>,
|
||||
pub wake: Vec<ActionData>,
|
||||
pub sleep: Vec<ActionData>,
|
||||
pub shutdown: Vec<ActionData>,
|
||||
}
|
||||
|
||||
@@ -89,12 +96,6 @@ impl AnimeConfigCached {
|
||||
}
|
||||
self.wake = wake;
|
||||
|
||||
let mut sleep = Vec::with_capacity(config.sleep.len());
|
||||
for ani in &config.sleep {
|
||||
sleep.push(ActionData::from_anime_action(anime_type, ani)?);
|
||||
}
|
||||
self.sleep = sleep;
|
||||
|
||||
let mut shutdown = Vec::with_capacity(config.shutdown.len());
|
||||
for ani in &config.shutdown {
|
||||
shutdown.push(ActionData::from_anime_action(anime_type, ani)?);
|
||||
@@ -105,18 +106,21 @@ impl AnimeConfigCached {
|
||||
}
|
||||
|
||||
/// Config for base system actions for the anime display
|
||||
#[derive(Deserialize, Serialize, Debug)]
|
||||
#[derive(Deserialize, Serialize, Debug, Clone)]
|
||||
pub struct AnimeConfig {
|
||||
pub model_override: Option<AnimeType>,
|
||||
pub system: Vec<ActionLoader>,
|
||||
pub boot: Vec<ActionLoader>,
|
||||
pub wake: Vec<ActionLoader>,
|
||||
pub sleep: Vec<ActionLoader>,
|
||||
pub shutdown: Vec<ActionLoader>,
|
||||
pub brightness: f32,
|
||||
// pub brightness: f32,
|
||||
pub display_enabled: bool,
|
||||
pub display_brightness: Brightness,
|
||||
pub builtin_anims_enabled: bool,
|
||||
pub off_when_unplugged: bool,
|
||||
pub off_when_suspended: bool,
|
||||
pub off_when_lid_closed: bool,
|
||||
pub brightness_on_battery: Brightness,
|
||||
pub builtin_anims: Animations,
|
||||
}
|
||||
|
||||
@@ -127,12 +131,15 @@ impl Default for AnimeConfig {
|
||||
system: Vec::new(),
|
||||
boot: Vec::new(),
|
||||
wake: Vec::new(),
|
||||
sleep: Vec::new(),
|
||||
shutdown: Vec::new(),
|
||||
brightness: 1.0,
|
||||
// brightness: 1.0,
|
||||
display_enabled: true,
|
||||
display_brightness: Brightness::Med,
|
||||
builtin_anims_enabled: true,
|
||||
off_when_unplugged: true,
|
||||
off_when_suspended: true,
|
||||
off_when_lid_closed: true,
|
||||
brightness_on_battery: Brightness::Low,
|
||||
builtin_anims: Animations::default(),
|
||||
}
|
||||
}
|
||||
@@ -143,16 +150,31 @@ impl StdConfig for AnimeConfig {
|
||||
Self::create_default()
|
||||
}
|
||||
|
||||
fn config_dir() -> std::path::PathBuf {
|
||||
std::path::PathBuf::from(crate::CONFIG_PATH_BASE)
|
||||
}
|
||||
|
||||
fn file_name(&self) -> String {
|
||||
CONFIG_FILE.to_owned()
|
||||
}
|
||||
|
||||
fn config_dir() -> std::path::PathBuf {
|
||||
std::path::PathBuf::from(crate::CONFIG_PATH_BASE)
|
||||
}
|
||||
}
|
||||
|
||||
impl StdConfigLoad2<AnimeConfigV460, AnimeConfigV5> for AnimeConfig {}
|
||||
impl StdConfigLoad2<AnimeConfigV460, AnimeConfigV472> for AnimeConfig {}
|
||||
|
||||
impl From<&AnimeConfig> for DeviceState {
|
||||
fn from(config: &AnimeConfig) -> Self {
|
||||
DeviceState {
|
||||
display_enabled: config.display_enabled,
|
||||
display_brightness: config.display_brightness,
|
||||
builtin_anims_enabled: config.builtin_anims_enabled,
|
||||
builtin_anims: config.builtin_anims,
|
||||
off_when_unplugged: config.off_when_unplugged,
|
||||
off_when_suspended: config.off_when_suspended,
|
||||
off_when_lid_closed: config.off_when_lid_closed,
|
||||
brightness_on_battery: config.brightness_on_battery,
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl AnimeConfig {
|
||||
// fn clamp_config_brightness(mut config: &mut AnimeConfig) {
|
||||
@@ -193,14 +215,6 @@ impl AnimeConfig {
|
||||
Duration::from_secs(2),
|
||||
)),
|
||||
}],
|
||||
sleep: vec![ActionLoader::ImageAnimation {
|
||||
file: "/usr/share/asusd/anime/custom/sonic-wait.gif".into(),
|
||||
scale: 0.9,
|
||||
angle: 0.0,
|
||||
translation: Vec2::new(3.0, 2.0),
|
||||
brightness: 1.0,
|
||||
time: AnimTime::Infinite,
|
||||
}],
|
||||
shutdown: vec![ActionLoader::ImageAnimation {
|
||||
file: "/usr/share/asusd/anime/custom/sonic-wait.gif".into(),
|
||||
scale: 0.9,
|
||||
@@ -209,7 +223,6 @@ impl AnimeConfig {
|
||||
brightness: 1.0,
|
||||
time: AnimTime::Infinite,
|
||||
}],
|
||||
brightness: 1.0,
|
||||
..Default::default()
|
||||
}
|
||||
}
|
||||
|
||||
@@ -8,25 +8,19 @@ use std::sync::Arc;
|
||||
use std::thread::sleep;
|
||||
|
||||
use ::zbus::export::futures_util::lock::Mutex;
|
||||
use config_traits::{StdConfig, StdConfigLoad2};
|
||||
use log::{error, info, warn};
|
||||
use rog_anime::error::AnimeError;
|
||||
use rog_anime::usb::{get_anime_type, pkt_flush, pkt_set_enable_powersave_anim, pkts_for_init};
|
||||
use rog_anime::usb::{
|
||||
get_anime_type, pkt_flush, pkt_set_brightness, pkt_set_enable_display,
|
||||
pkt_set_enable_powersave_anim, pkts_for_init, Brightness,
|
||||
};
|
||||
use rog_anime::{ActionData, AnimeDataBuffer, AnimePacketType, AnimeType};
|
||||
use rog_platform::hid_raw::HidRaw;
|
||||
use rog_platform::supported::AnimeSupportedFunctions;
|
||||
use rog_platform::usb_raw::USBRaw;
|
||||
|
||||
use self::config::{AnimeConfig, AnimeConfigCached};
|
||||
use crate::error::RogError;
|
||||
use crate::GetSupported;
|
||||
|
||||
impl GetSupported for CtrlAnime {
|
||||
type A = AnimeSupportedFunctions;
|
||||
|
||||
fn get_supported() -> Self::A {
|
||||
AnimeSupportedFunctions(HidRaw::new("193b").is_ok())
|
||||
}
|
||||
}
|
||||
|
||||
enum Node {
|
||||
Usb(USBRaw),
|
||||
@@ -46,6 +40,13 @@ impl Node {
|
||||
}
|
||||
Ok(())
|
||||
}
|
||||
|
||||
pub fn set_builtins_enabled(&self, enabled: bool, bright: Brightness) -> Result<(), RogError> {
|
||||
self.write_bytes(&pkt_set_enable_powersave_anim(enabled))?;
|
||||
self.write_bytes(&pkt_set_enable_display(enabled))?;
|
||||
self.write_bytes(&pkt_set_brightness(bright))?;
|
||||
self.write_bytes(&pkt_set_enable_powersave_anim(enabled))
|
||||
}
|
||||
}
|
||||
|
||||
pub struct CtrlAnime {
|
||||
@@ -62,17 +63,34 @@ pub struct CtrlAnime {
|
||||
|
||||
impl CtrlAnime {
|
||||
#[inline]
|
||||
pub fn new(config: AnimeConfig) -> Result<CtrlAnime, RogError> {
|
||||
let hid = HidRaw::new("193b").ok();
|
||||
pub fn new() -> Result<CtrlAnime, RogError> {
|
||||
let usb = USBRaw::new(0x193b).ok();
|
||||
let node = if hid.is_some() {
|
||||
unsafe { Node::Hid(hid.unwrap_unchecked()) }
|
||||
} else if usb.is_some() {
|
||||
let hid = HidRaw::new("193b").ok();
|
||||
let node = if usb.is_some() {
|
||||
info!("Anime using the USB interface");
|
||||
unsafe { Node::Usb(usb.unwrap_unchecked()) }
|
||||
} else if hid.is_some() {
|
||||
info!("Anime using the HID interface");
|
||||
unsafe { Node::Hid(hid.unwrap_unchecked()) }
|
||||
} else {
|
||||
return Err(RogError::Anime(AnimeError::NoDevice));
|
||||
};
|
||||
|
||||
// TODO: something better to set wakeups disabled
|
||||
// if matches!(node, Node::Usb(_)) {
|
||||
// if let Ok(mut enumerator) = udev::Enumerator::new() {
|
||||
// enumerator.match_subsystem("usb").ok();
|
||||
// enumerator.match_attribute("idProduct", "193b").ok();
|
||||
|
||||
// if let Ok(mut enumer) = enumerator.scan_devices() {
|
||||
// if let Some(mut dev) = enumer.next() {
|
||||
// dev.set_attribute_value("power/wakeup", "disabled").ok();
|
||||
// }
|
||||
// }
|
||||
// }
|
||||
// }
|
||||
|
||||
let config = AnimeConfig::new().load();
|
||||
let mut anime_type = get_anime_type()?;
|
||||
if let AnimeType::Unknown = anime_type {
|
||||
if let Some(model) = config.model_override {
|
||||
@@ -230,6 +248,14 @@ impl CtrlAnime {
|
||||
})
|
||||
.ok();
|
||||
}
|
||||
lock.node
|
||||
.write_bytes(&pkt_set_enable_powersave_anim(
|
||||
lock.config.builtin_anims_enabled,
|
||||
))
|
||||
.map_err(|err| {
|
||||
warn!("rog_anime::run_animation:callback {}", err);
|
||||
})
|
||||
.ok();
|
||||
}
|
||||
// Loop ended, set the atmonics
|
||||
thread_running.store(false, Ordering::SeqCst);
|
||||
@@ -243,7 +269,7 @@ impl CtrlAnime {
|
||||
/// global brightness set in config.
|
||||
fn write_data_buffer(&self, mut buffer: AnimeDataBuffer) -> Result<(), RogError> {
|
||||
for led in buffer.data_mut().iter_mut() {
|
||||
let mut bright = *led as f32 * self.config.brightness;
|
||||
let mut bright = *led as f32;
|
||||
if bright > 254.0 {
|
||||
bright = 254.0;
|
||||
}
|
||||
|
||||
@@ -1,228 +1,300 @@
|
||||
use std::sync::atomic::Ordering;
|
||||
use std::sync::Arc;
|
||||
|
||||
use async_trait::async_trait;
|
||||
use config_traits::StdConfig;
|
||||
use log::warn;
|
||||
use logind_zbus::manager::ManagerProxy;
|
||||
use rog_anime::usb::{
|
||||
pkt_set_brightness, pkt_set_builtin_animations, pkt_set_enable_display,
|
||||
pkt_set_enable_powersave_anim, AnimAwake, AnimBooting, AnimShutdown, AnimSleeping, Brightness,
|
||||
pkt_set_enable_powersave_anim, Brightness,
|
||||
};
|
||||
use rog_anime::{AnimeDataBuffer, DeviceState};
|
||||
use rog_anime::{Animations, AnimeDataBuffer, DeviceState};
|
||||
use zbus::export::futures_util::lock::Mutex;
|
||||
use zbus::{dbus_interface, Connection, SignalContext};
|
||||
use zbus::{interface, CacheProperties, Connection, SignalContext};
|
||||
|
||||
use super::config::AnimeConfig;
|
||||
use super::CtrlAnime;
|
||||
use crate::error::RogError;
|
||||
|
||||
pub(super) const ZBUS_PATH: &str = "/org/asuslinux/Anime";
|
||||
pub const ANIME_ZBUS_NAME: &str = "Anime";
|
||||
pub const ANIME_ZBUS_PATH: &str = "/org/asuslinux";
|
||||
|
||||
async fn get_logind_manager<'a>() -> ManagerProxy<'a> {
|
||||
let connection = Connection::system()
|
||||
.await
|
||||
.expect("Controller could not create dbus connection");
|
||||
|
||||
ManagerProxy::builder(&connection)
|
||||
.cache_properties(CacheProperties::No)
|
||||
.build()
|
||||
.await
|
||||
.expect("Controller could not create ManagerProxy")
|
||||
}
|
||||
|
||||
#[derive(Clone)]
|
||||
pub struct CtrlAnimeZbus(pub Arc<Mutex<CtrlAnime>>);
|
||||
|
||||
/// The struct with the main dbus methods requires this trait
|
||||
#[async_trait]
|
||||
impl crate::ZbusRun for CtrlAnimeZbus {
|
||||
async fn add_to_server(self, server: &mut Connection) {
|
||||
Self::add_to_server_helper(self, ZBUS_PATH, server).await;
|
||||
Self::add_to_server_helper(self, ANIME_ZBUS_PATH, server).await;
|
||||
}
|
||||
}
|
||||
|
||||
// None of these calls can be guarnateed to succeed unless we loop until okay
|
||||
// If the try_lock *does* succeed then any other thread trying to lock will not
|
||||
// grab it until we finish.
|
||||
#[dbus_interface(name = "org.asuslinux.Daemon")]
|
||||
#[interface(name = "org.asuslinux.Anime")]
|
||||
impl CtrlAnimeZbus {
|
||||
/// Writes a data stream of length. Will force system thread to exit until
|
||||
/// it is restarted
|
||||
async fn write(&self, input: AnimeDataBuffer) -> zbus::fdo::Result<()> {
|
||||
let lock = self.0.lock().await;
|
||||
lock.thread_exit.store(true, Ordering::SeqCst);
|
||||
lock.write_data_buffer(input).map_err(|err| {
|
||||
warn!("rog_anime::run_animation:callback {}", err);
|
||||
err
|
||||
})?;
|
||||
self.0
|
||||
.lock()
|
||||
.await
|
||||
.thread_exit
|
||||
.store(true, Ordering::SeqCst);
|
||||
self.0
|
||||
.lock()
|
||||
.await
|
||||
.write_data_buffer(input)
|
||||
.map_err(|err| {
|
||||
warn!("ctrl_anime::run_animation:callback {}", err);
|
||||
err
|
||||
})?;
|
||||
Ok(())
|
||||
}
|
||||
|
||||
/// Set the global AniMe brightness
|
||||
async fn set_image_brightness(&self, bright: f32) {
|
||||
let mut lock = self.0.lock().await;
|
||||
let mut bright = bright;
|
||||
if bright < 0.0 {
|
||||
bright = 0.0;
|
||||
} else if bright > 1.0 {
|
||||
bright = 1.0;
|
||||
}
|
||||
lock.config.brightness = bright;
|
||||
lock.config.write();
|
||||
/// Set base brightness level
|
||||
#[zbus(property)]
|
||||
async fn brightness(&self) -> Brightness {
|
||||
self.0.lock().await.config.display_brightness
|
||||
}
|
||||
|
||||
/// Set base brightness level
|
||||
// TODO: enum for brightness
|
||||
async fn set_brightness(
|
||||
&self,
|
||||
#[zbus(signal_context)] ctxt: SignalContext<'_>,
|
||||
brightness: Brightness,
|
||||
) {
|
||||
let mut lock = self.0.lock().await;
|
||||
lock.node
|
||||
#[zbus(property)]
|
||||
async fn set_brightness(&self, brightness: Brightness) {
|
||||
self.0
|
||||
.lock()
|
||||
.await
|
||||
.node
|
||||
.write_bytes(&pkt_set_brightness(brightness))
|
||||
.map_err(|err| {
|
||||
warn!("rog_anime::run_animation:callback {}", err);
|
||||
warn!("ctrl_anime::set_brightness {}", err);
|
||||
})
|
||||
.ok();
|
||||
self.0
|
||||
.lock()
|
||||
.await
|
||||
.node
|
||||
.write_bytes(&pkt_set_enable_display(brightness != Brightness::Off))
|
||||
.map_err(|err| {
|
||||
warn!("ctrl_anime::set_brightness {}", err);
|
||||
})
|
||||
.ok();
|
||||
lock.config.display_brightness = brightness;
|
||||
lock.config.write();
|
||||
|
||||
Self::notify_device_state(
|
||||
&ctxt,
|
||||
DeviceState {
|
||||
display_enabled: lock.config.display_enabled,
|
||||
display_brightness: lock.config.display_brightness,
|
||||
builtin_anims_enabled: lock.config.builtin_anims_enabled,
|
||||
builtin_anims: lock.config.builtin_anims,
|
||||
},
|
||||
)
|
||||
.await
|
||||
.ok();
|
||||
self.0.lock().await.config.display_enabled = brightness != Brightness::Off;
|
||||
self.0.lock().await.config.display_brightness = brightness;
|
||||
self.0.lock().await.config.write();
|
||||
}
|
||||
|
||||
#[zbus(property)]
|
||||
async fn builtins_enabled(&self) -> bool {
|
||||
let lock = self.0.lock().await;
|
||||
lock.config.builtin_anims_enabled
|
||||
}
|
||||
|
||||
/// Enable the builtin animations or not. This is quivalent to "Powersave
|
||||
/// animations" in Armory crate
|
||||
async fn set_builtins_enabled(
|
||||
&self,
|
||||
#[zbus(signal_context)] ctxt: SignalContext<'_>,
|
||||
enabled: bool,
|
||||
) {
|
||||
let mut lock = self.0.lock().await;
|
||||
lock.node
|
||||
.write_bytes(&pkt_set_enable_powersave_anim(enabled))
|
||||
#[zbus(property)]
|
||||
async fn set_builtins_enabled(&self, enabled: bool) {
|
||||
let brightness = self.0.lock().await.config.display_brightness;
|
||||
self.0
|
||||
.lock()
|
||||
.await
|
||||
.node
|
||||
.set_builtins_enabled(enabled, brightness)
|
||||
.map_err(|err| {
|
||||
warn!("rog_anime::run_animation:callback {}", err);
|
||||
warn!("ctrl_anime::set_builtins_enabled {}", err);
|
||||
})
|
||||
.ok();
|
||||
lock.config.builtin_anims_enabled = enabled;
|
||||
lock.config.write();
|
||||
if enabled {
|
||||
lock.thread_exit.store(true, Ordering::Release);
|
||||
|
||||
if !enabled {
|
||||
let anime_type = self.0.lock().await.anime_type;
|
||||
let data = vec![255u8; anime_type.data_length()];
|
||||
if let Ok(tmp) = AnimeDataBuffer::from_vec(anime_type, data).map_err(|err| {
|
||||
warn!("ctrl_anime::set_builtins_enabled {}", err);
|
||||
}) {
|
||||
self.0
|
||||
.lock()
|
||||
.await
|
||||
.node
|
||||
.write_bytes(tmp.data())
|
||||
.map_err(|err| {
|
||||
warn!("ctrl_anime::set_builtins_enabled {}", err);
|
||||
})
|
||||
.ok();
|
||||
}
|
||||
}
|
||||
|
||||
Self::notify_device_state(
|
||||
&ctxt,
|
||||
DeviceState {
|
||||
display_enabled: lock.config.display_enabled,
|
||||
display_brightness: lock.config.display_brightness,
|
||||
builtin_anims_enabled: lock.config.builtin_anims_enabled,
|
||||
builtin_anims: lock.config.builtin_anims,
|
||||
},
|
||||
)
|
||||
.await
|
||||
.ok();
|
||||
self.0.lock().await.config.builtin_anims_enabled = enabled;
|
||||
self.0.lock().await.config.write();
|
||||
if enabled {
|
||||
self.0
|
||||
.lock()
|
||||
.await
|
||||
.thread_exit
|
||||
.store(true, Ordering::Release);
|
||||
}
|
||||
}
|
||||
|
||||
#[zbus(property)]
|
||||
async fn builtin_animations(&self) -> Animations {
|
||||
self.0.lock().await.config.builtin_anims
|
||||
}
|
||||
|
||||
/// Set which builtin animation is used for each stage
|
||||
async fn set_builtin_animations(
|
||||
&self,
|
||||
#[zbus(signal_context)] ctxt: SignalContext<'_>,
|
||||
boot: AnimBooting,
|
||||
awake: AnimAwake,
|
||||
sleep: AnimSleeping,
|
||||
shutdown: AnimShutdown,
|
||||
) {
|
||||
let mut lock = self.0.lock().await;
|
||||
lock.node
|
||||
#[zbus(property)]
|
||||
async fn set_builtin_animations(&self, settings: Animations) {
|
||||
self.0
|
||||
.lock()
|
||||
.await
|
||||
.node
|
||||
.write_bytes(&pkt_set_builtin_animations(
|
||||
settings.boot,
|
||||
settings.awake,
|
||||
settings.sleep,
|
||||
settings.shutdown,
|
||||
))
|
||||
.map_err(|err| {
|
||||
warn!("ctrl_anime::run_animation:callback {}", err);
|
||||
})
|
||||
.ok();
|
||||
self.0
|
||||
.lock()
|
||||
.await
|
||||
.node
|
||||
.write_bytes(&pkt_set_enable_powersave_anim(true))
|
||||
.map_err(|err| {
|
||||
warn!("rog_anime::run_animation:callback {}", err);
|
||||
warn!("ctrl_anime::run_animation:callback {}", err);
|
||||
})
|
||||
.ok();
|
||||
lock.node
|
||||
.write_bytes(&pkt_set_builtin_animations(boot, awake, sleep, shutdown))
|
||||
.map_err(|err| {
|
||||
warn!("rog_anime::run_animation:callback {}", err);
|
||||
})
|
||||
.ok();
|
||||
lock.config.builtin_anims.boot = boot;
|
||||
lock.config.builtin_anims.sleep = sleep;
|
||||
lock.config.builtin_anims.awake = awake;
|
||||
lock.config.builtin_anims.shutdown = shutdown;
|
||||
lock.config.write();
|
||||
self.0.lock().await.config.display_enabled = true;
|
||||
self.0.lock().await.config.builtin_anims = settings;
|
||||
self.0.lock().await.config.write();
|
||||
}
|
||||
|
||||
Self::notify_device_state(
|
||||
&ctxt,
|
||||
DeviceState {
|
||||
display_enabled: lock.config.display_enabled,
|
||||
display_brightness: lock.config.display_brightness,
|
||||
builtin_anims_enabled: lock.config.builtin_anims_enabled,
|
||||
builtin_anims: lock.config.builtin_anims,
|
||||
},
|
||||
)
|
||||
.await
|
||||
.ok();
|
||||
#[zbus(property)]
|
||||
async fn enable_display(&self) -> bool {
|
||||
self.0.lock().await.config.display_enabled
|
||||
}
|
||||
|
||||
/// Set whether the AniMe is enabled at all
|
||||
async fn set_enable_display(
|
||||
&self,
|
||||
#[zbus(signal_context)] ctxt: SignalContext<'_>,
|
||||
enabled: bool,
|
||||
) {
|
||||
let mut lock = self.0.lock().await;
|
||||
lock.node
|
||||
#[zbus(property)]
|
||||
async fn set_enable_display(&self, enabled: bool) {
|
||||
self.0
|
||||
.lock()
|
||||
.await
|
||||
.node
|
||||
.write_bytes(&pkt_set_enable_display(enabled))
|
||||
.map_err(|err| {
|
||||
warn!("rog_anime::run_animation:callback {}", err);
|
||||
warn!("ctrl_anime::run_animation:callback {}", err);
|
||||
})
|
||||
.ok();
|
||||
lock.config.display_enabled = enabled;
|
||||
lock.config.write();
|
||||
self.0.lock().await.config.display_enabled = enabled;
|
||||
self.0.lock().await.config.write();
|
||||
}
|
||||
|
||||
Self::notify_device_state(
|
||||
&ctxt,
|
||||
DeviceState {
|
||||
display_enabled: lock.config.display_enabled,
|
||||
display_brightness: lock.config.display_brightness,
|
||||
builtin_anims_enabled: lock.config.builtin_anims_enabled,
|
||||
builtin_anims: lock.config.builtin_anims,
|
||||
},
|
||||
)
|
||||
.await
|
||||
.ok();
|
||||
#[zbus(property)]
|
||||
async fn off_when_unplugged(&self) -> bool {
|
||||
self.0.lock().await.config.off_when_unplugged
|
||||
}
|
||||
|
||||
/// Set if to turn the AniMe Matrix off when external power is unplugged
|
||||
#[zbus(property)]
|
||||
async fn set_off_when_unplugged(&self, enabled: bool) {
|
||||
let manager = get_logind_manager().await;
|
||||
let pow = manager.on_external_power().await.unwrap_or_default();
|
||||
|
||||
self.0
|
||||
.lock()
|
||||
.await
|
||||
.node
|
||||
.write_bytes(&pkt_set_enable_display(!pow && !enabled))
|
||||
.map_err(|err| {
|
||||
warn!("create_sys_event_tasks::off_when_lid_closed {}", err);
|
||||
})
|
||||
.ok();
|
||||
|
||||
self.0.lock().await.config.off_when_unplugged = enabled;
|
||||
self.0.lock().await.config.write();
|
||||
}
|
||||
|
||||
#[zbus(property)]
|
||||
async fn off_when_suspended(&self) -> bool {
|
||||
self.0.lock().await.config.off_when_suspended
|
||||
}
|
||||
|
||||
/// Set if to turn the AniMe Matrix off when the laptop is suspended
|
||||
#[zbus(property)]
|
||||
async fn set_off_when_suspended(&self, enabled: bool) {
|
||||
self.0.lock().await.config.off_when_suspended = enabled;
|
||||
self.0.lock().await.config.write();
|
||||
}
|
||||
|
||||
#[zbus(property)]
|
||||
async fn off_when_lid_closed(&self) -> bool {
|
||||
self.0.lock().await.config.off_when_lid_closed
|
||||
}
|
||||
|
||||
/// Set if to turn the AniMe Matrix off when the lid is closed
|
||||
#[zbus(property)]
|
||||
async fn set_off_when_lid_closed(&self, enabled: bool) {
|
||||
let manager = get_logind_manager().await;
|
||||
let lid = manager.lid_closed().await.unwrap_or_default();
|
||||
|
||||
self.0
|
||||
.lock()
|
||||
.await
|
||||
.node
|
||||
.write_bytes(&pkt_set_enable_display(lid && !enabled))
|
||||
.map_err(|err| {
|
||||
warn!("create_sys_event_tasks::off_when_lid_closed {}", err);
|
||||
})
|
||||
.ok();
|
||||
|
||||
self.0.lock().await.config.off_when_lid_closed = enabled;
|
||||
self.0.lock().await.config.write();
|
||||
}
|
||||
|
||||
/// The main loop is the base system set action if the user isn't running
|
||||
/// the user daemon
|
||||
async fn run_main_loop(&self, start: bool) {
|
||||
if start {
|
||||
let lock = self.0.lock().await;
|
||||
lock.thread_exit.store(true, Ordering::SeqCst);
|
||||
CtrlAnime::run_thread(self.0.clone(), lock.cache.system.clone(), false).await;
|
||||
self.0
|
||||
.lock()
|
||||
.await
|
||||
.thread_exit
|
||||
.store(true, Ordering::SeqCst);
|
||||
CtrlAnime::run_thread(
|
||||
self.0.clone(),
|
||||
self.0.lock().await.cache.system.clone(),
|
||||
false,
|
||||
)
|
||||
.await;
|
||||
}
|
||||
}
|
||||
|
||||
/// Get the device state as stored by asusd
|
||||
// #[dbus_interface(property)]
|
||||
// #[zbus(property)]
|
||||
async fn device_state(&self) -> DeviceState {
|
||||
let lock = self.0.lock().await;
|
||||
DeviceState {
|
||||
display_enabled: lock.config.display_enabled,
|
||||
display_brightness: lock.config.display_brightness,
|
||||
builtin_anims_enabled: lock.config.builtin_anims_enabled,
|
||||
builtin_anims: lock.config.builtin_anims,
|
||||
}
|
||||
DeviceState::from(&self.0.lock().await.config)
|
||||
}
|
||||
|
||||
/// Notify listeners of the status of AniMe LED power and factory
|
||||
/// system-status animations
|
||||
#[dbus_interface(signal)]
|
||||
async fn notify_device_state(ctxt: &SignalContext<'_>, data: DeviceState) -> zbus::Result<()>;
|
||||
}
|
||||
|
||||
#[async_trait]
|
||||
impl crate::CtrlTask for CtrlAnimeZbus {
|
||||
fn zbus_path() -> &'static str {
|
||||
ZBUS_PATH
|
||||
ANIME_ZBUS_PATH
|
||||
}
|
||||
|
||||
async fn create_tasks(&self, _: SignalContext<'static>) -> Result<(), RogError> {
|
||||
@@ -231,36 +303,164 @@ impl crate::CtrlTask for CtrlAnimeZbus {
|
||||
let inner3 = self.0.clone();
|
||||
let inner4 = self.0.clone();
|
||||
self.create_sys_event_tasks(
|
||||
move || {
|
||||
move |sleeping| {
|
||||
// on_sleep
|
||||
let inner1 = inner1.clone();
|
||||
let inner = inner1.clone();
|
||||
async move {
|
||||
let lock = inner1.lock().await;
|
||||
CtrlAnime::run_thread(inner1.clone(), lock.cache.sleep.clone(), true).await;
|
||||
let config = inner.lock().await.config.clone();
|
||||
if config.display_enabled {
|
||||
inner
|
||||
.lock()
|
||||
.await
|
||||
.thread_exit
|
||||
.store(true, Ordering::Release); // ensure clean slate
|
||||
|
||||
inner
|
||||
.lock()
|
||||
.await
|
||||
.node
|
||||
.write_bytes(&pkt_set_enable_display(
|
||||
!(sleeping && config.off_when_suspended),
|
||||
))
|
||||
.map_err(|err| {
|
||||
warn!("create_sys_event_tasks::off_when_suspended {}", err);
|
||||
})
|
||||
.ok();
|
||||
|
||||
if config.builtin_anims_enabled {
|
||||
inner
|
||||
.lock()
|
||||
.await
|
||||
.node
|
||||
.write_bytes(&pkt_set_enable_powersave_anim(
|
||||
!(sleeping && config.off_when_suspended),
|
||||
))
|
||||
.map_err(|err| {
|
||||
warn!("create_sys_event_tasks::off_when_suspended {}", err);
|
||||
})
|
||||
.ok();
|
||||
} else if !sleeping && !config.builtin_anims_enabled {
|
||||
// Run custom wake animation
|
||||
inner
|
||||
.lock()
|
||||
.await
|
||||
.node
|
||||
.write_bytes(&pkt_set_enable_powersave_anim(false))
|
||||
.ok(); // ensure builtins are disabled
|
||||
|
||||
CtrlAnime::run_thread(
|
||||
inner.clone(),
|
||||
inner.lock().await.cache.wake.clone(),
|
||||
true,
|
||||
)
|
||||
.await;
|
||||
}
|
||||
}
|
||||
}
|
||||
},
|
||||
move || {
|
||||
// on_wake
|
||||
let inner2 = inner2.clone();
|
||||
async move {
|
||||
let lock = inner2.lock().await;
|
||||
CtrlAnime::run_thread(inner2.clone(), lock.cache.wake.clone(), true).await;
|
||||
}
|
||||
},
|
||||
move || {
|
||||
move |shutting_down| {
|
||||
// on_shutdown
|
||||
let inner3 = inner3.clone();
|
||||
let inner = inner2.clone();
|
||||
async move {
|
||||
let lock = inner3.lock().await;
|
||||
CtrlAnime::run_thread(inner3.clone(), lock.cache.shutdown.clone(), true).await;
|
||||
let AnimeConfig {
|
||||
display_enabled,
|
||||
builtin_anims_enabled,
|
||||
..
|
||||
} = inner.lock().await.config;
|
||||
if display_enabled && !builtin_anims_enabled {
|
||||
if shutting_down {
|
||||
CtrlAnime::run_thread(
|
||||
inner.clone(),
|
||||
inner.lock().await.cache.shutdown.clone(),
|
||||
true,
|
||||
)
|
||||
.await;
|
||||
} else {
|
||||
CtrlAnime::run_thread(
|
||||
inner.clone(),
|
||||
inner.lock().await.cache.boot.clone(),
|
||||
true,
|
||||
)
|
||||
.await;
|
||||
}
|
||||
}
|
||||
}
|
||||
},
|
||||
move || {
|
||||
// on_boot
|
||||
let inner4 = inner4.clone();
|
||||
move |lid_closed| {
|
||||
let inner = inner3.clone();
|
||||
// on lid change
|
||||
async move {
|
||||
let lock = inner4.lock().await;
|
||||
CtrlAnime::run_thread(inner4.clone(), lock.cache.boot.clone(), true).await;
|
||||
let AnimeConfig {
|
||||
off_when_lid_closed,
|
||||
builtin_anims_enabled,
|
||||
..
|
||||
} = inner.lock().await.config;
|
||||
if off_when_lid_closed {
|
||||
if builtin_anims_enabled {
|
||||
inner
|
||||
.lock()
|
||||
.await
|
||||
.node
|
||||
.write_bytes(&pkt_set_enable_powersave_anim(!lid_closed))
|
||||
.map_err(|err| {
|
||||
warn!("create_sys_event_tasks::off_when_suspended {}", err);
|
||||
})
|
||||
.ok();
|
||||
}
|
||||
inner
|
||||
.lock()
|
||||
.await
|
||||
.node
|
||||
.write_bytes(&pkt_set_enable_display(!lid_closed))
|
||||
.map_err(|err| {
|
||||
warn!("create_sys_event_tasks::off_when_lid_closed {}", err);
|
||||
})
|
||||
.ok();
|
||||
}
|
||||
}
|
||||
},
|
||||
move |power_plugged| {
|
||||
let inner = inner4.clone();
|
||||
// on power change
|
||||
async move {
|
||||
let AnimeConfig {
|
||||
off_when_unplugged,
|
||||
builtin_anims_enabled,
|
||||
brightness_on_battery,
|
||||
..
|
||||
} = inner.lock().await.config;
|
||||
if off_when_unplugged {
|
||||
if builtin_anims_enabled {
|
||||
inner
|
||||
.lock()
|
||||
.await
|
||||
.node
|
||||
.write_bytes(&pkt_set_enable_powersave_anim(power_plugged))
|
||||
.map_err(|err| {
|
||||
warn!("create_sys_event_tasks::off_when_suspended {}", err);
|
||||
})
|
||||
.ok();
|
||||
}
|
||||
inner
|
||||
.lock()
|
||||
.await
|
||||
.node
|
||||
.write_bytes(&pkt_set_enable_display(power_plugged))
|
||||
.map_err(|err| {
|
||||
warn!("create_sys_event_tasks::off_when_unplugged {}", err);
|
||||
})
|
||||
.ok();
|
||||
} else {
|
||||
inner
|
||||
.lock()
|
||||
.await
|
||||
.node
|
||||
.write_bytes(&pkt_set_brightness(brightness_on_battery))
|
||||
.map_err(|err| {
|
||||
warn!("create_sys_event_tasks::off_when_unplugged {}", err);
|
||||
})
|
||||
.ok();
|
||||
}
|
||||
}
|
||||
},
|
||||
)
|
||||
@@ -270,30 +470,52 @@ impl crate::CtrlTask for CtrlAnimeZbus {
|
||||
}
|
||||
}
|
||||
|
||||
#[async_trait]
|
||||
impl crate::Reloadable for CtrlAnimeZbus {
|
||||
async fn reload(&mut self) -> Result<(), RogError> {
|
||||
if let Some(lock) = self.0.try_lock() {
|
||||
let anim = &lock.config.builtin_anims;
|
||||
lock.node
|
||||
.write_bytes(&pkt_set_enable_display(lock.config.display_enabled))?;
|
||||
lock.node.write_bytes(&pkt_set_enable_powersave_anim(
|
||||
// Set builtins
|
||||
if lock.config.builtin_anims_enabled {
|
||||
lock.node.write_bytes(&pkt_set_builtin_animations(
|
||||
anim.boot,
|
||||
anim.awake,
|
||||
anim.sleep,
|
||||
anim.shutdown,
|
||||
))?;
|
||||
}
|
||||
// Builtins enabled or na?
|
||||
lock.node.set_builtins_enabled(
|
||||
lock.config.builtin_anims_enabled,
|
||||
))?;
|
||||
lock.node.write_bytes(&pkt_set_builtin_animations(
|
||||
anim.boot,
|
||||
anim.awake,
|
||||
anim.sleep,
|
||||
anim.shutdown,
|
||||
))?;
|
||||
lock.config.display_brightness,
|
||||
)?;
|
||||
|
||||
if lock.config.builtin_anims_enabled && !lock.cache.boot.is_empty() {
|
||||
let manager = get_logind_manager().await;
|
||||
let lid_closed = manager.lid_closed().await.unwrap_or_default();
|
||||
let power_plugged = manager.on_external_power().await.unwrap_or_default();
|
||||
|
||||
let turn_off = (lid_closed && lock.config.off_when_lid_closed)
|
||||
|| (!power_plugged && lock.config.off_when_unplugged);
|
||||
lock.node
|
||||
.write_bytes(&pkt_set_enable_display(!turn_off))
|
||||
.map_err(|err| {
|
||||
warn!("create_sys_event_tasks::reload {}", err);
|
||||
})
|
||||
.ok();
|
||||
|
||||
if turn_off || !lock.config.display_enabled {
|
||||
lock.node.write_bytes(&pkt_set_enable_display(false))?;
|
||||
// early return so we don't run animation thread
|
||||
return Ok(());
|
||||
}
|
||||
|
||||
if !lock.config.builtin_anims_enabled && !lock.cache.boot.is_empty() {
|
||||
lock.node
|
||||
.write_bytes(&pkt_set_enable_powersave_anim(false))
|
||||
.ok();
|
||||
|
||||
let action = lock.cache.boot.clone();
|
||||
CtrlAnime::run_thread(self.0.clone(), action, true).await;
|
||||
}
|
||||
let action = lock.cache.boot.clone();
|
||||
CtrlAnime::run_thread(self.0.clone(), action, true).await;
|
||||
}
|
||||
Ok(())
|
||||
}
|
||||
|
||||
@@ -1,166 +1,60 @@
|
||||
use std::collections::{BTreeMap, HashSet};
|
||||
use std::collections::BTreeMap;
|
||||
|
||||
use config_traits::{StdConfig, StdConfigLoad};
|
||||
use log::warn;
|
||||
use rog_aura::aura_detection::{LaptopLedData, ASUS_KEYBOARD_DEVICES};
|
||||
use rog_aura::power::AuraPower;
|
||||
use rog_aura::usb::{AuraDevRog1, AuraDevTuf, AuraDevice, AuraPowerDev};
|
||||
use rog_aura::{AuraEffect, AuraModeNum, AuraZone, Direction, LedBrightness, Speed, GRADIENT};
|
||||
use rog_platform::hid_raw::HidRaw;
|
||||
use log::{debug, info, warn};
|
||||
use rog_aura::aura_detection::LedSupportData;
|
||||
use rog_aura::keyboard::LaptopAuraPower;
|
||||
use rog_aura::{
|
||||
AuraDeviceType, AuraEffect, AuraModeNum, AuraZone, Direction, LedBrightness, Speed, GRADIENT,
|
||||
};
|
||||
use serde_derive::{Deserialize, Serialize};
|
||||
|
||||
const CONFIG_FILE: &str = "aura.ron";
|
||||
|
||||
/// Enable/disable LED control in various states such as
|
||||
/// when the device is awake, suspended, shutting down or
|
||||
/// booting.
|
||||
#[derive(Clone, Debug, PartialEq, Eq, Serialize, Deserialize)]
|
||||
pub enum AuraPowerConfig {
|
||||
AuraDevTuf(HashSet<AuraDevTuf>),
|
||||
AuraDevRog1(HashSet<AuraDevRog1>),
|
||||
AuraDevRog2(AuraPower),
|
||||
}
|
||||
|
||||
impl AuraPowerConfig {
|
||||
/// Invalid for TUF laptops
|
||||
pub fn to_bytes(control: &Self) -> [u8; 4] {
|
||||
match control {
|
||||
AuraPowerConfig::AuraDevTuf(_) => [0, 0, 0, 0],
|
||||
AuraPowerConfig::AuraDevRog1(c) => {
|
||||
let c: Vec<AuraDevRog1> = c.iter().copied().collect();
|
||||
AuraDevRog1::to_bytes(&c)
|
||||
}
|
||||
AuraPowerConfig::AuraDevRog2(c) => c.to_bytes(),
|
||||
}
|
||||
}
|
||||
|
||||
pub fn to_tuf_bool_array(control: &Self) -> Option<[bool; 5]> {
|
||||
if let Self::AuraDevTuf(c) = control {
|
||||
return Some([
|
||||
true,
|
||||
c.contains(&AuraDevTuf::Boot),
|
||||
c.contains(&AuraDevTuf::Awake),
|
||||
c.contains(&AuraDevTuf::Sleep),
|
||||
c.contains(&AuraDevTuf::Keyboard),
|
||||
]);
|
||||
}
|
||||
|
||||
if let Self::AuraDevRog1(c) = control {
|
||||
return Some([
|
||||
true,
|
||||
c.contains(&AuraDevRog1::Boot),
|
||||
c.contains(&AuraDevRog1::Awake),
|
||||
c.contains(&AuraDevRog1::Sleep),
|
||||
c.contains(&AuraDevRog1::Keyboard),
|
||||
]);
|
||||
}
|
||||
|
||||
None
|
||||
}
|
||||
|
||||
pub fn set_tuf(&mut self, power: AuraDevTuf, on: bool) {
|
||||
if let Self::AuraDevTuf(p) = self {
|
||||
if on {
|
||||
p.insert(power);
|
||||
} else {
|
||||
p.remove(&power);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
pub fn set_0x1866(&mut self, power: AuraDevRog1, on: bool) {
|
||||
if let Self::AuraDevRog1(p) = self {
|
||||
if on {
|
||||
p.insert(power);
|
||||
} else {
|
||||
p.remove(&power);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
pub fn set_0x19b6(&mut self, power: AuraPower) {
|
||||
if let Self::AuraDevRog2(p) = self {
|
||||
*p = power;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl From<&AuraPowerConfig> for AuraPowerDev {
|
||||
fn from(config: &AuraPowerConfig) -> Self {
|
||||
match config {
|
||||
AuraPowerConfig::AuraDevTuf(d) => AuraPowerDev {
|
||||
tuf: d.iter().copied().collect(),
|
||||
..Default::default()
|
||||
},
|
||||
AuraPowerConfig::AuraDevRog1(d) => AuraPowerDev {
|
||||
old_rog: d.iter().copied().collect(),
|
||||
..Default::default()
|
||||
},
|
||||
AuraPowerConfig::AuraDevRog2(d) => AuraPowerDev {
|
||||
rog: d.clone(),
|
||||
..Default::default()
|
||||
},
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[derive(Deserialize, Serialize, Debug, Clone)]
|
||||
#[derive(Deserialize, Serialize, Default, Debug, Clone)]
|
||||
// #[serde(default)]
|
||||
pub struct AuraConfig {
|
||||
pub config_name: String,
|
||||
pub brightness: LedBrightness,
|
||||
pub current_mode: AuraModeNum,
|
||||
pub builtins: BTreeMap<AuraModeNum, AuraEffect>,
|
||||
#[serde(skip_serializing_if = "Option::is_none", default)]
|
||||
pub multizone: Option<BTreeMap<AuraModeNum, Vec<AuraEffect>>>,
|
||||
pub multizone_on: bool,
|
||||
pub enabled: AuraPowerConfig,
|
||||
pub enabled: LaptopAuraPower,
|
||||
}
|
||||
|
||||
impl StdConfig for AuraConfig {
|
||||
/// Detect the keyboard type and load from default DB if data available
|
||||
fn new() -> Self {
|
||||
warn!("AuraConfig: creating new config");
|
||||
let mut prod_id = AuraDevice::Unknown;
|
||||
for prod in ASUS_KEYBOARD_DEVICES {
|
||||
if HidRaw::new(prod.into()).is_ok() {
|
||||
prod_id = prod;
|
||||
break;
|
||||
}
|
||||
panic!("This should not be used");
|
||||
}
|
||||
|
||||
fn file_name(&self) -> String {
|
||||
if self.config_name.is_empty() {
|
||||
panic!("Config file name should not be empty");
|
||||
}
|
||||
Self::create_default(prod_id, &LaptopLedData::get_data())
|
||||
self.config_name.to_owned()
|
||||
}
|
||||
|
||||
fn config_dir() -> std::path::PathBuf {
|
||||
std::path::PathBuf::from(crate::CONFIG_PATH_BASE)
|
||||
}
|
||||
|
||||
fn file_name(&self) -> String {
|
||||
CONFIG_FILE.to_owned()
|
||||
}
|
||||
}
|
||||
|
||||
impl StdConfigLoad for AuraConfig {}
|
||||
|
||||
impl AuraConfig {
|
||||
pub fn create_default(prod_id: AuraDevice, support_data: &LaptopLedData) -> Self {
|
||||
/// Detect the keyboard type and load from default DB if data available
|
||||
pub fn new(prod_id: &str) -> Self {
|
||||
info!("Setting up AuraConfig for {prod_id:?}");
|
||||
// create a default config here
|
||||
let enabled = if prod_id == AuraDevice::X19b6 {
|
||||
AuraPowerConfig::AuraDevRog2(AuraPower::new_all_on())
|
||||
} else if prod_id == AuraDevice::Tuf {
|
||||
AuraPowerConfig::AuraDevTuf(HashSet::from([
|
||||
AuraDevTuf::Awake,
|
||||
AuraDevTuf::Boot,
|
||||
AuraDevTuf::Sleep,
|
||||
AuraDevTuf::Keyboard,
|
||||
]))
|
||||
} else {
|
||||
AuraPowerConfig::AuraDevRog1(HashSet::from([
|
||||
AuraDevRog1::Awake,
|
||||
AuraDevRog1::Boot,
|
||||
AuraDevRog1::Sleep,
|
||||
AuraDevRog1::Keyboard,
|
||||
AuraDevRog1::Lightbar,
|
||||
]))
|
||||
};
|
||||
let device_type = AuraDeviceType::from(prod_id);
|
||||
if device_type == AuraDeviceType::Unknown {
|
||||
warn!("idProduct:{prod_id:?} is unknown");
|
||||
}
|
||||
let support_data = LedSupportData::get_data(prod_id);
|
||||
let enabled = LaptopAuraPower::new(device_type, &support_data);
|
||||
let mut config = AuraConfig {
|
||||
config_name: format!("aura_{prod_id}.ron"),
|
||||
brightness: LedBrightness::Med,
|
||||
current_mode: AuraModeNum::Static,
|
||||
builtins: BTreeMap::new(),
|
||||
@@ -170,6 +64,7 @@ impl AuraConfig {
|
||||
};
|
||||
|
||||
for n in &support_data.basic_modes {
|
||||
debug!("creating default for {n}");
|
||||
config
|
||||
.builtins
|
||||
.insert(*n, AuraEffect::default_with_mode(*n));
|
||||
@@ -239,15 +134,13 @@ impl AuraConfig {
|
||||
|
||||
#[cfg(test)]
|
||||
mod tests {
|
||||
use rog_aura::aura_detection::LaptopLedData;
|
||||
use rog_aura::usb::AuraDevice;
|
||||
use rog_aura::{AuraEffect, AuraModeNum, AuraZone, Colour};
|
||||
|
||||
use super::AuraConfig;
|
||||
|
||||
#[test]
|
||||
fn set_multizone_4key_config() {
|
||||
let mut config = AuraConfig::create_default(AuraDevice::X19b6, &LaptopLedData::default());
|
||||
let mut config = AuraConfig::new("19b6");
|
||||
|
||||
let effect = AuraEffect {
|
||||
colour1: Colour {
|
||||
@@ -337,7 +230,7 @@ mod tests {
|
||||
|
||||
#[test]
|
||||
fn set_multizone_multimode_config() {
|
||||
let mut config = AuraConfig::create_default(AuraDevice::X19b6, &LaptopLedData::default());
|
||||
let mut config = AuraConfig::new("19b6");
|
||||
|
||||
let effect = AuraEffect {
|
||||
zone: AuraZone::Key1,
|
||||
|
||||
@@ -1,126 +1,241 @@
|
||||
use std::collections::BTreeMap;
|
||||
use std::collections::{BTreeMap, HashSet};
|
||||
|
||||
use config_traits::{StdConfig, StdConfigLoad};
|
||||
use log::{info, warn};
|
||||
use rog_aura::advanced::{LedUsbPackets, UsbPackets};
|
||||
use rog_aura::aura_detection::{LaptopLedData, ASUS_KEYBOARD_DEVICES};
|
||||
use rog_aura::usb::{AuraDevice, LED_APPLY, LED_SET};
|
||||
use rog_aura::{AuraEffect, AuraZone, Direction, LedBrightness, Speed, GRADIENT, LED_MSG_LEN};
|
||||
use dmi_id::DMIID;
|
||||
use inotify::Inotify;
|
||||
use log::{debug, info, warn};
|
||||
use rog_aura::aura_detection::LedSupportData;
|
||||
use rog_aura::keyboard::{LedUsbPackets, UsbPackets};
|
||||
use rog_aura::usb::{LED_APPLY, LED_SET};
|
||||
use rog_aura::{
|
||||
AuraDeviceType, AuraEffect, Direction, LedBrightness, Speed, GRADIENT, LED_MSG_LEN,
|
||||
};
|
||||
use rog_platform::hid_raw::HidRaw;
|
||||
use rog_platform::keyboard_led::KeyboardLed;
|
||||
use rog_platform::supported::LedSupportedFunctions;
|
||||
use rog_platform::keyboard_led::KeyboardBacklight;
|
||||
use zbus::zvariant::OwnedObjectPath;
|
||||
|
||||
use super::config::{AuraConfig, AuraPowerConfig};
|
||||
use super::config::AuraConfig;
|
||||
use crate::ctrl_aura::manager::{dbus_path_for_dev, dbus_path_for_tuf};
|
||||
use crate::error::RogError;
|
||||
use crate::GetSupported;
|
||||
|
||||
impl GetSupported for CtrlKbdLed {
|
||||
type A = LedSupportedFunctions;
|
||||
#[derive(Debug)]
|
||||
pub enum LEDNode {
|
||||
/// Brightness and/or TUF RGB controls
|
||||
KbdLed(KeyboardBacklight),
|
||||
/// Raw HID handle
|
||||
Rog(Option<KeyboardBacklight>, HidRaw),
|
||||
}
|
||||
|
||||
fn get_supported() -> Self::A {
|
||||
// let mode = <&str>::from(&<AuraModes>::from(*mode));
|
||||
let laptop = LaptopLedData::get_data();
|
||||
|
||||
let mut prod_id = AuraDevice::Unknown;
|
||||
for prod in ASUS_KEYBOARD_DEVICES {
|
||||
if HidRaw::new(prod.into()).is_ok() {
|
||||
prod_id = prod;
|
||||
break;
|
||||
impl LEDNode {
|
||||
// TODO: move various methods upwards to this
|
||||
pub fn set_brightness(&self, value: u8) -> Result<(), RogError> {
|
||||
match self {
|
||||
LEDNode::KbdLed(k) => k.set_brightness(value)?,
|
||||
LEDNode::Rog(k, _) => {
|
||||
if let Some(k) = k {
|
||||
k.set_brightness(value)?
|
||||
} else {
|
||||
debug!("No brightness control found");
|
||||
}
|
||||
}
|
||||
}
|
||||
Ok(())
|
||||
}
|
||||
|
||||
let rgb = KeyboardLed::new();
|
||||
if let Ok(p) = rgb.as_ref() {
|
||||
if p.has_kbd_rgb_mode() {
|
||||
prod_id = AuraDevice::Tuf;
|
||||
pub fn get_brightness(&self) -> Result<u8, RogError> {
|
||||
Ok(match self {
|
||||
LEDNode::KbdLed(k) => k.get_brightness()?,
|
||||
LEDNode::Rog(k, _) => {
|
||||
if let Some(k) = k {
|
||||
k.get_brightness()?
|
||||
} else {
|
||||
debug!("No brightness control found");
|
||||
return Err(RogError::MissingFunction(
|
||||
"No keyboard brightness control found".to_string(),
|
||||
));
|
||||
}
|
||||
}
|
||||
}
|
||||
})
|
||||
}
|
||||
|
||||
LedSupportedFunctions {
|
||||
dev_id: prod_id,
|
||||
brightness: rgb.is_ok(),
|
||||
basic_modes: laptop.basic_modes,
|
||||
basic_zones: laptop.basic_zones,
|
||||
advanced_type: laptop.advanced_type.into(),
|
||||
power_zones: laptop.power_zones,
|
||||
pub fn monitor_brightness(&self) -> Result<Inotify, RogError> {
|
||||
Ok(match self {
|
||||
LEDNode::KbdLed(k) => k.monitor_brightness()?,
|
||||
LEDNode::Rog(k, _) => {
|
||||
if let Some(k) = k {
|
||||
k.monitor_brightness()?
|
||||
} else {
|
||||
debug!("No brightness control found");
|
||||
return Err(RogError::MissingFunction(
|
||||
"No keyboard brightness control found".to_string(),
|
||||
));
|
||||
}
|
||||
}
|
||||
})
|
||||
}
|
||||
|
||||
pub fn has_brightness_control(&self) -> bool {
|
||||
match self {
|
||||
LEDNode::KbdLed(k) => k.has_brightness(),
|
||||
LEDNode::Rog(k, _) => {
|
||||
if let Some(k) = k {
|
||||
k.has_brightness()
|
||||
} else {
|
||||
false
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[derive(Debug, PartialEq, Eq)]
|
||||
pub enum LEDNode {
|
||||
KbdLed(KeyboardLed),
|
||||
Rog(HidRaw),
|
||||
None,
|
||||
}
|
||||
|
||||
/// Individual controller for one Aura device
|
||||
pub struct CtrlKbdLed {
|
||||
// TODO: config stores the keyboard type as an AuraPower, use or update this
|
||||
pub led_prod: AuraDevice,
|
||||
pub led_type: AuraDeviceType,
|
||||
pub led_node: LEDNode,
|
||||
pub kd_brightness: KeyboardLed,
|
||||
pub supported_modes: LaptopLedData,
|
||||
pub flip_effect_write: bool,
|
||||
pub supported_data: LedSupportData, // TODO: is storing this really required?
|
||||
pub per_key_mode_active: bool,
|
||||
pub config: AuraConfig,
|
||||
pub dbus_path: OwnedObjectPath,
|
||||
}
|
||||
|
||||
impl CtrlKbdLed {
|
||||
pub fn new(supported_modes: LaptopLedData) -> Result<Self, RogError> {
|
||||
let mut led_prod = AuraDevice::Unknown;
|
||||
let mut usb_node = None;
|
||||
for prod in ASUS_KEYBOARD_DEVICES {
|
||||
match HidRaw::new(prod.into()) {
|
||||
Ok(node) => {
|
||||
led_prod = prod;
|
||||
usb_node = Some(node);
|
||||
info!(
|
||||
"Looked for keyboard controller 0x{}: Found",
|
||||
<&str>::from(prod)
|
||||
);
|
||||
break;
|
||||
pub fn find_all() -> Result<Vec<Self>, RogError> {
|
||||
info!("Searching for all Aura devices");
|
||||
let mut devices = Vec::new();
|
||||
let mut found = HashSet::new(); // track and ensure we use only one hidraw per prod_id
|
||||
|
||||
let mut enumerator = udev::Enumerator::new().map_err(|err| {
|
||||
warn!("{}", err);
|
||||
err
|
||||
})?;
|
||||
|
||||
enumerator.match_subsystem("hidraw").map_err(|err| {
|
||||
warn!("{}", err);
|
||||
err
|
||||
})?;
|
||||
|
||||
for end_point in enumerator.scan_devices()? {
|
||||
// usb_device gives us a product and vendor ID
|
||||
if let Some(usb_device) =
|
||||
end_point.parent_with_subsystem_devtype("usb", "usb_device")?
|
||||
{
|
||||
// The asus_wmi driver latches MCU that controls the USB endpoints
|
||||
if let Some(parent) = end_point.parent() {
|
||||
if let Some(driver) = parent.driver() {
|
||||
// There is a tree of devices added so filter by driver
|
||||
if driver != "asus" {
|
||||
continue;
|
||||
}
|
||||
} else {
|
||||
continue;
|
||||
}
|
||||
}
|
||||
Err(err) => info!(
|
||||
"Looked for keyboard controller 0x{}: {err}",
|
||||
<&str>::from(prod)
|
||||
),
|
||||
// Device is something like 002, while its parent is the MCU
|
||||
// Think of it like the device is an endpoint of the USB device attached
|
||||
let mut prod_id = String::new();
|
||||
if let Some(usb_id) = usb_device.attribute_value("idProduct") {
|
||||
prod_id = usb_id.to_string_lossy().to_string();
|
||||
let aura_dev = AuraDeviceType::from(prod_id.as_str());
|
||||
if aura_dev == AuraDeviceType::Unknown || found.contains(&aura_dev) {
|
||||
log::debug!("Unknown or invalid device: {usb_id:?}, skipping");
|
||||
continue;
|
||||
}
|
||||
found.insert(aura_dev);
|
||||
}
|
||||
|
||||
let dev_node = if let Some(dev_node) = usb_device.devnode() {
|
||||
dev_node
|
||||
} else {
|
||||
debug!("Device has no devnode, skipping");
|
||||
continue;
|
||||
};
|
||||
info!("AuraControl found device at: {:?}", dev_node);
|
||||
let dbus_path = dbus_path_for_dev(&usb_device).unwrap_or_default();
|
||||
let dev = HidRaw::from_device(end_point)?;
|
||||
let mut dev = Self::from_hidraw(dev, dbus_path)?;
|
||||
dev.config = Self::init_config(&prod_id);
|
||||
devices.push(dev);
|
||||
}
|
||||
}
|
||||
|
||||
let rgb_led = KeyboardLed::new()?;
|
||||
// Check for a TUF laptop LED. Assume there is only ever one.
|
||||
if let Ok(kbd_backlight) = KeyboardBacklight::new() {
|
||||
if kbd_backlight.has_kbd_rgb_mode() {
|
||||
// Extra sure double-check that this isn't a laptop with crap
|
||||
// ACPI with borked return on the TUF rgb methods
|
||||
let dmi = DMIID::new().unwrap_or_default();
|
||||
info!("Found a TUF with product family: {}", dmi.product_family);
|
||||
info!("and board name: {}", dmi.board_name);
|
||||
|
||||
if usb_node.is_none() && !rgb_led.has_kbd_rgb_mode() {
|
||||
let dmi = sysfs_class::DmiId::default();
|
||||
if let Ok(prod_family) = dmi.product_family() {
|
||||
if prod_family.contains("TUF") {
|
||||
warn!(
|
||||
"kbd_rgb_mode was not found in the /sys/. You require a minimum 6.1 \
|
||||
kernel and a supported TUF laptop"
|
||||
);
|
||||
if dmi.product_family.contains("TUF") {
|
||||
info!("AuraControl found a TUF laptop keyboard");
|
||||
let ctrl = CtrlKbdLed {
|
||||
led_type: AuraDeviceType::LaptopTuf,
|
||||
led_node: LEDNode::KbdLed(kbd_backlight),
|
||||
supported_data: LedSupportData::get_data("tuf"),
|
||||
per_key_mode_active: false,
|
||||
config: Self::init_config("tuf"),
|
||||
dbus_path: dbus_path_for_tuf(),
|
||||
};
|
||||
devices.push(ctrl);
|
||||
}
|
||||
}
|
||||
return Err(RogError::NoAuraKeyboard);
|
||||
}
|
||||
|
||||
let led_node = if let Some(rog) = usb_node {
|
||||
info!("Found ROG USB keyboard");
|
||||
LEDNode::Rog(rog)
|
||||
} else if rgb_led.has_kbd_rgb_mode() {
|
||||
info!("Found TUF keyboard");
|
||||
LEDNode::KbdLed(rgb_led.clone())
|
||||
} else {
|
||||
LEDNode::None
|
||||
let dmi = DMIID::new().unwrap_or_default();
|
||||
warn!("No asus::kbd_backlight found for {} ??", dmi.product_family);
|
||||
}
|
||||
|
||||
info!("Found {} Aura devices", devices.len());
|
||||
|
||||
Ok(devices)
|
||||
}
|
||||
|
||||
/// The generated data from this function has a default config. This config
|
||||
/// should be overwritten. The reason for the default config is because
|
||||
/// of async issues between this and udev/hidraw
|
||||
pub fn from_hidraw(device: HidRaw, dbus_path: OwnedObjectPath) -> Result<Self, RogError> {
|
||||
let rgb_led = KeyboardBacklight::new()
|
||||
.map_err(|e| {
|
||||
log::error!(
|
||||
"{} is missing a keyboard backlight brightness control: {e:?}",
|
||||
device.prod_id()
|
||||
);
|
||||
})
|
||||
.ok();
|
||||
let prod_id = AuraDeviceType::from(device.prod_id());
|
||||
if prod_id == AuraDeviceType::Unknown {
|
||||
log::error!("{} is AuraDevice::Unknown", device.prod_id());
|
||||
return Err(RogError::NoAuraNode);
|
||||
}
|
||||
|
||||
// New loads data from the DB also
|
||||
// let config = Self::init_config(prod_id, data);
|
||||
|
||||
let data = LedSupportData::get_data(device.prod_id());
|
||||
let ctrl = CtrlKbdLed {
|
||||
led_type: prod_id,
|
||||
led_node: LEDNode::Rog(rgb_led, device),
|
||||
supported_data: data.clone(),
|
||||
per_key_mode_active: false,
|
||||
config: AuraConfig::default(),
|
||||
dbus_path,
|
||||
};
|
||||
Ok(ctrl)
|
||||
}
|
||||
|
||||
let mut config_init = AuraConfig::create_default(led_prod, &supported_modes);
|
||||
pub fn init_config(prod_id: &str) -> AuraConfig {
|
||||
// New loads data from the DB also
|
||||
let mut config_init = AuraConfig::new(prod_id);
|
||||
// config_init.set_filename(prod_id);
|
||||
let mut config_loaded = config_init.clone().load();
|
||||
|
||||
// update the initialised data with what we loaded from disk
|
||||
for mode in &mut config_init.builtins {
|
||||
// update init values from loaded values if they exist
|
||||
if let Some(loaded) = config_loaded.builtins.get(mode.0) {
|
||||
*mode.1 = loaded.clone();
|
||||
}
|
||||
}
|
||||
// Then replace just incase the initialised data contains new modes added
|
||||
config_loaded.builtins = config_init.builtins;
|
||||
|
||||
if let (Some(mut multizone_init), Some(multizone_loaded)) =
|
||||
@@ -130,9 +245,10 @@ impl CtrlKbdLed {
|
||||
// update init values from loaded values if they exist
|
||||
if let Some(loaded) = multizone_loaded.get(mode.0) {
|
||||
let mut new_set = Vec::new();
|
||||
let data = LedSupportData::get_data(prod_id);
|
||||
// only reuse a zone mode if the mode is supported
|
||||
for mode in loaded {
|
||||
if supported_modes.basic_modes.contains(&mode.mode) {
|
||||
if data.basic_modes.contains(&mode.mode) {
|
||||
new_set.push(mode.clone());
|
||||
}
|
||||
}
|
||||
@@ -142,62 +258,21 @@ impl CtrlKbdLed {
|
||||
*multizone_loaded = multizone_init;
|
||||
}
|
||||
|
||||
let ctrl = CtrlKbdLed {
|
||||
led_prod,
|
||||
led_node, // on TUF this is the same as rgb_led / kd_brightness
|
||||
kd_brightness: rgb_led, // If was none then we already returned above
|
||||
supported_modes,
|
||||
flip_effect_write: false,
|
||||
per_key_mode_active: false,
|
||||
config: config_loaded,
|
||||
};
|
||||
Ok(ctrl)
|
||||
}
|
||||
|
||||
pub(super) fn get_brightness(&self) -> Result<u8, RogError> {
|
||||
self.kd_brightness
|
||||
.get_brightness()
|
||||
.map_err(RogError::Platform)
|
||||
}
|
||||
|
||||
pub(super) fn set_brightness(&self, brightness: LedBrightness) -> Result<(), RogError> {
|
||||
self.kd_brightness
|
||||
.set_brightness(brightness as u8)
|
||||
.map_err(RogError::Platform)
|
||||
}
|
||||
|
||||
pub fn next_brightness(&mut self) -> Result<(), RogError> {
|
||||
let mut bright = (self.config.brightness as u32) + 1;
|
||||
if bright > 3 {
|
||||
bright = 0;
|
||||
}
|
||||
self.config.brightness = <LedBrightness>::from(bright);
|
||||
self.config.write();
|
||||
self.set_brightness(self.config.brightness)
|
||||
}
|
||||
|
||||
pub fn prev_brightness(&mut self) -> Result<(), RogError> {
|
||||
let mut bright = self.config.brightness as u32;
|
||||
if bright == 0 {
|
||||
bright = 3;
|
||||
} else {
|
||||
bright -= 1;
|
||||
}
|
||||
self.config.brightness = <LedBrightness>::from(bright);
|
||||
self.config.write();
|
||||
self.set_brightness(self.config.brightness)
|
||||
config_loaded
|
||||
}
|
||||
|
||||
/// Set combination state for boot animation/sleep animation/all leds/keys
|
||||
/// leds/side leds LED active
|
||||
pub(super) fn set_power_states(&mut self) -> Result<(), RogError> {
|
||||
if let LEDNode::KbdLed(platform) = &mut self.led_node {
|
||||
if let Some(pwr) = AuraPowerConfig::to_tuf_bool_array(&self.config.enabled) {
|
||||
let buf = [1, pwr[1] as u8, pwr[2] as u8, pwr[3] as u8, pwr[4] as u8];
|
||||
platform.set_kbd_rgb_state(&buf)?;
|
||||
}
|
||||
} else if let LEDNode::Rog(hid_raw) = &self.led_node {
|
||||
let bytes = AuraPowerConfig::to_bytes(&self.config.enabled);
|
||||
if let LEDNode::KbdLed(_platform) = &mut self.led_node {
|
||||
// TODO: tuf bool array
|
||||
// if let Some(pwr) =
|
||||
// AuraPowerConfig::to_tuf_bool_array(&self.config.enabled) {
|
||||
// let buf = [1, pwr[1] as u8, pwr[2] as u8, pwr[3] as u8,
|
||||
// pwr[4] as u8]; platform.set_kbd_rgb_state(&buf)?;
|
||||
// }
|
||||
} else if let LEDNode::Rog(_, hid_raw) = &self.led_node {
|
||||
let bytes = self.config.enabled.to_bytes(self.led_type);
|
||||
let message = [0x5d, 0xbd, 0x01, bytes[0], bytes[1], bytes[2], bytes[3]];
|
||||
|
||||
hid_raw.write_bytes(&message)?;
|
||||
@@ -208,29 +283,6 @@ impl CtrlKbdLed {
|
||||
Ok(())
|
||||
}
|
||||
|
||||
/// Set an Aura effect if the effect mode or zone is supported.
|
||||
///
|
||||
/// On success the aura config file is read to refresh cached values, then
|
||||
/// the effect is stored and config written to disk.
|
||||
pub(crate) fn set_effect(&mut self, effect: AuraEffect) -> Result<(), RogError> {
|
||||
if !self.supported_modes.basic_modes.contains(&effect.mode)
|
||||
|| effect.zone != AuraZone::None
|
||||
&& !self.supported_modes.basic_zones.contains(&effect.zone)
|
||||
{
|
||||
return Err(RogError::AuraEffectNotSupported);
|
||||
}
|
||||
|
||||
self.write_mode(&effect)?;
|
||||
self.config.read(); // refresh config if successful
|
||||
self.config.set_builtin(effect);
|
||||
if self.config.brightness == LedBrightness::Off {
|
||||
self.config.brightness = LedBrightness::Med;
|
||||
}
|
||||
self.config.write();
|
||||
self.set_brightness(self.config.brightness)?;
|
||||
Ok(())
|
||||
}
|
||||
|
||||
/// Write an effect block. This is for per-key, but can be repurposed to
|
||||
/// write the raw factory mode packets - when doing this it is expected that
|
||||
/// only the first `Vec` (`effect[0]`) is valid.
|
||||
@@ -245,20 +297,20 @@ impl CtrlKbdLed {
|
||||
|
||||
if pkt_type != PER_KEY_TYPE {
|
||||
self.per_key_mode_active = false;
|
||||
if let LEDNode::Rog(hid_raw) = &self.led_node {
|
||||
if let LEDNode::Rog(_, hid_raw) = &self.led_node {
|
||||
hid_raw.write_bytes(&effect[0])?;
|
||||
hid_raw.write_bytes(&LED_SET)?;
|
||||
// hid_raw.write_bytes(&LED_APPLY)?;
|
||||
}
|
||||
} else {
|
||||
if !self.per_key_mode_active {
|
||||
if let LEDNode::Rog(hid_raw) = &self.led_node {
|
||||
if let LEDNode::Rog(_, hid_raw) = &self.led_node {
|
||||
let init = LedUsbPackets::get_init_msg();
|
||||
hid_raw.write_bytes(&init)?;
|
||||
}
|
||||
self.per_key_mode_active = true;
|
||||
}
|
||||
if let LEDNode::Rog(hid_raw) = &self.led_node {
|
||||
if let LEDNode::Rog(_, hid_raw) = &self.led_node {
|
||||
for row in effect.iter() {
|
||||
hid_raw.write_bytes(row)?;
|
||||
}
|
||||
@@ -270,47 +322,11 @@ impl CtrlKbdLed {
|
||||
tuf.set_kbd_rgb_mode(&[0, 0, r, g, b, 0])?;
|
||||
}
|
||||
}
|
||||
self.flip_effect_write = !self.flip_effect_write;
|
||||
}
|
||||
Ok(())
|
||||
}
|
||||
|
||||
pub(super) fn toggle_mode(&mut self, reverse: bool) -> Result<(), RogError> {
|
||||
let current = self.config.current_mode;
|
||||
if let Some(idx) = self
|
||||
.supported_modes
|
||||
.basic_modes
|
||||
.iter()
|
||||
.position(|v| *v == current)
|
||||
{
|
||||
let mut idx = idx;
|
||||
// goes past end of array
|
||||
if reverse {
|
||||
if idx == 0 {
|
||||
idx = self.supported_modes.basic_modes.len() - 1;
|
||||
} else {
|
||||
idx -= 1;
|
||||
}
|
||||
} else {
|
||||
idx += 1;
|
||||
if idx == self.supported_modes.basic_modes.len() {
|
||||
idx = 0;
|
||||
}
|
||||
}
|
||||
let next = self.supported_modes.basic_modes[idx];
|
||||
|
||||
self.config.read();
|
||||
// if self.config.builtins.contains_key(&next) {
|
||||
self.config.current_mode = next;
|
||||
self.write_current_config_mode()?;
|
||||
// }
|
||||
self.config.write();
|
||||
}
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
fn write_mode(&mut self, mode: &AuraEffect) -> Result<(), RogError> {
|
||||
pub fn write_mode(&mut self, mode: &AuraEffect) -> Result<(), RogError> {
|
||||
if let LEDNode::KbdLed(platform) = &self.led_node {
|
||||
let buf = [
|
||||
1,
|
||||
@@ -321,7 +337,7 @@ impl CtrlKbdLed {
|
||||
mode.speed as u8,
|
||||
];
|
||||
platform.set_kbd_rgb_mode(&buf)?;
|
||||
} else if let LEDNode::Rog(hid_raw) = &self.led_node {
|
||||
} else if let LEDNode::Rog(_, hid_raw) = &self.led_node {
|
||||
let bytes: [u8; LED_MSG_LEN] = mode.into();
|
||||
hid_raw.write_bytes(&bytes)?;
|
||||
hid_raw.write_bytes(&LED_SET)?;
|
||||
@@ -374,7 +390,7 @@ impl CtrlKbdLed {
|
||||
/// exists.
|
||||
fn create_multizone_default(&mut self) -> Result<(), RogError> {
|
||||
let mut default = vec![];
|
||||
for (i, tmp) in self.supported_modes.basic_zones.iter().enumerate() {
|
||||
for (i, tmp) in self.supported_data.basic_zones.iter().enumerate() {
|
||||
default.push(AuraEffect {
|
||||
mode: self.config.current_mode,
|
||||
zone: *tmp,
|
||||
@@ -401,112 +417,48 @@ impl CtrlKbdLed {
|
||||
|
||||
#[cfg(test)]
|
||||
mod tests {
|
||||
use rog_aura::aura_detection::{LaptopLedData, PowerZones};
|
||||
use rog_aura::usb::AuraDevice;
|
||||
use rog_aura::{AuraEffect, AuraModeNum, AuraZone, Colour};
|
||||
use rog_platform::keyboard_led::KeyboardLed;
|
||||
use rog_aura::aura_detection::LedSupportData;
|
||||
use rog_aura::{AuraDeviceType, AuraModeNum, AuraZone, PowerZones};
|
||||
use rog_platform::hid_raw::HidRaw;
|
||||
use rog_platform::keyboard_led::KeyboardBacklight;
|
||||
use zbus::zvariant::OwnedObjectPath;
|
||||
|
||||
use super::CtrlKbdLed;
|
||||
use crate::ctrl_aura::config::AuraConfig;
|
||||
use crate::ctrl_aura::controller::LEDNode;
|
||||
|
||||
#[test]
|
||||
// #[ignore = "Must be manually run due to detection stage"]
|
||||
fn check_set_mode_errors() {
|
||||
// Checking to ensure set_mode errors when unsupported modes are tried
|
||||
let config = AuraConfig::create_default(AuraDevice::X19b6, &LaptopLedData::default());
|
||||
let supported_modes = LaptopLedData {
|
||||
board_name: String::new(),
|
||||
layout_name: "ga401".to_owned(),
|
||||
basic_modes: vec![AuraModeNum::Static],
|
||||
basic_zones: vec![],
|
||||
advanced_type: rog_aura::AdvancedAuraType::None,
|
||||
power_zones: vec![PowerZones::Keyboard, PowerZones::RearGlow],
|
||||
};
|
||||
let mut controller = CtrlKbdLed {
|
||||
led_prod: AuraDevice::X19b6,
|
||||
led_node: LEDNode::None,
|
||||
kd_brightness: KeyboardLed::default(),
|
||||
supported_modes,
|
||||
flip_effect_write: false,
|
||||
per_key_mode_active: false,
|
||||
config,
|
||||
};
|
||||
|
||||
let mut effect = AuraEffect {
|
||||
colour1: Colour {
|
||||
r: 0xff,
|
||||
g: 0x00,
|
||||
b: 0xff,
|
||||
},
|
||||
zone: AuraZone::None,
|
||||
..Default::default()
|
||||
};
|
||||
|
||||
// This error comes from write_bytes because we don't have a keyboard node
|
||||
// stored
|
||||
assert_eq!(
|
||||
controller
|
||||
.set_effect(effect.clone())
|
||||
.unwrap_err()
|
||||
.to_string(),
|
||||
"No supported Aura keyboard"
|
||||
);
|
||||
|
||||
effect.mode = AuraModeNum::Laser;
|
||||
assert_eq!(
|
||||
controller
|
||||
.set_effect(effect.clone())
|
||||
.unwrap_err()
|
||||
.to_string(),
|
||||
"Aura effect not supported"
|
||||
);
|
||||
|
||||
effect.mode = AuraModeNum::Static;
|
||||
effect.zone = AuraZone::Key2;
|
||||
assert_eq!(
|
||||
controller
|
||||
.set_effect(effect.clone())
|
||||
.unwrap_err()
|
||||
.to_string(),
|
||||
"Aura effect not supported"
|
||||
);
|
||||
|
||||
controller.supported_modes.basic_zones.push(AuraZone::Key2);
|
||||
assert_eq!(
|
||||
controller.set_effect(effect).unwrap_err().to_string(),
|
||||
"No supported Aura keyboard"
|
||||
);
|
||||
}
|
||||
|
||||
#[test]
|
||||
#[ignore = "Unable to run in CI as the HIDRAW device is required"]
|
||||
fn create_multizone_if_no_config() {
|
||||
// Checking to ensure set_mode errors when unsupported modes are tried
|
||||
let config = AuraConfig::create_default(AuraDevice::X19b6, &LaptopLedData::default());
|
||||
let supported_modes = LaptopLedData {
|
||||
board_name: String::new(),
|
||||
let config = AuraConfig::new("19b6");
|
||||
let supported_basic_modes = LedSupportData {
|
||||
device_name: String::new(),
|
||||
product_id: String::new(),
|
||||
layout_name: "ga401".to_owned(),
|
||||
basic_modes: vec![AuraModeNum::Static],
|
||||
basic_zones: vec![],
|
||||
advanced_type: rog_aura::AdvancedAuraType::None,
|
||||
advanced_type: rog_aura::keyboard::AdvancedAuraType::None,
|
||||
power_zones: vec![PowerZones::Keyboard, PowerZones::RearGlow],
|
||||
};
|
||||
let mut controller = CtrlKbdLed {
|
||||
led_prod: AuraDevice::X19b6,
|
||||
led_node: LEDNode::None,
|
||||
kd_brightness: KeyboardLed::default(),
|
||||
supported_modes,
|
||||
flip_effect_write: false,
|
||||
led_type: AuraDeviceType::LaptopPost2021,
|
||||
led_node: LEDNode::Rog(
|
||||
Some(KeyboardBacklight::default()),
|
||||
HidRaw::new("19b6").unwrap(),
|
||||
),
|
||||
supported_data: supported_basic_modes,
|
||||
per_key_mode_active: false,
|
||||
config,
|
||||
dbus_path: OwnedObjectPath::default(),
|
||||
};
|
||||
|
||||
assert!(controller.config.multizone.is_none());
|
||||
assert!(controller.create_multizone_default().is_err());
|
||||
assert!(controller.config.multizone.is_none());
|
||||
|
||||
controller.supported_modes.basic_zones.push(AuraZone::Key1);
|
||||
controller.supported_modes.basic_zones.push(AuraZone::Key2);
|
||||
controller.supported_data.basic_zones.push(AuraZone::Key1);
|
||||
controller.supported_data.basic_zones.push(AuraZone::Key2);
|
||||
assert!(controller.create_multizone_default().is_ok());
|
||||
assert!(controller.config.multizone.is_some());
|
||||
|
||||
@@ -519,25 +471,30 @@ mod tests {
|
||||
}
|
||||
|
||||
#[test]
|
||||
#[ignore = "Unable to run in CI as the HIDRAW device is required"]
|
||||
// TODO: use sim device
|
||||
fn next_mode_create_multizone_if_no_config() {
|
||||
// Checking to ensure set_mode errors when unsupported modes are tried
|
||||
let config = AuraConfig::create_default(AuraDevice::X19b6, &LaptopLedData::default());
|
||||
let supported_modes = LaptopLedData {
|
||||
board_name: String::new(),
|
||||
let config = AuraConfig::new("19b6");
|
||||
let supported_basic_modes = LedSupportData {
|
||||
device_name: String::new(),
|
||||
product_id: String::new(),
|
||||
layout_name: "ga401".to_owned(),
|
||||
basic_modes: vec![AuraModeNum::Static],
|
||||
basic_zones: vec![AuraZone::Key1, AuraZone::Key2],
|
||||
advanced_type: rog_aura::AdvancedAuraType::None,
|
||||
advanced_type: rog_aura::keyboard::AdvancedAuraType::None,
|
||||
power_zones: vec![PowerZones::Keyboard, PowerZones::RearGlow],
|
||||
};
|
||||
let mut controller = CtrlKbdLed {
|
||||
led_prod: AuraDevice::X19b6,
|
||||
led_node: LEDNode::None,
|
||||
kd_brightness: KeyboardLed::default(),
|
||||
supported_modes,
|
||||
flip_effect_write: false,
|
||||
led_type: AuraDeviceType::LaptopPost2021,
|
||||
led_node: LEDNode::Rog(
|
||||
Some(KeyboardBacklight::default()),
|
||||
HidRaw::new("19b6").unwrap(),
|
||||
),
|
||||
supported_data: supported_basic_modes,
|
||||
per_key_mode_active: false,
|
||||
config,
|
||||
dbus_path: OwnedObjectPath::default(),
|
||||
};
|
||||
|
||||
assert!(controller.config.multizone.is_none());
|
||||
|
||||
187
asusd/src/ctrl_aura/manager.rs
Normal file
187
asusd/src/ctrl_aura/manager.rs
Normal file
@@ -0,0 +1,187 @@
|
||||
// Plan:
|
||||
// - Manager has udev monitor on USB looking for ROG devices
|
||||
// - If a device is found, add it to watch
|
||||
// - Add it to Zbus server
|
||||
// - If udev sees device removed then remove the zbus path
|
||||
|
||||
use std::collections::HashSet;
|
||||
|
||||
use log::{debug, error, info, warn};
|
||||
use mio::{Events, Interest, Poll, Token};
|
||||
use rog_aura::AuraDeviceType;
|
||||
use rog_platform::hid_raw::HidRaw;
|
||||
use tokio::task::spawn_blocking;
|
||||
use udev::{Device, MonitorBuilder};
|
||||
use zbus::object_server::SignalContext;
|
||||
use zbus::zvariant::{ObjectPath, OwnedObjectPath};
|
||||
use zbus::Connection;
|
||||
|
||||
use crate::ctrl_aura::controller::CtrlKbdLed;
|
||||
use crate::ctrl_aura::trait_impls::{CtrlAuraZbus, AURA_ZBUS_PATH};
|
||||
use crate::error::RogError;
|
||||
use crate::{CtrlTask, Reloadable};
|
||||
|
||||
pub struct AuraManager {
|
||||
_connection: Connection,
|
||||
}
|
||||
|
||||
impl AuraManager {
|
||||
pub async fn new(connection: Connection) -> Result<Self, RogError> {
|
||||
let conn_copy = connection.clone();
|
||||
let mut interfaces = HashSet::new();
|
||||
|
||||
// Do the initial keyboard detection:
|
||||
let all = CtrlKbdLed::find_all()?;
|
||||
for ctrl in all {
|
||||
let path = ctrl.dbus_path.clone();
|
||||
interfaces.insert(path.clone()); // ensure we record the initial stuff
|
||||
let sig_ctx = CtrlAuraZbus::signal_context(&connection)?;
|
||||
let sig_ctx2 = sig_ctx.clone();
|
||||
let zbus = CtrlAuraZbus::new(ctrl, sig_ctx);
|
||||
start_tasks(zbus, connection.clone(), sig_ctx2, path).await?;
|
||||
}
|
||||
|
||||
let manager = Self {
|
||||
_connection: connection,
|
||||
};
|
||||
|
||||
// detect all plugged in aura devices (eventually)
|
||||
// only USB devices are detected for here
|
||||
spawn_blocking(move || {
|
||||
let mut monitor = MonitorBuilder::new()?.match_subsystem("hidraw")?.listen()?;
|
||||
let mut poll = Poll::new()?;
|
||||
let mut events = Events::with_capacity(1024);
|
||||
poll.registry()
|
||||
.register(&mut monitor, Token(0), Interest::READABLE)?;
|
||||
|
||||
loop {
|
||||
if poll.poll(&mut events, None).is_err() {
|
||||
continue;
|
||||
}
|
||||
for event in monitor.iter() {
|
||||
let parent = if let Some(parent) =
|
||||
event.parent_with_subsystem_devtype("usb", "usb_device")?
|
||||
{
|
||||
parent
|
||||
} else {
|
||||
continue;
|
||||
};
|
||||
|
||||
let action = if let Some(action) = event.action() {
|
||||
action
|
||||
} else {
|
||||
continue;
|
||||
};
|
||||
|
||||
let id_product = if let Some(id_product) = parent.attribute_value("idProduct") {
|
||||
id_product.to_string_lossy()
|
||||
} else {
|
||||
continue;
|
||||
};
|
||||
|
||||
let path = if let Some(path) = dbus_path_for_dev(&parent) {
|
||||
path
|
||||
} else {
|
||||
continue;
|
||||
};
|
||||
|
||||
let aura_device = AuraDeviceType::from(&*id_product);
|
||||
if aura_device == AuraDeviceType::Unknown {
|
||||
warn!("idProduct:{id_product:?} is unknown, not using");
|
||||
continue;
|
||||
}
|
||||
|
||||
if action == "remove" {
|
||||
if interfaces.remove(&path) {
|
||||
info!("AuraManager removing: {path:?}");
|
||||
let conn_copy = conn_copy.clone();
|
||||
tokio::spawn(async move {
|
||||
let res = conn_copy
|
||||
.object_server()
|
||||
.remove::<CtrlAuraZbus, _>(&path)
|
||||
.await
|
||||
.map_err(|e| {
|
||||
error!("Failed to remove {path:?}, {e:?}");
|
||||
e
|
||||
})?;
|
||||
info!("AuraManager removed: {path:?}, {res}");
|
||||
Ok::<(), RogError>(())
|
||||
});
|
||||
}
|
||||
} else if action == "add" {
|
||||
if interfaces.contains(&path) {
|
||||
debug!("Already a ctrl at {path:?}");
|
||||
continue;
|
||||
}
|
||||
|
||||
// Need to check the driver is asus to prevent using hid_generic
|
||||
if let Some(p2) = event.parent() {
|
||||
if let Some(driver) = p2.driver() {
|
||||
// There is a tree of devices added so filter by driver
|
||||
if driver != "asus" {
|
||||
debug!("{id_product:?} driver was not asus, skipping");
|
||||
continue;
|
||||
}
|
||||
} else {
|
||||
continue;
|
||||
}
|
||||
}
|
||||
|
||||
if let Some(dev_node) = event.devnode() {
|
||||
if let Ok(raw) = HidRaw::from_device(event.device())
|
||||
.map_err(|e| error!("device path error: {e:?}"))
|
||||
{
|
||||
if let Ok(mut ctrl) = CtrlKbdLed::from_hidraw(raw, path.clone()) {
|
||||
ctrl.config = CtrlKbdLed::init_config(&id_product);
|
||||
interfaces.insert(path.clone());
|
||||
info!("AuraManager starting device at: {dev_node:?}, {path:?}");
|
||||
let sig_ctx = CtrlAuraZbus::signal_context(&conn_copy)?;
|
||||
let zbus = CtrlAuraZbus::new(ctrl, sig_ctx);
|
||||
let sig_ctx = CtrlAuraZbus::signal_context(&conn_copy)?;
|
||||
let conn_copy = conn_copy.clone();
|
||||
tokio::spawn(async move {
|
||||
start_tasks(zbus, conn_copy.clone(), sig_ctx, path).await
|
||||
});
|
||||
}
|
||||
}
|
||||
}
|
||||
};
|
||||
}
|
||||
}
|
||||
// Required for return type on spawn
|
||||
#[allow(unreachable_code)]
|
||||
Ok::<(), RogError>(())
|
||||
});
|
||||
Ok(manager)
|
||||
}
|
||||
}
|
||||
|
||||
pub(crate) fn dbus_path_for_dev(parent: &Device) -> Option<OwnedObjectPath> {
|
||||
if let Some(filename) = super::filename_partial(parent) {
|
||||
return Some(
|
||||
ObjectPath::from_str_unchecked(&format!("{AURA_ZBUS_PATH}/{filename}")).into(),
|
||||
);
|
||||
}
|
||||
None
|
||||
}
|
||||
|
||||
pub(crate) fn dbus_path_for_tuf() -> OwnedObjectPath {
|
||||
ObjectPath::from_str_unchecked(&format!("{AURA_ZBUS_PATH}/tuf")).into()
|
||||
}
|
||||
|
||||
async fn start_tasks(
|
||||
mut zbus: CtrlAuraZbus,
|
||||
connection: Connection,
|
||||
_signal_ctx: SignalContext<'static>,
|
||||
path: OwnedObjectPath,
|
||||
) -> Result<(), RogError> {
|
||||
// let task = zbus.clone();
|
||||
// let signal_ctx = signal_ctx.clone();
|
||||
zbus.reload()
|
||||
.await
|
||||
.unwrap_or_else(|err| warn!("Controller error: {}", err));
|
||||
connection.object_server().at(path, zbus).await.unwrap();
|
||||
// TODO: skip this until we keep handles to tasks so they can be killed
|
||||
// task.create_tasks(signal_ctx).await
|
||||
Ok(())
|
||||
}
|
||||
@@ -1,4 +1,29 @@
|
||||
use udev::Device;
|
||||
use zbus::zvariant::{ObjectPath, OwnedObjectPath};
|
||||
|
||||
pub mod config;
|
||||
pub mod controller;
|
||||
pub mod manager;
|
||||
/// Implements `CtrlTask`, `Reloadable`, `ZbusRun`
|
||||
pub mod trait_impls;
|
||||
|
||||
/// Returns only the Device details concatenated in a form usable for
|
||||
/// adding/appending to a filename
|
||||
pub(super) fn filename_partial(parent: &Device) -> Option<OwnedObjectPath> {
|
||||
if let Some(id_product) = parent.attribute_value("idProduct") {
|
||||
let id_product = id_product.to_string_lossy();
|
||||
let path = if let Some(devnum) = parent.attribute_value("devnum") {
|
||||
let devnum = devnum.to_string_lossy();
|
||||
if let Some(devpath) = parent.attribute_value("devpath") {
|
||||
let devpath = devpath.to_string_lossy();
|
||||
format!("{id_product}_{devnum}_{devpath}")
|
||||
} else {
|
||||
format!("{id_product}_{devnum}")
|
||||
}
|
||||
} else {
|
||||
format!("{id_product}")
|
||||
};
|
||||
return Some(ObjectPath::from_str_unchecked(&path).into());
|
||||
}
|
||||
None
|
||||
}
|
||||
|
||||
@@ -1,308 +1,302 @@
|
||||
use std::collections::BTreeMap;
|
||||
use std::sync::Arc;
|
||||
|
||||
use async_trait::async_trait;
|
||||
use config_traits::StdConfig;
|
||||
use log::{error, info, warn};
|
||||
use rog_aura::advanced::UsbPackets;
|
||||
use rog_aura::usb::{AuraDevice, AuraPowerDev};
|
||||
use rog_aura::{AuraEffect, AuraModeNum, LedBrightness};
|
||||
use log::{debug, error, info, warn};
|
||||
use rog_aura::keyboard::{LaptopAuraPower, UsbPackets};
|
||||
use rog_aura::{AuraDeviceType, AuraEffect, AuraModeNum, AuraZone, LedBrightness, PowerZones};
|
||||
use zbus::export::futures_util::lock::{Mutex, MutexGuard};
|
||||
use zbus::export::futures_util::StreamExt;
|
||||
use zbus::{dbus_interface, Connection, SignalContext};
|
||||
use zbus::fdo::Error as ZbErr;
|
||||
use zbus::{interface, SignalContext};
|
||||
|
||||
use super::controller::CtrlKbdLed;
|
||||
use crate::error::RogError;
|
||||
use crate::CtrlTask;
|
||||
|
||||
pub(super) const ZBUS_PATH: &str = "/org/asuslinux/Aura";
|
||||
pub const AURA_ZBUS_NAME: &str = "Aura";
|
||||
pub const AURA_ZBUS_PATH: &str = "/org/asuslinux";
|
||||
|
||||
#[derive(Clone)]
|
||||
pub struct CtrlKbdLedZbus(pub Arc<Mutex<CtrlKbdLed>>);
|
||||
pub struct CtrlAuraZbus(Arc<Mutex<CtrlKbdLed>>, SignalContext<'static>);
|
||||
|
||||
impl CtrlAuraZbus {
|
||||
pub fn new(controller: CtrlKbdLed, signal: SignalContext<'static>) -> Self {
|
||||
Self(Arc::new(Mutex::new(controller)), signal)
|
||||
}
|
||||
|
||||
impl CtrlKbdLedZbus {
|
||||
fn update_config(lock: &mut CtrlKbdLed) -> Result<(), RogError> {
|
||||
let bright = lock.kd_brightness.get_brightness()?;
|
||||
let bright = lock.led_node.get_brightness().unwrap_or_default();
|
||||
lock.config.read();
|
||||
lock.config.brightness = (bright as u32).into();
|
||||
lock.config.brightness = bright.into();
|
||||
lock.config.write();
|
||||
Ok(())
|
||||
}
|
||||
}
|
||||
|
||||
#[async_trait]
|
||||
impl crate::ZbusRun for CtrlKbdLedZbus {
|
||||
async fn add_to_server(self, server: &mut Connection) {
|
||||
Self::add_to_server_helper(self, ZBUS_PATH, server).await;
|
||||
}
|
||||
}
|
||||
|
||||
/// The main interface for changing, reading, or notfying signals
|
||||
/// The main interface for changing, reading, or notfying
|
||||
///
|
||||
/// LED commands are split between Brightness, Modes, Per-Key
|
||||
#[dbus_interface(name = "org.asuslinux.Daemon")]
|
||||
impl CtrlKbdLedZbus {
|
||||
/// Set the keyboard brightness level (0-3)
|
||||
async fn set_brightness(&mut self, brightness: LedBrightness) {
|
||||
#[interface(name = "org.asuslinux.Aura")]
|
||||
impl CtrlAuraZbus {
|
||||
/// Return the device type for this Aura keyboard
|
||||
#[zbus(property)]
|
||||
async fn device_type(&self) -> AuraDeviceType {
|
||||
let ctrl = self.0.lock().await;
|
||||
ctrl.set_brightness(brightness)
|
||||
.map_err(|err| warn!("{}", err))
|
||||
.ok();
|
||||
ctrl.led_type
|
||||
}
|
||||
|
||||
/// Return the current LED brightness
|
||||
#[zbus(property)]
|
||||
async fn brightness(&self) -> Result<LedBrightness, ZbErr> {
|
||||
let ctrl = self.0.lock().await;
|
||||
Ok(ctrl.led_node.get_brightness().map(|n| n.into())?)
|
||||
}
|
||||
|
||||
/// Set the keyboard brightness level (0-3)
|
||||
#[zbus(property)]
|
||||
async fn set_brightness(&mut self, brightness: LedBrightness) -> Result<(), ZbErr> {
|
||||
let ctrl = self.0.lock().await;
|
||||
Ok(ctrl.led_node.set_brightness(brightness.into())?)
|
||||
}
|
||||
|
||||
/// Total levels of brightness available
|
||||
#[zbus(property)]
|
||||
async fn supported_brightness(&self) -> Vec<LedBrightness> {
|
||||
vec![
|
||||
LedBrightness::Off,
|
||||
LedBrightness::Low,
|
||||
LedBrightness::Med,
|
||||
LedBrightness::High,
|
||||
]
|
||||
}
|
||||
|
||||
/// The total available modes
|
||||
#[zbus(property)]
|
||||
async fn supported_basic_modes(&self) -> Result<Vec<AuraModeNum>, ZbErr> {
|
||||
let ctrl = self.0.lock().await;
|
||||
Ok(ctrl.config.builtins.keys().cloned().collect())
|
||||
}
|
||||
|
||||
#[zbus(property)]
|
||||
async fn supported_basic_zones(&self) -> Result<Vec<AuraZone>, ZbErr> {
|
||||
let ctrl = self.0.lock().await;
|
||||
Ok(ctrl.supported_data.basic_zones.clone())
|
||||
}
|
||||
|
||||
#[zbus(property)]
|
||||
async fn supported_power_zones(&self) -> Result<Vec<PowerZones>, ZbErr> {
|
||||
let ctrl = self.0.lock().await;
|
||||
Ok(ctrl.supported_data.power_zones.clone())
|
||||
}
|
||||
|
||||
/// The current mode data
|
||||
#[zbus(property)]
|
||||
async fn led_mode(&self) -> Result<AuraModeNum, ZbErr> {
|
||||
let ctrl = self.0.lock().await;
|
||||
Ok(ctrl.config.current_mode)
|
||||
}
|
||||
|
||||
/// Set an Aura effect if the effect mode or zone is supported.
|
||||
///
|
||||
/// On success the aura config file is read to refresh cached values, then
|
||||
/// the effect is stored and config written to disk.
|
||||
#[zbus(property)]
|
||||
async fn set_led_mode(&mut self, num: AuraModeNum) -> Result<(), ZbErr> {
|
||||
let mut ctrl = self.0.lock().await;
|
||||
ctrl.config.current_mode = num;
|
||||
ctrl.write_current_config_mode()?;
|
||||
if ctrl.config.brightness == LedBrightness::Off {
|
||||
ctrl.config.brightness = LedBrightness::Med;
|
||||
}
|
||||
if ctrl.led_node.has_brightness_control() {
|
||||
ctrl.led_node
|
||||
.set_brightness(ctrl.config.brightness.into())?;
|
||||
}
|
||||
ctrl.config.write();
|
||||
|
||||
self.led_mode_data_invalidate(&self.1).await.ok();
|
||||
Ok(())
|
||||
}
|
||||
|
||||
/// The current mode data
|
||||
#[zbus(property)]
|
||||
async fn led_mode_data(&self) -> Result<AuraEffect, ZbErr> {
|
||||
let ctrl = self.0.lock().await;
|
||||
let mode = ctrl.config.current_mode;
|
||||
match ctrl.config.builtins.get(&mode) {
|
||||
Some(effect) => Ok(effect.clone()),
|
||||
None => Err(ZbErr::Failed("Could not get the current effect".into())),
|
||||
}
|
||||
}
|
||||
|
||||
/// Set an Aura effect if the effect mode or zone is supported.
|
||||
///
|
||||
/// On success the aura config file is read to refresh cached values, then
|
||||
/// the effect is stored and config written to disk.
|
||||
#[zbus(property)]
|
||||
async fn set_led_mode_data(&mut self, effect: AuraEffect) -> Result<(), ZbErr> {
|
||||
let mut ctrl = self.0.lock().await;
|
||||
if !ctrl.supported_data.basic_modes.contains(&effect.mode)
|
||||
|| effect.zone != AuraZone::None
|
||||
&& !ctrl.supported_data.basic_zones.contains(&effect.zone)
|
||||
{
|
||||
return Err(ZbErr::NotSupported(format!(
|
||||
"The Aura effect is not supported: {effect:?}"
|
||||
)));
|
||||
}
|
||||
|
||||
ctrl.write_mode(&effect)?;
|
||||
if ctrl.config.brightness == LedBrightness::Off {
|
||||
ctrl.config.brightness = LedBrightness::Med;
|
||||
}
|
||||
if ctrl.led_node.has_brightness_control() {
|
||||
ctrl.led_node
|
||||
.set_brightness(ctrl.config.brightness.into())?;
|
||||
}
|
||||
ctrl.config.set_builtin(effect);
|
||||
ctrl.config.write();
|
||||
|
||||
self.led_mode_invalidate(&self.1).await.ok();
|
||||
Ok(())
|
||||
}
|
||||
|
||||
/// Get the data set for every mode available
|
||||
async fn all_mode_data(&self) -> BTreeMap<AuraModeNum, AuraEffect> {
|
||||
let ctrl = self.0.lock().await;
|
||||
ctrl.config.builtins.clone()
|
||||
}
|
||||
|
||||
// As property doesn't work for AuraPowerDev (complexity of serialization?)
|
||||
#[zbus(property)]
|
||||
async fn led_power(&self) -> LaptopAuraPower {
|
||||
let ctrl = self.0.lock().await;
|
||||
ctrl.config.enabled.clone()
|
||||
}
|
||||
|
||||
/// Set a variety of states, input is array of enum.
|
||||
/// `enabled` sets if the sent array should be disabled or enabled
|
||||
///
|
||||
/// For Modern ROG devices the "enabled" flag is ignored.
|
||||
async fn set_led_power(
|
||||
&mut self,
|
||||
#[zbus(signal_context)] ctxt: SignalContext<'_>,
|
||||
options: AuraPowerDev,
|
||||
enabled: bool,
|
||||
) -> zbus::fdo::Result<()> {
|
||||
#[zbus(property)]
|
||||
async fn set_led_power(&mut self, options: LaptopAuraPower) -> Result<(), ZbErr> {
|
||||
let mut ctrl = self.0.lock().await;
|
||||
for p in options.tuf {
|
||||
ctrl.config.enabled.set_tuf(p, enabled);
|
||||
for opt in options.states {
|
||||
let zone = opt.zone;
|
||||
for config in ctrl.config.enabled.states.iter_mut() {
|
||||
if config.zone == zone {
|
||||
*config = opt;
|
||||
}
|
||||
}
|
||||
}
|
||||
for p in options.old_rog {
|
||||
ctrl.config.enabled.set_0x1866(p, enabled);
|
||||
}
|
||||
ctrl.config.enabled.set_0x19b6(options.rog);
|
||||
|
||||
ctrl.config.write();
|
||||
|
||||
ctrl.set_power_states().map_err(|e| {
|
||||
Ok(ctrl.set_power_states().map_err(|e| {
|
||||
warn!("{}", e);
|
||||
e
|
||||
})?;
|
||||
|
||||
Self::notify_power_states(&ctxt, &AuraPowerDev::from(&ctrl.config.enabled))
|
||||
.await
|
||||
.unwrap_or_else(|err| warn!("{}", err));
|
||||
Ok(())
|
||||
}
|
||||
|
||||
async fn set_led_mode(
|
||||
&mut self,
|
||||
#[zbus(signal_context)] ctxt: SignalContext<'_>,
|
||||
effect: AuraEffect,
|
||||
) -> zbus::fdo::Result<()> {
|
||||
let mut ctrl = self.0.lock().await;
|
||||
|
||||
ctrl.set_effect(effect).map_err(|e| {
|
||||
warn!("{}", e);
|
||||
e
|
||||
})?;
|
||||
|
||||
ctrl.set_brightness(ctrl.config.brightness).map_err(|e| {
|
||||
warn!("{}", e);
|
||||
e
|
||||
})?;
|
||||
|
||||
if let Some(mode) = ctrl.config.builtins.get(&ctrl.config.current_mode) {
|
||||
Self::notify_led(&ctxt, mode.clone())
|
||||
.await
|
||||
.unwrap_or_else(|err| warn!("{}", err));
|
||||
}
|
||||
Ok(())
|
||||
}
|
||||
|
||||
async fn next_led_mode(
|
||||
&self,
|
||||
#[zbus(signal_context)] ctxt: SignalContext<'_>,
|
||||
) -> zbus::fdo::Result<()> {
|
||||
let mut ctrl = self.0.lock().await;
|
||||
|
||||
ctrl.toggle_mode(false).map_err(|e| {
|
||||
warn!("{}", e);
|
||||
e
|
||||
})?;
|
||||
|
||||
if let Some(mode) = ctrl.config.builtins.get(&ctrl.config.current_mode) {
|
||||
Self::notify_led(&ctxt, mode.clone())
|
||||
.await
|
||||
.unwrap_or_else(|err| warn!("{}", err));
|
||||
}
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
async fn prev_led_mode(
|
||||
&self,
|
||||
#[zbus(signal_context)] ctxt: SignalContext<'_>,
|
||||
) -> zbus::fdo::Result<()> {
|
||||
let mut ctrl = self.0.lock().await;
|
||||
|
||||
ctrl.toggle_mode(true).map_err(|e| {
|
||||
warn!("{}", e);
|
||||
e
|
||||
})?;
|
||||
|
||||
if let Some(mode) = ctrl.config.builtins.get(&ctrl.config.current_mode) {
|
||||
Self::notify_led(&ctxt, mode.clone())
|
||||
.await
|
||||
.unwrap_or_else(|err| warn!("{}", err));
|
||||
}
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
async fn next_led_brightness(&self) -> zbus::fdo::Result<()> {
|
||||
let mut ctrl = self.0.lock().await;
|
||||
ctrl.next_brightness().map_err(|e| {
|
||||
warn!("{}", e);
|
||||
e
|
||||
})?;
|
||||
Ok(())
|
||||
}
|
||||
|
||||
async fn prev_led_brightness(&self) -> zbus::fdo::Result<()> {
|
||||
let mut ctrl = self.0.lock().await;
|
||||
ctrl.prev_brightness().map_err(|e| {
|
||||
warn!("{}", e);
|
||||
e
|
||||
})?;
|
||||
Ok(())
|
||||
}
|
||||
|
||||
/// Return the device type for this Aura keyboard
|
||||
async fn device_type(&self) -> AuraDevice {
|
||||
let ctrl = self.0.lock().await;
|
||||
ctrl.led_prod
|
||||
}
|
||||
|
||||
// As property doesn't work for AuraPowerDev (complexity of serialization?)
|
||||
// #[dbus_interface(property)]
|
||||
async fn led_power(&self) -> AuraPowerDev {
|
||||
let ctrl = self.0.lock().await;
|
||||
AuraPowerDev::from(&ctrl.config.enabled)
|
||||
}
|
||||
|
||||
/// Return the current mode data
|
||||
async fn led_mode(&self) -> AuraModeNum {
|
||||
let ctrl = self.0.lock().await;
|
||||
ctrl.config.current_mode
|
||||
}
|
||||
|
||||
/// Return a list of available modes
|
||||
async fn led_modes(&self) -> BTreeMap<AuraModeNum, AuraEffect> {
|
||||
let ctrl = self.0.lock().await;
|
||||
ctrl.config.builtins.clone()
|
||||
})?)
|
||||
}
|
||||
|
||||
/// On machine that have some form of either per-key keyboard or per-zone
|
||||
/// this can be used to write custom effects over dbus. The input is a
|
||||
/// nested `Vec<Vec<8>>` where `Vec<u8>` is a raw USB packet
|
||||
async fn direct_addressing_raw(&self, data: UsbPackets) -> zbus::fdo::Result<()> {
|
||||
async fn direct_addressing_raw(&self, data: UsbPackets) -> Result<(), ZbErr> {
|
||||
let mut ctrl = self.0.lock().await;
|
||||
ctrl.write_effect_block(&data)?;
|
||||
Ok(())
|
||||
}
|
||||
|
||||
/// Return the current LED brightness
|
||||
#[dbus_interface(property)]
|
||||
async fn led_brightness(&self) -> i8 {
|
||||
let ctrl = self.0.lock().await;
|
||||
ctrl.get_brightness().map(|n| n as i8).unwrap_or(-1)
|
||||
}
|
||||
|
||||
#[dbus_interface(signal)]
|
||||
async fn notify_led(signal_ctxt: &SignalContext<'_>, data: AuraEffect) -> zbus::Result<()>;
|
||||
|
||||
#[dbus_interface(signal)]
|
||||
async fn notify_power_states(
|
||||
signal_ctxt: &SignalContext<'_>,
|
||||
data: &AuraPowerDev,
|
||||
) -> zbus::Result<()>;
|
||||
}
|
||||
|
||||
#[async_trait]
|
||||
impl CtrlTask for CtrlKbdLedZbus {
|
||||
impl CtrlTask for CtrlAuraZbus {
|
||||
fn zbus_path() -> &'static str {
|
||||
ZBUS_PATH
|
||||
"/org/asuslinux"
|
||||
}
|
||||
|
||||
async fn create_tasks(&self, _: SignalContext<'static>) -> Result<(), RogError> {
|
||||
let load_save = |start: bool, mut lock: MutexGuard<'_, CtrlKbdLed>| {
|
||||
// If waking up
|
||||
if !start {
|
||||
info!("CtrlKbdLedTask reloading brightness and modes");
|
||||
lock.set_brightness(lock.config.brightness)
|
||||
.map_err(|e| error!("CtrlKbdLedTask: {e}"))
|
||||
.ok();
|
||||
lock.write_current_config_mode()
|
||||
.map_err(|e| error!("CtrlKbdLedTask: {e}"))
|
||||
.ok();
|
||||
} else if start {
|
||||
Self::update_config(&mut lock)
|
||||
.map_err(|e| error!("CtrlKbdLedTask: {e}"))
|
||||
.ok();
|
||||
}
|
||||
};
|
||||
let load_save =
|
||||
|start: bool, mut lock: MutexGuard<'_, CtrlKbdLed>| -> Result<(), RogError> {
|
||||
// If waking up
|
||||
if !start {
|
||||
info!("CtrlKbdLedTask reloading brightness and modes");
|
||||
if lock.led_node.has_brightness_control() {
|
||||
lock.led_node
|
||||
.set_brightness(lock.config.brightness.into())
|
||||
.map_err(|e| {
|
||||
error!("CtrlKbdLedTask: {e}");
|
||||
e
|
||||
})?;
|
||||
}
|
||||
lock.write_current_config_mode().map_err(|e| {
|
||||
error!("CtrlKbdLedTask: {e}");
|
||||
e
|
||||
})?;
|
||||
} else if start {
|
||||
Self::update_config(&mut lock).map_err(|e| {
|
||||
error!("CtrlKbdLedTask: {e}");
|
||||
e
|
||||
})?;
|
||||
}
|
||||
Ok(())
|
||||
};
|
||||
|
||||
let inner1 = self.0.clone();
|
||||
let inner2 = self.0.clone();
|
||||
let inner3 = self.0.clone();
|
||||
let inner4 = self.0.clone();
|
||||
self.create_sys_event_tasks(
|
||||
// Loop so that we do aquire the lock but also don't block other
|
||||
// threads (prevents potential deadlocks)
|
||||
move || {
|
||||
move |sleeping| {
|
||||
let inner1 = inner1.clone();
|
||||
async move {
|
||||
let lock = inner1.lock().await;
|
||||
load_save(true, lock);
|
||||
load_save(sleeping, lock).unwrap(); // unwrap as we want to
|
||||
// bomb out of the task
|
||||
}
|
||||
},
|
||||
move || {
|
||||
let inner2 = inner2.clone();
|
||||
async move {
|
||||
let lock = inner2.lock().await;
|
||||
load_save(false, lock);
|
||||
}
|
||||
},
|
||||
move || {
|
||||
move |_shutting_down| {
|
||||
let inner3 = inner3.clone();
|
||||
async move {
|
||||
let lock = inner3.lock().await;
|
||||
load_save(false, lock);
|
||||
load_save(false, lock).unwrap(); // unwrap as we want to
|
||||
// bomb out of the task
|
||||
}
|
||||
},
|
||||
move || {
|
||||
let inner4 = inner4.clone();
|
||||
async move {
|
||||
let lock = inner4.lock().await;
|
||||
load_save(false, lock);
|
||||
}
|
||||
move |_lid_closed| {
|
||||
// on lid change
|
||||
async move {}
|
||||
},
|
||||
move |_power_plugged| {
|
||||
// power change
|
||||
async move {}
|
||||
},
|
||||
)
|
||||
.await;
|
||||
|
||||
let ctrl2 = self.0.clone();
|
||||
let ctrl = self.0.lock().await;
|
||||
let watch = ctrl.kd_brightness.monitor_brightness()?;
|
||||
tokio::spawn(async move {
|
||||
let mut buffer = [0; 32];
|
||||
watch
|
||||
.into_event_stream(&mut buffer)
|
||||
.unwrap()
|
||||
.for_each(|_| async {
|
||||
if let Some(lock) = ctrl2.try_lock() {
|
||||
load_save(true, lock);
|
||||
}
|
||||
})
|
||||
.await;
|
||||
});
|
||||
if ctrl.led_node.has_brightness_control() {
|
||||
let watch = ctrl.led_node.monitor_brightness()?;
|
||||
tokio::spawn(async move {
|
||||
let mut buffer = [0; 32];
|
||||
watch
|
||||
.into_event_stream(&mut buffer)
|
||||
.unwrap()
|
||||
.for_each(|_| async {
|
||||
if let Some(lock) = ctrl2.try_lock() {
|
||||
load_save(true, lock).unwrap(); // unwrap as we want to
|
||||
// bomb out of the task
|
||||
}
|
||||
})
|
||||
.await;
|
||||
});
|
||||
}
|
||||
|
||||
Ok(())
|
||||
}
|
||||
}
|
||||
|
||||
#[async_trait]
|
||||
impl crate::Reloadable for CtrlKbdLedZbus {
|
||||
impl crate::Reloadable for CtrlAuraZbus {
|
||||
async fn reload(&mut self) -> Result<(), RogError> {
|
||||
let mut ctrl = self.0.lock().await;
|
||||
debug!("reloading keyboard mode");
|
||||
ctrl.write_current_config_mode()?;
|
||||
debug!("reloading power states");
|
||||
ctrl.set_power_states().map_err(|err| warn!("{err}")).ok();
|
||||
Ok(())
|
||||
}
|
||||
|
||||
286
asusd/src/ctrl_fancurves.rs
Normal file
286
asusd/src/ctrl_fancurves.rs
Normal file
@@ -0,0 +1,286 @@
|
||||
use std::path::PathBuf;
|
||||
use std::sync::Arc;
|
||||
|
||||
use config_traits::{StdConfig, StdConfigLoad};
|
||||
use futures_lite::StreamExt;
|
||||
use log::{debug, error, info, warn};
|
||||
use rog_platform::platform::{RogPlatform, ThrottlePolicy};
|
||||
use rog_profiles::error::ProfileError;
|
||||
use rog_profiles::fan_curve_set::CurveData;
|
||||
use rog_profiles::{find_fan_curve_node, FanCurvePU, FanCurveProfiles};
|
||||
use serde_derive::{Deserialize, Serialize};
|
||||
use tokio::sync::Mutex;
|
||||
use zbus::{interface, Connection, SignalContext};
|
||||
|
||||
use crate::error::RogError;
|
||||
use crate::{CtrlTask, CONFIG_PATH_BASE};
|
||||
|
||||
pub const FAN_CURVE_ZBUS_NAME: &str = "FanCurves";
|
||||
pub const FAN_CURVE_ZBUS_PATH: &str = "/org/asuslinux";
|
||||
|
||||
#[derive(Deserialize, Serialize, Debug, Default)]
|
||||
pub struct FanCurveConfig {
|
||||
pub profiles: FanCurveProfiles,
|
||||
#[serde(skip)]
|
||||
pub current: u8,
|
||||
}
|
||||
|
||||
impl StdConfig for FanCurveConfig {
|
||||
/// Create a new config. The defaults are zeroed so the device must be read
|
||||
/// to get the actual device defaults.
|
||||
fn new() -> Self {
|
||||
Self::default()
|
||||
}
|
||||
|
||||
fn file_name(&self) -> String {
|
||||
"fan_curves.ron".to_owned()
|
||||
}
|
||||
|
||||
fn config_dir() -> std::path::PathBuf {
|
||||
PathBuf::from(CONFIG_PATH_BASE)
|
||||
}
|
||||
}
|
||||
|
||||
impl StdConfigLoad for FanCurveConfig {}
|
||||
|
||||
#[derive(Debug, Clone)]
|
||||
pub struct CtrlFanCurveZbus {
|
||||
config: Arc<Mutex<FanCurveConfig>>,
|
||||
platform: RogPlatform,
|
||||
}
|
||||
|
||||
// Non-zbus-derive impl
|
||||
impl CtrlFanCurveZbus {
|
||||
pub fn new() -> Result<Self, RogError> {
|
||||
let platform = RogPlatform::new()?;
|
||||
if platform.has_throttle_thermal_policy() {
|
||||
info!("Device has profile control available");
|
||||
find_fan_curve_node()?;
|
||||
info!("Device has fan curves available");
|
||||
let mut config = FanCurveConfig::new().load();
|
||||
let mut fan_curves = FanCurveProfiles::default();
|
||||
|
||||
// Only do defaults if the config doesn't already exist\
|
||||
if config.profiles.balanced.is_empty() || !config.file_path().exists() {
|
||||
info!("Fetching default fan curves");
|
||||
|
||||
let current = platform.get_throttle_thermal_policy()?;
|
||||
for this in [
|
||||
ThrottlePolicy::Balanced,
|
||||
ThrottlePolicy::Performance,
|
||||
ThrottlePolicy::Quiet,
|
||||
] {
|
||||
// For each profile we need to switch to it before we
|
||||
// can read the existing values from hardware. The ACPI method used
|
||||
// for this is what limits us.
|
||||
platform.set_throttle_thermal_policy(this.into())?;
|
||||
let mut dev = find_fan_curve_node()?;
|
||||
fan_curves.set_active_curve_to_defaults(this, &mut dev)?;
|
||||
|
||||
info!("{this:?}:");
|
||||
for curve in fan_curves.get_fan_curves_for(this) {
|
||||
info!("{}", String::from(curve));
|
||||
}
|
||||
}
|
||||
platform.set_throttle_thermal_policy(current)?;
|
||||
config.profiles = fan_curves;
|
||||
config.write();
|
||||
} else {
|
||||
info!("Fan curves previously stored, loading...");
|
||||
config = config.load();
|
||||
}
|
||||
|
||||
return Ok(Self {
|
||||
config: Arc::new(Mutex::new(config)),
|
||||
platform,
|
||||
});
|
||||
}
|
||||
|
||||
Err(ProfileError::NotSupported.into())
|
||||
}
|
||||
}
|
||||
|
||||
#[interface(name = "org.asuslinux.FanCurves")]
|
||||
impl CtrlFanCurveZbus {
|
||||
/// Set all fan curves for a profile to enabled status. Will also activate a
|
||||
/// fan curve if in the same profile mode
|
||||
async fn set_fan_curves_enabled(
|
||||
&mut self,
|
||||
profile: ThrottlePolicy,
|
||||
enabled: bool,
|
||||
) -> zbus::fdo::Result<()> {
|
||||
self.config
|
||||
.lock()
|
||||
.await
|
||||
.profiles
|
||||
.set_profile_curves_enabled(profile, enabled);
|
||||
self.config
|
||||
.lock()
|
||||
.await
|
||||
.profiles
|
||||
.write_profile_curve_to_platform(profile, &mut find_fan_curve_node()?)?;
|
||||
self.config.lock().await.write();
|
||||
Ok(())
|
||||
}
|
||||
|
||||
/// Set a single fan curve for a profile to enabled status. Will also
|
||||
/// activate a fan curve if in the same profile mode
|
||||
async fn set_profile_fan_curve_enabled(
|
||||
&mut self,
|
||||
profile: ThrottlePolicy,
|
||||
fan: FanCurvePU,
|
||||
enabled: bool,
|
||||
) -> zbus::fdo::Result<()> {
|
||||
self.config
|
||||
.lock()
|
||||
.await
|
||||
.profiles
|
||||
.set_profile_fan_curve_enabled(profile, fan, enabled);
|
||||
self.config
|
||||
.lock()
|
||||
.await
|
||||
.profiles
|
||||
.write_profile_curve_to_platform(profile, &mut find_fan_curve_node()?)?;
|
||||
self.config.lock().await.write();
|
||||
Ok(())
|
||||
}
|
||||
|
||||
/// Get the fan-curve data for the currently active ThrottlePolicy
|
||||
async fn fan_curve_data(
|
||||
&mut self,
|
||||
profile: ThrottlePolicy,
|
||||
) -> zbus::fdo::Result<Vec<CurveData>> {
|
||||
let curve = self
|
||||
.config
|
||||
.lock()
|
||||
.await
|
||||
.profiles
|
||||
.get_fan_curves_for(profile)
|
||||
.to_vec();
|
||||
Ok(curve)
|
||||
}
|
||||
|
||||
/// Set the fan curve for the specified profile.
|
||||
/// Will also activate the fan curve if the user is in the same mode.
|
||||
async fn set_fan_curve(
|
||||
&mut self,
|
||||
profile: ThrottlePolicy,
|
||||
curve: CurveData,
|
||||
) -> zbus::fdo::Result<()> {
|
||||
self.config
|
||||
.lock()
|
||||
.await
|
||||
.profiles
|
||||
.save_fan_curve(curve, profile)?;
|
||||
let active: ThrottlePolicy = self.platform.get_throttle_thermal_policy()?.into();
|
||||
if active == profile {
|
||||
self.config
|
||||
.lock()
|
||||
.await
|
||||
.profiles
|
||||
.write_profile_curve_to_platform(profile, &mut find_fan_curve_node()?)?;
|
||||
}
|
||||
self.config.lock().await.write();
|
||||
Ok(())
|
||||
}
|
||||
|
||||
/// Reset the stored (self) and device curves to the defaults of the
|
||||
/// platform.
|
||||
///
|
||||
/// Each platform_profile has a different default and the default can be
|
||||
/// read only for the currently active profile.
|
||||
async fn set_curves_to_defaults(&mut self, profile: ThrottlePolicy) -> zbus::fdo::Result<()> {
|
||||
let active = self.platform.get_throttle_thermal_policy()?;
|
||||
self.platform.set_throttle_thermal_policy(profile.into())?;
|
||||
self.config
|
||||
.lock()
|
||||
.await
|
||||
.profiles
|
||||
.set_active_curve_to_defaults(profile, &mut find_fan_curve_node()?)?;
|
||||
self.platform.set_throttle_thermal_policy(active)?;
|
||||
self.config.lock().await.write();
|
||||
Ok(())
|
||||
}
|
||||
|
||||
/// Reset the stored (self) and device curve to the defaults of the
|
||||
/// platform.
|
||||
///
|
||||
/// Each platform_profile has a different default and the defualt can be
|
||||
/// read only for the currently active profile.
|
||||
async fn reset_profile_curves(&self, profile: ThrottlePolicy) -> zbus::fdo::Result<()> {
|
||||
let active = self.platform.get_throttle_thermal_policy()?;
|
||||
|
||||
self.platform.set_throttle_thermal_policy(profile.into())?;
|
||||
self.config
|
||||
.lock()
|
||||
.await
|
||||
.profiles
|
||||
.set_active_curve_to_defaults(active.into(), &mut find_fan_curve_node()?)?;
|
||||
self.platform.set_throttle_thermal_policy(active)?;
|
||||
|
||||
self.config.lock().await.write();
|
||||
Ok(())
|
||||
}
|
||||
}
|
||||
|
||||
impl crate::ZbusRun for CtrlFanCurveZbus {
|
||||
async fn add_to_server(self, server: &mut Connection) {
|
||||
Self::add_to_server_helper(self, FAN_CURVE_ZBUS_PATH, server).await;
|
||||
}
|
||||
}
|
||||
|
||||
impl CtrlTask for CtrlFanCurveZbus {
|
||||
fn zbus_path() -> &'static str {
|
||||
FAN_CURVE_ZBUS_PATH
|
||||
}
|
||||
|
||||
async fn create_tasks(&self, _signal_ctxt: SignalContext<'static>) -> Result<(), RogError> {
|
||||
let watch_throttle_thermal_policy = self.platform.monitor_throttle_thermal_policy()?;
|
||||
let platform = self.platform.clone();
|
||||
let config = self.config.clone();
|
||||
let fan_curves = self.config.clone();
|
||||
|
||||
tokio::spawn(async move {
|
||||
let mut buffer = [0; 32];
|
||||
if let Ok(mut stream) = watch_throttle_thermal_policy.into_event_stream(&mut buffer) {
|
||||
while (stream.next().await).is_some() {
|
||||
debug!("watch_throttle_thermal_policy changed");
|
||||
if let Ok(profile) = platform.get_throttle_thermal_policy().map_err(|e| {
|
||||
error!("get_throttle_thermal_policy error: {e}");
|
||||
}) {
|
||||
if profile != config.lock().await.current {
|
||||
fan_curves
|
||||
.lock()
|
||||
.await
|
||||
.profiles
|
||||
.write_profile_curve_to_platform(
|
||||
profile.into(),
|
||||
&mut find_fan_curve_node().unwrap(),
|
||||
)
|
||||
.map_err(|e| warn!("write_profile_curve_to_platform, {}", e))
|
||||
.ok();
|
||||
config.lock().await.current = profile;
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
});
|
||||
|
||||
Ok(())
|
||||
}
|
||||
}
|
||||
|
||||
impl crate::Reloadable for CtrlFanCurveZbus {
|
||||
/// Fetch the active profile and use that to set all related components up
|
||||
async fn reload(&mut self) -> Result<(), RogError> {
|
||||
let active = self.platform.get_throttle_thermal_policy()?.into();
|
||||
let mut config = self.config.lock().await;
|
||||
if let Ok(mut device) = find_fan_curve_node() {
|
||||
config
|
||||
.profiles
|
||||
.write_profile_curve_to_platform(active, &mut device)?;
|
||||
}
|
||||
|
||||
Ok(())
|
||||
}
|
||||
}
|
||||
File diff suppressed because it is too large
Load Diff
@@ -1,287 +0,0 @@
|
||||
use std::process::Command;
|
||||
use std::sync::Arc;
|
||||
use std::time::Duration;
|
||||
|
||||
use async_trait::async_trait;
|
||||
use config_traits::StdConfig;
|
||||
use log::{error, info, warn};
|
||||
use rog_platform::power::AsusPower;
|
||||
use rog_platform::supported::ChargeSupportedFunctions;
|
||||
use systemd_zbus::{ManagerProxy as SystemdProxy, Mode, UnitFileState};
|
||||
use tokio::time::sleep;
|
||||
use zbus::export::futures_util::lock::Mutex;
|
||||
use zbus::{dbus_interface, Connection, SignalContext};
|
||||
|
||||
use crate::config::Config;
|
||||
use crate::error::RogError;
|
||||
use crate::{CtrlTask, GetSupported};
|
||||
|
||||
const ZBUS_PATH: &str = "/org/asuslinux/Power";
|
||||
const NVIDIA_POWERD: &str = "nvidia-powerd.service";
|
||||
|
||||
impl GetSupported for CtrlPower {
|
||||
type A = ChargeSupportedFunctions;
|
||||
|
||||
fn get_supported() -> Self::A {
|
||||
ChargeSupportedFunctions {
|
||||
charge_level_set: if let Ok(power) = AsusPower::new() {
|
||||
power.has_charge_control_end_threshold()
|
||||
} else {
|
||||
false
|
||||
},
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[derive(Clone)]
|
||||
pub struct CtrlPower {
|
||||
power: AsusPower,
|
||||
config: Arc<Mutex<Config>>,
|
||||
}
|
||||
|
||||
#[dbus_interface(name = "org.asuslinux.Daemon")]
|
||||
impl CtrlPower {
|
||||
async fn set_charge_control_end_threshold(
|
||||
&mut self,
|
||||
#[zbus(signal_context)] ctxt: SignalContext<'_>,
|
||||
limit: u8,
|
||||
) -> zbus::fdo::Result<()> {
|
||||
if !(20..=100).contains(&limit) {
|
||||
return Err(RogError::ChargeLimit(limit))?;
|
||||
}
|
||||
self.set(limit)
|
||||
.map_err(|err| {
|
||||
warn!("CtrlCharge: set_limit {}", err);
|
||||
err
|
||||
})
|
||||
.ok();
|
||||
Self::notify_charge_control_end_threshold(&ctxt, limit)
|
||||
.await
|
||||
.ok();
|
||||
Ok(())
|
||||
}
|
||||
|
||||
fn charge_control_end_threshold(&self) -> u8 {
|
||||
loop {
|
||||
if let Some(mut config) = self.config.try_lock() {
|
||||
let limit = self
|
||||
.power
|
||||
.get_charge_control_end_threshold()
|
||||
.map_err(|err| {
|
||||
warn!("CtrlCharge: get_charge_control_end_threshold {}", err);
|
||||
err
|
||||
})
|
||||
.unwrap_or(100);
|
||||
|
||||
config.read();
|
||||
config.bat_charge_limit = limit;
|
||||
config.write();
|
||||
|
||||
return config.bat_charge_limit;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
fn mains_online(&self) -> bool {
|
||||
if self.power.has_online() {
|
||||
if let Ok(v) = self.power.get_online() {
|
||||
return v == 1;
|
||||
}
|
||||
}
|
||||
false
|
||||
}
|
||||
|
||||
#[dbus_interface(signal)]
|
||||
async fn notify_charge_control_end_threshold(
|
||||
ctxt: &SignalContext<'_>,
|
||||
limit: u8,
|
||||
) -> zbus::Result<()>;
|
||||
|
||||
#[dbus_interface(signal)]
|
||||
async fn notify_mains_online(ctxt: &SignalContext<'_>, on: bool) -> zbus::Result<()>;
|
||||
}
|
||||
|
||||
#[async_trait]
|
||||
impl crate::ZbusRun for CtrlPower {
|
||||
async fn add_to_server(self, server: &mut Connection) {
|
||||
Self::add_to_server_helper(self, ZBUS_PATH, server).await;
|
||||
}
|
||||
}
|
||||
|
||||
#[async_trait]
|
||||
impl crate::Reloadable for CtrlPower {
|
||||
async fn reload(&mut self) -> Result<(), RogError> {
|
||||
if let Some(mut config) = self.config.try_lock() {
|
||||
config.read();
|
||||
self.set(config.bat_charge_limit)?;
|
||||
}
|
||||
Ok(())
|
||||
}
|
||||
}
|
||||
|
||||
impl CtrlPower {
|
||||
// task_watch_item!(charge_control_end_threshold power);
|
||||
|
||||
pub fn new(config: Arc<Mutex<Config>>) -> Result<Self, RogError> {
|
||||
Ok(CtrlPower {
|
||||
power: AsusPower::new()?,
|
||||
config,
|
||||
})
|
||||
}
|
||||
|
||||
pub(super) fn set(&self, limit: u8) -> Result<(), RogError> {
|
||||
if !(20..=100).contains(&limit) {
|
||||
return Err(RogError::ChargeLimit(limit));
|
||||
}
|
||||
|
||||
self.power.set_charge_control_end_threshold(limit)?;
|
||||
|
||||
info!("Battery charge limit: {}", limit);
|
||||
|
||||
if let Some(mut config) = self.config.try_lock() {
|
||||
config.read();
|
||||
config.bat_charge_limit = limit;
|
||||
config.write();
|
||||
}
|
||||
|
||||
Ok(())
|
||||
}
|
||||
}
|
||||
|
||||
#[async_trait]
|
||||
impl CtrlTask for CtrlPower {
|
||||
fn zbus_path() -> &'static str {
|
||||
ZBUS_PATH
|
||||
}
|
||||
|
||||
async fn create_tasks(&self, signal_ctxt: SignalContext<'static>) -> Result<(), RogError> {
|
||||
let conn = zbus::Connection::system().await?;
|
||||
let sysd1 = SystemdProxy::new(&conn).await?;
|
||||
let sysd2 = sysd1.clone();
|
||||
let sysd3 = sysd1.clone();
|
||||
|
||||
let power1 = self.clone();
|
||||
let power2 = self.clone();
|
||||
self.create_sys_event_tasks(
|
||||
move || async {},
|
||||
move || {
|
||||
let power = power1.clone();
|
||||
let sysd = sysd1.clone();
|
||||
async move {
|
||||
info!("CtrlCharge reloading charge limit");
|
||||
let lock = power.config.lock().await;
|
||||
power
|
||||
.set(lock.bat_charge_limit)
|
||||
.map_err(|err| {
|
||||
warn!("CtrlCharge: set_limit {}", err);
|
||||
err
|
||||
})
|
||||
.ok();
|
||||
|
||||
if lock.disable_nvidia_powerd_on_battery {
|
||||
if let Ok(value) = power.power.get_online() {
|
||||
do_nvidia_powerd_action(&sysd, value == 1).await;
|
||||
}
|
||||
}
|
||||
}
|
||||
},
|
||||
move || async {},
|
||||
move || {
|
||||
let power = power2.clone();
|
||||
let sysd = sysd2.clone();
|
||||
async move {
|
||||
info!("CtrlCharge reloading charge limit");
|
||||
let lock = power.config.lock().await;
|
||||
power
|
||||
.set(lock.bat_charge_limit)
|
||||
.map_err(|err| {
|
||||
warn!("CtrlCharge: set_limit {}", err);
|
||||
err
|
||||
})
|
||||
.ok();
|
||||
|
||||
if lock.disable_nvidia_powerd_on_battery {
|
||||
if let Ok(value) = power.power.get_online() {
|
||||
do_nvidia_powerd_action(&sysd, value == 1).await;
|
||||
}
|
||||
}
|
||||
}
|
||||
},
|
||||
)
|
||||
.await;
|
||||
|
||||
let config = self.config.clone();
|
||||
// self.watch_charge_control_end_threshold(signal_ctxt.clone())
|
||||
// .await?;
|
||||
|
||||
let ctrl = self.clone();
|
||||
tokio::spawn(async move {
|
||||
let mut online = 10;
|
||||
loop {
|
||||
if let Ok(value) = ctrl.power.get_online() {
|
||||
if online != value {
|
||||
online = value;
|
||||
let mut config = config.lock().await;
|
||||
config.read();
|
||||
|
||||
if config.disable_nvidia_powerd_on_battery {
|
||||
do_nvidia_powerd_action(&sysd3, value == 1).await;
|
||||
}
|
||||
|
||||
Self::notify_mains_online(&signal_ctxt, value == 1)
|
||||
.await
|
||||
.unwrap();
|
||||
|
||||
let mut prog: Vec<&str> = Vec::new();
|
||||
if value == 1 {
|
||||
// AC ONLINE
|
||||
prog = config.ac_command.split_whitespace().collect();
|
||||
} else if value == 0 {
|
||||
// BATTERY
|
||||
prog = config.bat_command.split_whitespace().collect();
|
||||
}
|
||||
|
||||
if prog.len() > 1 {
|
||||
let mut cmd = Command::new(prog[0]);
|
||||
for arg in prog.iter().skip(1) {
|
||||
cmd.arg(*arg);
|
||||
}
|
||||
if let Err(e) = cmd.spawn() {
|
||||
if value == 1 {
|
||||
error!("AC power command error: {e}");
|
||||
} else {
|
||||
error!("Battery power command error: {e}");
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
// The inotify doesn't pick up events when the kernel changes internal value
|
||||
// so we need to watch it with a thread and sleep unfortunately
|
||||
sleep(Duration::from_secs(1)).await;
|
||||
}
|
||||
});
|
||||
|
||||
Ok(())
|
||||
}
|
||||
}
|
||||
|
||||
async fn do_nvidia_powerd_action(proxy: &SystemdProxy<'_>, ac_on: bool) {
|
||||
if let Ok(res) = proxy.get_unit_file_state(NVIDIA_POWERD).await {
|
||||
if res == UnitFileState::Enabled {
|
||||
if ac_on {
|
||||
proxy
|
||||
.start_unit(NVIDIA_POWERD, Mode::Replace)
|
||||
.await
|
||||
.map_err(|e| error!("Error stopping {NVIDIA_POWERD}, {e:?}"))
|
||||
.ok();
|
||||
} else {
|
||||
proxy
|
||||
.stop_unit(NVIDIA_POWERD, Mode::Replace)
|
||||
.await
|
||||
.map_err(|e| error!("Error stopping {NVIDIA_POWERD}, {e:?}"))
|
||||
.ok();
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -1,60 +0,0 @@
|
||||
use std::path::PathBuf;
|
||||
|
||||
use config_traits::{StdConfig, StdConfigLoad};
|
||||
use rog_profiles::fan_curve_set::CurveData;
|
||||
use rog_profiles::Profile;
|
||||
use serde_derive::{Deserialize, Serialize};
|
||||
|
||||
use crate::CONFIG_PATH_BASE;
|
||||
|
||||
const CONFIG_FILE: &str = "profile.ron";
|
||||
const CONFIG_FAN_FILE: &str = "fan_curves.ron";
|
||||
|
||||
#[derive(Deserialize, Serialize, Debug)]
|
||||
pub struct ProfileConfig {
|
||||
/// For restore on boot
|
||||
pub active_profile: Profile,
|
||||
}
|
||||
|
||||
impl StdConfig for ProfileConfig {
|
||||
fn new() -> Self {
|
||||
Self {
|
||||
active_profile: Profile::Balanced,
|
||||
}
|
||||
}
|
||||
|
||||
fn config_dir() -> std::path::PathBuf {
|
||||
PathBuf::from(CONFIG_PATH_BASE)
|
||||
}
|
||||
|
||||
fn file_name(&self) -> String {
|
||||
CONFIG_FILE.to_owned()
|
||||
}
|
||||
}
|
||||
|
||||
impl StdConfigLoad for ProfileConfig {}
|
||||
|
||||
#[derive(Deserialize, Serialize, Debug, Default)]
|
||||
pub struct FanCurveConfig {
|
||||
pub balanced: Vec<CurveData>,
|
||||
pub performance: Vec<CurveData>,
|
||||
pub quiet: Vec<CurveData>,
|
||||
}
|
||||
|
||||
impl StdConfig for FanCurveConfig {
|
||||
/// Create a new config. The defaults are zeroed so the device must be read
|
||||
/// to get the actual device defaults.
|
||||
fn new() -> Self {
|
||||
Self::default()
|
||||
}
|
||||
|
||||
fn config_dir() -> std::path::PathBuf {
|
||||
PathBuf::from(CONFIG_PATH_BASE)
|
||||
}
|
||||
|
||||
fn file_name(&self) -> String {
|
||||
CONFIG_FAN_FILE.to_owned()
|
||||
}
|
||||
}
|
||||
|
||||
impl StdConfigLoad for FanCurveConfig {}
|
||||
@@ -1,171 +0,0 @@
|
||||
use config_traits::{StdConfig, StdConfigLoad};
|
||||
use log::{info, warn};
|
||||
use rog_platform::platform::AsusPlatform;
|
||||
use rog_platform::supported::PlatformProfileFunctions;
|
||||
use rog_profiles::error::ProfileError;
|
||||
use rog_profiles::{FanCurveProfiles, Profile};
|
||||
|
||||
use super::config::{FanCurveConfig, ProfileConfig};
|
||||
use crate::error::RogError;
|
||||
use crate::GetSupported;
|
||||
|
||||
// TODO: macro wrapper for warn/info/error log macros to add module name
|
||||
const MOD_NAME: &str = "CtrlPlatformProfile";
|
||||
|
||||
pub struct FanCurves {
|
||||
config_file: FanCurveConfig,
|
||||
profiles: FanCurveProfiles,
|
||||
}
|
||||
|
||||
impl FanCurves {
|
||||
pub fn update_profiles_from_config(&mut self) {
|
||||
self.profiles.balanced = self.config_file.balanced.clone();
|
||||
self.profiles.performance = self.config_file.performance.clone();
|
||||
self.profiles.quiet = self.config_file.quiet.clone();
|
||||
}
|
||||
|
||||
pub fn update_config_from_profiles(&mut self) {
|
||||
self.config_file.balanced = self.profiles.balanced.clone();
|
||||
self.config_file.performance = self.profiles.performance.clone();
|
||||
self.config_file.quiet = self.profiles.quiet.clone();
|
||||
}
|
||||
|
||||
pub fn profiles(&self) -> &FanCurveProfiles {
|
||||
&self.profiles
|
||||
}
|
||||
|
||||
pub fn profiles_mut(&mut self) -> &mut FanCurveProfiles {
|
||||
&mut self.profiles
|
||||
}
|
||||
}
|
||||
|
||||
pub struct CtrlPlatformProfile {
|
||||
pub profile_config: ProfileConfig,
|
||||
pub fan_curves: Option<FanCurves>,
|
||||
pub platform: AsusPlatform,
|
||||
}
|
||||
|
||||
impl GetSupported for CtrlPlatformProfile {
|
||||
type A = PlatformProfileFunctions;
|
||||
|
||||
fn get_supported() -> Self::A {
|
||||
if !Profile::is_platform_profile_supported() {
|
||||
warn!(
|
||||
"platform_profile kernel interface not found, your laptop does not support this, \
|
||||
or the interface is missing."
|
||||
);
|
||||
}
|
||||
|
||||
let res = FanCurveProfiles::supported_fans();
|
||||
|
||||
if res.is_err() {
|
||||
info!(
|
||||
"fan curves kernel interface not found, your laptop does not support this, or the \
|
||||
interface is missing."
|
||||
);
|
||||
}
|
||||
|
||||
PlatformProfileFunctions {
|
||||
platform_profile: Profile::is_platform_profile_supported(),
|
||||
fans: res.unwrap_or_default(),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl CtrlPlatformProfile {
|
||||
pub fn new(config: ProfileConfig) -> Result<Self, RogError> {
|
||||
let platform = AsusPlatform::new()?;
|
||||
if platform.has_platform_profile() || platform.has_throttle_thermal_policy() {
|
||||
info!("{MOD_NAME}: Device has profile control available");
|
||||
|
||||
let mut controller = CtrlPlatformProfile {
|
||||
profile_config: config,
|
||||
fan_curves: None,
|
||||
platform,
|
||||
};
|
||||
if FanCurveProfiles::get_device().is_ok() {
|
||||
info!("{MOD_NAME}: Device has fan curves available");
|
||||
let fan_config = FanCurveConfig::new();
|
||||
// Only do defaults if the config doesn't already exist
|
||||
if !fan_config.file_path().exists() {
|
||||
info!("{MOD_NAME}: Fetching default fan curves");
|
||||
controller.fan_curves = Some(FanCurves {
|
||||
config_file: fan_config,
|
||||
profiles: FanCurveProfiles::default(),
|
||||
});
|
||||
for _ in [Profile::Balanced, Profile::Performance, Profile::Quiet] {
|
||||
// For each profile we need to switch to it before we
|
||||
// can read the existing values from hardware. The ACPI method used
|
||||
// for this is what limits us.
|
||||
let next =
|
||||
Profile::get_next_profile(controller.profile_config.active_profile);
|
||||
Profile::set_profile(next)
|
||||
.map_err(|e| warn!("{MOD_NAME}: set_profile, {}", e))
|
||||
.ok();
|
||||
controller.profile_config.active_profile = next;
|
||||
|
||||
// Make sure to set the baseline to default
|
||||
controller.set_active_curve_to_defaults()?;
|
||||
let active = Profile::get_active_profile().unwrap_or(Profile::Balanced);
|
||||
|
||||
if let Some(curves) = controller.fan_curves.as_ref() {
|
||||
info!("{MOD_NAME}: {active:?}:");
|
||||
for curve in curves.profiles().get_fan_curves_for(active) {
|
||||
info!("{}", String::from(curve));
|
||||
}
|
||||
}
|
||||
}
|
||||
if let Some(curves) = controller.fan_curves.as_ref() {
|
||||
curves.config_file.write();
|
||||
}
|
||||
} else {
|
||||
info!("{MOD_NAME}: Fan curves previously stored, loading...");
|
||||
let mut fan_curves = FanCurves {
|
||||
config_file: fan_config.load(),
|
||||
profiles: FanCurveProfiles::default(),
|
||||
};
|
||||
fan_curves.update_profiles_from_config();
|
||||
controller.fan_curves = Some(fan_curves);
|
||||
}
|
||||
}
|
||||
|
||||
return Ok(controller);
|
||||
}
|
||||
|
||||
Err(ProfileError::NotSupported.into())
|
||||
}
|
||||
|
||||
pub fn save_config(&mut self) {
|
||||
self.profile_config.write();
|
||||
if let Some(fans) = self.fan_curves.as_mut() {
|
||||
fans.update_config_from_profiles();
|
||||
fans.config_file.write(); // config write
|
||||
}
|
||||
}
|
||||
|
||||
/// Set the curve for the active profile active
|
||||
pub(super) fn write_profile_curve_to_platform(&mut self) -> Result<(), RogError> {
|
||||
if let Some(curves) = &mut self.fan_curves {
|
||||
if let Ok(mut device) = FanCurveProfiles::get_device() {
|
||||
curves.profiles_mut().write_profile_curve_to_platform(
|
||||
self.profile_config.active_profile,
|
||||
&mut device,
|
||||
)?;
|
||||
}
|
||||
}
|
||||
Ok(())
|
||||
}
|
||||
|
||||
pub(super) fn set_active_curve_to_defaults(&mut self) -> Result<(), RogError> {
|
||||
if let Some(curves) = self.fan_curves.as_mut() {
|
||||
if let Ok(mut device) = FanCurveProfiles::get_device() {
|
||||
curves.profiles_mut().set_active_curve_to_defaults(
|
||||
self.profile_config.active_profile,
|
||||
&mut device,
|
||||
)?;
|
||||
curves.update_config_from_profiles();
|
||||
}
|
||||
}
|
||||
Ok(())
|
||||
}
|
||||
}
|
||||
@@ -1,4 +0,0 @@
|
||||
pub mod config;
|
||||
pub mod controller;
|
||||
/// Implements `CtrlTask`, Reloadable, `ZbusRun`
|
||||
pub mod trait_impls;
|
||||
@@ -1,332 +0,0 @@
|
||||
use std::str::FromStr;
|
||||
use std::sync::Arc;
|
||||
|
||||
use async_trait::async_trait;
|
||||
use config_traits::StdConfig;
|
||||
use log::{error, info, warn};
|
||||
use rog_profiles::fan_curve_set::CurveData;
|
||||
use rog_profiles::{FanCurvePU, FanCurveProfiles, Profile};
|
||||
use zbus::export::futures_util::lock::Mutex;
|
||||
use zbus::export::futures_util::StreamExt;
|
||||
use zbus::fdo::Error;
|
||||
use zbus::{dbus_interface, Connection, SignalContext};
|
||||
|
||||
use super::controller::CtrlPlatformProfile;
|
||||
use crate::error::RogError;
|
||||
use crate::CtrlTask;
|
||||
|
||||
const MOD_NAME: &str = "ProfileZbus";
|
||||
|
||||
const ZBUS_PATH: &str = "/org/asuslinux/Profile";
|
||||
const UNSUPPORTED_MSG: &str =
|
||||
"Fan curves are not supported on this laptop or you require a patched kernel";
|
||||
|
||||
#[derive(Clone)]
|
||||
pub struct ProfileZbus(pub Arc<Mutex<CtrlPlatformProfile>>);
|
||||
|
||||
#[dbus_interface(name = "org.asuslinux.Daemon")]
|
||||
impl ProfileZbus {
|
||||
/// Fetch profile names
|
||||
fn profiles(&mut self) -> zbus::fdo::Result<Vec<Profile>> {
|
||||
if let Ok(profiles) = Profile::get_profile_names() {
|
||||
return Ok(profiles);
|
||||
}
|
||||
Err(Error::Failed(
|
||||
"Failed to get all profile details".to_owned(),
|
||||
))
|
||||
}
|
||||
|
||||
/// Toggle to next platform_profile. Names provided by `Profiles`.
|
||||
/// If fan-curves are supported will also activate a fan curve for profile.
|
||||
async fn next_profile(&mut self, #[zbus(signal_context)] ctxt: SignalContext<'_>) {
|
||||
let mut ctrl = self.0.lock().await;
|
||||
let next = Profile::get_next_profile(ctrl.profile_config.active_profile);
|
||||
Profile::set_profile(next)
|
||||
.map_err(|e| warn!("{MOD_NAME}: set_profile, {}", e))
|
||||
.ok();
|
||||
ctrl.profile_config.active_profile = next;
|
||||
ctrl.save_config();
|
||||
|
||||
Self::notify_profile(&ctxt, ctrl.profile_config.active_profile)
|
||||
.await
|
||||
.ok();
|
||||
}
|
||||
|
||||
/// Fetch the active profile name
|
||||
async fn active_profile(&mut self) -> zbus::fdo::Result<Profile> {
|
||||
let mut ctrl = self.0.lock().await;
|
||||
ctrl.profile_config.read();
|
||||
Ok(ctrl.profile_config.active_profile)
|
||||
}
|
||||
|
||||
/// Set this platform_profile name as active
|
||||
async fn set_active_profile(
|
||||
&self,
|
||||
#[zbus(signal_context)] ctxt: SignalContext<'_>,
|
||||
profile: Profile,
|
||||
) {
|
||||
let mut ctrl = self.0.lock().await;
|
||||
// Read first just incase the user has modified the config before calling this
|
||||
ctrl.profile_config.read();
|
||||
Profile::set_profile(profile)
|
||||
.map_err(|e| warn!("{MOD_NAME}: set_profile, {}", e))
|
||||
.ok();
|
||||
ctrl.profile_config.active_profile = profile;
|
||||
ctrl.write_profile_curve_to_platform()
|
||||
.map_err(|e| warn!("{MOD_NAME}: write_profile_curve_to_platform, {}", e))
|
||||
.ok();
|
||||
|
||||
ctrl.save_config();
|
||||
|
||||
Self::notify_profile(&ctxt, ctrl.profile_config.active_profile)
|
||||
.await
|
||||
.ok();
|
||||
}
|
||||
|
||||
/// Set all fan curves for a profile to enabled status. Will also activate a
|
||||
/// fan curve if in the same profile mode
|
||||
async fn set_fan_curves_enabled(
|
||||
&mut self,
|
||||
profile: Profile,
|
||||
enabled: bool,
|
||||
) -> zbus::fdo::Result<()> {
|
||||
let mut ctrl = self.0.lock().await;
|
||||
ctrl.profile_config.read();
|
||||
if let Some(curves) = &mut ctrl.fan_curves {
|
||||
curves
|
||||
.profiles_mut()
|
||||
.set_profile_curves_enabled(profile, enabled);
|
||||
|
||||
ctrl.write_profile_curve_to_platform()
|
||||
.map_err(|e| warn!("{MOD_NAME}: write_profile_curve_to_platform, {}", e))
|
||||
.ok();
|
||||
|
||||
ctrl.save_config();
|
||||
Ok(())
|
||||
} else {
|
||||
Err(Error::Failed(UNSUPPORTED_MSG.to_owned()))
|
||||
}
|
||||
}
|
||||
|
||||
/// Set a single fan curve for a profile to enabled status. Will also
|
||||
/// activate a fan curve if in the same profile mode
|
||||
async fn set_profile_fan_curve_enabled(
|
||||
&mut self,
|
||||
profile: Profile,
|
||||
fan: FanCurvePU,
|
||||
enabled: bool,
|
||||
) -> zbus::fdo::Result<()> {
|
||||
let mut ctrl = self.0.lock().await;
|
||||
ctrl.profile_config.read();
|
||||
if let Some(curves) = &mut ctrl.fan_curves {
|
||||
curves
|
||||
.profiles_mut()
|
||||
.set_profile_fan_curve_enabled(profile, fan, enabled);
|
||||
|
||||
ctrl.write_profile_curve_to_platform()
|
||||
.map_err(|e| warn!("{MOD_NAME}: write_profile_curve_to_platform, {}", e))
|
||||
.ok();
|
||||
|
||||
ctrl.save_config();
|
||||
Ok(())
|
||||
} else {
|
||||
Err(Error::Failed(UNSUPPORTED_MSG.to_owned()))
|
||||
}
|
||||
}
|
||||
|
||||
/// Get the fan-curve data for the currently active Profile
|
||||
async fn fan_curve_data(&mut self, profile: Profile) -> zbus::fdo::Result<Vec<CurveData>> {
|
||||
let mut ctrl = self.0.lock().await;
|
||||
ctrl.profile_config.read();
|
||||
if let Some(curves) = &mut ctrl.fan_curves {
|
||||
let curve = curves.profiles().get_fan_curves_for(profile);
|
||||
return Ok(curve.to_vec());
|
||||
}
|
||||
Err(Error::Failed(UNSUPPORTED_MSG.to_owned()))
|
||||
}
|
||||
|
||||
/// Set the fan curve for the specified profile.
|
||||
/// Will also activate the fan curve if the user is in the same mode.
|
||||
async fn set_fan_curve(&self, profile: Profile, curve: CurveData) -> zbus::fdo::Result<()> {
|
||||
let mut ctrl = self.0.lock().await;
|
||||
ctrl.profile_config.read();
|
||||
if let Some(curves) = &mut ctrl.fan_curves {
|
||||
curves
|
||||
.profiles_mut()
|
||||
.save_fan_curve(curve, profile)
|
||||
.map_err(|err| zbus::fdo::Error::Failed(err.to_string()))?;
|
||||
} else {
|
||||
return Err(Error::Failed(UNSUPPORTED_MSG.to_owned()));
|
||||
}
|
||||
ctrl.write_profile_curve_to_platform()
|
||||
.map_err(|e| warn!("{MOD_NAME}: Profile::set_profile, {}", e))
|
||||
.ok();
|
||||
ctrl.save_config();
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
/// Reset the stored (self) and device curve to the defaults of the
|
||||
/// platform.
|
||||
///
|
||||
/// Each platform_profile has a different default and the defualt can be
|
||||
/// read only for the currently active profile.
|
||||
async fn set_active_curve_to_defaults(&self) -> zbus::fdo::Result<()> {
|
||||
let mut ctrl = self.0.lock().await;
|
||||
ctrl.profile_config.read();
|
||||
ctrl.set_active_curve_to_defaults()
|
||||
.map_err(|e| warn!("{MOD_NAME}: Profile::set_active_curve_to_defaults, {}", e))
|
||||
.ok();
|
||||
ctrl.save_config();
|
||||
Ok(())
|
||||
}
|
||||
|
||||
/// Reset the stored (self) and device curve to the defaults of the
|
||||
/// platform.
|
||||
///
|
||||
/// Each platform_profile has a different default and the defualt can be
|
||||
/// read only for the currently active profile.
|
||||
async fn reset_profile_curves(&self, profile: Profile) -> zbus::fdo::Result<()> {
|
||||
let mut ctrl = self.0.lock().await;
|
||||
ctrl.profile_config.read();
|
||||
let active = Profile::get_active_profile().unwrap_or(Profile::Balanced);
|
||||
|
||||
Profile::set_profile(profile)
|
||||
.map_err(|e| warn!("{MOD_NAME}: set_profile, {}", e))
|
||||
.ok();
|
||||
ctrl.set_active_curve_to_defaults()
|
||||
.map_err(|e| warn!("{MOD_NAME}: Profile::set_active_curve_to_defaults, {}", e))
|
||||
.ok();
|
||||
|
||||
Profile::set_profile(active)
|
||||
.map_err(|e| warn!("{MOD_NAME}: set_profile, {}", e))
|
||||
.ok();
|
||||
ctrl.save_config();
|
||||
Ok(())
|
||||
}
|
||||
|
||||
#[dbus_interface(signal)]
|
||||
async fn notify_profile(signal_ctxt: &SignalContext<'_>, profile: Profile) -> zbus::Result<()> {
|
||||
}
|
||||
}
|
||||
|
||||
#[async_trait]
|
||||
impl crate::ZbusRun for ProfileZbus {
|
||||
async fn add_to_server(self, server: &mut Connection) {
|
||||
Self::add_to_server_helper(self, ZBUS_PATH, server).await;
|
||||
}
|
||||
}
|
||||
|
||||
#[async_trait]
|
||||
impl CtrlTask for ProfileZbus {
|
||||
fn zbus_path() -> &'static str {
|
||||
ZBUS_PATH
|
||||
}
|
||||
|
||||
async fn create_tasks(&self, signal_ctxt: SignalContext<'static>) -> Result<(), RogError> {
|
||||
let ctrl = self.0.clone();
|
||||
let sig_ctx = signal_ctxt.clone();
|
||||
let watch = self
|
||||
.0
|
||||
.lock()
|
||||
.await
|
||||
.platform
|
||||
.monitor_throttle_thermal_policy()?;
|
||||
|
||||
tokio::spawn(async move {
|
||||
let mut buffer = [0; 32];
|
||||
if let Ok(stream) = watch.into_event_stream(&mut buffer) {
|
||||
stream
|
||||
.for_each(|_| async {
|
||||
let mut lock = ctrl.lock().await;
|
||||
if let Ok(profile) =
|
||||
lock.platform.get_throttle_thermal_policy().map_err(|e| {
|
||||
error!("{MOD_NAME}: get_throttle_thermal_policy error: {e}");
|
||||
})
|
||||
{
|
||||
let new_profile = Profile::from_throttle_thermal_policy(profile);
|
||||
if new_profile != lock.profile_config.active_profile {
|
||||
info!("{MOD_NAME}: platform_profile changed to {new_profile}");
|
||||
lock.profile_config.active_profile = new_profile;
|
||||
lock.write_profile_curve_to_platform().unwrap();
|
||||
lock.save_config();
|
||||
Profile::set_profile(lock.profile_config.active_profile)
|
||||
.map_err(|e| {
|
||||
error!("Profile::set_profile() error: {e}");
|
||||
})
|
||||
.ok();
|
||||
|
||||
Self::notify_profile(&sig_ctx, lock.profile_config.active_profile)
|
||||
.await
|
||||
.ok();
|
||||
}
|
||||
}
|
||||
})
|
||||
.await;
|
||||
}
|
||||
});
|
||||
|
||||
let ctrl = self.0.clone();
|
||||
let watch = self.0.lock().await.platform.monitor_platform_profile()?;
|
||||
|
||||
tokio::spawn(async move {
|
||||
let mut buffer = [0; 32];
|
||||
if let Ok(stream) = watch.into_event_stream(&mut buffer) {
|
||||
stream
|
||||
.for_each(|_| async {
|
||||
let mut lock = ctrl.lock().await;
|
||||
if let Ok(profile) = lock.platform.get_platform_profile().map_err(|e| {
|
||||
error!("get_platform_profile error: {e}");
|
||||
}) {
|
||||
if let Ok(new_profile) = Profile::from_str(&profile).map_err(|e| {
|
||||
error!("Profile::from_str(&profile) error: {e}");
|
||||
}) {
|
||||
if new_profile != lock.profile_config.active_profile {
|
||||
info!("{MOD_NAME}: platform_profile changed to {new_profile}");
|
||||
lock.profile_config.active_profile = new_profile;
|
||||
lock.write_profile_curve_to_platform().unwrap();
|
||||
lock.save_config();
|
||||
Profile::set_profile(lock.profile_config.active_profile)
|
||||
.map_err(|e| {
|
||||
error!("Profile::set_profile() error: {e}");
|
||||
})
|
||||
.ok();
|
||||
|
||||
Self::notify_profile(
|
||||
&signal_ctxt,
|
||||
lock.profile_config.active_profile,
|
||||
)
|
||||
.await
|
||||
.ok();
|
||||
}
|
||||
}
|
||||
}
|
||||
})
|
||||
.await;
|
||||
}
|
||||
});
|
||||
|
||||
Ok(())
|
||||
}
|
||||
}
|
||||
|
||||
#[async_trait]
|
||||
impl crate::Reloadable for ProfileZbus {
|
||||
/// Fetch the active profile and use that to set all related components up
|
||||
async fn reload(&mut self) -> Result<(), RogError> {
|
||||
let mut ctrl = self.0.lock().await;
|
||||
let active = ctrl.profile_config.active_profile;
|
||||
if let Some(curves) = &mut ctrl.fan_curves {
|
||||
if let Ok(mut device) = FanCurveProfiles::get_device() {
|
||||
// There is a possibility that the curve was default zeroed, so this call
|
||||
// initialises the data from system read and we need to save it
|
||||
// after
|
||||
curves
|
||||
.profiles_mut()
|
||||
.write_profile_curve_to_platform(active, &mut device)?;
|
||||
ctrl.profile_config.write();
|
||||
}
|
||||
}
|
||||
Ok(())
|
||||
}
|
||||
}
|
||||
51
asusd/src/ctrl_slash/config.rs
Normal file
51
asusd/src/ctrl_slash/config.rs
Normal file
@@ -0,0 +1,51 @@
|
||||
use config_traits::{StdConfig, StdConfigLoad};
|
||||
use rog_slash::{DeviceState, SlashMode};
|
||||
use serde_derive::{Deserialize, Serialize};
|
||||
|
||||
const CONFIG_FILE: &str = "slash.ron";
|
||||
|
||||
/// Config for base system actions for the anime display
|
||||
#[derive(Deserialize, Serialize, Debug)]
|
||||
pub struct SlashConfig {
|
||||
pub slash_enabled: bool,
|
||||
pub slash_brightness: u8,
|
||||
pub slash_interval: u8,
|
||||
pub slash_mode: SlashMode,
|
||||
}
|
||||
|
||||
impl Default for SlashConfig {
|
||||
fn default() -> Self {
|
||||
SlashConfig {
|
||||
slash_enabled: true,
|
||||
slash_brightness: 255,
|
||||
slash_interval: 0,
|
||||
slash_mode: SlashMode::Bounce,
|
||||
}
|
||||
}
|
||||
}
|
||||
impl StdConfig for SlashConfig {
|
||||
fn new() -> Self {
|
||||
Self::default()
|
||||
}
|
||||
|
||||
fn file_name(&self) -> String {
|
||||
CONFIG_FILE.to_owned()
|
||||
}
|
||||
|
||||
fn config_dir() -> std::path::PathBuf {
|
||||
std::path::PathBuf::from(crate::CONFIG_PATH_BASE)
|
||||
}
|
||||
}
|
||||
|
||||
impl StdConfigLoad for SlashConfig {}
|
||||
|
||||
impl From<&SlashConfig> for DeviceState {
|
||||
fn from(config: &SlashConfig) -> Self {
|
||||
DeviceState {
|
||||
slash_enabled: config.slash_enabled,
|
||||
slash_brightness: config.slash_brightness,
|
||||
slash_interval: config.slash_interval,
|
||||
slash_mode: config.slash_mode,
|
||||
}
|
||||
}
|
||||
}
|
||||
98
asusd/src/ctrl_slash/mod.rs
Normal file
98
asusd/src/ctrl_slash/mod.rs
Normal file
@@ -0,0 +1,98 @@
|
||||
pub mod config;
|
||||
pub mod trait_impls;
|
||||
|
||||
use config_traits::{StdConfig, StdConfigLoad};
|
||||
use rog_platform::hid_raw::HidRaw;
|
||||
use rog_platform::usb_raw::USBRaw;
|
||||
use rog_slash::error::SlashError;
|
||||
use rog_slash::usb::{get_slash_type, pkt_set_mode, pkt_set_options, pkts_for_init};
|
||||
use rog_slash::{SlashMode, SlashType};
|
||||
|
||||
use crate::ctrl_slash::config::SlashConfig;
|
||||
use crate::error::RogError;
|
||||
|
||||
enum Node {
|
||||
Usb(USBRaw),
|
||||
Hid(HidRaw),
|
||||
}
|
||||
|
||||
impl Node {
|
||||
pub fn write_bytes(&self, message: &[u8]) -> Result<(), RogError> {
|
||||
// TODO: map and pass on errors
|
||||
match self {
|
||||
Node::Usb(u) => {
|
||||
u.write_bytes(message).ok();
|
||||
}
|
||||
Node::Hid(h) => {
|
||||
h.write_bytes(message).ok();
|
||||
}
|
||||
}
|
||||
Ok(())
|
||||
}
|
||||
}
|
||||
|
||||
pub struct CtrlSlash {
|
||||
node: Node,
|
||||
config: SlashConfig,
|
||||
}
|
||||
|
||||
impl CtrlSlash {
|
||||
#[inline]
|
||||
pub fn new() -> Result<CtrlSlash, RogError> {
|
||||
let slash_type = get_slash_type()?;
|
||||
if matches!(slash_type, SlashType::Unknown | SlashType::Unsupported) {
|
||||
return Err(RogError::Slash(SlashError::NoDevice));
|
||||
}
|
||||
|
||||
let usb = USBRaw::new(rog_slash::usb::PROD_ID).ok();
|
||||
let hid = HidRaw::new(rog_slash::usb::PROD_ID_STR).ok();
|
||||
let node = if usb.is_some() {
|
||||
unsafe { Node::Usb(usb.unwrap_unchecked()) }
|
||||
} else if hid.is_some() {
|
||||
unsafe { Node::Hid(hid.unwrap_unchecked()) }
|
||||
} else {
|
||||
return Err(RogError::NotSupported);
|
||||
};
|
||||
|
||||
let ctrl = CtrlSlash {
|
||||
node,
|
||||
config: SlashConfig::new().load(),
|
||||
};
|
||||
ctrl.do_initialization()?;
|
||||
|
||||
Ok(ctrl)
|
||||
}
|
||||
|
||||
fn do_initialization(&self) -> Result<(), RogError> {
|
||||
let init_packets = pkts_for_init();
|
||||
self.node.write_bytes(&init_packets[0])?;
|
||||
self.node.write_bytes(&init_packets[1])?;
|
||||
|
||||
// Apply config upon initialization
|
||||
let option_packets = pkt_set_options(
|
||||
self.config.slash_enabled,
|
||||
self.config.slash_brightness,
|
||||
self.config.slash_interval,
|
||||
);
|
||||
self.node.write_bytes(&option_packets)?;
|
||||
|
||||
let mode_packets = pkt_set_mode(self.config.slash_mode);
|
||||
self.node.write_bytes(&mode_packets[0])?;
|
||||
self.node.write_bytes(&mode_packets[1])?;
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
pub fn set_options(&self, enabled: bool, brightness: u8, interval: u8) -> Result<(), RogError> {
|
||||
let command_packets = pkt_set_options(enabled, brightness, interval);
|
||||
self.node.write_bytes(&command_packets)?;
|
||||
Ok(())
|
||||
}
|
||||
|
||||
pub fn set_slash_mode(&self, slash_mode: SlashMode) -> Result<(), RogError> {
|
||||
let command_packets = pkt_set_mode(slash_mode);
|
||||
self.node.write_bytes(&command_packets[0])?;
|
||||
self.node.write_bytes(&command_packets[1])?;
|
||||
Ok(())
|
||||
}
|
||||
}
|
||||
165
asusd/src/ctrl_slash/trait_impls.rs
Normal file
165
asusd/src/ctrl_slash/trait_impls.rs
Normal file
@@ -0,0 +1,165 @@
|
||||
use std::sync::Arc;
|
||||
|
||||
use config_traits::StdConfig;
|
||||
use log::warn;
|
||||
use rog_slash::usb::{pkt_set_mode, pkt_set_options};
|
||||
use rog_slash::{DeviceState, SlashMode};
|
||||
use zbus::export::futures_util::lock::Mutex;
|
||||
use zbus::{interface, Connection, SignalContext};
|
||||
|
||||
use crate::ctrl_slash::CtrlSlash;
|
||||
use crate::error::RogError;
|
||||
|
||||
pub const SLASH_ZBUS_NAME: &str = "Slash";
|
||||
pub const SLASH_ZBUS_PATH: &str = "/org/asuslinux";
|
||||
|
||||
#[derive(Clone)]
|
||||
pub struct CtrlSlashZbus(pub Arc<Mutex<CtrlSlash>>);
|
||||
|
||||
/// The struct with the main dbus methods requires this trait
|
||||
impl crate::ZbusRun for CtrlSlashZbus {
|
||||
async fn add_to_server(self, server: &mut Connection) {
|
||||
Self::add_to_server_helper(self, SLASH_ZBUS_PATH, server).await;
|
||||
}
|
||||
}
|
||||
|
||||
#[interface(name = "org.asuslinux.Slash")]
|
||||
impl CtrlSlashZbus {
|
||||
/// Get enabled or not
|
||||
#[zbus(property)]
|
||||
async fn enabled(&self) -> bool {
|
||||
let lock = self.0.lock().await;
|
||||
lock.config.slash_enabled
|
||||
}
|
||||
|
||||
/// Set enabled true or false
|
||||
#[zbus(property)]
|
||||
async fn set_enabled(&self, enabled: bool) {
|
||||
let mut lock = self.0.lock().await;
|
||||
let brightness = if enabled && lock.config.slash_brightness == 0 {
|
||||
0x88
|
||||
} else {
|
||||
lock.config.slash_brightness
|
||||
};
|
||||
lock.node
|
||||
.write_bytes(&pkt_set_options(
|
||||
enabled,
|
||||
brightness,
|
||||
lock.config.slash_interval,
|
||||
))
|
||||
.map_err(|err| {
|
||||
warn!("ctrl_slash::set_options {}", err);
|
||||
})
|
||||
.ok();
|
||||
|
||||
lock.config.slash_enabled = enabled;
|
||||
lock.config.slash_brightness = brightness;
|
||||
lock.config.write();
|
||||
}
|
||||
|
||||
/// Get brightness level
|
||||
#[zbus(property)]
|
||||
async fn brightness(&self) -> u8 {
|
||||
let lock = self.0.lock().await;
|
||||
lock.config.slash_brightness
|
||||
}
|
||||
|
||||
/// Set brightness level
|
||||
#[zbus(property)]
|
||||
async fn set_brightness(&self, brightness: u8) {
|
||||
let mut lock = self.0.lock().await;
|
||||
let enabled = brightness > 0;
|
||||
lock.node
|
||||
.write_bytes(&pkt_set_options(
|
||||
enabled,
|
||||
brightness,
|
||||
lock.config.slash_interval,
|
||||
))
|
||||
.map_err(|err| {
|
||||
warn!("ctrl_slash::set_options {}", err);
|
||||
})
|
||||
.ok();
|
||||
|
||||
lock.config.slash_enabled = enabled;
|
||||
lock.config.slash_brightness = brightness;
|
||||
lock.config.write();
|
||||
}
|
||||
|
||||
#[zbus(property)]
|
||||
async fn interval(&self) -> u8 {
|
||||
let lock = self.0.lock().await;
|
||||
lock.config.slash_interval
|
||||
}
|
||||
|
||||
/// Set interval between slash animations (0-255)
|
||||
#[zbus(property)]
|
||||
async fn set_interval(&self, interval: u8) {
|
||||
let mut lock = self.0.lock().await;
|
||||
lock.node
|
||||
.write_bytes(&pkt_set_options(
|
||||
lock.config.slash_enabled,
|
||||
lock.config.slash_brightness,
|
||||
interval,
|
||||
))
|
||||
.map_err(|err| {
|
||||
warn!("ctrl_slash::set_options {}", err);
|
||||
})
|
||||
.ok();
|
||||
|
||||
lock.config.slash_interval = interval;
|
||||
lock.config.write();
|
||||
}
|
||||
|
||||
#[zbus(property)]
|
||||
async fn slash_mode(&self) -> u8 {
|
||||
let lock = self.0.lock().await;
|
||||
lock.config.slash_interval
|
||||
}
|
||||
|
||||
/// Set interval between slash animations (0-255)
|
||||
#[zbus(property)]
|
||||
async fn set_slash_mode(&self, slash_mode: SlashMode) {
|
||||
let mut lock = self.0.lock().await;
|
||||
|
||||
let command_packets = pkt_set_mode(slash_mode);
|
||||
|
||||
lock.node
|
||||
.write_bytes(&command_packets[0])
|
||||
.map_err(|err| {
|
||||
warn!("ctrl_slash::set_options {}", err);
|
||||
})
|
||||
.ok();
|
||||
lock.node
|
||||
.write_bytes(&command_packets[1])
|
||||
.map_err(|err| {
|
||||
warn!("ctrl_slash::set_options {}", err);
|
||||
})
|
||||
.ok();
|
||||
|
||||
lock.config.slash_mode = slash_mode;
|
||||
lock.config.write();
|
||||
}
|
||||
|
||||
/// Get the device state as stored by asusd
|
||||
// #[zbus(property)]
|
||||
async fn device_state(&self) -> DeviceState {
|
||||
let lock = self.0.lock().await;
|
||||
DeviceState::from(&lock.config)
|
||||
}
|
||||
}
|
||||
|
||||
impl crate::CtrlTask for CtrlSlashZbus {
|
||||
fn zbus_path() -> &'static str {
|
||||
SLASH_ZBUS_PATH
|
||||
}
|
||||
|
||||
async fn create_tasks(&self, _: SignalContext<'static>) -> Result<(), RogError> {
|
||||
Ok(())
|
||||
}
|
||||
}
|
||||
|
||||
impl crate::Reloadable for CtrlSlashZbus {
|
||||
async fn reload(&mut self) -> Result<(), RogError> {
|
||||
Ok(())
|
||||
}
|
||||
}
|
||||
@@ -1,49 +0,0 @@
|
||||
use async_trait::async_trait;
|
||||
use serde_derive::{Deserialize, Serialize};
|
||||
use zbus::zvariant::Type;
|
||||
use zbus::{dbus_interface, Connection};
|
||||
|
||||
use crate::ctrl_anime::CtrlAnime;
|
||||
use crate::ctrl_aura::controller::CtrlKbdLed;
|
||||
use crate::ctrl_platform::CtrlPlatform;
|
||||
use crate::ctrl_power::CtrlPower;
|
||||
use crate::ctrl_profiles::controller::CtrlPlatformProfile;
|
||||
use crate::GetSupported;
|
||||
|
||||
#[derive(Serialize, Deserialize, Debug, Type)]
|
||||
pub struct SupportedFunctions(rog_platform::supported::SupportedFunctions);
|
||||
|
||||
#[dbus_interface(name = "org.asuslinux.Daemon")]
|
||||
impl SupportedFunctions {
|
||||
pub fn supported_functions(
|
||||
&self,
|
||||
) -> zbus::fdo::Result<&rog_platform::supported::SupportedFunctions> {
|
||||
Ok(&self.0)
|
||||
}
|
||||
|
||||
#[dbus_interface(out_args("answer", "question"))]
|
||||
fn meaning_of_life(&self) -> zbus::fdo::Result<(i32, String)> {
|
||||
Ok((42, String::from("Meaning of life")))
|
||||
}
|
||||
}
|
||||
|
||||
#[async_trait]
|
||||
impl crate::ZbusRun for SupportedFunctions {
|
||||
async fn add_to_server(self, server: &mut Connection) {
|
||||
Self::add_to_server_helper(self, "/org/asuslinux/Supported", server).await;
|
||||
}
|
||||
}
|
||||
|
||||
impl GetSupported for SupportedFunctions {
|
||||
type A = SupportedFunctions;
|
||||
|
||||
fn get_supported() -> Self::A {
|
||||
Self(rog_platform::supported::SupportedFunctions {
|
||||
anime_ctrl: CtrlAnime::get_supported(),
|
||||
keyboard_led: CtrlKbdLed::get_supported(),
|
||||
charge_ctrl: CtrlPower::get_supported(),
|
||||
platform_profile: CtrlPlatformProfile::get_supported(),
|
||||
rog_bios_ctrl: CtrlPlatform::get_supported(),
|
||||
})
|
||||
}
|
||||
}
|
||||
@@ -1,39 +1,30 @@
|
||||
use std::env;
|
||||
use std::error::Error;
|
||||
use std::io::Write;
|
||||
use std::sync::Arc;
|
||||
use std::time::Duration;
|
||||
|
||||
use ::zbus::export::futures_util::lock::Mutex;
|
||||
use ::zbus::Connection;
|
||||
use asusd::config::Config;
|
||||
use asusd::ctrl_anime::config::AnimeConfig;
|
||||
use asusd::ctrl_anime::trait_impls::CtrlAnimeZbus;
|
||||
use asusd::ctrl_anime::CtrlAnime;
|
||||
use asusd::ctrl_aura::controller::CtrlKbdLed;
|
||||
use asusd::ctrl_aura::trait_impls::CtrlKbdLedZbus;
|
||||
use asusd::ctrl_aura::manager::AuraManager;
|
||||
use asusd::ctrl_fancurves::CtrlFanCurveZbus;
|
||||
use asusd::ctrl_platform::CtrlPlatform;
|
||||
use asusd::ctrl_power::CtrlPower;
|
||||
use asusd::ctrl_profiles::config::ProfileConfig;
|
||||
use asusd::ctrl_profiles::controller::CtrlPlatformProfile;
|
||||
use asusd::ctrl_profiles::trait_impls::ProfileZbus;
|
||||
use asusd::ctrl_supported::SupportedFunctions;
|
||||
use asusd::{print_board_info, CtrlTask, GetSupported, Reloadable, ZbusRun};
|
||||
use config_traits::{StdConfig, StdConfigLoad, StdConfigLoad2};
|
||||
use log::{error, info, warn};
|
||||
use rog_aura::aura_detection::LaptopLedData;
|
||||
use rog_dbus::DBUS_NAME;
|
||||
use rog_profiles::Profile;
|
||||
use tokio::time::sleep;
|
||||
use zbus::SignalContext;
|
||||
use asusd::ctrl_slash::trait_impls::CtrlSlashZbus;
|
||||
use asusd::ctrl_slash::CtrlSlash;
|
||||
use asusd::{print_board_info, start_tasks, CtrlTask, DBUS_NAME};
|
||||
use config_traits::{StdConfig, StdConfigLoad1};
|
||||
use log::{error, info};
|
||||
use zbus::fdo::ObjectManager;
|
||||
|
||||
#[tokio::main]
|
||||
async fn main() -> Result<(), Box<dyn std::error::Error>> {
|
||||
// console_subscriber::init();
|
||||
let mut logger = env_logger::Builder::new();
|
||||
logger
|
||||
.parse_default_env()
|
||||
.target(env_logger::Target::Stdout)
|
||||
.format(|buf, record| writeln!(buf, "{}: {}", record.level(), record.args()))
|
||||
.format_timestamp(None)
|
||||
.init();
|
||||
|
||||
let is_service = match env::var_os("IS_SERVICE") {
|
||||
@@ -52,8 +43,8 @@ async fn main() -> Result<(), Box<dyn std::error::Error>> {
|
||||
|
||||
info!(" daemon v{}", asusd::VERSION);
|
||||
info!(" rog-anime v{}", rog_anime::VERSION);
|
||||
info!(" rog-slash v{}", rog_slash::VERSION);
|
||||
info!(" rog-aura v{}", rog_aura::VERSION);
|
||||
info!(" rog-dbus v{}", rog_dbus::VERSION);
|
||||
info!(" rog-profiles v{}", rog_profiles::VERSION);
|
||||
info!("rog-platform v{}", rog_platform::VERSION);
|
||||
|
||||
@@ -63,19 +54,39 @@ async fn main() -> Result<(), Box<dyn std::error::Error>> {
|
||||
|
||||
/// The actual main loop for the daemon
|
||||
async fn start_daemon() -> Result<(), Box<dyn Error>> {
|
||||
let supported = SupportedFunctions::get_supported();
|
||||
// let supported = SupportedFunctions::get_supported();
|
||||
print_board_info();
|
||||
println!("{:?}", supported.supported_functions());
|
||||
// println!("{:?}", supported.supported_functions());
|
||||
|
||||
// Start zbus server
|
||||
let mut connection = Connection::system().await?;
|
||||
connection
|
||||
.object_server()
|
||||
.at("/org/asuslinux", ObjectManager)
|
||||
.await
|
||||
.unwrap();
|
||||
|
||||
let config = Config::new().load();
|
||||
let cfg_path = config.file_path();
|
||||
let config = Arc::new(Mutex::new(config));
|
||||
|
||||
supported.add_to_server(&mut connection).await;
|
||||
// supported.add_to_server(&mut connection).await;
|
||||
|
||||
match CtrlPlatform::new(config.clone()) {
|
||||
match CtrlFanCurveZbus::new() {
|
||||
Ok(ctrl) => {
|
||||
let sig_ctx = CtrlFanCurveZbus::signal_context(&connection)?;
|
||||
start_tasks(ctrl, &mut connection, sig_ctx).await?;
|
||||
}
|
||||
Err(err) => {
|
||||
error!("FanCurves: {}", err);
|
||||
}
|
||||
}
|
||||
|
||||
match CtrlPlatform::new(
|
||||
config.clone(),
|
||||
&cfg_path,
|
||||
CtrlPlatform::signal_context(&connection)?,
|
||||
) {
|
||||
Ok(ctrl) => {
|
||||
let sig_ctx = CtrlPlatform::signal_context(&connection)?;
|
||||
start_tasks(ctrl, &mut connection, sig_ctx).await?;
|
||||
@@ -85,33 +96,7 @@ async fn start_daemon() -> Result<(), Box<dyn Error>> {
|
||||
}
|
||||
}
|
||||
|
||||
match CtrlPower::new(config.clone()) {
|
||||
Ok(ctrl) => {
|
||||
let sig_ctx = CtrlPower::signal_context(&connection)?;
|
||||
start_tasks(ctrl, &mut connection, sig_ctx).await?;
|
||||
}
|
||||
Err(err) => {
|
||||
error!("CtrlPower: {}", err);
|
||||
}
|
||||
}
|
||||
|
||||
if Profile::is_platform_profile_supported() {
|
||||
let profile_config = ProfileConfig::new().load();
|
||||
match CtrlPlatformProfile::new(profile_config) {
|
||||
Ok(ctrl) => {
|
||||
let zbus = ProfileZbus(Arc::new(Mutex::new(ctrl)));
|
||||
let sig_ctx = ProfileZbus::signal_context(&connection)?;
|
||||
start_tasks(zbus, &mut connection, sig_ctx).await?;
|
||||
}
|
||||
Err(err) => {
|
||||
error!("Profile control: {}", err);
|
||||
}
|
||||
}
|
||||
} else {
|
||||
warn!("platform_profile support not found");
|
||||
}
|
||||
|
||||
match CtrlAnime::new(AnimeConfig::new().load()) {
|
||||
match CtrlAnime::new() {
|
||||
Ok(ctrl) => {
|
||||
let zbus = CtrlAnimeZbus(Arc::new(Mutex::new(ctrl)));
|
||||
let sig_ctx = CtrlAnimeZbus::signal_context(&connection)?;
|
||||
@@ -122,44 +107,28 @@ async fn start_daemon() -> Result<(), Box<dyn Error>> {
|
||||
}
|
||||
}
|
||||
|
||||
let laptop = LaptopLedData::get_data();
|
||||
// CtrlKbdLed deviates from the config pattern above due to requiring a keyboard
|
||||
// detection first
|
||||
match CtrlKbdLed::new(laptop) {
|
||||
match CtrlSlash::new() {
|
||||
Ok(ctrl) => {
|
||||
let zbus = CtrlKbdLedZbus(Arc::new(Mutex::new(ctrl)));
|
||||
let sig_ctx = CtrlKbdLedZbus::signal_context(&connection)?;
|
||||
let zbus = CtrlSlashZbus(Arc::new(Mutex::new(ctrl)));
|
||||
// Currently, the Slash has no need for a loop watching power events, however,
|
||||
// it could be cool to have the slash do some power-on/off animation
|
||||
// (It has a built-in power on animation which plays when u plug in the power
|
||||
// supply)
|
||||
let sig_ctx = CtrlSlashZbus::signal_context(&connection)?;
|
||||
start_tasks(zbus, &mut connection, sig_ctx).await?;
|
||||
}
|
||||
Err(err) => {
|
||||
error!("Keyboard control: {}", err);
|
||||
info!("AniMe control: {}", err);
|
||||
}
|
||||
}
|
||||
|
||||
let _ = AuraManager::new(connection.clone()).await?;
|
||||
|
||||
// Request dbus name after finishing initalizing all functions
|
||||
connection.request_name(DBUS_NAME).await?;
|
||||
|
||||
loop {
|
||||
// This is just a blocker to idle and ensure the reator reacts
|
||||
sleep(Duration::from_millis(1000)).await;
|
||||
connection.executor().tick().await;
|
||||
}
|
||||
}
|
||||
|
||||
async fn start_tasks<T>(
|
||||
mut zbus: T,
|
||||
connection: &mut Connection,
|
||||
signal_ctx: SignalContext<'static>,
|
||||
) -> Result<(), Box<dyn Error>>
|
||||
where
|
||||
T: ZbusRun + Reloadable + CtrlTask + Clone,
|
||||
{
|
||||
let task = zbus.clone();
|
||||
|
||||
zbus.reload()
|
||||
.await
|
||||
.unwrap_or_else(|err| warn!("Controller error: {}", err));
|
||||
zbus.add_to_server(connection).await;
|
||||
|
||||
task.create_tasks(signal_ctx).await.ok();
|
||||
Ok(())
|
||||
}
|
||||
|
||||
@@ -5,6 +5,7 @@ use config_traits::ron;
|
||||
use rog_anime::error::AnimeError;
|
||||
use rog_platform::error::PlatformError;
|
||||
use rog_profiles::error::ProfileError;
|
||||
use rog_slash::error::SlashError;
|
||||
|
||||
#[derive(Debug)]
|
||||
pub enum RogError {
|
||||
@@ -31,6 +32,7 @@ pub enum RogError {
|
||||
NoAuraKeyboard,
|
||||
NoAuraNode,
|
||||
Anime(AnimeError),
|
||||
Slash(SlashError),
|
||||
Platform(PlatformError),
|
||||
SystemdUnitAction(String),
|
||||
SystemdUnitWaitTimeout(String),
|
||||
@@ -72,6 +74,7 @@ impl fmt::Display for RogError {
|
||||
RogError::NoAuraKeyboard => write!(f, "No supported Aura keyboard"),
|
||||
RogError::NoAuraNode => write!(f, "No Aura keyboard node found"),
|
||||
RogError::Anime(deets) => write!(f, "AniMe Matrix error: {}", deets),
|
||||
RogError::Slash(deets) => write!(f, "Slash error: {}", deets),
|
||||
RogError::Platform(deets) => write!(f, "Asus Platform error: {}", deets),
|
||||
RogError::SystemdUnitAction(action) => {
|
||||
write!(f, "systemd unit action {} failed", action)
|
||||
@@ -103,6 +106,12 @@ impl From<AnimeError> for RogError {
|
||||
}
|
||||
}
|
||||
|
||||
impl From<SlashError> for RogError {
|
||||
fn from(err: SlashError) -> Self {
|
||||
RogError::Slash(err)
|
||||
}
|
||||
}
|
||||
|
||||
impl From<PlatformError> for RogError {
|
||||
fn from(err: PlatformError) -> Self {
|
||||
RogError::Platform(err)
|
||||
|
||||
268
asusd/src/lib.rs
268
asusd/src/lib.rs
@@ -5,30 +5,32 @@ pub mod config;
|
||||
pub mod ctrl_anime;
|
||||
/// Keyboard LED brightness control, RGB, and LED display modes
|
||||
pub mod ctrl_aura;
|
||||
/// Control platform profiles + fan-curves if available
|
||||
pub mod ctrl_fancurves;
|
||||
/// Control ASUS bios function such as boot sound, Optimus/Dedicated gfx mode
|
||||
pub mod ctrl_platform;
|
||||
/// Control of battery charge level
|
||||
pub mod ctrl_power;
|
||||
/// Control platform profiles + fan-curves if available
|
||||
pub mod ctrl_profiles;
|
||||
|
||||
/// Fetch all supported functions for the laptop
|
||||
pub mod ctrl_supported;
|
||||
/// Control of Slash led bar
|
||||
pub mod ctrl_slash;
|
||||
|
||||
pub mod error;
|
||||
|
||||
use std::future::Future;
|
||||
use std::time::Duration;
|
||||
|
||||
use async_trait::async_trait;
|
||||
use dmi_id::DMIID;
|
||||
use futures_lite::stream::StreamExt;
|
||||
use log::{debug, info, warn};
|
||||
use logind_zbus::manager::ManagerProxy;
|
||||
use zbus::export::futures_util::StreamExt;
|
||||
use tokio::time::sleep;
|
||||
use zbus::zvariant::ObjectPath;
|
||||
use zbus::{Connection, SignalContext};
|
||||
use zbus::{CacheProperties, Connection, SignalContext};
|
||||
|
||||
use crate::error::RogError;
|
||||
|
||||
const CONFIG_PATH_BASE: &str = "/etc/asusd/";
|
||||
pub static DBUS_NAME: &str = "org.asuslinux.Daemon";
|
||||
pub static DBUS_PATH: &str = "/org/asuslinux/Daemon";
|
||||
pub static DBUS_IFACE: &str = "org.asuslinux.Daemon";
|
||||
|
||||
/// This macro adds a function which spawns an `inotify` task on the passed in
|
||||
/// `Executor`.
|
||||
@@ -46,14 +48,54 @@ const CONFIG_PATH_BASE: &str = "/etc/asusd/";
|
||||
/// # Example
|
||||
///
|
||||
/// ```ignore
|
||||
/// impl CtrlRogBios {
|
||||
/// impl RogPlatform {
|
||||
/// task_watch_item!(panel_od platform);
|
||||
/// task_watch_item!(gpu_mux_mode platform);
|
||||
/// }
|
||||
/// ```
|
||||
/// ```\
|
||||
/// // TODO: this is kind of useless if it can't trigger some action
|
||||
#[macro_export]
|
||||
macro_rules! task_watch_item {
|
||||
($name:ident $name_str:literal $self_inner:ident) => {
|
||||
concat_idents::concat_idents!(fn_name = watch_, $name {
|
||||
async fn fn_name(
|
||||
&self,
|
||||
signal_ctxt: SignalContext<'static>,
|
||||
) -> Result<(), RogError> {
|
||||
use zbus::export::futures_util::StreamExt;
|
||||
|
||||
let ctrl = self.clone();
|
||||
concat_idents::concat_idents!(watch_fn = monitor_, $name {
|
||||
match self.$self_inner.watch_fn() {
|
||||
Ok(watch) => {
|
||||
tokio::spawn(async move {
|
||||
let mut buffer = [0; 32];
|
||||
watch.into_event_stream(&mut buffer).unwrap().for_each(|_| async {
|
||||
if let Ok(value) = ctrl.$name() { // get new value from zbus method
|
||||
if ctrl.config.lock().await.$name != value {
|
||||
log::debug!("{} was changed to {} externally", $name_str, value);
|
||||
concat_idents::concat_idents!(notif_fn = $name, _changed {
|
||||
ctrl.notif_fn(&signal_ctxt).await.ok();
|
||||
});
|
||||
let mut lock = ctrl.config.lock().await;
|
||||
lock.$name = value;
|
||||
lock.write();
|
||||
}
|
||||
}
|
||||
}).await;
|
||||
});
|
||||
}
|
||||
Err(e) => info!("inotify watch failed: {}. You can ignore this if your device does not support the feature", e),
|
||||
}
|
||||
});
|
||||
Ok(())
|
||||
}
|
||||
});
|
||||
};
|
||||
}
|
||||
|
||||
#[macro_export]
|
||||
macro_rules! task_watch_item_notify {
|
||||
($name:ident $self_inner:ident) => {
|
||||
concat_idents::concat_idents!(fn_name = watch_, $name {
|
||||
async fn fn_name(
|
||||
@@ -69,9 +111,8 @@ macro_rules! task_watch_item {
|
||||
tokio::spawn(async move {
|
||||
let mut buffer = [0; 32];
|
||||
watch.into_event_stream(&mut buffer).unwrap().for_each(|_| async {
|
||||
let value = ctrl.$name();
|
||||
concat_idents::concat_idents!(notif_fn = notify_, $name {
|
||||
Self::notif_fn(&signal_ctxt, value).await.ok();
|
||||
concat_idents::concat_idents!(notif_fn = $name, _changed {
|
||||
ctrl.notif_fn(&signal_ctxt).await.ok();
|
||||
});
|
||||
}).await;
|
||||
});
|
||||
@@ -88,42 +129,48 @@ macro_rules! task_watch_item {
|
||||
pub const VERSION: &str = env!("CARGO_PKG_VERSION");
|
||||
|
||||
pub fn print_board_info() {
|
||||
let dmi = sysfs_class::DmiId::default();
|
||||
let board_name = dmi.board_name().expect("Could not get board_name");
|
||||
let prod_family = dmi.product_family().expect("Could not get product_family");
|
||||
|
||||
info!("Product family: {}", prod_family.trim());
|
||||
info!("Board name: {}", board_name.trim());
|
||||
let dmi = DMIID::new().unwrap_or_default();
|
||||
info!("Product family: {}", dmi.product_family);
|
||||
info!("Board name: {}", dmi.board_name);
|
||||
}
|
||||
|
||||
#[async_trait]
|
||||
pub trait Reloadable {
|
||||
async fn reload(&mut self) -> Result<(), RogError>;
|
||||
fn reload(&mut self) -> impl Future<Output = Result<(), RogError>> + Send;
|
||||
}
|
||||
|
||||
#[async_trait]
|
||||
pub trait ZbusRun {
|
||||
async fn add_to_server(self, server: &mut Connection);
|
||||
pub trait ReloadAndNotify {
|
||||
type Data: Send;
|
||||
|
||||
async fn add_to_server_helper(
|
||||
fn reload_and_notify(
|
||||
&mut self,
|
||||
signal_context: &SignalContext<'static>,
|
||||
data: Self::Data,
|
||||
) -> impl Future<Output = Result<(), RogError>> + Send;
|
||||
}
|
||||
|
||||
pub trait ZbusRun {
|
||||
fn add_to_server(self, server: &mut Connection) -> impl Future<Output = ()> + Send;
|
||||
|
||||
fn add_to_server_helper(
|
||||
iface: impl zbus::Interface,
|
||||
path: &str,
|
||||
server: &mut Connection,
|
||||
) {
|
||||
server
|
||||
.object_server()
|
||||
.at(&ObjectPath::from_str_unchecked(path), iface)
|
||||
.await
|
||||
.map_err(|err| {
|
||||
warn!("{}: add_to_server {}", path, err);
|
||||
err
|
||||
})
|
||||
.ok();
|
||||
) -> impl Future<Output = ()> + Send {
|
||||
async move {
|
||||
server
|
||||
.object_server()
|
||||
.at(&ObjectPath::from_str_unchecked(path), iface)
|
||||
.await
|
||||
.map_err(|err| {
|
||||
warn!("{}: add_to_server {}", path, err);
|
||||
err
|
||||
})
|
||||
.ok();
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/// Set up a task to run on the async executor
|
||||
#[async_trait]
|
||||
pub trait CtrlTask {
|
||||
fn zbus_path() -> &'static str;
|
||||
|
||||
@@ -134,7 +181,10 @@ pub trait CtrlTask {
|
||||
/// Implement to set up various tasks that may be required, using the
|
||||
/// `Executor`. No blocking loops are allowed, or they must be run on a
|
||||
/// separate thread.
|
||||
async fn create_tasks(&self, signal: SignalContext<'static>) -> Result<(), RogError>;
|
||||
fn create_tasks(
|
||||
&self,
|
||||
signal: SignalContext<'static>,
|
||||
) -> impl Future<Output = Result<(), RogError>> + Send;
|
||||
|
||||
// /// Create a timed repeating task
|
||||
// async fn repeating_task(&self, millis: u64, mut task: impl FnMut() + Send +
|
||||
@@ -152,74 +202,89 @@ pub trait CtrlTask {
|
||||
///
|
||||
/// The closures can potentially block, so execution time should be the
|
||||
/// minimal possible such as save a variable.
|
||||
async fn create_sys_event_tasks<
|
||||
Fut1,
|
||||
Fut2,
|
||||
Fut3,
|
||||
Fut4,
|
||||
F1: Send + 'static,
|
||||
F2: Send + 'static,
|
||||
F3: Send + 'static,
|
||||
F4: Send + 'static,
|
||||
>(
|
||||
fn create_sys_event_tasks<Fut1, Fut2, Fut3, Fut4, F1, F2, F3, F4>(
|
||||
&self,
|
||||
mut on_sleep: F1,
|
||||
mut on_wake: F2,
|
||||
mut on_shutdown: F3,
|
||||
mut on_boot: F4,
|
||||
) where
|
||||
F1: FnMut() -> Fut1,
|
||||
F2: FnMut() -> Fut2,
|
||||
F3: FnMut() -> Fut3,
|
||||
F4: FnMut() -> Fut4,
|
||||
mut on_prepare_for_sleep: F1,
|
||||
mut on_prepare_for_shutdown: F2,
|
||||
mut on_lid_change: F3,
|
||||
mut on_external_power_change: F4,
|
||||
) -> impl Future<Output = ()> + Send
|
||||
where
|
||||
F1: FnMut(bool) -> Fut1 + Send + 'static,
|
||||
F2: FnMut(bool) -> Fut2 + Send + 'static,
|
||||
F3: FnMut(bool) -> Fut3 + Send + 'static,
|
||||
F4: FnMut(bool) -> Fut4 + Send + 'static,
|
||||
Fut1: Future<Output = ()> + Send,
|
||||
Fut2: Future<Output = ()> + Send,
|
||||
Fut3: Future<Output = ()> + Send,
|
||||
Fut4: Future<Output = ()> + Send,
|
||||
{
|
||||
let connection = Connection::system()
|
||||
.await
|
||||
.expect("Controller could not create dbus connection");
|
||||
async {
|
||||
let connection = Connection::system()
|
||||
.await
|
||||
.expect("Controller could not create dbus connection");
|
||||
|
||||
let manager = ManagerProxy::new(&connection)
|
||||
.await
|
||||
.expect("Controller could not create ManagerProxy");
|
||||
let manager = ManagerProxy::builder(&connection)
|
||||
.cache_properties(CacheProperties::No)
|
||||
.build()
|
||||
.await
|
||||
.expect("Controller could not create ManagerProxy");
|
||||
|
||||
tokio::spawn(async move {
|
||||
if let Ok(mut notif) = manager.receive_prepare_for_sleep().await {
|
||||
while let Some(event) = notif.next().await {
|
||||
if let Ok(args) = event.args() {
|
||||
if args.start {
|
||||
debug!("Doing on_sleep()");
|
||||
on_sleep().await;
|
||||
} else if !args.start() {
|
||||
debug!("Doing on_wake()");
|
||||
on_wake().await;
|
||||
let manager1 = manager.clone();
|
||||
tokio::spawn(async move {
|
||||
if let Ok(mut notif) = manager1.receive_prepare_for_shutdown().await {
|
||||
while let Some(event) = notif.next().await {
|
||||
// blocks thread :|
|
||||
if let Ok(args) = event.args() {
|
||||
debug!("Doing on_prepare_for_shutdown({})", args.start);
|
||||
on_prepare_for_shutdown(args.start).await;
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
});
|
||||
});
|
||||
|
||||
let manager = ManagerProxy::new(&connection)
|
||||
.await
|
||||
.expect("Controller could not create ManagerProxy");
|
||||
|
||||
tokio::spawn(async move {
|
||||
if let Ok(mut notif) = manager.receive_prepare_for_shutdown().await {
|
||||
while let Some(event) = notif.next().await {
|
||||
if let Ok(args) = event.args() {
|
||||
if args.start {
|
||||
debug!("Doing on_shutdown()");
|
||||
on_shutdown().await;
|
||||
} else if !args.start() {
|
||||
debug!("Doing on_boot()");
|
||||
on_boot().await;
|
||||
let manager2 = manager.clone();
|
||||
tokio::spawn(async move {
|
||||
if let Ok(mut notif) = manager2.receive_prepare_for_sleep().await {
|
||||
while let Some(event) = notif.next().await {
|
||||
// blocks thread :|
|
||||
if let Ok(args) = event.args() {
|
||||
debug!("Doing on_prepare_for_sleep({})", args.start);
|
||||
on_prepare_for_sleep(args.start).await;
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
});
|
||||
});
|
||||
|
||||
let manager3 = manager.clone();
|
||||
tokio::spawn(async move {
|
||||
let mut last_power = manager3.on_external_power().await.unwrap_or_default();
|
||||
|
||||
loop {
|
||||
if let Ok(next) = manager3.on_external_power().await {
|
||||
if next != last_power {
|
||||
last_power = next;
|
||||
on_external_power_change(next).await;
|
||||
}
|
||||
}
|
||||
sleep(Duration::from_secs(2)).await;
|
||||
}
|
||||
});
|
||||
|
||||
tokio::spawn(async move {
|
||||
let mut last_lid = manager.lid_closed().await.unwrap_or_default();
|
||||
// need to loop on these as they don't emit signals
|
||||
loop {
|
||||
if let Ok(next) = manager.lid_closed().await {
|
||||
if next != last_lid {
|
||||
last_lid = next;
|
||||
on_lid_change(next).await;
|
||||
}
|
||||
}
|
||||
sleep(Duration::from_secs(2)).await;
|
||||
}
|
||||
});
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
@@ -228,3 +293,22 @@ pub trait GetSupported {
|
||||
|
||||
fn get_supported() -> Self::A;
|
||||
}
|
||||
|
||||
pub async fn start_tasks<T>(
|
||||
mut zbus: T,
|
||||
connection: &mut Connection,
|
||||
signal_ctx: SignalContext<'static>,
|
||||
) -> Result<(), RogError>
|
||||
where
|
||||
T: ZbusRun + Reloadable + CtrlTask + Clone,
|
||||
{
|
||||
let zbus_clone = zbus.clone();
|
||||
|
||||
zbus.reload()
|
||||
.await
|
||||
.unwrap_or_else(|err| warn!("Controller error: {}", err));
|
||||
zbus.add_to_server(connection).await;
|
||||
|
||||
zbus_clone.create_tasks(signal_ctx).await.ok();
|
||||
Ok(())
|
||||
}
|
||||
|
||||
@@ -1,65 +0,0 @@
|
||||
<!DOCTYPE node PUBLIC "-//freedesktop//DTD D-BUS Object Introspection 1.0//EN" "http://www.freedesktop.org/standards/dbus/1.0/introspect.dtd">
|
||||
<node>
|
||||
<interface name="org.asuslinux.Daemon">
|
||||
<!--
|
||||
Writes a data stream of length. Will force system thread to exit until
|
||||
it is restarted
|
||||
-->
|
||||
<method name="Write">
|
||||
<arg name="input" type="(ays)" direction="in"/>
|
||||
</method>
|
||||
<!--
|
||||
Set the global AniMe brightness
|
||||
-->
|
||||
<method name="SetImageBrightness">
|
||||
<arg name="bright" type="d" direction="in"/>
|
||||
</method>
|
||||
<!--
|
||||
Set base brightness level
|
||||
-->
|
||||
<method name="SetBrightness">
|
||||
<arg name="brightness" type="s" direction="in"/>
|
||||
</method>
|
||||
<!--
|
||||
Enable the builtin animations or not
|
||||
-->
|
||||
<method name="SetBuiltinsEnabled">
|
||||
<arg name="enabled" type="b" direction="in"/>
|
||||
</method>
|
||||
<!--
|
||||
Set which builtin animation is used for each stage
|
||||
-->
|
||||
<method name="SetBuiltinAnimations">
|
||||
<arg name="boot" type="s" direction="in"/>
|
||||
<arg name="awake" type="s" direction="in"/>
|
||||
<arg name="sleep" type="s" direction="in"/>
|
||||
<arg name="shutdown" type="s" direction="in"/>
|
||||
</method>
|
||||
<!--
|
||||
Set whether the AniMe is enabled at all
|
||||
-->
|
||||
<method name="SetEnableDisplay">
|
||||
<arg name="enabled" type="b" direction="in"/>
|
||||
</method>
|
||||
<!--
|
||||
The main loop is the base system set action if the user isn't running
|
||||
the user daemon
|
||||
-->
|
||||
<method name="RunMainLoop">
|
||||
<arg name="start" type="b" direction="in"/>
|
||||
</method>
|
||||
<!--
|
||||
Get the device state as stored by asusd
|
||||
-->
|
||||
<method name="DeviceState">
|
||||
<arg type="bsb(ssss)" direction="out"/>
|
||||
</method>
|
||||
<!--
|
||||
Notify listeners of the status of AniMe LED power and factory
|
||||
system-status animations
|
||||
-->
|
||||
<signal name="NotifyDeviceState">
|
||||
<arg name="data" type="(bsb(ssss))"/>
|
||||
</signal>
|
||||
</interface>
|
||||
</node>
|
||||
@@ -1,71 +0,0 @@
|
||||
<!DOCTYPE node PUBLIC "-//freedesktop//DTD D-BUS Object Introspection 1.0//EN" "http://www.freedesktop.org/standards/dbus/1.0/introspect.dtd">
|
||||
<node>
|
||||
<interface name="org.asuslinux.Daemon">
|
||||
<!--
|
||||
Set the keyboard brightness level (0-3)
|
||||
-->
|
||||
<method name="SetBrightness">
|
||||
<arg name="brightness" type="s" direction="in"/>
|
||||
</method>
|
||||
<!--
|
||||
Set a variety of states, input is array of enum.
|
||||
`enabled` sets if the sent array should be disabled or enabled
|
||||
|
||||
For Modern ROG devices the "enabled" flag is ignored.
|
||||
-->
|
||||
<method name="SetLedPower">
|
||||
<arg name="options" type="(asas((sbbbb)(sbbbb)(sbbbb)(sbbbb)(sbbbb)))" direction="in"/>
|
||||
<arg name="enabled" type="b" direction="in"/>
|
||||
</method>
|
||||
<method name="SetLedMode">
|
||||
<arg name="effect" type="(ss(yyy)(yyy)ss)" direction="in"/>
|
||||
</method>
|
||||
<method name="NextLedMode">
|
||||
</method>
|
||||
<method name="PrevLedMode">
|
||||
</method>
|
||||
<method name="NextLedBrightness">
|
||||
</method>
|
||||
<method name="PrevLedBrightness">
|
||||
</method>
|
||||
<!--
|
||||
Return the device type for this Aura keyboard
|
||||
-->
|
||||
<method name="DeviceType">
|
||||
<arg type="s" direction="out"/>
|
||||
</method>
|
||||
<method name="LedPower">
|
||||
<arg type="asas((sbbbb)(sbbbb)(sbbbb)(sbbbb)(sbbbb))" direction="out"/>
|
||||
</method>
|
||||
<!--
|
||||
Return the current mode data
|
||||
-->
|
||||
<method name="LedMode">
|
||||
<arg type="s" direction="out"/>
|
||||
</method>
|
||||
<!--
|
||||
Return a list of available modes
|
||||
-->
|
||||
<method name="LedModes">
|
||||
<arg type="a{s(ss(yyy)(yyy)ss)}" direction="out"/>
|
||||
</method>
|
||||
<!--
|
||||
On machine that have some form of either per-key keyboard or per-zone
|
||||
this can be used to write custom effects over dbus. The input is a
|
||||
nested `Vec<Vec<8>>` where `Vec<u8>` is a raw USB packet
|
||||
-->
|
||||
<method name="DirectAddressingRaw">
|
||||
<arg name="data" type="aay" direction="in"/>
|
||||
</method>
|
||||
<signal name="NotifyLed">
|
||||
<arg name="data" type="(ss(yyy)(yyy)ss)"/>
|
||||
</signal>
|
||||
<signal name="NotifyPowerStates">
|
||||
<arg name="data" type="(asas((sbbbb)(sbbbb)(sbbbb)(sbbbb)(sbbbb)))"/>
|
||||
</signal>
|
||||
<!--
|
||||
Return the current LED brightness
|
||||
-->
|
||||
<property name="LedBrightness" type="n" access="read"/>
|
||||
</interface>
|
||||
</node>
|
||||
@@ -1,67 +0,0 @@
|
||||
<!DOCTYPE node PUBLIC "-//freedesktop//DTD D-BUS Object Introspection 1.0//EN" "http://www.freedesktop.org/standards/dbus/1.0/introspect.dtd">
|
||||
<node>
|
||||
<interface name="org.asuslinux.Daemon">
|
||||
<method name="SetGpuMuxMode">
|
||||
<arg name="mode" type="u" direction="in"/>
|
||||
</method>
|
||||
<method name="GpuMuxMode">
|
||||
<arg type="u" direction="out"/>
|
||||
</method>
|
||||
<signal name="NotifyGpuMuxMode">
|
||||
<arg name="mode" type="u"/>
|
||||
</signal>
|
||||
<method name="SetPostBootSound">
|
||||
<arg name="on" type="b" direction="in"/>
|
||||
</method>
|
||||
<method name="PostBootSound">
|
||||
<arg type="n" direction="out"/>
|
||||
</method>
|
||||
<signal name="NotifyPostBootSound">
|
||||
<arg name="on" type="b"/>
|
||||
</signal>
|
||||
<method name="SetPanelOd">
|
||||
<arg name="overdrive" type="b" direction="in"/>
|
||||
</method>
|
||||
<!--
|
||||
Get the `panel_od` value from platform. Updates the stored value in
|
||||
internal config also.
|
||||
-->
|
||||
<method name="PanelOd">
|
||||
<arg type="b" direction="out"/>
|
||||
</method>
|
||||
<signal name="NotifyPanelOd">
|
||||
<arg name="overdrive" type="b"/>
|
||||
</signal>
|
||||
<method name="SetMiniLedMode">
|
||||
<arg name="on" type="b" direction="in"/>
|
||||
</method>
|
||||
<!--
|
||||
Get the `panel_od` value from platform. Updates the stored value in
|
||||
internal config also.
|
||||
-->
|
||||
<method name="MiniLedMode">
|
||||
<arg type="b" direction="out"/>
|
||||
</method>
|
||||
<signal name="NotifyMiniLedMode">
|
||||
<arg name="on" type="b"/>
|
||||
</signal>
|
||||
<method name="SetDgpuDisable">
|
||||
<arg name="disable" type="b" direction="in"/>
|
||||
</method>
|
||||
<method name="DgpuDisable">
|
||||
<arg type="b" direction="out"/>
|
||||
</method>
|
||||
<signal name="NotifyDgpuDisable">
|
||||
<arg name="disable" type="b"/>
|
||||
</signal>
|
||||
<method name="SetEgpuEnable">
|
||||
<arg name="enable" type="b" direction="in"/>
|
||||
</method>
|
||||
<method name="EgpuEnable">
|
||||
<arg type="b" direction="out"/>
|
||||
</method>
|
||||
<signal name="NotifyEgpuEnable">
|
||||
<arg name="enable" type="b"/>
|
||||
</signal>
|
||||
</interface>
|
||||
</node>
|
||||
@@ -1,20 +0,0 @@
|
||||
<!DOCTYPE node PUBLIC "-//freedesktop//DTD D-BUS Object Introspection 1.0//EN" "http://www.freedesktop.org/standards/dbus/1.0/introspect.dtd">
|
||||
<node>
|
||||
<interface name="org.asuslinux.Daemon">
|
||||
<method name="SetChargeControlEndThreshold">
|
||||
<arg name="limit" type="y" direction="in"/>
|
||||
</method>
|
||||
<method name="ChargeControlEndThreshold">
|
||||
<arg type="y" direction="out"/>
|
||||
</method>
|
||||
<method name="MainsOnline">
|
||||
<arg type="b" direction="out"/>
|
||||
</method>
|
||||
<signal name="NotifyChargeControlEndThreshold">
|
||||
<arg name="limit" type="y"/>
|
||||
</signal>
|
||||
<signal name="NotifyMainsOnline">
|
||||
<arg name="on" type="b"/>
|
||||
</signal>
|
||||
</interface>
|
||||
</node>
|
||||
@@ -1,80 +0,0 @@
|
||||
<!DOCTYPE node PUBLIC "-//freedesktop//DTD D-BUS Object Introspection 1.0//EN" "http://www.freedesktop.org/standards/dbus/1.0/introspect.dtd">
|
||||
<node>
|
||||
<interface name="org.asuslinux.Daemon">
|
||||
<!--
|
||||
Fetch profile names
|
||||
-->
|
||||
<method name="Profiles">
|
||||
<arg type="as" direction="out"/>
|
||||
</method>
|
||||
<!--
|
||||
Toggle to next platform_profile. Names provided by `Profiles`.
|
||||
If fan-curves are supported will also activate a fan curve for profile.
|
||||
-->
|
||||
<method name="NextProfile">
|
||||
</method>
|
||||
<!--
|
||||
Fetch the active profile name
|
||||
-->
|
||||
<method name="ActiveProfile">
|
||||
<arg type="s" direction="out"/>
|
||||
</method>
|
||||
<!--
|
||||
Set this platform_profile name as active
|
||||
-->
|
||||
<method name="SetActiveProfile">
|
||||
<arg name="profile" type="s" direction="in"/>
|
||||
</method>
|
||||
<!--
|
||||
Get a list of profiles that have fan-curves enabled.
|
||||
-->
|
||||
<method name="EnabledFanProfiles">
|
||||
<arg type="as" direction="out"/>
|
||||
</method>
|
||||
<!--
|
||||
Set a profile fan curve enabled status. Will also activate a fan curve
|
||||
if in the same profile mode
|
||||
-->
|
||||
<method name="SetFanCurveEnabled">
|
||||
<arg name="profile" type="s" direction="in"/>
|
||||
<arg name="enabled" type="b" direction="in"/>
|
||||
</method>
|
||||
<!--
|
||||
Get the fan-curve data for the currently active Profile
|
||||
-->
|
||||
<method name="FanCurveData">
|
||||
<arg name="profile" type="s" direction="in"/>
|
||||
<arg type="(b(s(yyyyyyyy)(yyyyyyyy))(s(yyyyyyyy)(yyyyyyyy)))" direction="out"/>
|
||||
</method>
|
||||
<!--
|
||||
Set the fan curve for the specified profile.
|
||||
Will also activate the fan curve if the user is in the same mode.
|
||||
-->
|
||||
<method name="SetFanCurve">
|
||||
<arg name="profile" type="s" direction="in"/>
|
||||
<arg name="curve" type="(s(yyyyyyyy)(yyyyyyyy))" direction="in"/>
|
||||
</method>
|
||||
<!--
|
||||
Reset the stored (self) and device curve to the defaults of the
|
||||
platform.
|
||||
|
||||
Each platform_profile has a different default and the defualt can be
|
||||
read only for the currently active profile.
|
||||
-->
|
||||
<method name="SetActiveCurveToDefaults">
|
||||
</method>
|
||||
<!--
|
||||
Reset the stored (self) and device curve to the defaults of the
|
||||
platform.
|
||||
|
||||
Each platform_profile has a different default and the defualt can be
|
||||
read only for the currently active profile.
|
||||
-->
|
||||
<method name="ResetProfileCurves">
|
||||
<arg name="profile" type="s" direction="in"/>
|
||||
</method>
|
||||
<signal name="NotifyProfile">
|
||||
<arg name="profile" type="s"/>
|
||||
</signal>
|
||||
</interface>
|
||||
</node>
|
||||
@@ -1,12 +0,0 @@
|
||||
<!DOCTYPE node PUBLIC "-//freedesktop//DTD D-BUS Object Introspection 1.0//EN" "http://www.freedesktop.org/standards/dbus/1.0/introspect.dtd">
|
||||
<node>
|
||||
<interface name="org.asuslinux.Daemon">
|
||||
<method name="SupportedFunctions">
|
||||
<arg type="b(b)(bb)(sbasassas)(bbbbbb)" direction="out"/>
|
||||
</method>
|
||||
<method name="MeaningOfLife">
|
||||
<arg name="answer" type="i" direction="out"/>
|
||||
<arg name="question" type="s" direction="out"/>
|
||||
</method>
|
||||
</interface>
|
||||
</node>
|
||||
@@ -1,53 +0,0 @@
|
||||
/*
|
||||
Generated by typeshare 1.6.0
|
||||
*/
|
||||
|
||||
export enum AnimBooting {
|
||||
GlitchConstruction = "GlitchConstruction",
|
||||
StaticEmergence = "StaticEmergence",
|
||||
}
|
||||
|
||||
export enum AnimAwake {
|
||||
BinaryBannerScroll = "BinaryBannerScroll",
|
||||
RogLogoGlitch = "RogLogoGlitch",
|
||||
}
|
||||
|
||||
export enum AnimSleeping {
|
||||
BannerSwipe = "BannerSwipe",
|
||||
Starfield = "Starfield",
|
||||
}
|
||||
|
||||
export enum AnimShutdown {
|
||||
GlitchOut = "GlitchOut",
|
||||
SeeYa = "SeeYa",
|
||||
}
|
||||
|
||||
export interface Animations {
|
||||
boot: AnimBooting;
|
||||
awake: AnimAwake;
|
||||
sleep: AnimSleeping;
|
||||
shutdown: AnimShutdown;
|
||||
}
|
||||
|
||||
/** Base LED brightness of the display */
|
||||
export enum Brightness {
|
||||
Off = "Off",
|
||||
Low = "Low",
|
||||
Med = "Med",
|
||||
High = "High",
|
||||
}
|
||||
|
||||
export interface DeviceState {
|
||||
display_enabled: boolean;
|
||||
display_brightness: Brightness;
|
||||
builtin_anims_enabled: boolean;
|
||||
builtin_anims: Animations;
|
||||
}
|
||||
|
||||
export enum AnimeType {
|
||||
GA401 = "GA401",
|
||||
GA402 = "GA402",
|
||||
GU604 = "GU604",
|
||||
Unknown = "Unknown",
|
||||
}
|
||||
|
||||
@@ -1,232 +0,0 @@
|
||||
/*
|
||||
Generated by typeshare 1.6.0
|
||||
*/
|
||||
|
||||
/** Represents the per-key raw USB packets */
|
||||
export type UsbPackets = number[][];
|
||||
|
||||
/**
|
||||
* A `UsbPackets` contains all data to change the full set of keyboard
|
||||
* key colours individually.
|
||||
*
|
||||
* Each row of the internal array is a full HID packet that can be sent
|
||||
* to the keyboard EC. One row controls one group of keys, these keys are not
|
||||
* necessarily all on the same row of the keyboard, with some splitting between
|
||||
* two rows.
|
||||
*/
|
||||
export interface LedUsbPackets {
|
||||
/** The packet data used to send data to the USB keyboard */
|
||||
usb_packets: UsbPackets;
|
||||
/**
|
||||
* Wether or not this packet collection is zoned. The determines which
|
||||
* starting bytes are used and what the indexing is for lightbar RGB
|
||||
* colours
|
||||
*/
|
||||
zoned: boolean;
|
||||
}
|
||||
|
||||
export interface Colour {
|
||||
r: number;
|
||||
g: number;
|
||||
b: number;
|
||||
}
|
||||
|
||||
/** Enum of modes that convert to the actual number required by a USB HID packet */
|
||||
export enum AuraModeNum {
|
||||
Static = "Static",
|
||||
Breathe = "Breathe",
|
||||
Strobe = "Strobe",
|
||||
Rainbow = "Rainbow",
|
||||
Star = "Star",
|
||||
Rain = "Rain",
|
||||
Highlight = "Highlight",
|
||||
Laser = "Laser",
|
||||
Ripple = "Ripple",
|
||||
Pulse = "Pulse",
|
||||
Comet = "Comet",
|
||||
Flash = "Flash",
|
||||
}
|
||||
|
||||
/** Base effects have no zoning, while multizone is 1-4 */
|
||||
export enum AuraZone {
|
||||
/** Used if keyboard has no zones, or if setting all */
|
||||
None = "None",
|
||||
/** Leftmost zone */
|
||||
Key1 = "Key1",
|
||||
/** Zone after leftmost */
|
||||
Key2 = "Key2",
|
||||
/** Zone second from right */
|
||||
Key3 = "Key3",
|
||||
/** Rightmost zone */
|
||||
Key4 = "Key4",
|
||||
/** Logo on the lid (or elsewhere?) */
|
||||
Logo = "Logo",
|
||||
/** The left part of a lightbar (typically on the front of laptop) */
|
||||
BarLeft = "BarLeft",
|
||||
/** The right part of a lightbar */
|
||||
BarRight = "BarRight",
|
||||
}
|
||||
|
||||
export enum Speed {
|
||||
Low = "Low",
|
||||
Med = "Med",
|
||||
High = "High",
|
||||
}
|
||||
|
||||
/**
|
||||
* Used for Rainbow mode.
|
||||
*
|
||||
* Enum corresponds to the required integer value
|
||||
*/
|
||||
export enum Direction {
|
||||
Right = "Right",
|
||||
Left = "Left",
|
||||
Up = "Up",
|
||||
Down = "Down",
|
||||
}
|
||||
|
||||
/**
|
||||
* Default factory modes structure. This easily converts to an USB HID packet
|
||||
* with:
|
||||
* ```rust
|
||||
* // let bytes: [u8; LED_MSG_LEN] = mode.into();
|
||||
* ```
|
||||
*/
|
||||
export interface AuraEffect {
|
||||
/** The effect type */
|
||||
mode: AuraModeNum;
|
||||
/** `AuraZone::None` for no zone or zoneless keyboards */
|
||||
zone: AuraZone;
|
||||
/** Primary colour for all modes */
|
||||
colour1: Colour;
|
||||
/** Secondary colour in some modes like Breathing or Stars */
|
||||
colour2: Colour;
|
||||
/** One of three speeds for modes that support speed (most that animate) */
|
||||
speed: Speed;
|
||||
/** Up, down, left, right. Only Rainbow mode seems to use this */
|
||||
direction: Direction;
|
||||
}
|
||||
|
||||
/** The powerr zones this laptop supports */
|
||||
export enum PowerZones {
|
||||
/** The logo on some laptop lids */
|
||||
Logo = "Logo",
|
||||
/** The full keyboard (not zones) */
|
||||
Keyboard = "Keyboard",
|
||||
/** The lightbar, typically on the front of the laptop */
|
||||
Lightbar = "Lightbar",
|
||||
/** The leds that may be placed around the edge of the laptop lid */
|
||||
Lid = "Lid",
|
||||
/** The led strip on the rear of some laptops */
|
||||
RearGlow = "RearGlow",
|
||||
}
|
||||
|
||||
export interface KbAuraPowerState {
|
||||
zone: PowerZones;
|
||||
boot: boolean;
|
||||
awake: boolean;
|
||||
sleep: boolean;
|
||||
shutdown: boolean;
|
||||
}
|
||||
|
||||
/**
|
||||
* Track and control the Aura keyboard power state
|
||||
*
|
||||
* # Bits for newer 0x18c6, 0x19B6, 0x1a30, keyboard models
|
||||
*
|
||||
* | Byte 1 | Byte 2 | Byte 3 | Byte 4 | Label |
|
||||
* |--------|---------|---------|---------|----------|
|
||||
* |00000001| 00000000| 00000000| 00000000|boot_logo_|
|
||||
* |00000010| 00000000| 00000000| 00000000|boot_keyb_|
|
||||
* |00000100| 00000000| 00000000| 00000000|awake_logo|
|
||||
* |00001000| 00000000| 00000000| 00000000|awake_keyb|
|
||||
* |00010000| 00000000| 00000000| 00000000|sleep_logo|
|
||||
* |00100000| 00000000| 00000000| 00000000|sleep_keyb|
|
||||
* |01000000| 00000000| 00000000| 00000000|shut_logo_|
|
||||
* |10000000| 00000000| 00000000| 00000000|shut_keyb_|
|
||||
* |00000000| 00000010| 00000000| 00000000|boot_bar__|
|
||||
* |00000000| 00000100| 00000000| 00000000|awake_bar_|
|
||||
* |00000000| 00001000| 00000000| 00000000|sleep_bar_|
|
||||
* |00000000| 00010000| 00000000| 00000000|shut_bar__|
|
||||
* |00000000| 00000000| 00000001| 00000000|boot_lid__|
|
||||
* |00000000| 00000000| 00000010| 00000000|awkae_lid_|
|
||||
* |00000000| 00000000| 00000100| 00000000|sleep_lid_|
|
||||
* |00000000| 00000000| 00001000| 00000000|shut_lid__|
|
||||
* |00000000| 00000000| 00000000| 00000001|boot_rear_|
|
||||
* |00000000| 00000000| 00000000| 00000010|awake_rear|
|
||||
* |00000000| 00000000| 00000000| 00000100|sleep_rear|
|
||||
* |00000000| 00000000| 00000000| 00001000|shut_rear_|
|
||||
*/
|
||||
export interface AuraPower {
|
||||
keyboard: KbAuraPowerState;
|
||||
logo: KbAuraPowerState;
|
||||
lightbar: KbAuraPowerState;
|
||||
lid: KbAuraPowerState;
|
||||
rear_glow: KbAuraPowerState;
|
||||
}
|
||||
|
||||
export enum AuraDevTuf {
|
||||
Boot = "Boot",
|
||||
Awake = "Awake",
|
||||
Sleep = "Sleep",
|
||||
Keyboard = "Keyboard",
|
||||
}
|
||||
|
||||
/**
|
||||
* # Bits for older 0x1866 keyboard model
|
||||
*
|
||||
* Keybord and Lightbar require Awake, Boot and Sleep apply to both
|
||||
* Keybord and Lightbar regardless of if either are enabled (or Awake is
|
||||
* enabled)
|
||||
*
|
||||
* | Byte 1 | Byte 2 | Byte 3 | function | hex |
|
||||
* |------------|------------|------------|----------|----------|
|
||||
* | 0000, 0000 | 0000, 0000 | 0000, 0010 | Awake | 00,00,02 |
|
||||
* | 0000, 1000 | 0000, 0000 | 0000, 0000 | Keyboard | 08,00,00 |
|
||||
* | 0000, 0100 | 0000, 0101 | 0000, 0000 | Lightbar | 04,05,00 |
|
||||
* | 1100, 0011 | 0001, 0010 | 0000, 1001 | Boot/Sht | c3,12,09 |
|
||||
* | 0011, 0000 | 0000, 1000 | 0000, 0100 | Sleep | 30,08,04 |
|
||||
* | 1111, 1111 | 0001, 1111 | 0000, 1111 | all on | |
|
||||
*/
|
||||
export enum AuraDevRog1 {
|
||||
Awake = "Awake",
|
||||
Keyboard = "Keyboard",
|
||||
Lightbar = "Lightbar",
|
||||
Boot = "Boot",
|
||||
Sleep = "Sleep",
|
||||
}
|
||||
|
||||
/** This struct is intended as a helper to pass args to generic dbus interface */
|
||||
export interface AuraPowerDev {
|
||||
/**
|
||||
* TUF laptops use a similar style of control to the older ROG devices but
|
||||
* through WMI
|
||||
*/
|
||||
tuf: AuraDevTuf[];
|
||||
/**
|
||||
* Pre-0x19b6 devices use a different smaller scheme to the newer ROG
|
||||
* devices
|
||||
*/
|
||||
old_rog: AuraDevRog1[];
|
||||
/** ASUS standardised control scheme from 2020 onwards */
|
||||
rog: AuraPower;
|
||||
}
|
||||
|
||||
export enum LedBrightness {
|
||||
Off = "Off",
|
||||
Low = "Low",
|
||||
Med = "Med",
|
||||
High = "High",
|
||||
}
|
||||
|
||||
export enum AuraDevice {
|
||||
Tuf = "Tuf",
|
||||
X1854 = "X1854",
|
||||
X1869 = "X1869",
|
||||
X1866 = "X1866",
|
||||
X18c6 = "X18c6",
|
||||
X19b6 = "X19b6",
|
||||
X1a30 = "X1a30",
|
||||
Unknown = "Unknown",
|
||||
}
|
||||
|
||||
@@ -1,58 +0,0 @@
|
||||
/*
|
||||
Generated by typeshare 1.6.0
|
||||
*/
|
||||
|
||||
export type AnimeSupportedFunctions = boolean;
|
||||
|
||||
export interface ChargeSupportedFunctions {
|
||||
charge_level_set: boolean;
|
||||
}
|
||||
|
||||
export interface PlatformProfileFunctions {
|
||||
platform_profile: boolean;
|
||||
fan_curves: boolean;
|
||||
}
|
||||
|
||||
export enum AdvancedAura {
|
||||
None = "None",
|
||||
Zoned = "Zoned",
|
||||
PerKey = "PerKey",
|
||||
}
|
||||
|
||||
export interface LedSupportedFunctions {
|
||||
dev_id: AuraDevice;
|
||||
brightness: boolean;
|
||||
basic_modes: AuraModeNum[];
|
||||
basic_zones: AuraZone[];
|
||||
advanced_type: AdvancedAura;
|
||||
power_zones: PowerZones[];
|
||||
}
|
||||
|
||||
export interface RogBiosSupportedFunctions {
|
||||
post_sound: boolean;
|
||||
gpu_mux: boolean;
|
||||
panel_overdrive: boolean;
|
||||
dgpu_disable: boolean;
|
||||
egpu_enable: boolean;
|
||||
mini_led_mode: boolean;
|
||||
}
|
||||
|
||||
export interface SupportedFunctions {
|
||||
anime_ctrl: AnimeSupportedFunctions;
|
||||
charge_ctrl: ChargeSupportedFunctions;
|
||||
platform_profile: PlatformProfileFunctions;
|
||||
keyboard_led: LedSupportedFunctions;
|
||||
rog_bios_ctrl: RogBiosSupportedFunctions;
|
||||
}
|
||||
|
||||
export enum GpuMode {
|
||||
Discrete = "Discrete",
|
||||
Optimus = "Optimus",
|
||||
Integrated = "Integrated",
|
||||
Egpu = "Egpu",
|
||||
Vfio = "Vfio",
|
||||
Ultimate = "Ultimate",
|
||||
Error = "Error",
|
||||
NotSupported = "NotSupported",
|
||||
}
|
||||
|
||||
@@ -1,35 +0,0 @@
|
||||
/*
|
||||
Generated by typeshare 1.6.0
|
||||
*/
|
||||
|
||||
export enum FanCurvePU {
|
||||
CPU = "CPU",
|
||||
GPU = "GPU",
|
||||
}
|
||||
|
||||
export interface CurveData {
|
||||
fan: FanCurvePU;
|
||||
pwm: [number, number, number, number, number, number, number, number];
|
||||
temp: [number, number, number, number, number, number, number, number];
|
||||
}
|
||||
|
||||
/** A `FanCurveSet` contains both CPU and GPU fan curve data */
|
||||
export interface FanCurveSet {
|
||||
enabled: boolean;
|
||||
cpu: CurveData;
|
||||
gpu: CurveData;
|
||||
}
|
||||
|
||||
/** Main purpose of `FanCurves` is to enable restoring state on system boot */
|
||||
export interface FanCurveProfiles {
|
||||
balanced: FanCurveSet;
|
||||
performance: FanCurveSet;
|
||||
quiet: FanCurveSet;
|
||||
}
|
||||
|
||||
export enum Profile {
|
||||
Balanced = "Balanced",
|
||||
Performance = "Performance",
|
||||
Quiet = "Quiet",
|
||||
}
|
||||
|
||||
@@ -1,18 +1,18 @@
|
||||
[package]
|
||||
name = "config-traits"
|
||||
license = "MPL-2.0"
|
||||
authors = ["Luke D Jones <luke@ljones.dev>"]
|
||||
edition = "2021"
|
||||
license.workspace = true
|
||||
version.workspace = true
|
||||
readme.workspace = true
|
||||
authors.workspace = true
|
||||
repository.workspace = true
|
||||
homepage.workspace = true
|
||||
edition.workspace = true
|
||||
|
||||
[dependencies]
|
||||
serde.workspace = true
|
||||
serde_derive.workspace = true
|
||||
serde_json.workspace = true
|
||||
toml.workspace = true
|
||||
ron.workspace = true
|
||||
|
||||
log.workspace = true
|
||||
|
||||
[dev-dependencies]
|
||||
cargo-husky.workspace = true
|
||||
cargo-husky.workspace = true
|
||||
|
||||
@@ -3,10 +3,7 @@
|
||||
//! updating them from previous versions where fields or names are changed in
|
||||
//! some way.
|
||||
//!
|
||||
//! The end canonical file format is `.ron` as this supports rust types well,
|
||||
//! and includes the ability to add commenting, and is less verbose than `json`.
|
||||
//! Currently the crate will also try to parse from `json` and `toml` if the
|
||||
//! `ron` parsing fails, then update to `ron` format.
|
||||
//! The end canonical file format is `.ron` as this supports rust types well
|
||||
|
||||
use std::fs::{self, create_dir, File, OpenOptions};
|
||||
use std::io::{Read, Write};
|
||||
@@ -92,6 +89,7 @@ where
|
||||
.read(true)
|
||||
.write(true)
|
||||
.create(true)
|
||||
.truncate(false)
|
||||
.open(self.file_path())
|
||||
.unwrap_or_else(|e| panic!("Could not open {:?} {e}", self.file_path()))
|
||||
}
|
||||
@@ -109,6 +107,20 @@ where
|
||||
}
|
||||
}
|
||||
|
||||
/// Open and parse the config file to self from ron format
|
||||
fn read_new(&self) -> Option<Self> {
|
||||
if let Ok(data) = fs::read_to_string(self.file_path()) {
|
||||
if data.is_empty() {
|
||||
warn!("File is empty {:?}", self.file_path());
|
||||
} else if let Ok(data) = ron::from_str(&data) {
|
||||
return Some(data);
|
||||
} else {
|
||||
warn!("Could not deserialise {:?}", self.file_path());
|
||||
}
|
||||
}
|
||||
None
|
||||
}
|
||||
|
||||
/// Write the config file data to pretty ron format
|
||||
fn write(&self) {
|
||||
let mut file = match File::create(self.file_path()) {
|
||||
@@ -206,21 +218,9 @@ macro_rules! std_config_load {
|
||||
if let Ok(data) = ron::from_str(&buf) {
|
||||
self = data;
|
||||
log::info!("Parsed RON for {:?}", std::any::type_name::<Self>());
|
||||
} else if let Ok(data) = serde_json::from_str(&buf) {
|
||||
self = data;
|
||||
log::info!("Parsed JSON for {:?}", std::any::type_name::<Self>());
|
||||
} else if let Ok(data) = toml::from_str(&buf) {
|
||||
self = data;
|
||||
log::info!("Parsed TOML for {:?}", std::any::type_name::<Self>());
|
||||
} $(else if let Ok(data) = ron::from_str::<$generic>(&buf) {
|
||||
} $(else if let Ok(data) = ron::from_str::<$generic>(&buf) {
|
||||
self = data.into();
|
||||
log::info!("New version failed, trying previous: Parsed RON for {:?}", std::any::type_name::<$generic>());
|
||||
} else if let Ok(data) = serde_json::from_str::<$generic>(&buf) {
|
||||
self = data.into();
|
||||
log::info!("New version failed, trying previous: Parsed JSON for {:?}", std::any::type_name::<$generic>());
|
||||
} else if let Ok(data) = toml::from_str::<$generic>(&buf) {
|
||||
self = data.into();
|
||||
log::info!("Newvious version failed, trying previous: Parsed TOML for {:?}", std::any::type_name::<$generic>());
|
||||
})* else {
|
||||
self.rename_file_old();
|
||||
self = Self::new();
|
||||
|
||||
11
cpuctl/Cargo.toml
Normal file
11
cpuctl/Cargo.toml
Normal file
@@ -0,0 +1,11 @@
|
||||
[package]
|
||||
name = "cpuctl"
|
||||
license.workspace = true
|
||||
version.workspace = true
|
||||
readme.workspace = true
|
||||
authors.workspace = true
|
||||
repository.workspace = true
|
||||
homepage.workspace = true
|
||||
edition.workspace = true
|
||||
|
||||
[dependencies]
|
||||
14
cpuctl/src/lib.rs
Normal file
14
cpuctl/src/lib.rs
Normal file
@@ -0,0 +1,14 @@
|
||||
pub fn add(left: usize, right: usize) -> usize {
|
||||
left + right
|
||||
}
|
||||
|
||||
#[cfg(test)]
|
||||
mod tests {
|
||||
use super::*;
|
||||
|
||||
#[test]
|
||||
fn it_works() {
|
||||
let result = add(2, 2);
|
||||
assert_eq!(result, 4);
|
||||
}
|
||||
}
|
||||
@@ -1,6 +1,3 @@
|
||||
#ACTION=="add|change", SUBSYSTEM=="input", ENV{ID_VENDOR_ID}=="0b05", ENV{ID_MODEL_ID}=="1[89][a-zA-Z0-9][a-zA-Z0-9]|193b", ENV{ID_TYPE}=="hid", TAG+="systemd", ENV{SYSTEMD_WANTS}="asusd.service"
|
||||
#ACTION=="add|remove", SUBSYSTEM=="input", ENV{ID_VENDOR_ID}=="0b05", ENV{ID_MODEL_ID}=="1[89][a-zA-Z0-9][a-zA-Z0-9]|193b", RUN+="systemctl restart asusd.service"
|
||||
|
||||
ENV{DMI_VENDOR}="$attr{[dmi/id]sys_vendor}"
|
||||
ENV{DMI_VENDOR}!="ASUSTeK COMPUTER INC.", GOTO="asusd_end"
|
||||
|
||||
|
||||
@@ -1,19 +1,18 @@
|
||||
[Unit]
|
||||
Description=ASUS Notebook Control
|
||||
StartLimitInterval=200
|
||||
StartLimitBurst=2
|
||||
Before=multi-user.target
|
||||
After=power-profiles-daemon.service
|
||||
After=nvidia-powerd.service
|
||||
StartLimitInterval=500
|
||||
StartLimitBurst=5
|
||||
After=nvidia-powerd.service systemd-udevd.service
|
||||
|
||||
[Service]
|
||||
Environment=IS_SERVICE=1
|
||||
Environment=RUST_LOG="info"
|
||||
ExecStartPre=/bin/sleep 2
|
||||
# required to prevent init issues with hid_asus and MCU
|
||||
ExecStartPre=/bin/sleep 1
|
||||
ExecStart=/usr/bin/asusd
|
||||
Restart=on-failure
|
||||
RestartSec=1
|
||||
Type=dbus
|
||||
BusName=org.asuslinux.Daemon
|
||||
SELinuxContext=system_u:system_r:unconfined_t:s0
|
||||
#SELinuxContext=system_u:object_r:modules_object_t:s0
|
||||
#SELinuxContext=system_u:object_r:modules_object_t:s0
|
||||
|
||||
@@ -1,25 +0,0 @@
|
||||
/* eslint-env node */
|
||||
module.exports = {
|
||||
extends: ["eslint:recommended", "plugin:@typescript-eslint/recommended"],
|
||||
parser: "@typescript-eslint/parser",
|
||||
plugins: ["@typescript-eslint"],
|
||||
root: true,
|
||||
|
||||
"rules": {
|
||||
// enable additional rules
|
||||
"indent": ["error", 4],
|
||||
"linebreak-style": ["error", "unix"],
|
||||
"quotes": ["error", "double"],
|
||||
"semi": ["error", "always"],
|
||||
|
||||
// override configuration set by extending "eslint:recommended"
|
||||
"no-empty": "warn",
|
||||
"no-cond-assign": ["error", "always"],
|
||||
|
||||
// disable rules from base configurations
|
||||
"for-direction": "off",
|
||||
|
||||
"@typescript-eslint/no-explicit-any": "warn",
|
||||
"@typescript-eslint/ban-ts-comment": "off"
|
||||
}
|
||||
};
|
||||
@@ -1,373 +0,0 @@
|
||||
Mozilla Public License Version 2.0
|
||||
==================================
|
||||
|
||||
1. Definitions
|
||||
--------------
|
||||
|
||||
1.1. "Contributor"
|
||||
means each individual or legal entity that creates, contributes to
|
||||
the creation of, or owns Covered Software.
|
||||
|
||||
1.2. "Contributor Version"
|
||||
means the combination of the Contributions of others (if any) used
|
||||
by a Contributor and that particular Contributor's Contribution.
|
||||
|
||||
1.3. "Contribution"
|
||||
means Covered Software of a particular Contributor.
|
||||
|
||||
1.4. "Covered Software"
|
||||
means Source Code Form to which the initial Contributor has attached
|
||||
the notice in Exhibit A, the Executable Form of such Source Code
|
||||
Form, and Modifications of such Source Code Form, in each case
|
||||
including portions thereof.
|
||||
|
||||
1.5. "Incompatible With Secondary Licenses"
|
||||
means
|
||||
|
||||
(a) that the initial Contributor has attached the notice described
|
||||
in Exhibit B to the Covered Software; or
|
||||
|
||||
(b) that the Covered Software was made available under the terms of
|
||||
version 1.1 or earlier of the License, but not also under the
|
||||
terms of a Secondary License.
|
||||
|
||||
1.6. "Executable Form"
|
||||
means any form of the work other than Source Code Form.
|
||||
|
||||
1.7. "Larger Work"
|
||||
means a work that combines Covered Software with other material, in
|
||||
a separate file or files, that is not Covered Software.
|
||||
|
||||
1.8. "License"
|
||||
means this document.
|
||||
|
||||
1.9. "Licensable"
|
||||
means having the right to grant, to the maximum extent possible,
|
||||
whether at the time of the initial grant or subsequently, any and
|
||||
all of the rights conveyed by this License.
|
||||
|
||||
1.10. "Modifications"
|
||||
means any of the following:
|
||||
|
||||
(a) any file in Source Code Form that results from an addition to,
|
||||
deletion from, or modification of the contents of Covered
|
||||
Software; or
|
||||
|
||||
(b) any new file in Source Code Form that contains any Covered
|
||||
Software.
|
||||
|
||||
1.11. "Patent Claims" of a Contributor
|
||||
means any patent claim(s), including without limitation, method,
|
||||
process, and apparatus claims, in any patent Licensable by such
|
||||
Contributor that would be infringed, but for the grant of the
|
||||
License, by the making, using, selling, offering for sale, having
|
||||
made, import, or transfer of either its Contributions or its
|
||||
Contributor Version.
|
||||
|
||||
1.12. "Secondary License"
|
||||
means either the GNU General Public License, Version 2.0, the GNU
|
||||
Lesser General Public License, Version 2.1, the GNU Affero General
|
||||
Public License, Version 3.0, or any later versions of those
|
||||
licenses.
|
||||
|
||||
1.13. "Source Code Form"
|
||||
means the form of the work preferred for making modifications.
|
||||
|
||||
1.14. "You" (or "Your")
|
||||
means an individual or a legal entity exercising rights under this
|
||||
License. For legal entities, "You" includes any entity that
|
||||
controls, is controlled by, or is under common control with You. For
|
||||
purposes of this definition, "control" means (a) the power, direct
|
||||
or indirect, to cause the direction or management of such entity,
|
||||
whether by contract or otherwise, or (b) ownership of more than
|
||||
fifty percent (50%) of the outstanding shares or beneficial
|
||||
ownership of such entity.
|
||||
|
||||
2. License Grants and Conditions
|
||||
--------------------------------
|
||||
|
||||
2.1. Grants
|
||||
|
||||
Each Contributor hereby grants You a world-wide, royalty-free,
|
||||
non-exclusive license:
|
||||
|
||||
(a) under intellectual property rights (other than patent or trademark)
|
||||
Licensable by such Contributor to use, reproduce, make available,
|
||||
modify, display, perform, distribute, and otherwise exploit its
|
||||
Contributions, either on an unmodified basis, with Modifications, or
|
||||
as part of a Larger Work; and
|
||||
|
||||
(b) under Patent Claims of such Contributor to make, use, sell, offer
|
||||
for sale, have made, import, and otherwise transfer either its
|
||||
Contributions or its Contributor Version.
|
||||
|
||||
2.2. Effective Date
|
||||
|
||||
The licenses granted in Section 2.1 with respect to any Contribution
|
||||
become effective for each Contribution on the date the Contributor first
|
||||
distributes such Contribution.
|
||||
|
||||
2.3. Limitations on Grant Scope
|
||||
|
||||
The licenses granted in this Section 2 are the only rights granted under
|
||||
this License. No additional rights or licenses will be implied from the
|
||||
distribution or licensing of Covered Software under this License.
|
||||
Notwithstanding Section 2.1(b) above, no patent license is granted by a
|
||||
Contributor:
|
||||
|
||||
(a) for any code that a Contributor has removed from Covered Software;
|
||||
or
|
||||
|
||||
(b) for infringements caused by: (i) Your and any other third party's
|
||||
modifications of Covered Software, or (ii) the combination of its
|
||||
Contributions with other software (except as part of its Contributor
|
||||
Version); or
|
||||
|
||||
(c) under Patent Claims infringed by Covered Software in the absence of
|
||||
its Contributions.
|
||||
|
||||
This License does not grant any rights in the trademarks, service marks,
|
||||
or logos of any Contributor (except as may be necessary to comply with
|
||||
the notice requirements in Section 3.4).
|
||||
|
||||
2.4. Subsequent Licenses
|
||||
|
||||
No Contributor makes additional grants as a result of Your choice to
|
||||
distribute the Covered Software under a subsequent version of this
|
||||
License (see Section 10.2) or under the terms of a Secondary License (if
|
||||
permitted under the terms of Section 3.3).
|
||||
|
||||
2.5. Representation
|
||||
|
||||
Each Contributor represents that the Contributor believes its
|
||||
Contributions are its original creation(s) or it has sufficient rights
|
||||
to grant the rights to its Contributions conveyed by this License.
|
||||
|
||||
2.6. Fair Use
|
||||
|
||||
This License is not intended to limit any rights You have under
|
||||
applicable copyright doctrines of fair use, fair dealing, or other
|
||||
equivalents.
|
||||
|
||||
2.7. Conditions
|
||||
|
||||
Sections 3.1, 3.2, 3.3, and 3.4 are conditions of the licenses granted
|
||||
in Section 2.1.
|
||||
|
||||
3. Responsibilities
|
||||
-------------------
|
||||
|
||||
3.1. Distribution of Source Form
|
||||
|
||||
All distribution of Covered Software in Source Code Form, including any
|
||||
Modifications that You create or to which You contribute, must be under
|
||||
the terms of this License. You must inform recipients that the Source
|
||||
Code Form of the Covered Software is governed by the terms of this
|
||||
License, and how they can obtain a copy of this License. You may not
|
||||
attempt to alter or restrict the recipients' rights in the Source Code
|
||||
Form.
|
||||
|
||||
3.2. Distribution of Executable Form
|
||||
|
||||
If You distribute Covered Software in Executable Form then:
|
||||
|
||||
(a) such Covered Software must also be made available in Source Code
|
||||
Form, as described in Section 3.1, and You must inform recipients of
|
||||
the Executable Form how they can obtain a copy of such Source Code
|
||||
Form by reasonable means in a timely manner, at a charge no more
|
||||
than the cost of distribution to the recipient; and
|
||||
|
||||
(b) You may distribute such Executable Form under the terms of this
|
||||
License, or sublicense it under different terms, provided that the
|
||||
license for the Executable Form does not attempt to limit or alter
|
||||
the recipients' rights in the Source Code Form under this License.
|
||||
|
||||
3.3. Distribution of a Larger Work
|
||||
|
||||
You may create and distribute a Larger Work under terms of Your choice,
|
||||
provided that You also comply with the requirements of this License for
|
||||
the Covered Software. If the Larger Work is a combination of Covered
|
||||
Software with a work governed by one or more Secondary Licenses, and the
|
||||
Covered Software is not Incompatible With Secondary Licenses, this
|
||||
License permits You to additionally distribute such Covered Software
|
||||
under the terms of such Secondary License(s), so that the recipient of
|
||||
the Larger Work may, at their option, further distribute the Covered
|
||||
Software under the terms of either this License or such Secondary
|
||||
License(s).
|
||||
|
||||
3.4. Notices
|
||||
|
||||
You may not remove or alter the substance of any license notices
|
||||
(including copyright notices, patent notices, disclaimers of warranty,
|
||||
or limitations of liability) contained within the Source Code Form of
|
||||
the Covered Software, except that You may alter any license notices to
|
||||
the extent required to remedy known factual inaccuracies.
|
||||
|
||||
3.5. Application of Additional Terms
|
||||
|
||||
You may choose to offer, and to charge a fee for, warranty, support,
|
||||
indemnity or liability obligations to one or more recipients of Covered
|
||||
Software. However, You may do so only on Your own behalf, and not on
|
||||
behalf of any Contributor. You must make it absolutely clear that any
|
||||
such warranty, support, indemnity, or liability obligation is offered by
|
||||
You alone, and You hereby agree to indemnify every Contributor for any
|
||||
liability incurred by such Contributor as a result of warranty, support,
|
||||
indemnity or liability terms You offer. You may include additional
|
||||
disclaimers of warranty and limitations of liability specific to any
|
||||
jurisdiction.
|
||||
|
||||
4. Inability to Comply Due to Statute or Regulation
|
||||
---------------------------------------------------
|
||||
|
||||
If it is impossible for You to comply with any of the terms of this
|
||||
License with respect to some or all of the Covered Software due to
|
||||
statute, judicial order, or regulation then You must: (a) comply with
|
||||
the terms of this License to the maximum extent possible; and (b)
|
||||
describe the limitations and the code they affect. Such description must
|
||||
be placed in a text file included with all distributions of the Covered
|
||||
Software under this License. Except to the extent prohibited by statute
|
||||
or regulation, such description must be sufficiently detailed for a
|
||||
recipient of ordinary skill to be able to understand it.
|
||||
|
||||
5. Termination
|
||||
--------------
|
||||
|
||||
5.1. The rights granted under this License will terminate automatically
|
||||
if You fail to comply with any of its terms. However, if You become
|
||||
compliant, then the rights granted under this License from a particular
|
||||
Contributor are reinstated (a) provisionally, unless and until such
|
||||
Contributor explicitly and finally terminates Your grants, and (b) on an
|
||||
ongoing basis, if such Contributor fails to notify You of the
|
||||
non-compliance by some reasonable means prior to 60 days after You have
|
||||
come back into compliance. Moreover, Your grants from a particular
|
||||
Contributor are reinstated on an ongoing basis if such Contributor
|
||||
notifies You of the non-compliance by some reasonable means, this is the
|
||||
first time You have received notice of non-compliance with this License
|
||||
from such Contributor, and You become compliant prior to 30 days after
|
||||
Your receipt of the notice.
|
||||
|
||||
5.2. If You initiate litigation against any entity by asserting a patent
|
||||
infringement claim (excluding declaratory judgment actions,
|
||||
counter-claims, and cross-claims) alleging that a Contributor Version
|
||||
directly or indirectly infringes any patent, then the rights granted to
|
||||
You by any and all Contributors for the Covered Software under Section
|
||||
2.1 of this License shall terminate.
|
||||
|
||||
5.3. In the event of termination under Sections 5.1 or 5.2 above, all
|
||||
end user license agreements (excluding distributors and resellers) which
|
||||
have been validly granted by You or Your distributors under this License
|
||||
prior to termination shall survive termination.
|
||||
|
||||
************************************************************************
|
||||
* *
|
||||
* 6. Disclaimer of Warranty *
|
||||
* ------------------------- *
|
||||
* *
|
||||
* Covered Software is provided under this License on an "as is" *
|
||||
* basis, without warranty of any kind, either expressed, implied, or *
|
||||
* statutory, including, without limitation, warranties that the *
|
||||
* Covered Software is free of defects, merchantable, fit for a *
|
||||
* particular purpose or non-infringing. The entire risk as to the *
|
||||
* quality and performance of the Covered Software is with You. *
|
||||
* Should any Covered Software prove defective in any respect, You *
|
||||
* (not any Contributor) assume the cost of any necessary servicing, *
|
||||
* repair, or correction. This disclaimer of warranty constitutes an *
|
||||
* essential part of this License. No use of any Covered Software is *
|
||||
* authorized under this License except under this disclaimer. *
|
||||
* *
|
||||
************************************************************************
|
||||
|
||||
************************************************************************
|
||||
* *
|
||||
* 7. Limitation of Liability *
|
||||
* -------------------------- *
|
||||
* *
|
||||
* Under no circumstances and under no legal theory, whether tort *
|
||||
* (including negligence), contract, or otherwise, shall any *
|
||||
* Contributor, or anyone who distributes Covered Software as *
|
||||
* permitted above, be liable to You for any direct, indirect, *
|
||||
* special, incidental, or consequential damages of any character *
|
||||
* including, without limitation, damages for lost profits, loss of *
|
||||
* goodwill, work stoppage, computer failure or malfunction, or any *
|
||||
* and all other commercial damages or losses, even if such party *
|
||||
* shall have been informed of the possibility of such damages. This *
|
||||
* limitation of liability shall not apply to liability for death or *
|
||||
* personal injury resulting from such party's negligence to the *
|
||||
* extent applicable law prohibits such limitation. Some *
|
||||
* jurisdictions do not allow the exclusion or limitation of *
|
||||
* incidental or consequential damages, so this exclusion and *
|
||||
* limitation may not apply to You. *
|
||||
* *
|
||||
************************************************************************
|
||||
|
||||
8. Litigation
|
||||
-------------
|
||||
|
||||
Any litigation relating to this License may be brought only in the
|
||||
courts of a jurisdiction where the defendant maintains its principal
|
||||
place of business and such litigation shall be governed by laws of that
|
||||
jurisdiction, without reference to its conflict-of-law provisions.
|
||||
Nothing in this Section shall prevent a party's ability to bring
|
||||
cross-claims or counter-claims.
|
||||
|
||||
9. Miscellaneous
|
||||
----------------
|
||||
|
||||
This License represents the complete agreement concerning the subject
|
||||
matter hereof. If any provision of this License is held to be
|
||||
unenforceable, such provision shall be reformed only to the extent
|
||||
necessary to make it enforceable. Any law or regulation which provides
|
||||
that the language of a contract shall be construed against the drafter
|
||||
shall not be used to construe this License against a Contributor.
|
||||
|
||||
10. Versions of the License
|
||||
---------------------------
|
||||
|
||||
10.1. New Versions
|
||||
|
||||
Mozilla Foundation is the license steward. Except as provided in Section
|
||||
10.3, no one other than the license steward has the right to modify or
|
||||
publish new versions of this License. Each version will be given a
|
||||
distinguishing version number.
|
||||
|
||||
10.2. Effect of New Versions
|
||||
|
||||
You may distribute the Covered Software under the terms of the version
|
||||
of the License under which You originally received the Covered Software,
|
||||
or under the terms of any subsequent version published by the license
|
||||
steward.
|
||||
|
||||
10.3. Modified Versions
|
||||
|
||||
If you create software not governed by this License, and you want to
|
||||
create a new license for such software, you may create and use a
|
||||
modified version of this License if you rename the license and remove
|
||||
any references to the name of the license steward (except to note that
|
||||
such modified license differs from this License).
|
||||
|
||||
10.4. Distributing Source Code Form that is Incompatible With Secondary
|
||||
Licenses
|
||||
|
||||
If You choose to distribute Source Code Form that is Incompatible With
|
||||
Secondary Licenses under the terms of this version of the License, the
|
||||
notice described in Exhibit B of this License must be attached.
|
||||
|
||||
Exhibit A - Source Code Form License Notice
|
||||
-------------------------------------------
|
||||
|
||||
This Source Code Form is subject to the terms of the Mozilla Public
|
||||
License, v. 2.0. If a copy of the MPL was not distributed with this
|
||||
file, You can obtain one at http://mozilla.org/MPL/2.0/.
|
||||
|
||||
If it is not possible or desirable to put the notice in a particular
|
||||
file, then You may include the notice in a location (such as a LICENSE
|
||||
file in a relevant directory) where a recipient would be likely to look
|
||||
for such a notice.
|
||||
|
||||
You may add additional accurate notices of copyright ownership.
|
||||
|
||||
Exhibit B - "Incompatible With Secondary Licenses" Notice
|
||||
---------------------------------------------------------
|
||||
|
||||
This Source Code Form is "Incompatible With Secondary Licenses", as
|
||||
defined by the Mozilla Public License, v. 2.0.
|
||||
@@ -1,21 +0,0 @@
|
||||
# asusctl
|
||||
|
||||
Requires `asusd` to be installed and running.
|
||||
|
||||
## build and install
|
||||
|
||||
```
|
||||
npm install
|
||||
npm run build && gnome-extensions install asusctl-gnome@asus-linux.org.zip --force
|
||||
npm run build && gnome-extensions enable asusctl-gnome@asus-linux.org.zip
|
||||
```
|
||||
|
||||
You will need to restart Gnome after installing or updating
|
||||
|
||||
## development
|
||||
|
||||
```
|
||||
npm run build
|
||||
gnome-extensions install asusctl-gnome@asus-linux.org.zip --force
|
||||
MUTTER_DEBUG_DUMMY_MODE_SPECS=1366x768 dbus-run-session -- gnome-shell --nested --wayland
|
||||
```
|
||||
@@ -1,65 +0,0 @@
|
||||
const { build } = require("esbuild");
|
||||
const fs = require("fs");
|
||||
const path = require("path");
|
||||
var exec = require('child_process').exec;
|
||||
const AdmZip = require("adm-zip");
|
||||
const metadata = require("./src/metadata.json");
|
||||
|
||||
build({
|
||||
entryPoints: ['src/extension.ts'],
|
||||
outdir: 'dist',
|
||||
bundle: true,
|
||||
// Do not remove the functions `enable()`, `disable()` and `init()`
|
||||
treeShaking: false,
|
||||
// firefox60 // Since GJS 1.53.90
|
||||
// firefox68 // Since GJS 1.63.90
|
||||
// firefox78 // Since GJS 1.65.90
|
||||
// firefox91 // Since GJS 1.71.1
|
||||
// firefox102 // Since GJS 1.73.2
|
||||
target: "firefox78",
|
||||
platform: "node",
|
||||
// platform: "neutral",
|
||||
// mainFields: ['main'],
|
||||
// conditions: ['require', 'default'],
|
||||
// format: 'cjs',
|
||||
external: ['gi://*', 'system', 'gettext', 'cairo'],
|
||||
}).then(() => {
|
||||
const metaSrc = path.resolve(__dirname, "src/metadata.json");
|
||||
const metaDist = path.resolve(__dirname, "dist/metadata.json");
|
||||
const schemaSrc = path.resolve(__dirname, "schemas");
|
||||
const schemaDist = path.resolve(__dirname, "dist/schemas");
|
||||
const dbusXmlSrc = path.resolve(__dirname, "../../bindings/dbus-xml");
|
||||
const dbusXmlDist = path.resolve(__dirname, "dist/resources/dbus");
|
||||
const zipFilename = `${metadata.uuid}.zip`;
|
||||
const zipDist = path.resolve(__dirname, zipFilename);
|
||||
|
||||
exec('glib-compile-schemas schemas/',
|
||||
(error, stdout, stderr) => {
|
||||
console.log('stdout: ' + stdout);
|
||||
console.log('stderr: ' + stderr);
|
||||
});
|
||||
|
||||
fs.copyFileSync(metaSrc, metaDist);
|
||||
|
||||
fs.cpSync(schemaSrc, schemaDist, { recursive: true }, (err) => {
|
||||
if (err) {
|
||||
console.error(err);
|
||||
}
|
||||
});
|
||||
|
||||
fs.cpSync(dbusXmlSrc, dbusXmlDist, { recursive: true }, (err) => {
|
||||
if (err) {
|
||||
console.error(err);
|
||||
}
|
||||
});
|
||||
|
||||
const zip = new AdmZip();
|
||||
zip.addLocalFolder(path.resolve(__dirname, "dist"));
|
||||
zip.writeZip(zipDist);
|
||||
|
||||
console.log(`Build complete. Zip file: ${zipFilename}\n`);
|
||||
console.log(`Install with: gnome-extensions install ${zipFilename}`)
|
||||
console.log(`Update with: gnome-extensions install ${zipFilename} --force`)
|
||||
console.log(`Enable with: gnome-extensions enable ${metadata.uuid} --user`)
|
||||
});
|
||||
|
||||
2002
desktop-extensions/gnome/package-lock.json
generated
2002
desktop-extensions/gnome/package-lock.json
generated
File diff suppressed because it is too large
Load Diff
@@ -1,40 +0,0 @@
|
||||
{
|
||||
"name": "asusctl-gnome",
|
||||
"version": "4.7.0",
|
||||
"description": "asusctl-gnome a gnome extension exposing some of the base features of asusd in a helpful and easy to use way",
|
||||
"main": "dist/extension.js",
|
||||
"scripts": {
|
||||
"clear": "rm -rf dist",
|
||||
"build:app": "node esbuild.js",
|
||||
"build": "yarn run clear && yarn run build:app",
|
||||
"validate": "tsc --noEmit"
|
||||
},
|
||||
"devDependencies": {
|
||||
"@typescript-eslint/eslint-plugin": "^5.60.1",
|
||||
"@typescript-eslint/parser": "^5.60.1",
|
||||
"adm-zip": "^0.5.10",
|
||||
"esbuild": "^0.17.19",
|
||||
"eslint": "^8.44.0",
|
||||
"typescript": "^5.1.6"
|
||||
},
|
||||
"repository": {
|
||||
"type": "git",
|
||||
"url": "git+ssh://git@gitlab.com/asus-linux/asusctl.git"
|
||||
},
|
||||
"keywords": [
|
||||
"gnome-shell",
|
||||
"extension",
|
||||
"asusctl",
|
||||
"asus",
|
||||
"rog",
|
||||
"gnome",
|
||||
"gjs",
|
||||
"typescript"
|
||||
],
|
||||
"author": "Armas Spann, Marco Laux, Luke Jones",
|
||||
"license": "MPL-2",
|
||||
"bugs": {
|
||||
"url": "https://gitlab.com/asus-linux/asusctl/issues"
|
||||
},
|
||||
"homepage": "https://gitlab.com/asus-linux/asusctl/desktop-extensions/gnome#readme"
|
||||
}
|
||||
@@ -1,21 +0,0 @@
|
||||
<?xml version="1.0" encoding="UTF-8"?>
|
||||
<schemalist gettext-domain="AsusctlGnomeExtension">
|
||||
<schema id="org.gnome.shell.extensions.asusctl-gnome" path="/org/gnome/shell/extensions/asusctl-gnome/" >
|
||||
<key type="b" name="mini-led-enabled">
|
||||
<default>false</default>
|
||||
</key>
|
||||
<key type="b" name="panel-od-enabled">
|
||||
<default>false</default>
|
||||
</key>
|
||||
<key type="b" name="anime-power">
|
||||
<default>false</default>
|
||||
</key>
|
||||
<key name="charge-level" type="u">
|
||||
<range min="20" max="100"/>
|
||||
<default>100</default>
|
||||
</key>
|
||||
<key type="s" name="primary-quickmenu-toggle">
|
||||
<default>"mini-led"</default>
|
||||
</key>
|
||||
</schema>
|
||||
</schemalist>
|
||||
@@ -1 +0,0 @@
|
||||
../../../bindings/ts
|
||||
@@ -1,114 +0,0 @@
|
||||
// REF: https://gjs.guide/extensions/development/creating.html
|
||||
|
||||
import { AnimeDbus } from "./modules/dbus/animatrix";
|
||||
import { Power } from "./modules/dbus/power";
|
||||
import { Supported } from "./modules/dbus/supported";
|
||||
import { Platform } from "./modules/dbus/platform";
|
||||
|
||||
import { QuickPanelOd } from "./modules/quick_toggles/panel_od";
|
||||
import { IndicateMiniLed } from "./modules/indicators/mini_led";
|
||||
import { QuickMiniLed } from "./modules/quick_toggles/mini_led";
|
||||
import { SliderChargeLevel } from "./modules/sliders/charge";
|
||||
import { QuickAnimePower } from "./modules/quick_toggles/anime_power";
|
||||
import { FeatureMenuToggle } from "./modules/quick_menus/laptop_features";
|
||||
import { AuraDbus } from "./modules/dbus/aura";
|
||||
import { AuraMenuToggle } from "./modules/quick_menus/aura";
|
||||
|
||||
class Extension {
|
||||
private _indicateMiniLed: typeof IndicateMiniLed;
|
||||
private _quickMiniLed: typeof QuickMiniLed;
|
||||
private _quickPanelOd: typeof QuickPanelOd;
|
||||
private _quickAnimePower: typeof QuickAnimePower;
|
||||
private _featureMenuToggle: typeof FeatureMenuToggle;
|
||||
private _auraModeMenuToggle: typeof AuraMenuToggle;
|
||||
private _sliderCharge: typeof SliderChargeLevel;
|
||||
|
||||
public dbus_supported: Supported = new Supported;
|
||||
public dbus_power: Power = new Power;
|
||||
public dbus_aura: AuraDbus = new AuraDbus;
|
||||
public dbus_anime: AnimeDbus = new AnimeDbus;
|
||||
public dbus_platform: Platform = new Platform;
|
||||
|
||||
|
||||
constructor() {
|
||||
this._indicateMiniLed = null;
|
||||
this._quickMiniLed = null;
|
||||
this._quickPanelOd = null;
|
||||
this._quickAnimePower = null;
|
||||
this._sliderCharge = null;
|
||||
|
||||
this.dbus_supported.start();
|
||||
this.dbus_aura.start();
|
||||
this.dbus_platform.start();
|
||||
this.dbus_power.start();
|
||||
this.dbus_anime.start();
|
||||
}
|
||||
|
||||
enable() {
|
||||
if (this._featureMenuToggle == null) {
|
||||
this._featureMenuToggle = new FeatureMenuToggle(this.dbus_supported, this.dbus_platform, this.dbus_anime);
|
||||
}
|
||||
if (this._auraModeMenuToggle == null) {
|
||||
this._auraModeMenuToggle = new AuraMenuToggle(this.dbus_aura);
|
||||
}
|
||||
if (this.dbus_supported.supported.rog_bios_ctrl.mini_led_mode) {
|
||||
// if (this._quickMiniLed == null) {
|
||||
// this._quickMiniLed = new QuickMiniLed(this.dbus_platform);
|
||||
// this.dbus_platform.notifyMiniLedSubscribers.push(this._quickMiniLed);
|
||||
// }
|
||||
if (this._indicateMiniLed == null) {
|
||||
this._indicateMiniLed = new IndicateMiniLed(this.dbus_platform);
|
||||
}
|
||||
}
|
||||
// if (this.dbus_supported.supported.rog_bios_ctrl.panel_overdrive) {
|
||||
// if (this._quickPanelOd == null) {
|
||||
// this._quickPanelOd = new QuickPanelOd(this.dbus_platform);
|
||||
// this.dbus_platform.notifyPanelOdSubscribers.push(this._quickPanelOd);
|
||||
// }
|
||||
// }
|
||||
// if (this.dbus_supported.supported.anime_ctrl) {
|
||||
// if (this._quickAnimePower == null) {
|
||||
// this._quickAnimePower = new QuickAnimePower(this._dbus_anime);
|
||||
// }
|
||||
// }
|
||||
if (this.dbus_supported.supported.charge_ctrl.charge_level_set) {
|
||||
if (this._sliderCharge == null) {
|
||||
this._sliderCharge = new SliderChargeLevel(this.dbus_power);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
disable() {
|
||||
if (this._indicateMiniLed != null) {
|
||||
this._indicateMiniLed.destroy();
|
||||
this._indicateMiniLed = null;
|
||||
}
|
||||
if (this._quickMiniLed != null) {
|
||||
this._quickMiniLed.destroy();
|
||||
this._quickMiniLed = null;
|
||||
}
|
||||
if (this._quickPanelOd != null) {
|
||||
this._quickPanelOd.destroy();
|
||||
this._quickPanelOd = null;
|
||||
}
|
||||
if (this._quickAnimePower != null) {
|
||||
this._quickAnimePower.destroy();
|
||||
this._quickAnimePower = null;
|
||||
}
|
||||
if (this._sliderCharge != null) {
|
||||
this._sliderCharge.destroy();
|
||||
this._sliderCharge = null;
|
||||
}
|
||||
|
||||
this.dbus_power.stop();
|
||||
this.dbus_platform.stop();
|
||||
this.dbus_anime.stop();
|
||||
this.dbus_aura.stop();
|
||||
this.dbus_supported.stop();
|
||||
}
|
||||
}
|
||||
|
||||
// eslint-disable-next-line @typescript-eslint/no-unused-vars
|
||||
function init() {
|
||||
return new Extension();
|
||||
}
|
||||
@@ -1,11 +0,0 @@
|
||||
{
|
||||
"name": "asusctl-gnome",
|
||||
"description": "asusctl-gnome a gnome extension exposing some of the base features of asusd in a helpful and easy to use way",
|
||||
"uuid": "asusctl-gnome@asus-linux.org",
|
||||
"uuid-dev": "asusctl-gnome-dev@asus-linux.org",
|
||||
"settings-schema": "org.gnome.shell.extensions.asusctl-gnome",
|
||||
"version": "4.3.2",
|
||||
"shell-version": [
|
||||
"43", "44"
|
||||
]
|
||||
}
|
||||
@@ -1,119 +0,0 @@
|
||||
import { DbusBase } from "./base";
|
||||
import { DeviceState, AnimBooting, Brightness, AnimAwake, AnimSleeping, AnimShutdown } from "../../bindings/anime";
|
||||
|
||||
export class AnimeDbus extends DbusBase {
|
||||
deviceState: DeviceState = {
|
||||
display_enabled: false,
|
||||
display_brightness: Brightness.Med,
|
||||
builtin_anims_enabled: false,
|
||||
builtin_anims: {
|
||||
boot: AnimBooting.GlitchConstruction,
|
||||
awake: AnimAwake.BinaryBannerScroll,
|
||||
sleep: AnimSleeping.BannerSwipe,
|
||||
shutdown: AnimShutdown.GlitchOut
|
||||
},
|
||||
};
|
||||
|
||||
// TODO: interface or something to enforce requirement of "sync()" method
|
||||
public notifyAnimeStateSubscribers: any[] = [];
|
||||
|
||||
constructor() {
|
||||
super("org-asuslinux-anime-4", "/org/asuslinux/Anime");
|
||||
}
|
||||
|
||||
public setEnableDisplay(state: boolean | null) {
|
||||
if (this.isRunning()) {
|
||||
try {
|
||||
// if null, toggle the current state
|
||||
state = (state == null ? !this.deviceState.display_enabled : state);
|
||||
|
||||
if (this.deviceState.display_enabled !== state) {
|
||||
this.deviceState.display_enabled = state;
|
||||
}
|
||||
return this.dbus_proxy.SetEnableDisplaySync(state);
|
||||
} catch (e) {
|
||||
//@ts-ignore
|
||||
log("AniMe DBus set power failed!", e);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
public setPowersaveAnim(state: boolean | null) {
|
||||
if (this.isRunning()) {
|
||||
try {
|
||||
// if null, toggle the current state
|
||||
state = (state == null ? !this.deviceState.builtin_anims_enabled : state);
|
||||
|
||||
if (this.deviceState.builtin_anims_enabled !== state) {
|
||||
this.deviceState.builtin_anims_enabled = state;
|
||||
}
|
||||
return this.dbus_proxy.SetEnableBuiltinsSync(state);
|
||||
} catch (e) {
|
||||
//@ts-ignore
|
||||
log("AniMe DBus set builtins failed!", e);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
public setBrightness(brightness: Brightness) {
|
||||
if (this.isRunning()) {
|
||||
try {
|
||||
if (this.deviceState.display_brightness !== brightness) {
|
||||
this.deviceState.display_brightness = brightness;
|
||||
}
|
||||
return this.dbus_proxy.SetBrightnessSync(brightness);
|
||||
} catch (e) {
|
||||
//@ts-ignore
|
||||
log("AniMe DBus set brightness failed!", e);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
_parseData(data: any) {
|
||||
if (data.length > 0) {
|
||||
this.deviceState.display_enabled = data[0];
|
||||
this.deviceState.display_brightness = Brightness[data[1] as Brightness];
|
||||
this.deviceState.builtin_anims_enabled = data[2];
|
||||
this.deviceState.builtin_anims.boot = AnimBooting[data[3][0] as AnimBooting];
|
||||
this.deviceState.builtin_anims.awake = AnimAwake[data[3][1] as AnimAwake];
|
||||
this.deviceState.builtin_anims.sleep = AnimSleeping[data[3][2] as AnimSleeping];
|
||||
this.deviceState.builtin_anims.shutdown = AnimShutdown[data[3][2] as AnimShutdown];
|
||||
}
|
||||
}
|
||||
|
||||
public getDeviceState() {
|
||||
if (this.isRunning()) {
|
||||
try {
|
||||
// janky shit going on with DeviceStateSync
|
||||
this._parseData(this.dbus_proxy.DeviceStateSync());
|
||||
} catch (e) {
|
||||
//@ts-ignore
|
||||
log("Failed to fetch DeviceState!", e);
|
||||
}
|
||||
}
|
||||
return this.deviceState;
|
||||
}
|
||||
|
||||
async start() {
|
||||
await super.start();
|
||||
this.getDeviceState();
|
||||
|
||||
this.dbus_proxy.connectSignal(
|
||||
"NotifyDeviceState",
|
||||
// eslint-disable-next-line @typescript-eslint/no-explicit-any
|
||||
(proxy: any = null, name: string, data: string) => {
|
||||
if (proxy) {
|
||||
// idiot xml parsing mneans the get is not nested while this is
|
||||
this._parseData(data[0]);
|
||||
this.notifyAnimeStateSubscribers.forEach(sub => {
|
||||
sub.sync();
|
||||
});
|
||||
}
|
||||
}
|
||||
);
|
||||
}
|
||||
|
||||
async stop() {
|
||||
await super.stop();
|
||||
}
|
||||
}
|
||||
@@ -1,284 +0,0 @@
|
||||
import { AuraDevRog1, AuraDevTuf, AuraDevice, AuraEffect, AuraModeNum, AuraPower, AuraPowerDev, AuraZone, Direction, PowerZones, Speed } from "../../bindings/aura";
|
||||
import { DbusBase } from "./base";
|
||||
|
||||
export class AuraDbus extends DbusBase {
|
||||
public device: AuraDevice = AuraDevice.Unknown;
|
||||
public current_aura_mode: AuraModeNum = AuraModeNum.Static;
|
||||
public aura_modes: Map<AuraModeNum, AuraEffect> = new Map;
|
||||
public leds_powered: AuraPowerDev = {
|
||||
tuf: [],
|
||||
old_rog: [],
|
||||
rog: {
|
||||
keyboard: {
|
||||
zone: PowerZones.Keyboard,
|
||||
boot: false,
|
||||
awake: false,
|
||||
sleep: false,
|
||||
shutdown: false
|
||||
},
|
||||
logo: {
|
||||
zone: PowerZones.Logo,
|
||||
boot: false,
|
||||
awake: false,
|
||||
sleep: false,
|
||||
shutdown: false
|
||||
},
|
||||
lightbar: {
|
||||
zone: PowerZones.Lightbar,
|
||||
boot: false,
|
||||
awake: false,
|
||||
sleep: false,
|
||||
shutdown: false
|
||||
},
|
||||
lid: {
|
||||
zone: PowerZones.Lid,
|
||||
boot: false,
|
||||
awake: false,
|
||||
sleep: false,
|
||||
shutdown: false
|
||||
},
|
||||
rear_glow: {
|
||||
zone: PowerZones.RearGlow,
|
||||
boot: false,
|
||||
awake: false,
|
||||
sleep: false,
|
||||
shutdown: false
|
||||
},
|
||||
}
|
||||
};
|
||||
// TODO: interface or something to enforce requirement of "sync()" method
|
||||
public notifyAuraModeSubscribers: any[] = [];
|
||||
public notifyAuraPowerSubscribers: any[] = [];
|
||||
|
||||
constructor() {
|
||||
super("org-asuslinux-aura-4", "/org/asuslinux/Aura");
|
||||
}
|
||||
|
||||
public getDevice() {
|
||||
if (this.isRunning()) {
|
||||
try {
|
||||
this.device = AuraDevice[this.dbus_proxy.DeviceTypeSync() as AuraDevice];
|
||||
//@ts-ignore
|
||||
log("LED device: " + this.device);
|
||||
} catch (e) {
|
||||
//@ts-ignore
|
||||
log("Failed to fetch supported functionalities", e);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
_parsePowerStates(data: any[]) {
|
||||
const power: AuraPowerDev = this.leds_powered;
|
||||
|
||||
power.tuf = data[0].map((value: string) => {
|
||||
return AuraDevTuf[value as AuraDevTuf];
|
||||
});
|
||||
power.old_rog = data[1].map((value: string) => {
|
||||
return AuraDevRog1[value as AuraDevRog1];
|
||||
});
|
||||
power.rog = {
|
||||
keyboard: {
|
||||
zone: PowerZones[data[2][0][0] as PowerZones],
|
||||
boot: data[2][0][1],
|
||||
awake: data[2][0][2],
|
||||
sleep: data[2][0][3],
|
||||
shutdown: data[2][0][4]
|
||||
},
|
||||
logo: {
|
||||
zone: PowerZones[data[2][1][0] as PowerZones],
|
||||
boot: data[2][1][1],
|
||||
awake: data[2][1][2],
|
||||
sleep: data[2][1][3],
|
||||
shutdown: data[2][1][4]
|
||||
},
|
||||
lightbar: {
|
||||
zone: PowerZones[data[2][2][0] as PowerZones],
|
||||
boot: data[2][2][1],
|
||||
awake: data[2][2][2],
|
||||
sleep: data[2][2][3],
|
||||
shutdown: data[2][2][4]
|
||||
},
|
||||
lid: {
|
||||
zone: PowerZones[data[2][3][0] as PowerZones],
|
||||
boot: data[2][3][1],
|
||||
awake: data[2][3][2],
|
||||
sleep: data[2][3][3],
|
||||
shutdown: data[2][3][4]
|
||||
},
|
||||
rear_glow: {
|
||||
zone: PowerZones[data[2][4][0] as PowerZones],
|
||||
boot: data[2][4][1],
|
||||
awake: data[2][4][2],
|
||||
sleep: data[2][4][3],
|
||||
shutdown: data[2][4][4]
|
||||
}
|
||||
};
|
||||
|
||||
return power;
|
||||
}
|
||||
|
||||
public getLedPower() {
|
||||
if (this.isRunning()) {
|
||||
try {
|
||||
const data = this.dbus_proxy.LedPowerSync();
|
||||
this.leds_powered = this._parsePowerStates(data);
|
||||
//@ts-ignore
|
||||
log("LED power tuf: " + this.leds_powered.tuf);
|
||||
//@ts-ignore
|
||||
log("LED power x1866: " + this.leds_powered.old_rog);
|
||||
//@ts-ignore
|
||||
log("LED power x19b6: " + this.leds_powered.rog);
|
||||
} catch (e) {
|
||||
//@ts-ignore
|
||||
log("Failed to fetch supported functionalities", e);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
public getLedMode() {
|
||||
if (this.isRunning()) {
|
||||
try {
|
||||
this.current_aura_mode = AuraModeNum[this.dbus_proxy.LedModeSync() as AuraModeNum];
|
||||
//@ts-ignore
|
||||
log("Current LED mode:", this.current_aura_mode);
|
||||
} catch (e) {
|
||||
//@ts-ignore
|
||||
log("Failed to fetch supported functionalities", e);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
public setLedMode(mode: AuraEffect) {
|
||||
if (this.isRunning()) {
|
||||
try {
|
||||
this.dbus_proxy.SetLedModeSync([
|
||||
mode.mode,
|
||||
mode.zone,
|
||||
[mode.colour1.r, mode.colour1.g, mode.colour1.b],
|
||||
[mode.colour2.r, mode.colour2.g, mode.colour2.b],
|
||||
mode.speed,
|
||||
mode.direction]);
|
||||
} catch (e) {
|
||||
//@ts-ignore
|
||||
log("Failed to fetch supported functionalities", e);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
_parseAuraEffect(data: any[]) {
|
||||
const aura: AuraEffect = {
|
||||
mode: AuraModeNum[data[0] as AuraModeNum],
|
||||
zone: AuraZone[data[1] as AuraZone],
|
||||
colour1: {
|
||||
r: parseInt(data[2][0]),
|
||||
g: parseInt(data[2][1]),
|
||||
b: parseInt(data[2][2]),
|
||||
},
|
||||
colour2: {
|
||||
r: parseInt(data[3][0]),
|
||||
g: parseInt(data[3][1]),
|
||||
b: parseInt(data[3][2]),
|
||||
},
|
||||
speed: Speed[data[4] as Speed],
|
||||
direction: Direction[data[5] as Direction],
|
||||
};
|
||||
return aura;
|
||||
}
|
||||
|
||||
// Return a list of the available modes, and the current settings for each
|
||||
public getLedModes() {
|
||||
// {'Breathe': ('Breathe', 'None', (166, 0, 0), (0, 0, 0), 'Med', 'Right'),
|
||||
// 'Comet': ('Comet', 'None', (166, 0, 0), (0, 0, 0), 'Med', 'Right'),
|
||||
// 'Static': ('Static', 'None', (78, 0, 0), (0, 0, 0), 'Med', 'Right'),
|
||||
// 'Strobe': ('Strobe', 'None', (166, 0, 0), (0, 0, 0), 'Med', 'Right')}
|
||||
if (this.isRunning()) {
|
||||
try {
|
||||
const _data = this.dbus_proxy.LedModesSync();
|
||||
for (const key in _data[0]) {
|
||||
const data = _data[0][key];
|
||||
const aura: AuraEffect = this._parseAuraEffect(data);
|
||||
this.aura_modes.set(AuraModeNum[key as AuraModeNum], aura);
|
||||
}
|
||||
|
||||
for (const [key, value] of this.aura_modes) {
|
||||
//@ts-ignore
|
||||
log(key, value.zone, value.colour1.r, value.speed, value.direction);
|
||||
}
|
||||
|
||||
} catch (e) {
|
||||
//@ts-ignore
|
||||
log("Failed to fetch supported functionalities", e);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
async start() {
|
||||
try {
|
||||
await super.start();
|
||||
this.getDevice();
|
||||
this.getLedPower();
|
||||
this.getLedMode();
|
||||
this.getLedModes();
|
||||
|
||||
//@ts-ignore
|
||||
log("Current LED mode data:", this.aura_modes.get(this.current_aura_mode)?.speed);
|
||||
|
||||
this.dbus_proxy.connectSignal(
|
||||
"NotifyLed",
|
||||
(proxy: any = null, name: string, data: any) => {
|
||||
if (proxy) {
|
||||
const aura: AuraEffect = this._parseAuraEffect(data[0]);
|
||||
this.current_aura_mode = aura.mode;
|
||||
this.aura_modes.set(aura.mode, aura);
|
||||
//@ts-ignore
|
||||
log("LED data has changed to ", aura.mode, aura.zone, aura.colour1.r, aura.speed, aura.direction);
|
||||
this.notifyAuraModeSubscribers.forEach(sub => {
|
||||
sub.sync();
|
||||
});
|
||||
}
|
||||
}
|
||||
);
|
||||
|
||||
this.dbus_proxy.connectSignal(
|
||||
"NotifyPowerStates",
|
||||
(proxy: any = null, name: string, data: any) => {
|
||||
if (proxy) {
|
||||
const power: AuraPowerDev = this._parsePowerStates(data[0]);
|
||||
this.leds_powered = power;
|
||||
switch (this.device) {
|
||||
case AuraDevice.Tuf:
|
||||
//@ts-ignore
|
||||
log("LED power has changed to ", this.leds_powered.tuf);
|
||||
break;
|
||||
case AuraDevice.X1854:
|
||||
case AuraDevice.X1869:
|
||||
case AuraDevice.X18c6:
|
||||
//@ts-ignore
|
||||
log("LED power has changed to ", this.leds_powered.old_rog);
|
||||
break;
|
||||
case AuraDevice.X19b6:
|
||||
case AuraDevice.X1a30:
|
||||
//@ts-ignore
|
||||
log("LED power has changed to ", this.leds_powered.rog);
|
||||
break;
|
||||
default:
|
||||
break;
|
||||
}
|
||||
//@ts-ignore
|
||||
log("LED power has changed to ", this.leds_powered.rog);
|
||||
this.notifyAuraPowerSubscribers.forEach(sub => {
|
||||
sub.sync();
|
||||
});
|
||||
}
|
||||
}
|
||||
);
|
||||
} catch (e) {
|
||||
//@ts-ignore
|
||||
log("Supported DBus initialization failed!", e);
|
||||
}
|
||||
}
|
||||
|
||||
async stop() {
|
||||
await super.stop();
|
||||
}
|
||||
}
|
||||
@@ -1,52 +0,0 @@
|
||||
declare const imports: any;
|
||||
|
||||
import * as Resources from "../resources";
|
||||
|
||||
const { Gio } = imports.gi;
|
||||
|
||||
export class DbusBase {
|
||||
dbus_proxy: any = null; // type: Gio.DbusProxy
|
||||
connected = false;
|
||||
xml_resource = "";
|
||||
dbus_path = "";
|
||||
|
||||
constructor(resource: string, dbus_path: string) {
|
||||
this.xml_resource = resource;
|
||||
this.dbus_path = dbus_path;
|
||||
}
|
||||
|
||||
async start() {
|
||||
//@ts-ignore
|
||||
log(`Starting ${this.dbus_path} dbus module`);
|
||||
try {
|
||||
const xml = Resources.File.DBus(this.xml_resource);
|
||||
this.dbus_proxy = new Gio.DBusProxy.makeProxyWrapper(xml)(
|
||||
Gio.DBus.system,
|
||||
"org.asuslinux.Daemon",
|
||||
this.dbus_path,
|
||||
);
|
||||
|
||||
this.connected = true;
|
||||
//@ts-ignore
|
||||
log(`${this.dbus_path} client started successfully.`);
|
||||
} catch (e) {
|
||||
//@ts-ignore
|
||||
logError(`${this.xml_resource} dbus init failed!`, e);
|
||||
}
|
||||
}
|
||||
|
||||
async stop() {
|
||||
//@ts-ignore
|
||||
log(`Stopping ${this.xml_resource} dbus module`);
|
||||
|
||||
if (this.connected) {
|
||||
this.dbus_proxy.destroy();
|
||||
this.connected = false;
|
||||
this.dbus_proxy = null;
|
||||
}
|
||||
}
|
||||
|
||||
isRunning(): boolean {
|
||||
return this.connected;
|
||||
}
|
||||
}
|
||||
@@ -1,202 +0,0 @@
|
||||
import * as bios from "../../bindings/platform";
|
||||
import { DbusBase } from "./base";
|
||||
|
||||
// TODO: add callbacks for notifications
|
||||
export class Platform extends DbusBase {
|
||||
bios: bios.RogBiosSupportedFunctions = {
|
||||
post_sound: false,
|
||||
gpu_mux: false,
|
||||
panel_overdrive: false,
|
||||
dgpu_disable: false,
|
||||
egpu_enable: false,
|
||||
mini_led_mode: false
|
||||
};
|
||||
|
||||
// TODO: interface or something to enforce requirement of "sync()" method
|
||||
public notifyPanelOdSubscribers: any[] = [];
|
||||
public notifyPostBootSoundSubscribers: any[] = [];
|
||||
public notifyMiniLedSubscribers: any[] = [];
|
||||
public notifyGpuMuxSubscribers: any[] = [];
|
||||
|
||||
constructor() {
|
||||
super("org-asuslinux-platform-4", "/org/asuslinux/Platform");
|
||||
}
|
||||
|
||||
public getPostBootSound() {
|
||||
if (this.isRunning()) {
|
||||
try {
|
||||
this.bios.post_sound = this.dbus_proxy.PostBootSoundSync() == "true" ? true : false;
|
||||
} catch (e) {
|
||||
//@ts-ignore
|
||||
log("Failed to get POST Boot Sound state!", e);
|
||||
}
|
||||
}
|
||||
return this.bios.post_sound;
|
||||
}
|
||||
|
||||
public setPostBootSound(state: boolean) {
|
||||
if (this.isRunning()) {
|
||||
try {
|
||||
if (state !== this.bios.post_sound) {
|
||||
this.bios.post_sound = state;
|
||||
}
|
||||
return this.dbus_proxy.SetPostBootSoundSync(state);
|
||||
} catch (e) {
|
||||
//@ts-ignore
|
||||
log("Platform DBus set Post Boot Sound failed!", e);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
public getGpuMuxMode() {
|
||||
if (this.isRunning()) {
|
||||
try {
|
||||
this.bios.gpu_mux = this.dbus_proxy.GpuMuxModeSync() == "true" ? true : false;
|
||||
} catch (e) {
|
||||
//@ts-ignore
|
||||
log("Failed to get MUX state!", e);
|
||||
}
|
||||
}
|
||||
return this.bios.gpu_mux;
|
||||
}
|
||||
|
||||
public setGpuMuxMode(state: boolean) {
|
||||
if (this.isRunning()) {
|
||||
try {
|
||||
if (!state !== this.bios.gpu_mux) {
|
||||
this.bios.gpu_mux = !state;
|
||||
}
|
||||
return this.dbus_proxy.SetGpuMuxModeSync(!state);
|
||||
} catch (e) {
|
||||
//@ts-ignore
|
||||
log("Switching the MUX failed!", e);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
public getPanelOd() {
|
||||
if (this.isRunning()) {
|
||||
try {
|
||||
this.bios.panel_overdrive = this.dbus_proxy.PanelOdSync() == "true" ? true : false;
|
||||
} catch (e) {
|
||||
//@ts-ignore
|
||||
log("Failed to get Overdrive state!", e);
|
||||
}
|
||||
}
|
||||
return this.bios.panel_overdrive;
|
||||
}
|
||||
|
||||
public setPanelOd(state: boolean) {
|
||||
if (this.isRunning()) {
|
||||
try {
|
||||
if (state !== this.bios.panel_overdrive) {
|
||||
this.bios.panel_overdrive = state;
|
||||
}
|
||||
return this.dbus_proxy.SetPanelOdSync(state);
|
||||
} catch (e) {
|
||||
//@ts-ignore
|
||||
log("Overdrive DBus set overdrive state failed!", e);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
public getMiniLedMode() {
|
||||
if (this.isRunning()) {
|
||||
try {
|
||||
this.bios.mini_led_mode = this.dbus_proxy.MiniLedModeSync() == "true" ? true : false;
|
||||
} catch (e) {
|
||||
//@ts-ignore
|
||||
log("Failed to get Overdrive state!", e);
|
||||
}
|
||||
}
|
||||
return this.bios.mini_led_mode;
|
||||
}
|
||||
|
||||
public setMiniLedMode(state: boolean) {
|
||||
if (this.isRunning()) {
|
||||
try {
|
||||
if (state !== this.bios.mini_led_mode) {
|
||||
this.bios.mini_led_mode = state;
|
||||
}
|
||||
return this.dbus_proxy.SetMiniLedModeSync(state);
|
||||
} catch (e) {
|
||||
//@ts-ignore
|
||||
log("setMiniLedMode failed!", e);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
async start() {
|
||||
try {
|
||||
await super.start();
|
||||
|
||||
this.getPostBootSound();
|
||||
this.dbus_proxy.connectSignal(
|
||||
"NotifyPostBootSound",
|
||||
(proxy: any = null, _name: string, data: boolean) => {
|
||||
if (proxy) {
|
||||
//@ts-ignore
|
||||
log(`PostBootSound changed to ${data}`);
|
||||
this.notifyPostBootSoundSubscribers.forEach(sub => {
|
||||
sub.sync();
|
||||
});
|
||||
}
|
||||
}
|
||||
);
|
||||
|
||||
this.getPanelOd();
|
||||
this.dbus_proxy.connectSignal(
|
||||
"NotifyPanelOd",
|
||||
(proxy: any = null, _name: string, data: boolean) => {
|
||||
if (proxy) {
|
||||
//@ts-ignore
|
||||
log(`NotifyPanelOd has changed to ${data}.`);
|
||||
this.notifyPanelOdSubscribers.forEach(sub => {
|
||||
sub.sync();
|
||||
});
|
||||
}
|
||||
}
|
||||
);
|
||||
|
||||
this.getMiniLedMode();
|
||||
this.dbus_proxy.connectSignal(
|
||||
"NotifyMiniLedMode",
|
||||
(proxy: any = null, _name: string, data: boolean) => {
|
||||
if (proxy) {
|
||||
//@ts-ignore
|
||||
log(`MiniLedMode has changed to ${data}.`);
|
||||
this.notifyMiniLedSubscribers.forEach(sub => {
|
||||
sub.sync();
|
||||
});
|
||||
}
|
||||
}
|
||||
);
|
||||
|
||||
this.getGpuMuxMode();
|
||||
this.dbus_proxy.connectSignal(
|
||||
"NotifyGpuMuxMode",
|
||||
(proxy: any = null, _name: string, data: boolean) => {
|
||||
if (proxy) {
|
||||
//@ts-ignore
|
||||
log(`MUX has changed to ${data}.`);
|
||||
this.notifyGpuMuxSubscribers.forEach(sub => {
|
||||
sub.sync();
|
||||
});
|
||||
}
|
||||
}
|
||||
);
|
||||
|
||||
} catch (e) {
|
||||
//@ts-ignore
|
||||
log("Platform DBus init failed!", e);
|
||||
}
|
||||
}
|
||||
|
||||
async stop() {
|
||||
await super.stop();
|
||||
this.bios.post_sound = false;
|
||||
this.bios.panel_overdrive = false;
|
||||
this.bios.mini_led_mode = false;
|
||||
this.bios.gpu_mux = false;
|
||||
}
|
||||
}
|
||||
@@ -1,99 +0,0 @@
|
||||
import { DbusBase } from "./base";
|
||||
|
||||
// function getMethods(obj: { [x: string]: { toString: () => string; }; }) {
|
||||
// var result = [];
|
||||
// for (var id in obj) {
|
||||
// try {
|
||||
// if (typeof(obj[id]) == "function") {
|
||||
// result.push(id + ": " + obj[id].toString());
|
||||
// }
|
||||
// } catch (err) {
|
||||
// result.push(id + ": inaccessible");
|
||||
// }
|
||||
// }
|
||||
// return result;
|
||||
// }
|
||||
|
||||
export class Power extends DbusBase {
|
||||
chargeLimit = 100;
|
||||
mainsOnline = false;
|
||||
|
||||
constructor() {
|
||||
super("org-asuslinux-power-4", "/org/asuslinux/Power");
|
||||
}
|
||||
|
||||
public getChargingLimit() {
|
||||
if (this.isRunning()) {
|
||||
try {
|
||||
this.chargeLimit = this.dbus_proxy.ChargeControlEndThresholdSync();
|
||||
} catch (e) {
|
||||
//@ts-ignore
|
||||
log("Failed to fetch Charging Limit!", e);
|
||||
}
|
||||
}
|
||||
return this.chargeLimit;
|
||||
}
|
||||
|
||||
public setChargingLimit(limit: number) {
|
||||
if (this.isRunning()) {
|
||||
try {
|
||||
if (limit > 0 && this.chargeLimit !== limit) {
|
||||
// update state
|
||||
this.chargeLimit = limit;
|
||||
}
|
||||
return this.dbus_proxy.SetChargeControlEndThresholdSync(limit);
|
||||
} catch (e) {
|
||||
//@ts-ignore
|
||||
log("Profile DBus set power profile failed!", e);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
public getMainsOnline() {
|
||||
if (this.isRunning()) {
|
||||
try {
|
||||
this.mainsOnline = this.dbus_proxy.MainsOnlineSync();
|
||||
} catch (e) {
|
||||
//@ts-ignore
|
||||
log("Failed to fetch MainsLonline!", e);
|
||||
}
|
||||
}
|
||||
return this.mainsOnline;
|
||||
}
|
||||
|
||||
async start() {
|
||||
try {
|
||||
await super.start();
|
||||
this.getChargingLimit();
|
||||
|
||||
this.dbus_proxy.connectSignal(
|
||||
"NotifyChargeControlEndThreshold",
|
||||
(proxy: any = null, name: string, data: string) => {
|
||||
if (proxy) {
|
||||
//@ts-ignore
|
||||
log(`Charging Limit has changed to ${data}% (${name}).`);
|
||||
this.chargeLimit = parseInt(data);
|
||||
}
|
||||
}
|
||||
);
|
||||
|
||||
this.dbus_proxy.connectSignal(
|
||||
"NotifyMainsOnline",
|
||||
(proxy: any = null, name: string, data: string) => {
|
||||
if (proxy) {
|
||||
//@ts-ignore
|
||||
log(`NotifyMainsOnline has changed to ${data}% (${name}).`);
|
||||
this.mainsOnline = parseInt(data) == 1 ? true : false;
|
||||
}
|
||||
}
|
||||
);
|
||||
} catch (e) {
|
||||
//@ts-ignore
|
||||
log("Charging Limit DBus initialization failed!", e);
|
||||
}
|
||||
}
|
||||
|
||||
async stop() {
|
||||
await super.stop();
|
||||
}
|
||||
}
|
||||
@@ -1,106 +0,0 @@
|
||||
import { SupportedFunctions, AdvancedAura } from "../../bindings/platform";
|
||||
import { AuraDevice, AuraModeNum, AuraZone, PowerZones } from "../../bindings/aura";
|
||||
import { DbusBase } from "./base";
|
||||
|
||||
export class Supported extends DbusBase {
|
||||
// False,
|
||||
// (True,),
|
||||
// (True, True),
|
||||
// ('X19b6',
|
||||
// True,
|
||||
// ['Static',
|
||||
// 'Breathe',
|
||||
// 'Strobe',
|
||||
// 'Rainbow',
|
||||
// 'Star',
|
||||
// 'Rain',
|
||||
// 'Highlight',
|
||||
// 'Laser',
|
||||
// 'Ripple',
|
||||
// 'Pulse',
|
||||
// 'Comet',
|
||||
// 'Flash'],
|
||||
// [],
|
||||
// 'PerKey',
|
||||
// ['Keyboard', 'Lightbar', 'Logo', 'RearGlow']),
|
||||
// (False, True, True, True, False, True)
|
||||
|
||||
supported: SupportedFunctions = {
|
||||
anime_ctrl: false,
|
||||
charge_ctrl: {
|
||||
charge_level_set: false
|
||||
},
|
||||
platform_profile: {
|
||||
platform_profile: false,
|
||||
fan_curves: false
|
||||
},
|
||||
keyboard_led: {
|
||||
dev_id: AuraDevice.Unknown,
|
||||
brightness: false,
|
||||
basic_modes: [],
|
||||
basic_zones: [],
|
||||
advanced_type: AdvancedAura.None
|
||||
},
|
||||
rog_bios_ctrl: {
|
||||
post_sound: false,
|
||||
gpu_mux: false,
|
||||
panel_overdrive: false,
|
||||
dgpu_disable: false,
|
||||
egpu_enable: false,
|
||||
mini_led_mode: false
|
||||
}
|
||||
};
|
||||
|
||||
constructor() {
|
||||
super("org-asuslinux-supported-4", "/org/asuslinux/Supported");
|
||||
}
|
||||
|
||||
public getSupported() {
|
||||
if (this.isRunning()) {
|
||||
try {
|
||||
const _data = this.dbus_proxy.SupportedFunctionsSync();
|
||||
this.supported.anime_ctrl = _data[0];
|
||||
this.supported.charge_ctrl.charge_level_set = _data[1];
|
||||
this.supported.platform_profile.platform_profile = _data[2][0];
|
||||
this.supported.platform_profile.fan_curves = _data[2][1];
|
||||
this.supported.keyboard_led.dev_id = AuraDevice[_data[3][0] as AuraDevice];
|
||||
this.supported.keyboard_led.brightness = _data[3][1];
|
||||
|
||||
this.supported.keyboard_led.basic_modes = _data[3][2].map(function (value: string) {
|
||||
return AuraModeNum[value as AuraModeNum];
|
||||
});
|
||||
this.supported.keyboard_led.basic_zones = _data[3][3].map(function (value: string) {
|
||||
return AuraZone[value as AuraZone];
|
||||
});
|
||||
this.supported.keyboard_led.advanced_type = AdvancedAura[_data[3][4] as AdvancedAura];
|
||||
this.supported.keyboard_led.power_zones = _data[3][5].map(function (value: string) {
|
||||
return PowerZones[value as PowerZones];
|
||||
});
|
||||
|
||||
this.supported.rog_bios_ctrl.post_sound = _data[4][0];
|
||||
this.supported.rog_bios_ctrl.gpu_mux = _data[4][1];
|
||||
this.supported.rog_bios_ctrl.panel_overdrive = _data[4][2];
|
||||
this.supported.rog_bios_ctrl.dgpu_disable = _data[4][3];
|
||||
this.supported.rog_bios_ctrl.egpu_enable = _data[4][4];
|
||||
this.supported.rog_bios_ctrl.mini_led_mode = _data[4][5];
|
||||
} catch (e) {
|
||||
//@ts-ignore
|
||||
log("Failed to fetch supported functionalities", e);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
async start() {
|
||||
try {
|
||||
await super.start();
|
||||
this.getSupported();
|
||||
} catch (e) {
|
||||
//@ts-ignore
|
||||
log("Supported DBus initialization failed!", e);
|
||||
}
|
||||
}
|
||||
|
||||
async stop() {
|
||||
await super.stop();
|
||||
}
|
||||
}
|
||||
@@ -1,15 +0,0 @@
|
||||
declare const imports: any;
|
||||
|
||||
const { QuickToggle } = imports.ui.quickSettings;
|
||||
const QuickSettingsMenu = imports.ui.main.panel.statusArea.quickSettings;
|
||||
|
||||
export function addQuickSettingsItems(items: [typeof QuickToggle], width = 1) {
|
||||
// Add the items with the built-in function
|
||||
QuickSettingsMenu._addItems(items, width);
|
||||
|
||||
// Ensure the tile(s) are above the background apps menu
|
||||
for (const item of items) {
|
||||
QuickSettingsMenu.menu._grid.set_child_below_sibling(item,
|
||||
QuickSettingsMenu._backgroundApps.quickSettingsItems[0]);
|
||||
}
|
||||
}
|
||||
@@ -1,28 +0,0 @@
|
||||
declare const imports: any;
|
||||
// REF: https://gjs.guide/extensions/development/creating.html
|
||||
|
||||
const { GObject, Gio } = imports.gi;
|
||||
const ExtensionUtils = imports.misc.extensionUtils;
|
||||
|
||||
const { SystemIndicator } = imports.ui.quickSettings;
|
||||
const QuickSettingsMenu = imports.ui.main.panel.statusArea.quickSettings;
|
||||
|
||||
export const IndicateMiniLed = GObject.registerClass(
|
||||
class IndicateMiniLed extends SystemIndicator {
|
||||
constructor() {
|
||||
super();
|
||||
|
||||
// Create the icon for the indicator
|
||||
this._indicator = this._addIndicator();
|
||||
this._indicator.icon_name = "selection-mode-symbolic";
|
||||
|
||||
// Showing the indicator when the feature is enabled
|
||||
this._settings = ExtensionUtils.getSettings();
|
||||
this._settings.bind("mini-led-enabled",
|
||||
this._indicator, "visible",
|
||||
Gio.SettingsBindFlags.DEFAULT);
|
||||
|
||||
// Add the indicator to the panel and the toggle to the menu
|
||||
QuickSettingsMenu._indicators.add_child(this);
|
||||
}
|
||||
});
|
||||
@@ -1,86 +0,0 @@
|
||||
declare const imports: any;
|
||||
|
||||
import { AnimeDbus } from "../dbus/animatrix";
|
||||
|
||||
const { GObject } = imports.gi;
|
||||
const ExtensionUtils = imports.misc.extensionUtils;
|
||||
const PopupMenu = imports.ui.popupMenu;
|
||||
|
||||
export const MenuToggleAnimePower = GObject.registerClass(
|
||||
class MenuToggleAnimePower extends PopupMenu.PopupSwitchMenuItem {
|
||||
private _dbus_anime: AnimeDbus;
|
||||
public toggle_callback = () => {};
|
||||
|
||||
constructor(dbus_anime: AnimeDbus) {
|
||||
super(
|
||||
"AniMatrix Display Power", dbus_anime.deviceState.display_enabled
|
||||
);
|
||||
this._dbus_anime = dbus_anime;
|
||||
this.label = "AniMatrix Display Power";
|
||||
this._settings = ExtensionUtils.getSettings();
|
||||
|
||||
this.connectObject(
|
||||
"destroy", () => this._settings.run_dispose(),
|
||||
"toggled", () => this._toggleMode(),
|
||||
this);
|
||||
|
||||
this.connect("destroy", () => {
|
||||
this.destroy();
|
||||
});
|
||||
|
||||
this.sync();
|
||||
}
|
||||
|
||||
_toggleMode() {
|
||||
this._dbus_anime.getDeviceState();
|
||||
if (this.state !== this._dbus_anime.deviceState.display_enabled)
|
||||
this._dbus_anime.setEnableDisplay(this.state);
|
||||
this.toggle_callback();
|
||||
}
|
||||
|
||||
sync() {
|
||||
this._dbus_anime.getDeviceState();
|
||||
const checked = this._dbus_anime.deviceState.display_enabled;
|
||||
this.setToggleState(checked);
|
||||
}
|
||||
});
|
||||
|
||||
|
||||
export const MenuToggleAnimeBuiltins = GObject.registerClass(
|
||||
class MenuToggleAnimeBuiltins extends PopupMenu.PopupSwitchMenuItem {
|
||||
private _dbus_anime: AnimeDbus;
|
||||
public toggle_callback = () => {};
|
||||
|
||||
constructor(dbus_anime: AnimeDbus) {
|
||||
super(
|
||||
"AniMatrix Powersave Animation", dbus_anime.deviceState.builtin_anims_enabled
|
||||
);
|
||||
this._dbus_anime = dbus_anime;
|
||||
this.label = "AniMatrix Powersave Animation";
|
||||
this._settings = ExtensionUtils.getSettings();
|
||||
|
||||
this.connectObject(
|
||||
"destroy", () => this._settings.run_dispose(),
|
||||
"toggled", () => this._toggleMode(),
|
||||
this);
|
||||
|
||||
this.connect("destroy", () => {
|
||||
this.destroy();
|
||||
});
|
||||
|
||||
this.sync();
|
||||
}
|
||||
|
||||
_toggleMode() {
|
||||
this._dbus_anime.getDeviceState();
|
||||
if (this.state !== this._dbus_anime.deviceState.builtin_anims_enabled)
|
||||
this._dbus_anime.setPowersaveAnim(this.state);
|
||||
this.toggle_callback();
|
||||
}
|
||||
|
||||
sync() {
|
||||
this._dbus_anime.getDeviceState();
|
||||
const checked = this._dbus_anime.deviceState.display_enabled;
|
||||
this.setToggleState(checked);
|
||||
}
|
||||
});
|
||||
@@ -1,46 +0,0 @@
|
||||
declare const imports: any;
|
||||
|
||||
import { Platform } from "../dbus/platform";
|
||||
|
||||
const { GObject, Gio } = imports.gi;
|
||||
const ExtensionUtils = imports.misc.extensionUtils;
|
||||
const PopupMenu = imports.ui.popupMenu;
|
||||
|
||||
export const MenuToggleMiniLed = GObject.registerClass(
|
||||
class MenuToggleMiniLed extends PopupMenu.PopupSwitchMenuItem {
|
||||
private _dbus_platform: Platform;
|
||||
public toggle_callback = () => {};
|
||||
|
||||
constructor(dbus_platform: Platform) {
|
||||
super("MiniLED", dbus_platform.bios.mini_led_mode);
|
||||
|
||||
this._dbus_platform = dbus_platform;
|
||||
this.label = "MiniLED";
|
||||
this._settings = ExtensionUtils.getSettings();
|
||||
|
||||
this.connectObject(
|
||||
"destroy", () => this._settings.run_dispose(),
|
||||
"toggled", () => this._toggleMode(),
|
||||
this);
|
||||
|
||||
this.connect("destroy", () => {
|
||||
this.destroy();
|
||||
});
|
||||
|
||||
this.sync();
|
||||
}
|
||||
|
||||
_toggleMode() {
|
||||
this._dbus_platform.getMiniLedMode();
|
||||
const state = this._dbus_platform.bios.mini_led_mode;
|
||||
if (this.state !== state)
|
||||
this._dbus_platform.setMiniLedMode(this.state);
|
||||
this.toggle_callback();
|
||||
}
|
||||
|
||||
sync() {
|
||||
this._dbus_platform.getMiniLedMode();
|
||||
const toggled = this._dbus_platform.bios.mini_led_mode;
|
||||
this.setToggleState(toggled);
|
||||
}
|
||||
});
|
||||
@@ -1,46 +0,0 @@
|
||||
declare const imports: any;
|
||||
|
||||
import { Platform } from "../dbus/platform";
|
||||
|
||||
const { GObject, Gio } = imports.gi;
|
||||
const ExtensionUtils = imports.misc.extensionUtils;
|
||||
const PopupMenu = imports.ui.popupMenu;
|
||||
|
||||
export const MenuTogglePanelOd = GObject.registerClass(
|
||||
class MenuTogglePanelOd extends PopupMenu.PopupSwitchMenuItem {
|
||||
private _dbus_platform: Platform;
|
||||
public toggle_callback = () => {};
|
||||
|
||||
constructor(dbus_platform: Platform) {
|
||||
super("Panel Overdrive", dbus_platform.bios.panel_overdrive);
|
||||
|
||||
this._dbus_platform = dbus_platform;
|
||||
this.label = "Panel Overdrive";
|
||||
this._settings = ExtensionUtils.getSettings();
|
||||
|
||||
this.connectObject(
|
||||
"destroy", () => this._settings.run_dispose(),
|
||||
"toggled", () => this._toggleMode(),
|
||||
this);
|
||||
|
||||
this.connect("destroy", () => {
|
||||
this.destroy();
|
||||
});
|
||||
|
||||
this.sync();
|
||||
}
|
||||
|
||||
_toggleMode() {
|
||||
this._dbus_platform.getPanelOd();
|
||||
const state = this._dbus_platform.bios.panel_overdrive;
|
||||
if (this.state !== state)
|
||||
this._dbus_platform.setPanelOd(this.state);
|
||||
this.toggle_callback();
|
||||
}
|
||||
|
||||
sync() {
|
||||
this._dbus_platform.getPanelOd();
|
||||
const toggled = this._dbus_platform.bios.panel_overdrive;
|
||||
this.setToggleState(toggled);
|
||||
}
|
||||
});
|
||||
@@ -1,86 +0,0 @@
|
||||
declare const imports: any;
|
||||
// REF: https://gjs.guide/extensions/development/creating.html
|
||||
|
||||
import { addQuickSettingsItems } from "../helpers";
|
||||
import { AuraDbus } from "../dbus/aura";
|
||||
import { AuraEffect, AuraModeNum } from "../../bindings/aura";
|
||||
|
||||
const { GObject } = imports.gi;
|
||||
const ExtensionUtils = imports.misc.extensionUtils;
|
||||
// const Me = ExtensionUtils.getCurrentExtension();
|
||||
// const Main = imports.ui.main;
|
||||
const PopupMenu = imports.ui.popupMenu;
|
||||
const QuickSettings = imports.ui.quickSettings;
|
||||
|
||||
export const AuraMenuToggle = GObject.registerClass(
|
||||
class AuraMenuToggle extends QuickSettings.QuickMenuToggle {
|
||||
private _dbus_aura: AuraDbus;
|
||||
private _last_mode: AuraModeNum = AuraModeNum.Static;
|
||||
|
||||
constructor(dbus_aura: AuraDbus) {
|
||||
super({
|
||||
title: "Aura Modes",
|
||||
iconName: "selection-mode-symbolic",
|
||||
toggleMode: true,
|
||||
});
|
||||
this._dbus_aura = dbus_aura;
|
||||
|
||||
this.connectObject(
|
||||
"destroy", () => this._settings.run_dispose(),
|
||||
this);
|
||||
|
||||
this.menu.setHeader("selection-mode-symbolic", this._dbus_aura.current_aura_mode);
|
||||
|
||||
this._settings = ExtensionUtils.getSettings();
|
||||
|
||||
this._itemsSection = new PopupMenu.PopupMenuSection();
|
||||
|
||||
this._dbus_aura.aura_modes.forEach((mode, key) => {
|
||||
this._itemsSection.addAction(key, () => {
|
||||
this._dbus_aura.setLedMode(mode);
|
||||
this.sync();
|
||||
}, "");
|
||||
});
|
||||
|
||||
this.menu.addMenuItem(this._itemsSection);
|
||||
|
||||
// Add an entry-point for more settings
|
||||
// this.menu.addMenuItem(new PopupMenu.PopupSeparatorMenuItem());
|
||||
// const settingsItem = this.menu.addAction("More Settings",
|
||||
// () => ExtensionUtils.openPrefs());
|
||||
// // Ensure the settings are unavailable when the screen is locked
|
||||
// settingsItem.visible = Main.sessionMode.allowSettings;
|
||||
// this.menu._settingsActions[Me.uuid] = settingsItem;
|
||||
|
||||
this.connectObject(
|
||||
"clicked", () => {
|
||||
let mode: AuraEffect | undefined;
|
||||
if (this._dbus_aura.current_aura_mode == AuraModeNum.Static) {
|
||||
mode = this._dbus_aura.aura_modes.get(this._last_mode);
|
||||
} else {
|
||||
mode = this._dbus_aura.aura_modes.get(AuraModeNum.Static);
|
||||
}
|
||||
if (mode != undefined) {
|
||||
this._dbus_aura.setLedMode(mode);
|
||||
this.sync();
|
||||
}
|
||||
},
|
||||
this);
|
||||
|
||||
this._dbus_aura.notifyAuraModeSubscribers.push(this);
|
||||
this.sync();
|
||||
|
||||
addQuickSettingsItems([this]);
|
||||
}
|
||||
|
||||
sync() {
|
||||
const checked = this._dbus_aura.current_aura_mode != AuraModeNum.Static;
|
||||
this.title = this._dbus_aura.current_aura_mode;
|
||||
if (this._last_mode != this._dbus_aura.current_aura_mode && this._dbus_aura.current_aura_mode != AuraModeNum.Static) {
|
||||
this._last_mode = this._dbus_aura.current_aura_mode;
|
||||
}
|
||||
|
||||
if (this.checked !== checked)
|
||||
this.set({ checked });
|
||||
}
|
||||
});
|
||||
@@ -1,179 +0,0 @@
|
||||
declare const imports: any;
|
||||
// REF: https://gjs.guide/extensions/development/creating.html
|
||||
|
||||
import { AnimeDbus } from "../dbus/animatrix";
|
||||
import { Supported } from "../dbus/supported";
|
||||
import { Platform } from "../dbus/platform";
|
||||
|
||||
import { addQuickSettingsItems } from "../helpers";
|
||||
import { MenuToggleAnimeBuiltins, MenuToggleAnimePower } from "../menu_toggles/anime";
|
||||
import { MenuTogglePanelOd } from "../menu_toggles/panel_od";
|
||||
import { MenuToggleMiniLed } from "../menu_toggles/mini_led";
|
||||
|
||||
|
||||
const { GObject } = imports.gi;
|
||||
|
||||
const ExtensionUtils = imports.misc.extensionUtils;
|
||||
// const Me = ExtensionUtils.getCurrentExtension();
|
||||
// const Main = imports.ui.main;
|
||||
const PopupMenu = imports.ui.popupMenu;
|
||||
const QuickSettings = imports.ui.quickSettings;
|
||||
|
||||
export const FeatureMenuToggle = GObject.registerClass(
|
||||
class FeatureMenuToggle extends QuickSettings.QuickMenuToggle {
|
||||
private _dbus_supported: Supported;
|
||||
private _dbus_platform: Platform;
|
||||
private _dbus_anime: AnimeDbus;
|
||||
|
||||
public miniLed: typeof MenuToggleMiniLed;
|
||||
public panelOd: typeof MenuTogglePanelOd;
|
||||
public animeDisplayPower: typeof MenuToggleAnimePower;
|
||||
public animePowersaveAnim: typeof MenuToggleAnimeBuiltins;
|
||||
private primary = "mini-led";
|
||||
|
||||
constructor(dbus_supported: Supported, dbus_platform: Platform, dbus_anime: AnimeDbus) {
|
||||
super({
|
||||
title: "Laptop",
|
||||
iconName: "selection-mode-symbolic",
|
||||
toggleMode: true,
|
||||
});
|
||||
this._dbus_supported = dbus_supported;
|
||||
this._dbus_platform = dbus_platform;
|
||||
this._dbus_anime = dbus_anime;
|
||||
|
||||
this.menu.setHeader("selection-mode-symbolic", "Laptop features");
|
||||
|
||||
this._settings = ExtensionUtils.getSettings();
|
||||
this.primary = this._settings.get_string("primary-quickmenu-toggle");
|
||||
|
||||
// TODO: temporary block
|
||||
if (this.primary == "mini-led" && !this._dbus_supported.supported.rog_bios_ctrl.mini_led_mode) {
|
||||
this.primary = "panel-od";
|
||||
} else if (this.primary == "panel-od" && !this._dbus_supported.supported.rog_bios_ctrl.panel_overdrive) {
|
||||
this.primary = "anime-power";
|
||||
} else if (this.primary == "anime-power" && !this._dbus_supported.supported.anime_ctrl) {
|
||||
this.primary = "mini-led";
|
||||
} else if (this.primary.length == 0) {
|
||||
this.primary = "panel-od";
|
||||
}
|
||||
|
||||
this.connectObject(
|
||||
"destroy", () => this._settings.run_dispose(),
|
||||
this);
|
||||
this._settings.connect('changed::primary-quickmenu-toggle',
|
||||
this.sync);
|
||||
this._settings.set_string("primary-quickmenu-toggle", this.primary);
|
||||
|
||||
this._itemsSection = new PopupMenu.PopupMenuSection();
|
||||
if (this._dbus_supported.supported.rog_bios_ctrl.mini_led_mode) {
|
||||
if (this.miniLed == null) {
|
||||
this.miniLed = new MenuToggleMiniLed(this._dbus_platform);
|
||||
this._dbus_platform.notifyMiniLedSubscribers.push(this.miniLed);
|
||||
this._itemsSection.addMenuItem(this.miniLed);
|
||||
this._dbus_platform.notifyMiniLedSubscribers.push(this);
|
||||
this.miniLed.toggle_callback = () => {
|
||||
this.primary = "mini-led";
|
||||
this.sync();
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
if (this._dbus_supported.supported.rog_bios_ctrl.panel_overdrive) {
|
||||
if (this.panelOd == null) {
|
||||
this.panelOd = new MenuTogglePanelOd(this._dbus_platform);
|
||||
this._dbus_platform.notifyPanelOdSubscribers.push(this.panelOd);
|
||||
this._itemsSection.addMenuItem(this.panelOd);
|
||||
this._dbus_platform.notifyPanelOdSubscribers.push(this);
|
||||
this.panelOd.toggle_callback = () => {
|
||||
this.primary = "panel-od";
|
||||
this.sync();
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
if (this._dbus_supported.supported.anime_ctrl) {
|
||||
if (this.animeDisplayPower == null) {
|
||||
this.animeDisplayPower = new MenuToggleAnimePower(this._dbus_anime);
|
||||
this._dbus_anime.notifyAnimeStateSubscribers.push(this.animeDisplayPower);
|
||||
this._itemsSection.addMenuItem(this.animeDisplayPower);
|
||||
this._dbus_anime.notifyAnimeStateSubscribers.push(this);
|
||||
this.animeDisplayPower.toggle_callback = () => {
|
||||
this.primary = "anime-power";
|
||||
this.sync();
|
||||
}
|
||||
}
|
||||
|
||||
if (this.animePowersaveAnim == null) {
|
||||
this.animePowersaveAnim = new MenuToggleAnimeBuiltins(this._dbus_anime);
|
||||
this._dbus_anime.notifyAnimeStateSubscribers.push(this.animePowersaveAnim);
|
||||
this._itemsSection.addMenuItem(this.animePowersaveAnim);
|
||||
}
|
||||
}
|
||||
|
||||
this.connectObject(
|
||||
"clicked", () => {
|
||||
this._toggle();
|
||||
},
|
||||
this);
|
||||
|
||||
this.menu.addMenuItem(this._itemsSection);
|
||||
|
||||
// // Add an entry-point for more settings
|
||||
// this.menu.addMenuItem(new PopupMenu.PopupSeparatorMenuItem());
|
||||
// const settingsItem = this.menu.addAction("More Settings",
|
||||
// () => ExtensionUtils.openPrefs());
|
||||
// // Ensure the settings are unavailable when the screen is locked
|
||||
// settingsItem.visible = Main.sessionMode.allowSettings;
|
||||
// this.menu._settingsActions[Me.uuid] = settingsItem;
|
||||
|
||||
this.sync();
|
||||
addQuickSettingsItems([this]);
|
||||
}
|
||||
|
||||
_toggle() {
|
||||
if (this.primary == "mini-led" && this.miniLed != null) {
|
||||
this._dbus_platform.getMiniLedMode();
|
||||
const checked = this._dbus_platform.bios.mini_led_mode;
|
||||
if (this.checked !== checked)
|
||||
this._dbus_platform.setMiniLedMode(this.checked);
|
||||
}
|
||||
|
||||
if (this.primary == "panel-od" && this.panelOd != null) {
|
||||
this._dbus_platform.getPanelOd();
|
||||
const checked = this._dbus_platform.bios.panel_overdrive;
|
||||
if (this.checked !== checked)
|
||||
this._dbus_platform.setPanelOd(this.checked);
|
||||
}
|
||||
|
||||
if (this.primary == "anime-power" && this.animeDisplayPower != null) {
|
||||
this._dbus_anime.getDeviceState();
|
||||
const checked = this._dbus_anime.deviceState.display_enabled;
|
||||
if (this.checked !== checked)
|
||||
this._dbus_anime.setEnableDisplay(this.checked);
|
||||
}
|
||||
}
|
||||
|
||||
sync() {
|
||||
let checked = false;
|
||||
if (this.primary == "mini-led" && this.miniLed != null) {
|
||||
this.title = this.miniLed.label;
|
||||
checked = this._dbus_platform.bios.mini_led_mode;
|
||||
}
|
||||
|
||||
if (this.primary == "panel-od" && this.panelOd != null) {
|
||||
this.title = this.panelOd.label;
|
||||
checked = this._dbus_platform.bios.panel_overdrive;
|
||||
}
|
||||
|
||||
if (this.primary == "anime-power" && this.animeDisplayPower != null) {
|
||||
this.title = this.animeDisplayPower.label;
|
||||
checked = this._dbus_anime.deviceState.display_enabled;
|
||||
}
|
||||
|
||||
// if (this.animePowersaveAnim != null) {
|
||||
// }
|
||||
|
||||
if (this.checked !== checked)
|
||||
this.set({ checked });
|
||||
}
|
||||
});
|
||||
@@ -1,56 +0,0 @@
|
||||
declare const imports: any;
|
||||
|
||||
import { AnimeDbus } from "../dbus/animatrix";
|
||||
import { addQuickSettingsItems } from "../helpers";
|
||||
|
||||
const { GObject, Gio } = imports.gi;
|
||||
const ExtensionUtils = imports.misc.extensionUtils;
|
||||
|
||||
const { QuickToggle } = imports.ui.quickSettings;
|
||||
|
||||
export const QuickAnimePower = GObject.registerClass(
|
||||
class QuickAnimePower extends QuickToggle {
|
||||
private _dbus_anime: AnimeDbus;
|
||||
|
||||
constructor(dbus_anime: AnimeDbus) {
|
||||
super({
|
||||
title: "AniMatrix Power",
|
||||
iconName: "selection-mode-symbolic",
|
||||
toggleMode: true,
|
||||
});
|
||||
this._dbus_anime = dbus_anime;
|
||||
this.label = "AniMatrix Power";
|
||||
this._settings = ExtensionUtils.getSettings();
|
||||
|
||||
this.connectObject(
|
||||
"destroy", () => this._settings.run_dispose(),
|
||||
"clicked", () => this._toggleMode(),
|
||||
this);
|
||||
|
||||
this.connect("destroy", () => {
|
||||
this.destroy();
|
||||
});
|
||||
|
||||
this._settings.bind("anime-power",
|
||||
this, "checked",
|
||||
Gio.SettingsBindFlags.DEFAULT);
|
||||
|
||||
this.sync();
|
||||
|
||||
addQuickSettingsItems([this]);
|
||||
}
|
||||
|
||||
_toggleMode() {
|
||||
this._dbus_anime.getDeviceState();
|
||||
const checked = this._dbus_anime.deviceState.display_enabled;
|
||||
if (this.checked !== checked)
|
||||
this._dbus_anime.setEnableDisplay(this.checked);
|
||||
}
|
||||
|
||||
sync() {
|
||||
this._dbus_anime.getDeviceState();
|
||||
const checked = this._dbus_anime.deviceState.display_enabled;
|
||||
if (this.checked !== checked)
|
||||
this.set({ checked });
|
||||
}
|
||||
});
|
||||
@@ -1,54 +0,0 @@
|
||||
declare const imports: any;
|
||||
|
||||
import { Platform } from "../dbus/platform";
|
||||
import { addQuickSettingsItems } from "../helpers";
|
||||
|
||||
const { GObject, Gio } = imports.gi;
|
||||
const ExtensionUtils = imports.misc.extensionUtils;
|
||||
|
||||
const { QuickToggle } = imports.ui.quickSettings;
|
||||
|
||||
export const QuickMiniLed = GObject.registerClass(
|
||||
class QuickMiniLed extends QuickToggle {
|
||||
private _dbus_platform: Platform;
|
||||
|
||||
constructor(dbus_platform: Platform) {
|
||||
super({
|
||||
title: "MiniLED",
|
||||
iconName: "selection-mode-symbolic",
|
||||
toggleMode: true,
|
||||
});
|
||||
this._dbus_platform = dbus_platform;
|
||||
this.label = "MiniLED";
|
||||
this._settings = ExtensionUtils.getSettings();
|
||||
|
||||
this.connectObject(
|
||||
"destroy", () => this._settings.run_dispose(),
|
||||
"clicked", () => this._toggleMode(),
|
||||
this);
|
||||
|
||||
this.connect("destroy", () => {
|
||||
this.destroy();
|
||||
});
|
||||
|
||||
this._settings.bind("mini-led-enabled",
|
||||
this, "checked",
|
||||
Gio.SettingsBindFlags.DEFAULT);
|
||||
|
||||
this.sync();
|
||||
|
||||
addQuickSettingsItems([this]);
|
||||
}
|
||||
|
||||
_toggleMode() {
|
||||
const checked = this._dbus_platform.getMiniLedMode();
|
||||
if (this.checked !== checked)
|
||||
this._dbus_platform.setMiniLedMode(this.checked);
|
||||
}
|
||||
|
||||
sync() {
|
||||
const checked = this._dbus_platform.getMiniLedMode();
|
||||
if (this.checked !== checked)
|
||||
this.set({ checked });
|
||||
}
|
||||
});
|
||||
@@ -1,54 +0,0 @@
|
||||
declare const imports: any;
|
||||
|
||||
import { Platform } from "../dbus/platform";
|
||||
import { addQuickSettingsItems } from "../helpers";
|
||||
|
||||
const { GObject, Gio } = imports.gi;
|
||||
const ExtensionUtils = imports.misc.extensionUtils;
|
||||
|
||||
const { QuickToggle } = imports.ui.quickSettings;
|
||||
|
||||
export const QuickPanelOd = GObject.registerClass(
|
||||
class QuickPanelOd extends QuickToggle {
|
||||
private _dbus_platform: Platform;
|
||||
|
||||
constructor(dbus_platform: Platform) {
|
||||
super({
|
||||
title: "Panel Overdrive",
|
||||
iconName: "selection-mode-symbolic",
|
||||
toggleMode: true,
|
||||
});
|
||||
this._dbus_platform = dbus_platform;
|
||||
this.label = "Panel Overdrive";
|
||||
this._settings = ExtensionUtils.getSettings();
|
||||
|
||||
this.connectObject(
|
||||
"destroy", () => this._settings.run_dispose(),
|
||||
"clicked", () => this._toggleMode(),
|
||||
this);
|
||||
|
||||
this.connect("destroy", () => {
|
||||
this.destroy();
|
||||
});
|
||||
|
||||
this._settings.bind("panel-od-enabled",
|
||||
this, "checked",
|
||||
Gio.SettingsBindFlags.DEFAULT);
|
||||
|
||||
this.sync();
|
||||
|
||||
addQuickSettingsItems([this]);
|
||||
}
|
||||
|
||||
_toggleMode() {
|
||||
const checked = this._dbus_platform.getPanelOd();
|
||||
if (this.checked !== checked)
|
||||
this._dbus_platform.setPanelOd(this.checked);
|
||||
}
|
||||
|
||||
sync() {
|
||||
const checked = this._dbus_platform.getPanelOd();
|
||||
if (this.checked !== checked)
|
||||
this.set({ checked });
|
||||
}
|
||||
});
|
||||
@@ -1,20 +0,0 @@
|
||||
declare const imports: any;
|
||||
const Me = imports.misc.extensionUtils.getCurrentExtension();
|
||||
|
||||
const GLib = imports.gi.GLib;
|
||||
|
||||
export class File {
|
||||
public static DBus(name: string) {
|
||||
const file = `${Me.path}/resources/dbus/${name}.xml`;
|
||||
try {
|
||||
const [_ok, bytes] = GLib.file_get_contents(file);
|
||||
if (!_ok)
|
||||
//@ts-ignore
|
||||
log(`Couldn't read contents of "${file}"`);
|
||||
return _ok ? imports.byteArray.toString(bytes) : null;
|
||||
} catch (e) {
|
||||
//@ts-ignore
|
||||
log(`Failed to load "${file}"`, e);
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -1,60 +0,0 @@
|
||||
import { Power } from "../dbus/power";
|
||||
import { addQuickSettingsItems } from "../helpers";
|
||||
|
||||
declare const imports: any;
|
||||
|
||||
const { GObject } = imports.gi;
|
||||
const ExtensionUtils = imports.misc.extensionUtils;
|
||||
const QuickSettings = imports.ui.quickSettings;
|
||||
|
||||
export const SliderChargeLevel = GObject.registerClass(
|
||||
class SliderChargeLevel extends QuickSettings.QuickSlider {
|
||||
private _dbus_power: Power;
|
||||
|
||||
constructor(dbus_power: Power) {
|
||||
super({
|
||||
iconName: "selection-mode-symbolic",
|
||||
});
|
||||
this._dbus_power = dbus_power;
|
||||
|
||||
this._sliderChangedId = this.slider.connect("drag-end",
|
||||
this._onSliderChanged.bind(this));
|
||||
|
||||
// Binding the slider to a GSettings key
|
||||
this._settings = ExtensionUtils.getSettings();
|
||||
|
||||
this._settings.connect("changed::charge-level",
|
||||
this._onSettingsChanged.bind(this));
|
||||
|
||||
// Set an accessible name for the slider
|
||||
this.slider.accessible_name = "Charge level";
|
||||
|
||||
this._sync();
|
||||
this._onSettingsChanged();
|
||||
|
||||
addQuickSettingsItems([this], 2);
|
||||
}
|
||||
|
||||
_onSettingsChanged() {
|
||||
// Prevent the slider from emitting a change signal while being updated
|
||||
this.slider.block_signal_handler(this._sliderChangedId);
|
||||
this.slider.value = this._settings.get_uint("charge-level") / 100.0;
|
||||
this.slider.unblock_signal_handler(this._sliderChangedId);
|
||||
}
|
||||
|
||||
_onSliderChanged() {
|
||||
// Assuming our GSettings holds values between 0..100, adjust for the
|
||||
// slider taking values between 0..1
|
||||
const percent = Math.floor(this.slider.value * 100);
|
||||
const stored = Math.floor(this._settings.get_uint("charge-level") / 100.0);
|
||||
if (this.slider.value !== stored)
|
||||
this._dbus_power.setChargingLimit(percent);
|
||||
this._settings.set_uint("charge-level", percent);
|
||||
}
|
||||
|
||||
_sync() {
|
||||
const value = this._dbus_power.getChargingLimit();
|
||||
if (this.slider.value !== value / 100)
|
||||
this._settings.set_uint("charge-level", value);
|
||||
}
|
||||
});
|
||||
Some files were not shown because too many files have changed in this diff Show More
Reference in New Issue
Block a user